{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b08c66c9-fad0-434e-bfff-9b080e1b9a8b",
          "code": "2204250-22-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2204250-22-4",
          "code_system": "CAS"
        },
        {
          "uuid": "2e93865a-c0e6-4acb-bf28-2c0ef4434a57",
          "code": "2X4DP6V9GV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8cc8ce01-b6da-6b5b-1d18-fb8693be551b",
          "code": "169490914",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/169490914",
          "code_system": "PUBCHEM",
          "references": [
            "a338a009-0bdf-5e88-cd9a-12796f71d8b7"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "10a422b0-ccc7-4728-ac2b-e9d9551ebfea",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b73a9542-ca4e-4993-a26f-c39a462a9313",
          "citation": "Bernard-Gauthier, Vadim, et al. \"Identification of [18F] TRACK, a fluorine-18-labeled tropomyosin receptor kinase (Trk) inhibitor for PET imaging.\" Journal of Medicinal Chemistry 61.4 (2018): 1737-1743.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acs.jmedchem.7b01607",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "52ab9da3-454d-44ba-a04b-ce5967422c52",
          "citation": "Bailey, Justin J., et al. \"First-in-human brain imaging of [18F] TRACK, a PET tracer for tropomyosin receptor kinases.\" ACS Chemical Neuroscience 10.6 (2019): 2697-2702.",
          "url": "https://pubs.acs.org/doi/full/10.1021/acschemneuro.9b00144",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "f3f350b2-d81e-428e-b4b3-aed03fe04caf",
          "citation": "Bernard-Gauthier, Vadim, et al. \"Identification of [18F] TRACK, a fluorine-18-labeled tropomyosin receptor kinase (Trk) inhibitor for PET imaging.\" Journal of Medicinal Chemistry 61.4 (2018): 1737-1743.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acs.jmedchem.7b01607",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a338a009-0bdf-5e88-cd9a-12796f71d8b7",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4c27aca0-2b07-498c-8928-b5c8e10a3c61",
          "id": "4c27aca0-2b07-498c-8928-b5c8e10a3c61",
          "molfile": "\n  Marvin  07062320202D          \n\n 31 35  0  0  1  0            999 V2000\n    6.4118    2.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1263    3.4112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4118    2.1737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9842    1.7612    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.3786    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9437    3.0756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6974    3.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3916    3.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6887    2.2910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6111    4.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8042    4.4032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5847    3.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8818    2.1195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3297    2.7326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6269    1.3349    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8422    1.0799    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1117    0.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8422    0.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6269    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8408    2.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8408    2.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5553    3.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5553    1.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2697    2.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2697    2.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1748    1.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4211    1.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2610    2.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7536    1.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5936    2.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8398    2.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  7  1  0  0  0  0\n  2 20  1  0  0  0  0\n  4 25  1  0  0  0  0\n  5 29  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7 10  2  0  0  0  0\n  8 11  2  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 14  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 26  1  6  0  0  0\n 17 19  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 23 25  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 28 30  2  0  0  0  0\n 29 31  2  0  0  0  0\n 30 31  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cc(c1)F)[C@H]2CCCN2c3ccc4ncc(C(=O)Nc5ccc(cc5)F)n4n3",
          "formula": "C23H19F2N5O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1756eb8e-94b4-4531-887f-9998fcf9f127"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "419.4275",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f94a208f-8a81-455c-bf22-d986d1c52256",
      "version": "6",
      "structure": {
        "id": "59bf8a71-035a-4176-a3cf-12c088875e6a",
        "molfile": "N-(4-Fluorophenyl)-6-[(2R)-2-(3-fluorophenyl)-1-pyrrolidinyl]imidazo[1,2-b]py...\n   JSDraw207062320202D\n\n 31 35  0  0  1  0              0 V2000\n   27.8526   -6.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2036   -5.4087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8526   -7.7488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   34.6076   -8.5288    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7284   -9.2521    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   25.0765   -6.0433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5016   -5.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.0326   -4.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5944   -7.5269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3385   -3.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8127   -3.5330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5068   -5.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0686   -7.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0246   -6.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5865   -9.3349    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1028   -9.