{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "cd9c39b8-6433-480a-bf05-2dc18e586b44", "code": "31658-50-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=31658-50-1", "code_system": "CAS", "references": [ "fbd229aa-3457-44d0-abec-e81ba29ca96b", "382a76cb-f8d1-4b9e-a879-fc503ed57617" ] }, { "uuid": "4c8920dd-64f8-4ae3-b084-305ced1e47d8", "code": "12133281", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12133281", "code_system": "PUBCHEM", "references": [ "fbd229aa-3457-44d0-abec-e81ba29ca96b" ] }, { "uuid": "1ddb2cc9-5596-d488-7a41-42a11f7b1506", "code": "DTXSID00478225", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00478225", "code_system": "EPA CompTox", "references": [ "73923b3a-89ee-8864-963f-035c2b5ac2ea" ] }, { "uuid": "4f60b270-8fa9-4302-9990-36187a4e121e", "code": "2Z4EDE9VR5", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "75efe4ea-392a-47d3-9a45-989d51b6c564", "name": "(3.ALPHA.,5.BETA.,17.ALPHA.)-19-NORPREGNANE-3,17-DIOL", "stdName": "(3.ALPHA.,5.BETA.,17.ALPHA.)-19-NORPREGNANE-3,17-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "917bb74b-2c95-4fb8-9194-07f3d03062ac", "f198af5c-d4a4-47ec-bbb7-7a0a10b23cbc" ], "display_name": false }, { "uuid": "2c5f7d30-0ac0-42a1-8dee-8fd240e760e0", "name": "17.ALPHA.-ETHYL-5.BETA.-ESTRANE-3.ALPHA.,17.BETA.-DIOL", "stdName": "17.ALPHA.-ETHYL-5.BETA.-ESTRANE-3.ALPHA.,17.BETA.-DIOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "917bb74b-2c95-4fb8-9194-07f3d03062ac", "f198af5c-d4a4-47ec-bbb7-7a0a10b23cbc" ], "display_name": true }, { "uuid": "7ae5bf92-286d-43ce-b826-16c93dc56e1e", "name": "17.ALPHA.-ETHYL-5B-ESTRANE-3.ALPHA.,17.BETA.-DIOL", "stdName": "17.ALPHA.-ETHYL-5B-ESTRANE-3.ALPHA.,17.BETA.-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "84477aba-6af2-41eb-a81d-8ed648b44bd5", "f198af5c-d4a4-47ec-bbb7-7a0a10b23cbc" ], "display_name": false }, { "uuid": "d9f0af13-4d4a-4d11-b3f0-f4d423b7f501", "name": "19-NOR-5.BETA.,17.ALPHA.-PREGNANE-3.ALPHA.,17-DIOL", "stdName": "19-NOR-5.BETA.,17.ALPHA.-PREGNANE-3.ALPHA.,17-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "917bb74b-2c95-4fb8-9194-07f3d03062ac", "f198af5c-d4a4-47ec-bbb7-7a0a10b23cbc" ], "display_name": false }, { "uuid": "a47fdedb-a5b2-4b2a-9201-f917fe4ebfe0", "name": "19-NORPREGNANE-3,17-DIOL, (3.ALPHA.,5.BETA.,17.ALPHA.)-", "stdName": "19-NORPREGNANE-3,17-DIOL, (3.ALPHA.,5.BETA.,17.ALPHA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "917bb74b-2c95-4fb8-9194-07f3d03062ac", "f198af5c-d4a4-47ec-bbb7-7a0a10b23cbc" ], "display_name": false } ], "references": [ { "uuid": "917bb74b-2c95-4fb8-9194-07f3d03062ac", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f198af5c-d4a4-47ec-bbb7-7a0a10b23cbc", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "84477aba-6af2-41eb-a81d-8ed648b44bd5", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fbd229aa-3457-44d0-abec-e81ba29ca96b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393355000, "tags": [ "NOMEN" ] }, { "uuid": "dca05938-c0bc-4f13-b77e-fce9d43c2d6c", "citation": "SRS import [2Z4EDE9VR5]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2Z4EDE9VR5", "doc_type": "SRS", "public_domain": true, "document_date": 1493393355000, "tags": [ "NOMEN" ] }, { "uuid": "73923b3a-89ee-8864-963f-035c2b5ac2ea", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31658-50-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "382a76cb-f8d1-4b9e-a879-fc503ed57617", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "55548cf8-4dc9-4ac2-8a14-fc2fa015a1d5", "id": "55548cf8-4dc9-4ac2-8a14-fc2fa015a1d5", "molfile": "\n Marvin 01132104262D \n\n 22 25 0 0 1 0 999 V2000\n 10.2456 -4.6532 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.0116 -4.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5396 -4.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0998 -3.6274 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 11.8400 -3.2631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9536 -2.8155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5836 -2.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3001 -3.8299 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 10.4404 -3.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6144 -3.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8743 -3.7355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8198 -4.5587 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.5054 -5.0175 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.4508 -5.