{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "3be66818-21ea-4d00-8965-1f65a55920e5", "code": "76956136", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76956136", "code_system": "PUBCHEM", "references": [ "56dd71fa-a6e6-41b5-ac28-436373226d8c" ] }, { "uuid": "e098d724-8112-40d7-b746-4296322dfcdc", "code": "2Z121Y1AYC", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "f79c3277-cf67-4466-ab75-aef9446388af", "name": "FEMA NO. 3050, (-)-", "stdName": "FEMA NO. 3050, (-)-", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "9f18a3f3-80da-4885-8f62-17e4ce3fc7de", "6fb91772-7d61-4e9f-a0e5-622b6c9dbf53" ], "display_name": false }, { "uuid": "05238b73-0f41-498e-8887-2ef4bddd4c5a", "name": "P-MENTH-1-EN-8-YL-ISOBUTYRATE, (-)-", "stdName": "P-MENTH-1-EN-8-YL-ISOBUTYRATE, (-)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9f18a3f3-80da-4885-8f62-17e4ce3fc7de", "6fb91772-7d61-4e9f-a0e5-622b6c9dbf53" ], "display_name": false }, { "uuid": "32a5ea99-140e-476b-84b3-4fdf79dbd8f3", "name": "TERPINYL ISOBUTYRATE, (-)-", "stdName": "TERPINYL ISOBUTYRATE, (-)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9f18a3f3-80da-4885-8f62-17e4ce3fc7de", "6fb91772-7d61-4e9f-a0e5-622b6c9dbf53" ], "display_name": true } ], "references": [ { "uuid": "9f18a3f3-80da-4885-8f62-17e4ce3fc7de", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "6fb91772-7d61-4e9f-a0e5-622b6c9dbf53", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "56dd71fa-a6e6-41b5-ac28-436373226d8c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391409000, "tags": [ "NOMEN" ] }, { "uuid": "fd2144df-4ec5-41fe-a023-2895ce5d783f", "citation": "SRS import [2Z121Y1AYC]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2Z121Y1AYC", "doc_type": "SRS", "public_domain": true, "document_date": 1493391409000, "tags": [ "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "939f3197-7c4a-43de-8c71-41ae7a87f76c", "id": "939f3197-7c4a-43de-8c71-41ae7a87f76c", "molfile": "\n Marvin 01132107392D \n\n 16 16 0 0 1 0 999 V2000\n 8.5486 -7.0230 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.8341 -6.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1197 -7.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1197 -7.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4052 -8.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8341 -8.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5486 -7.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2631 -6.6106 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.6756 -7.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8506 -5.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9775 -6.1980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9775 -5.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2630 -4.9606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6920 -4.9605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6920 -4.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4065 -5.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 7 1 0 0 0 0\n 1 8 1 1 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 4 2 0 0 0 0\n 7 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\nM END", "smiles": "CC(C)C(=O)OC(C)(C)[C@H]1CC=C(C)CC1", "formula": "C14H24O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ae8422c5-f983-44b0-ab3c-e7dd73da38b8" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "224.3397", "optical_activity": "UNSPECIFIED", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "fca401c9-d2f1-49a8-a9a0-c6ae47792923", "version": "2", "structure": { "id": "63d5c693-e49b-48d0-95ba-ad1c35a9b31c", "molfile": "\n Marvin 01132105112D \n\n 16 16 0 0 1 0 999 V2000\n 6.4052 -8.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1197 -7.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8341 -8.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5486 -7.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5486 -7.0230 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.2631 -6.6106 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.6756 -7.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8506 -5.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9775 -6.1980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9775 -5.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2630 -4.9606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8341 -6.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1197 -7.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6920 -4.9605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6920 -4.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4065 -5.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 1 0 0 0\n 7 6 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 5 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 2 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\nM END", "smiles": "CC(C)C(=O)OC(C)(C)[C@H]1CC=C(C)CC1", "formula": "C14H24O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "224.3397", "optical_activity": "UNSPECIFIED", "references": [ "9f18a3f3-80da-4885-8f62-17e4ce3fc7de", "fd2144df-4ec5-41fe-a023-2895ce5d783f" ], "stereo_centers": 1 }, "unii": "2Z121Y1AYC" } ] }