{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "31f0ad58-4e75-43ea-8378-1b8e11894ab2",
          "code": "29232-93-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=29232-93-7",
          "code_system": "CAS",
          "references": [
            "968142d9-cf40-4a73-8502-2149e89b8a59",
            "a1c75cce-d524-4e32-9525-3e64560183f4"
          ]
        },
        {
          "uuid": "2a1706ab-b0fa-4d33-84dd-dcc6c7b0803b",
          "code": "PIRIMIPHOS-METHYL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pirimiphos-methyl",
          "code_system": "WIKIPEDIA",
          "references": [
            "968142d9-cf40-4a73-8502-2149e89b8a59"
          ]
        },
        {
          "uuid": "790b6d6b-a1a5-4f25-a25e-611ec7e13c00",
          "code": "108102",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3437",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "968142d9-cf40-4a73-8502-2149e89b8a59"
          ]
        },
        {
          "uuid": "ac50d6e1-1365-4a24-8613-a4aaae39c206",
          "code": "m8880",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8880?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "968142d9-cf40-4a73-8502-2149e89b8a59"
          ]
        },
        {
          "uuid": "6bb98e86-35b4-4b6f-85d8-2188b0bc42f2",
          "code": "249-528-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.011",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "968142d9-cf40-4a73-8502-2149e89b8a59"
          ]
        },
        {
          "uuid": "a1549d2d-6331-480b-bfcc-bc91255a7b57",
          "code": "34526",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/34526",
          "code_system": "PUBCHEM",
          "references": [
            "968142d9-cf40-4a73-8502-2149e89b8a59"
          ]
        },
        {
          "uuid": "9d107ff7-57f5-3b2c-af67-5599a8975c62",
          "code": "6984",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6984",
          "code_system": "HSDB",
          "references": [
            "e5a993ce-fdee-acfc-96b2-c17b9f6595d3"
          ]
        },
        {
          "uuid": "672c84ee-bb42-a257-3e68-f99e46f3b9e9",
          "code": "DTXSID0024266",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0024266",
          "code_system": "EPA CompTox",
          "references": [
            "127fbbe2-d2a3-8a66-75eb-bc8027384d24"
          ]
        },
        {
          "uuid": "0f09dd69-b330-4529-a62e-4f8a4f9395a4",
          "code": "2VQZ4PK548",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "150e1162-1bfb-d2b4-2d2e-8db1965bbb9a",
          "code": "pirimiphos-methyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/pirimiphos-methyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "0cea6700-5ca5-985f-313e-9fff2e4c4930"
          ]
        },
        {
          "uuid": "8a790bd6-0ab0-d3bc-5c9d-581cab396801",
          "code": "300000048800",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "df453a89-8a48-2b67-514c-5232166e4759"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b2dff4b3-ae08-4862-9d90-b6d20de3c332",
          "name": "O-(2-(DIETHYLAMINO)-6-METHYL-4-PYRIMIDINYL) O,O-DIMETHYL PHOSPHOROTHIOATE",
          "stdName": "O-(2-(DIETHYLAMINO)-6-METHYL-4-PYRIMIDINYL) O,O-DIMETHYL PHOSPHOROTHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3a7bb3f-496a-4c79-85e4-cb3a3613e5a9",
            "f1f0d665-b07b-41e8-8790-ae5c3a1f3dae"
          ],
          "display_name": false
        },
        {
          "uuid": "53f03147-f10f-42f4-b6cb-b5f7bbbfc04a",
          "name": "O-2-DIETHYLAMINO-6-METHYLPYRIMIDIN-4-YL O,O-DIMETHYL PHOSPHOROTHIOATE",
          "stdName": "O-2-DIETHYLAMINO-6-METHYLPYRIMIDIN-4-YL O,O-DIMETHYL PHOSPHOROTHIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e288fad9-674a-4630-8969-b905e73f048a",
            "c3a7bb3f-496a-4c79-85e4-cb3a3613e5a9"
          ],
          "display_name": false
        },
        {
          "uuid": "116b5f58-798f-4e0e-a9c6-0c55679a410e",
          "name": "PIRIMIPHOS-METHYL",
          "stdName": "PIRIMIPHOS-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32f3cf30-a5d8-419a-8301-c85faf7341b8",
            "76a8943c-4e95-4e21-b039-bf6881a5a47f",
            "a8c97dfe-b92b-4f87-b841-dcb3f1b65ac2",
            "bbc5f5cd-a427-409f-a0c7-8aec780daaf1",
            "fa90d0e7-a7cc-4941-8514-c0dead17bea8",
            "4f1af13c-9423-48d4-bf06-5e44d2a7df56",
            "35cc5406-e21c-4595-90b0-5294a58a2d6c",
            "8148aa9c-2c22-4a76-8427-1503e1eccab4"
          ],
          "display_name": true
        },
        {
          "uuid": "5e8a9a9b-83bf-4743-8648-ba6e2f9773df",
          "name": "PIRIMIPHOS-METHYL [HSDB]",
          "stdName": "PIRIMIPHOS-METHYL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35cc5406-e21c-4595-90b0-5294a58a2d6c",
            "8148aa9c-2c22-4a76-8427-1503e1eccab4"
          ],
          "display_name": false
        },
        {
          "uuid": "5b78c59c-5920-49a9-8b07-75b100b3c8ce",
          "name": "PIRIMIPHOS-METHYL [ISO]",
          "stdName": "PIRIMIPHOS-METHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32f3cf30-a5d8-419a-8301-c85faf7341b8",
            "8148aa9c-2c22-4a76-8427-1503e1eccab4"
          ],
          "display_name": false
        },
        {
          "uuid": "48f9dcfa-caee-4c44-bf53-a67f8e236918",
          "name": "PIRIMIPHOS-METHYL [MI]",
          "stdName": "PIRIMIPHOS-METHYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76a8943c-4e95-4e21-b039-bf6881a5a47f",
