{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "baf617da-bd45-43e0-8c4f-63606698a721",
          "code": "89-32-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=89-32-7",
          "code_system": "CAS",
          "references": [
            "efd8b883-2f40-4a81-a50d-7db165f47f71",
            "a43724f4-9d78-44d5-a8ea-f714db789a8e"
          ]
        },
        {
          "uuid": "0cb655cf-43ac-4fd5-9346-e882c29f36f5",
          "code": "C012019",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67012019",
          "code_system": "MESH",
          "references": [
            "efd8b883-2f40-4a81-a50d-7db165f47f71"
          ]
        },
        {
          "uuid": "e457dbf4-af53-4bf5-96bf-e8d9c3948d2f",
          "code": "FCN NO. 1238",
          "comments": "FCN|MONOMER|POLYESTER COATING RESINS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=1238",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "efd8b883-2f40-4a81-a50d-7db165f47f71"
          ]
        },
        {
          "uuid": "429c701f-9a28-4e1f-a734-add3af958384",
          "code": "FCN NO. 1140",
          "comments": "FCN|COATING COMPONENT|POLYESTER CANS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=1140",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "efd8b883-2f40-4a81-a50d-7db165f47f71"
          ]
        },
        {
          "uuid": "bd419071-43b2-4cab-858b-fc3f1e8adf33",
          "code": "FCN NO. 10",
          "comments": "FCN|MODIFIER|ETHYLENE TEREPHTHALTE COPOLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=10",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "efd8b883-2f40-4a81-a50d-7db165f47f71"
          ]
        },
        {
          "uuid": "8a0a1c0d-dc1b-454d-910a-6691f5821599",
          "code": "FCN NO. 151",
          "comments": "FCN|MODIFIER|POLYETHYLENE PHTHALATE POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=151",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "efd8b883-2f40-4a81-a50d-7db165f47f71"
          ]
        },
        {
          "uuid": "0e6f3a40-b581-4d86-990b-c1deb3d40107",
          "code": "FCN NO. 200",
          "comments": "FCN|MODIFIER|POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=200",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "efd8b883-2f40-4a81-a50d-7db165f47f71"
          ]
        },
        {
          "uuid": "ca663917-7149-4472-9c0f-5b90e5fbb790",
          "code": "201-898-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.726",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "efd8b883-2f40-4a81-a50d-7db165f47f71"
          ]
        },
        {
          "uuid": "8b587e4b-390a-4c61-b65b-10611a267365",
          "code": "6966",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6966",
          "code_system": "PUBCHEM",
          "references": [
            "efd8b883-2f40-4a81-a50d-7db165f47f71"
          ]
        },
        {
          "uuid": "12f046c8-4f24-8576-a264-fd3bf4751fff",
          "code": "Pyromellitic dianhydride",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pyromellitic_dianhydride",
          "code_system": "WIKIPEDIA",
          "references": [
            "8a6eb1ec-7941-f761-23e1-1542d35d8805"
          ]
        },
        {
          "uuid": "cda25309-ee5b-386a-67e6-4dc96a5802d8",
          "code": "6950",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6950",
          "code_system": "HSDB",
          "references": [
            "60e18ee2-dc73-0d68-9799-194bdbfe10cd"
          ]
        },
        {
          "uuid": "8de818ef-dd53-cb34-2b8a-cd27ebd6a382",
          "code": "DTXSID1026536",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1026536",
          "code_system": "EPA CompTox",
          "references": [
            "9704ac9c-5884-39c4-765a-f9a99cf355c8"
          ]
        },
        {
          "uuid": "8aa29553-06ce-4ef1-8f1e-968d77881acd",
          "code": "2Z22T30QZQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "797ad131-a7f9-a787-b3f5-77575d6848cb",
          "code": "4798",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4798",
          "code_system": "NSC",
          "references": [
            "06fce5df-dc13-e6db-027c-8b87e724c73d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "098e99f8-a565-471a-bcee-fbc645c0b0fd",
          "name": "1,2,4,5-BENZENETETRACARBOXYLIC 1,2:4,5-DIANHYDRIDE",
          "stdName": "1,2,4,5-BENZENETETRACARBOXYLIC 1,2:4,5-DIANHYDRIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "4c2f581e-be1c-4b23-88be-dff54b26b79b",
          "name": "1,2,4,5-BENZENETETRACARBOXYLIC ACID 1,2:4,5-DIANHYDRIDE",
          "stdName": "1,2,4,5-BENZENETETRACARBOXYLIC ACID 1,2:4,5-DIANHYDRIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "66c5ad81-e542-4aaa-be48-1948507348e2",
          "name": "1,2,4,5-BENZENETETRACARBOXYLIC ACID DIANHYDRIDE",
          "stdName": "1,2,4,5-BENZENETETRACARBOXYLIC ACID DIANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "0ab17ad8-96ff-403c-8e54-2d5080bbcbdc",
          "name": "1H,3H-BENZO(1,2-C:4,5-C')DIFURAN-1,3,5,7-TETRONE",
          "stdName": "1H,3H-BENZO(1,2-C:4,5-C')DIFURAN-1,3,5,7-TETRONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "4d017723-dd6a-4a6a-949f-d556f434ba62",
          "name": "NSC-4798",
          "stdName": "NSC-4798",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "7d13882c-dd1c-4018-8afd-83ab0c1ec012",
          "name": "PMDA",
          "stdName": "PMDA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "3688f32b-d1eb-46e4-a95c-80dc76f54c71",
          "name": "PYROMELLITIC 1,2:4,5-DIANHYDRIDE",
          "stdName": "PYROMELLITIC 1,2:4,5-DIANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "94a641c4-bffe-4df2-94e8-c9eed845ee92",
          "name": "PYROMELLITIC ACID ANHYDRIDE",
          "stdName": "PYROMELLITIC ACID ANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "2e6a03a7-bde5-4fac-8c5c-60b90a8bdd7e",
          "name": "PYROMELLITIC ACID DIANHYDRIDE",
          "stdName": "PYROMELLITIC ACID DIANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "659e81b9-7323-426c-82ef-0705f6a2e7d1",
          "name": "PYROMELLITIC ANHYDRIDE",
