{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "27030dd7-f2e2-4345-b2a0-5e1f4d6a38ab",
          "code": "14933-03-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14933-03-0",
          "code_system": "CAS",
          "references": [
            "89ddfdae-3e2a-435d-83f8-676c0722b7a5",
            "e1727e29-c1c5-4547-bd86-80d2fa7e7702"
          ]
        },
        {
          "uuid": "ae52515f-a933-68a6-5fd3-b1d24e3504e6",
          "code": "12905177",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12905177",
          "code_system": "PUBCHEM",
          "references": [
            "87a9dbb8-bd2d-6ae5-9cc0-29a688668497"
          ]
        },
        {
          "uuid": "64a720c7-de64-45e0-a81d-cef9d2355b31",
          "code": "2X0X2FJM3L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "54a8648b-9cc9-41bf-ba6b-f36e28be4138",
          "name": "DISODIUM SULFOSUCCINATE",
          "stdName": "DISODIUM SULFOSUCCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdbf1ad3-6439-4c59-8ca6-a669cc7eab46",
            "e64edb57-095f-4909-bc3d-f4caec0bfc43"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "cdbf1ad3-6439-4c59-8ca6-a669cc7eab46",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e64edb57-095f-4909-bc3d-f4caec0bfc43",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89ddfdae-3e2a-435d-83f8-676c0722b7a5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393004000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8830c50-d4cd-4475-acdf-f28ea6f7953b",
          "citation": "SRS import [2X0X2FJM3L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2X0X2FJM3L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393004000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87a9dbb8-bd2d-6ae5-9cc0-29a688668497",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "e1727e29-c1c5-4547-bd86-80d2fa7e7702",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c9b9967e-4afc-4a8c-bdb7-815a68340d72",
          "id": "c9b9967e-4afc-4a8c-bdb7-815a68340d72",
          "molfile": "\n  Marvin  01132110252D          \n\n  1  0  0  0  0  0            999 V2000\n    6.5564  -10.3435    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "cbca7374-ec6b-4c79-9648-408c61014173"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b0a50355-68e3-4374-9eb1-18b7128f99dc",
          "id": "b0a50355-68e3-4374-9eb1-18b7128f99dc",
          "molfile": "\n  Marvin  01132109092D          \n\n 12 11  0  0  0  0            999 V2000\n    8.1435   -8.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8579   -9.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5724   -8.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2869   -9.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2869  -10.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0013   -8.8219    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.8579  -10.0595    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6829  -10.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0329  -10.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8579  -10.8845    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.4290   -9.2345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1435   -7.9969    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 11  2  0  0  0  0\n  1 12  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  2  0  0  0  0\n  7 10  1  0  0  0  0\nM  CHG  3   6  -1  10  -1  12  -1\nM  END",
          "smiles": "C(C(C(=O)[O-])S(=O)(=O)[O-])C(=O)[O-]",
          "formula": "C4H3O7S",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "361a7497-e0be-445e-a4ac-df156d911164"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "195.1287",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        },
        {
          "uuid": "8e496370-89ee-4732-bd62-e9a031913f96",
          "id": "8e496370-89ee-4732-bd62-e9a031913f96",
          "molfile": "\n  Marvin  01132107232D          \n\n  1  0  0  0  0  0            999 V2000\n    7.2688   -6.7231    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b8dfbe11-71e4-41a6-8389-d368afc70fa7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6a02f176-32a8-4192-80df-32f1bb5a5b21",
      "version": "3",
      "structure": {
        "id": "b09f959d-4456-473a-8eae-1ed386512b7c",
        "molfile": "\n  Marvin  01132109092D          \n\n 15 11  0  0  0  0            999 V2000\n    6.5564  -10.3435    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    8.1435   -8.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8579   -9.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5724   -8.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2869   -9.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2869  -10.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0013   -8.8219    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.8579  -10.0595    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6829  -10.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0329  -10.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8579  -10.8845    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.4290   -9.2345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1435   -7.9969    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.2688   -6.7231    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n    6.5564  -10.3435    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n  2 12  2  0  0  0  0\n  2 13  1  0  0  0  0\nM  CHG  6   1   1   7  -1  11  -1  13  -1  14   1  15   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2   1  15\nM  SPA   1  1   1\nM  SDI   1  4    6.1364  -10.7635    6.1364   -9.9235\nM  SDI   1  4    6.9764   -9.9235    6.9764  -10.7635\nM  SMT   1 2\nM  END",
        "smiles": "C(C(C(=O)[O-])S(=O)(=O)[O-])C(=O)[O-].[Na+].[Na+].[H+]",
        "formula": "C4H3O7S.2Na.H",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "242.1162",
        "optical_activity": "( + / - )",
        "references": [
          "cdbf1ad3-6439-4c59-8ca6-a669cc7eab46",
          "b8830c50-d4cd-4475-acdf-f28ea6f7953b"
        ],
        "stereo_centers": 1
      },
      "unii": "2X0X2FJM3L"
    }
  ]
}