            "8148aa9c-2c22-4a76-8427-1503e1eccab4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4f1af13c-9423-48d4-bf06-5e44d2a7df56",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c3a7bb3f-496a-4c79-85e4-cb3a3613e5a9",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e288fad9-674a-4630-8969-b905e73f048a",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1f0d665-b07b-41e8-8790-ae5c3a1f3dae",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76a8943c-4e95-4e21-b039-bf6881a5a47f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8148aa9c-2c22-4a76-8427-1503e1eccab4",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35cc5406-e21c-4595-90b0-5294a58a2d6c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32f3cf30-a5d8-419a-8301-c85faf7341b8",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "968142d9-cf40-4a73-8502-2149e89b8a59",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390890000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b270623b-4e7a-4ab1-8641-cf0ff91b12b1",
          "citation": "SRS import [2VQZ4PK548]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2VQZ4PK548",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390890000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e908e79-6686-4be5-8cb4-d45d8ec13bad",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbc5f5cd-a427-409f-a0c7-8aec780daaf1",
          "citation": "PIRIMIPHOS-METHYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a8c97dfe-b92b-4f87-b841-dcb3f1b65ac2",
          "citation": "PIRIMIPHOS-METHYL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fa90d0e7-a7cc-4941-8514-c0dead17bea8",
          "citation": "PIRIMIPHOS-METHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5a993ce-fdee-acfc-96b2-c17b9f6595d3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+29232-93-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "127fbbe2-d2a3-8a66-75eb-bc8027384d24",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=29232-93-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0cea6700-5ca5-985f-313e-9fff2e4c4930",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "a1c75cce-d524-4e32-9525-3e64560183f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "df453a89-8a48-2b67-514c-5232166e4759",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "76877c37-35aa-455c-afda-ea2c46c5d585",
          "id": "76877c37-35aa-455c-afda-ea2c46c5d585",
          "molfile": "\n  Marvin  01132106092D          \n\n 19 19  0  0  0  0            999 V2000\n    3.2320   -4.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9465   -4.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6610   -4.4606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6610   -3.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9465   -3.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3754   -4.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3754   -5.6981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0899   -6.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0899   -6.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8044   -5.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8044   -4.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5188   -4.4606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2333   -4.8731    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8652   -5.4034    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8166   -4.2897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6135   -4.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7601   -5.5489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1088   -6.2966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0899   -4.4606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 19  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 13 17  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)c1nc(C)cc(n1)OP(=S)(OC)OC",
          "formula": "C11H20N3O3PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "deeef44e-2a81-4fb5-94af-9f1783e56825"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "305.3351",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a99aaa93-4b6d-44ab-95eb-4cccf37c2649",
      "version": "6",
      "structure": {
        "id": "b99e74a2-f301-4c3b-8f5b-c6cf3b3bd3a4",
        "molfile": "\n  Marvin  01132109362D          \n\n 19 19  0  0  0  0            999 V2000\n    6.8044   -4.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0899   -4.4606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3754   -4.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6610   -4.4606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9465   -4.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2320   -4.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6610   -3.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9465   -3.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3754   -5.6981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0899   -6.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8044   -5.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0899   -6.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5188   -4.4606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2333   -4.8731    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8166   -4.2897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6135   -4.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7601   -5.5489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1088   -6.2966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8652   -5.4034    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  3  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 14 19  2  0  0  0  0\nM  END",
        "smiles": "CCN(CC)c1nc(C)cc(n1)OP(=S)(OC)OC",
        "formula": "C11H20N3O3PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "305.3351",
        "optical_activity": "NONE",
        "references": [
          "b270623b-4e7a-4ab1-8641-cf0ff91b12b1",
          "7e908e79-6686-4be5-8cb4-d45d8ec13bad"
        ],
        "stereo_centers": 0
      },
      "unii": "2VQZ4PK548"
    }
  ]
}