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7106 -6.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0250 -5.7462 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.2849 -6.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5992 -5.6518 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.8591 -6.0161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6537 -4.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3939 -4.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0796 -4.9231 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 1 2 1 1 0 0 0\n 1 8 1 0 0 0 0\n 13 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 1 0 0 0\n 4 6 1 0 0 0 0\n 8 4 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 1 1 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 1 0 0 0\n 12 13 1 0 0 0 0\n 22 12 1 0 0 0 0\n 13 14 1 6 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 6 0 0 0\n 22 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 6 0 0 0\n 18 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 6 0 0 0\nM END", "smiles": "CC[C@@]1(CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](CC[C@@H]4[C@H]3CC[C@@]21C)O)O", "formula": "C20H34O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "dd768e4f-3fed-4116-8644-49661b6a1d6b" }, "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "306.4835", "optical_activity": "UNSPECIFIED", "stereo_centers": 8 } ], "definition_level": "COMPLETE", "uuid": "21ac9545-ee18-41c7-a553-4e090df8e570", "version": "5", "structure": { "id": "41cb6c07-188e-4741-afcb-fef711c67252", "molfile": "\n Marvin 01132103282D \n\n 27 30 0 0 1 0 999 V2000\n 10.4404 -3.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3001 -3.8299 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.0998 -3.6274 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.8400 -3.2631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9536 -2.8155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5836 -2.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5396 -4.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0116 -4.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2456 -4.6532 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.2774 -5.4775 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5054 -5.0175 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.5599 -4.1943 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4508 -5.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7106 -6.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0250 -5.7462 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.9705 -6.5694 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2849 -6.1106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5992 -5.6518 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.8591 -6.0161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6537 -4.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3939 -4.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0796 -4.9231 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.1341 -4.0998 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8198 -4.5587 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.7652 -5.3819 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8743 -3.7355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6144 -3.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 1 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 2 9 1 0 0 0 0\n 9 10 1 6 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 1 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 1 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 6 0 0 0\n 20 18 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 15 1 0 0 0 0\n 22 23 1 1 0 0 0\n 24 22 1 0 0 0 0\n 11 24 1 0 0 0 0\n 24 25 1 6 0 0 0\n 26 24 1 0 0 0 0\n 2 27 1 0 0 0 0\n 27 26 1 0 0 0 0\nM END", "smiles": "CC[C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@]4([H])C[C@@H](CC[C@]4([H])[C@@]3([H])CC[C@@]21C)O)O", "formula": "C20H34O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "306.4835", "optical_activity": "UNSPECIFIED", "references": [ "dca05938-c0bc-4f13-b77e-fce9d43c2d6c", "917bb74b-2c95-4fb8-9194-07f3d03062ac" ], "stereo_centers": 8 }, "unii": "2Z4EDE9VR5" } ] }