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5033  -10.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1028  -11.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5865  -11.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5547   -6.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5547   -7.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.9057   -5.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.9057   -8.5288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.2567   -6.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.2567   -7.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8408   -8.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4156   -9.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0038   -7.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1535   -8.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7417   -6.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3165   -7.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  7  1  0  0  0  0\n  2 20  1  0  0  0  0\n  4 25  1  0  0  0  0\n  5 29  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7 10  2  0  0  0  0\n  8 11  2  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 14  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 26  1  6  0  0  0\n 17 19  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 23 25  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 28 30  2  0  0  0  0\n 29 31  2  0  0  0  0\n 30 31  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cc(c1)F)[C@H]2CCCN2c3ccc4ncc(C(=O)Nc5ccc(cc5)F)n4n3",
        "formula": "C23H19F2N5O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "419.4275",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "52ab9da3-454d-44ba-a04b-ce5967422c52"
        ],
        "stereo_centers": 1
      },
      "unii": "2X4DP6V9GV",
      "relationships": [
        {
          "uuid": "daf65364-b7c9-419d-beb4-c6058eb894a7",
          "amount": {
            "uuid": "81a2daa8-bf21-4f2b-be3f-6daa9d01f857"
          },
          "type": "LABELED->NON-LABELED",
          "references": [
            "f3f350b2-d81e-428e-b4b3-aed03fe04caf"
          ],
          "related_substance": {
            "uuid": "684a0aec-a10a-4beb-9fe3-ac9fa6cf37ba",
            "refuuid": "092587f8-8c1a-48bb-90ae-1f4bda9b5a7f",
            "name": "TRACK F-18",
            "unii": "LZ8R7Q2ASK",
            "linking_id": "LZ8R7Q2ASK",
            "ref_pname": "TRACK F-18",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bb65d79a-7c6e-471a-b0dd-71c7e30ce612",
          "amount": {
            "uuid": "36a58332-34a5-4b31-8602-c3c95d70f449",
            "average": 0.31,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "b73a9542-ca4e-4993-a26f-c39a462a9313"
          ],
          "related_substance": {
            "uuid": "ee8492cc-35b8-401c-822c-9ef229344ecc",
            "refuuid": "8b142407-4456-4fcb-b03d-b9c867bef88d",
            "name": "NT-3 GROWTH FACTOR RECEPTOR",
            "unii": "G0D1L6VX5I",
            "linking_id": "G0D1L6VX5I",
            "ref_pname": "NT-3 GROWTH FACTOR RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "354043eb-8f15-4fae-b1c2-d310877d4e58",
          "amount": {
            "uuid": "2cdd9912-9eb0-4cd4-8d69-1374896ae663",
            "average": 0.15,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "b73a9542-ca4e-4993-a26f-c39a462a9313"
          ],
          "related_substance": {
            "uuid": "d5094851-1414-4521-8085-ef40bb4638a0",
            "refuuid": "4ca6a0e3-e610-49bd-80bf-8d758bbf77ae",
            "name": "BDNF/NT-3 GROWTH FACTORS RECEPTOR",
            "unii": "M4PJ7V12VY",
            "linking_id": "M4PJ7V12VY",
            "ref_pname": "BDNF/NT-3 GROWTH FACTORS RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c437e760-481f-4020-aa54-33fc4fcea6ca",
          "amount": {
            "uuid": "7113a3ea-4621-456b-b592-465d5a150521",
            "average": 4.21,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "b73a9542-ca4e-4993-a26f-c39a462a9313"
          ],
          "related_substance": {
            "uuid": "88b76973-03da-448b-acbe-254d94057ad4",
            "refuuid": "7984584b-c5f4-4945-b833-a3c96c2f611c",
            "name": "HIGH AFFINITY NERVE GROWTH FACTOR RECEPTOR",
            "unii": "1L68U00N7O",
            "linking_id": "1L68U00N7O",
            "ref_pname": "HIGH AFFINITY NERVE GROWTH FACTOR RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ac18f736-5689-41f5-b2b1-c9adb5f77f0c",
          "amount": {
            "uuid": "fe2a94f5-0db9-40cb-bb15-d0e2e4817913"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "b73a9542-ca4e-4993-a26f-c39a462a9313"
          ],
          "related_substance": {
            "uuid": "df1b3cae-5f43-4a1b-a649-a6f1afc1dec9",
            "refuuid": "f94a208f-8a81-455c-bf22-d986d1c52256",
            "name": "TRACK",
            "unii": "2X4DP6V9GV",
            "linking_id": "2X4DP6V9GV",
            "ref_pname": "TRACK",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "f4e89d9f-c2ac-4361-a6af-9270f9748a8c",
          "name": "Imidazo[1,2-b]pyridazine-3-carboxamide, N-(4-fluorophenyl)-6-[(2R)-2-(3-fluorophenyl)-1-pyrrolidinyl]-",
          "stdName": "IMIDAZO(1,2-B)PYRIDAZINE-3-CARBOXAMIDE, N-(4-FLUOROPHENYL)-6-((2R)-2-(3-FLUOROPHENYL)-1-PYRROLIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a422b0-ccc7-4728-ac2b-e9d9551ebfea"
          ],
          "display_name": false
        },
        {
          "uuid": "d0b3a87e-7996-43cd-a29c-1736fb195d93",
          "name": "N-(4-Fluorophenyl)-6-[(2R)-2-(3-fluorophenyl)-1-pyrrolidinyl]imidazo[1,2-b]pyridazine-3-carboxamide",
          "stdName": "N-(4-FLUOROPHENYL)-6-((2R)-2-(3-FLUOROPHENYL)-1-PYRROLIDINYL)IMIDAZO(1,2-B)PYRIDAZINE-3-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10a422b0-ccc7-4728-ac2b-e9d9551ebfea"
          ],
          "display_name": false
        },
        {
          "uuid": "15dd876b-0e8c-48cb-ad9b-2a3525fef7f5",
          "name": "TRACK",
          "stdName": "TRACK",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b73a9542-ca4e-4993-a26f-c39a462a9313"
          ],
          "display_name": true
        }
      ],
      "modifications": {
        "uuid": "7615edce-2b31-44a3-879d-697cfc85c575"
      }
    }
  ]
}