{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1d27fe1e-0382-41dd-b561-a7a5d96ca2bb",
          "code": "3130-19-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3130-19-6",
          "code_system": "CAS",
          "references": [
            "019a39f8-e219-4319-827d-c223d2c6cd27",
            "1ffb5219-a6c6-4dd9-a140-b1f47575ef5c"
          ]
        },
        {
          "uuid": "e182276c-04be-438a-879a-af9c678de4c7",
          "code": "221-518-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.562",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "019a39f8-e219-4319-827d-c223d2c6cd27"
          ]
        },
        {
          "uuid": "1c72cb99-645b-457d-97c1-bc9284193c47",
          "code": "18410",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18410",
          "code_system": "PUBCHEM",
          "references": [
            "019a39f8-e219-4319-827d-c223d2c6cd27"
          ]
        },
        {
          "uuid": "ea1acf0d-bd27-574d-f57f-eaca8c03f6bc",
          "code": "DTXSID5051997",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5051997",
          "code_system": "EPA CompTox",
          "references": [
            "320e39e7-24d1-eb4f-ae03-b871efbcc8fe"
          ]
        },
        {
          "uuid": "4915b785-48c3-420f-b3ab-7bcede768c43",
          "code": "3006WLL1W8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "52ea635d-964c-4df3-854e-cb665bf18369",
          "name": "7-OXABICYCLO(4.1.0)HEPTANE-3-METHANOL, ADIPATE (2:1)",
          "stdName": "7-OXABICYCLO(4.1.0)HEPTANE-3-METHANOL, ADIPATE (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d941e5f1-d4dc-4d33-881e-b7b37ef78884"
          ],
          "display_name": false
        },
        {
          "uuid": "0f1f6406-43d0-454b-ac00-186e081f5684",
          "name": "ADIPIC ACID, DIESTER WITH 7-OXABICYCLO(4.1.0)HEPTANE-3-METHANOL",
          "stdName": "ADIPIC ACID, DIESTER WITH 7-OXABICYCLO(4.1.0)HEPTANE-3-METHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d941e5f1-d4dc-4d33-881e-b7b37ef78884"
          ],
          "display_name": false
        },
        {
          "uuid": "e0b77024-8128-4363-8d8b-31125f1e0168",
          "name": "BIS((3,4-EPOXYCYCLOHEXYL)METHYL) ADIPATE",
          "stdName": "BIS((3,4-EPOXYCYCLOHEXYL)METHYL) ADIPATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d941e5f1-d4dc-4d33-881e-b7b37ef78884"
          ],
          "display_name": false
        },
        {
          "uuid": "cf7226f5-ac91-4a4f-8a1a-a0c9a893c56f",
          "name": "BIS(3,4-EPOXYCYCLOHEXYLMETHYL) ADIPATE",
          "stdName": "BIS(3,4-EPOXYCYCLOHEXYLMETHYL) ADIPATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81a0bb85-5e36-4196-a8f8-f5d972e2a7a0"
          ],
          "display_name": true
        },
        {
          "uuid": "a5aa0bab-5115-44f1-8d64-be6448c4df83",
          "name": "DI(3,4-EPOXYCYCLOHEXYLMETHYL) ADIPATE",
          "stdName": "DI(3,4-EPOXYCYCLOHEXYLMETHYL) ADIPATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d941e5f1-d4dc-4d33-881e-b7b37ef78884"
          ],
          "display_name": false
        },
        {
          "uuid": "535508cf-0971-46c9-a3b0-a8b677582e2c",
          "name": "HEXANEDIOIC ACID, 1,6-BIS(7-OXABICYCLO(4.1.0)HEPT-3-YLMETHYL) ESTER",
          "stdName": "HEXANEDIOIC ACID, 1,6-BIS(7-OXABICYCLO(4.1.0)HEPT-3-YLMETHYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d941e5f1-d4dc-4d33-881e-b7b37ef78884"
          ],
          "display_name": false
        },
        {
          "uuid": "9a54e28b-aeed-425c-8709-f0f4f2efc145",
          "name": "TTA-26",
          "stdName": "TTA-26",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d941e5f1-d4dc-4d33-881e-b7b37ef78884"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "81a0bb85-5e36-4196-a8f8-f5d972e2a7a0",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d941e5f1-d4dc-4d33-881e-b7b37ef78884",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "019a39f8-e219-4319-827d-c223d2c6cd27",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393547000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e53efd7-c2a3-41c0-86a2-a207d34172ea",
          "citation": "SRS import [3006WLL1W8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3006WLL1W8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393547000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "320e39e7-24d1-eb4f-ae03-b871efbcc8fe",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3130-19-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1ffb5219-a6c6-4dd9-a140-b1f47575ef5c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "75867dbf-cd4c-41ec-84f8-eb00a3582621",
          "id": "75867dbf-cd4c-41ec-84f8-eb00a3582621",
          "molfile": "\n  Marvin  01132106062D          \n\n 26 29  0  0  0  0            999 V2000\n    4.3058   -6.5902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0220   -6.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0129   -5.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2968   -4.9404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2968   -4.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5806   -3.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5806   -2.8826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2968   -2.4747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8645   -2.4747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8645   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1484   -1.2419    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.1484   -0.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -0.4170    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.0000   -0.8249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -1.2419    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.4323   -1.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7291   -6.5902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7382   -7.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4542   -7.8230    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.4542   -8.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1704   -9.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8865   -8.6480    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.5936   -8.2401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8865   -7.8230    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.1704   -7.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 18  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 17  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 26 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "C(CCC(=O)OCC1CCC2C(C1)O2)CC(=O)OCC3CCC4C(C3)O4",
          "formula": "C20H30O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "afa6ccf4-189a-439e-a5a8-949a8b90675b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "366.4494",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "71b5273b-c53f-434e-99e0-2c75efb3ce12",
      "version": "4",
      "structure": {
        "id": "a2063315-7bd7-4805-ab54-90c9bafdccf8",
        "molfile": "\n  Marvin  01132108252D          \n\n 26 29  0  0  0  0            999 V2000\n    5.7382   -7.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7291   -6.5902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0220   -6.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0129   -5.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3058   -6.5902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2968   -4.9404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2968   -4.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5806   -3.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5806   -2.8826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8645   -2.4747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2968   -2.4747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8645   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8865   -7.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8865   -8.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5936   -8.2401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1704   -7.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1704   -9.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4542   -7.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4542   -8.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1484   -1.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323   -1.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1484   -0.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -1.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -0.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 18  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 20  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
        "smiles": "C(CCC(=O)OCC1CCC2C(C1)O2)CC(=O)OCC3CCC4C(C3)O4",
        "formula": "C20H30O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "366.4494",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0e53efd7-c2a3-41c0-86a2-a207d34172ea",
          "81a0bb85-5e36-4196-a8f8-f5d972e2a7a0"
        ],
        "stereo_centers": 6
      },
      "unii": "3006WLL1W8"
    }
  ]
}