          "stdName": "PYROMELLITIC ANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        },
        {
          "uuid": "aafc4f00-4b9c-4674-81e5-7b060cd881d7",
          "name": "PYROMELLITIC DIANHYDRIDE",
          "stdName": "PYROMELLITIC DIANHYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "690519e3-39eb-48b0-b201-2d6ad017ccc7",
            "be8861b4-9947-441a-8df8-1bceb17f22a2",
            "85e6a785-0572-4d83-a3ec-da43b1bf310c",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": true
        },
        {
          "uuid": "4ecf20bc-5311-4292-991c-db4742b04ed6",
          "name": "PYROMELLITIC DIANHYDRIDE [HSDB]",
          "stdName": "PYROMELLITIC DIANHYDRIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "690519e3-39eb-48b0-b201-2d6ad017ccc7",
            "4b5f36e9-7f01-44fe-83c1-fd903963cc47"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "be8861b4-9947-441a-8df8-1bceb17f22a2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4b5f36e9-7f01-44fe-83c1-fd903963cc47",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "690519e3-39eb-48b0-b201-2d6ad017ccc7",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efd8b883-2f40-4a81-a50d-7db165f47f71",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391216000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8827aebc-6952-4740-8f54-702062c123e1",
          "citation": "SRS import [2Z22T30QZQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2Z22T30QZQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391216000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b07ecc3-068c-4f29-8615-4afc52ccbf35",
          "citation": "http://www.chemicalland21.com/specialtychem/perchem/PYROMELLITIC%20DIANHYDRIDE.htm",
          "url": "http://www.chemicalland21.com/specialtychem/perchem/PYROMELLITIC%20DIANHYDRIDE.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85e6a785-0572-4d83-a3ec-da43b1bf310c",
          "citation": "PYROMELLITIC DIANHYDRIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a6eb1ec-7941-f761-23e1-1542d35d8805",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Pyromellitic_dianhydride",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "60e18ee2-dc73-0d68-9799-194bdbfe10cd",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+89-32-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9704ac9c-5884-39c4-765a-f9a99cf355c8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=89-32-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a43724f4-9d78-44d5-a8ea-f714db789a8e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "06fce5df-dc13-e6db-027c-8b87e724c73d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5f7fe355-a8d2-4058-8423-6e6e8a30b6bb",
          "id": "5f7fe355-a8d2-4058-8423-6e6e8a30b6bb",
          "molfile": "\n  Marvin  01132104562D          \n\n 16 18  0  0  0  0            999 V2000\n    6.1131   -2.1529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8995   -1.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3845   -0.6884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8995   -0.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1131    0.7764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1148   -0.2757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4069    0.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6918   -0.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6918   -1.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4071   -1.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1148   -1.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9029   -1.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6894   -2.1572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4207   -0.6914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9030   -0.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6896    0.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n 11  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 15  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 12  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\nM  END",
          "smiles": "c1c2c(cc3c1c(=O)oc3=O)c(=O)oc2=O",
          "formula": "C10H2O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "20c5d9b8-4eb5-40e0-8496-bf521d738e3d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "218.1197",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "aeb6a127-a026-4bcf-89de-b64b2ccbe700",
      "version": "6",
      "structure": {
        "id": "19aa8f30-64ef-4625-8012-7b5f3eb8030c",
        "molfile": "\n  Marvin  01132101312D          \n\n 16 18  0  0  0  0            999 V2000\n    3.6918   -0.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6918   -1.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4071   -1.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1148   -1.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1148   -0.2757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4069    0.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8995   -0.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3845   -0.6884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8995   -1.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1131   -2.1529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1131    0.7764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9029   -1.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4207   -0.6914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9030   -0.0225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6896    0.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6894   -2.1572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  7 11  2  0  0  0  0\n  2 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 12 16  2  0  0  0  0\nM  END",
        "smiles": "c1c2c(cc3c1c(=O)oc3=O)c(=O)oc2=O",
        "formula": "C10H2O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "218.1197",
        "optical_activity": "NONE",
        "references": [
          "8827aebc-6952-4740-8f54-702062c123e1",
          "3b07ecc3-068c-4f29-8615-4afc52ccbf35"
        ],
        "stereo_centers": 0
      },
      "unii": "2Z22T30QZQ"
    }
  ]
}