{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "95488547-05b7-4bf6-953e-44409c1c0820",
          "code": "129499-78-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=129499-78-1",
          "code_system": "CAS",
          "references": [
            "6d0aace4-2b37-4d27-a7ad-a946fde53d39",
            "873f69be-5c81-4808-8331-01f815d896f4"
          ]
        },
        {
          "uuid": "8c5d5e8a-b0c4-4a21-bca6-2846920f8aad",
          "code": "C065378",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67065378",
          "code_system": "MESH",
          "references": [
            "6d0aace4-2b37-4d27-a7ad-a946fde53d39"
          ]
        },
        {
          "uuid": "cfa0b28d-8b11-4d55-aca3-ef0cad21537f",
          "code": "1306933",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1306933/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6d0aace4-2b37-4d27-a7ad-a946fde53d39"
          ]
        },
        {
          "uuid": "4567624c-eb3e-4f2f-976e-91b8867d7b66",
          "code": "54693473",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54693473",
          "code_system": "PUBCHEM",
          "references": [
            "6d0aace4-2b37-4d27-a7ad-a946fde53d39"
          ]
        },
        {
          "uuid": "09c45299-72f5-394e-fb94-53db8b47d6cb",
          "code": "DB11335",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11335",
          "code_system": "DRUG BANK",
          "references": [
            "2b496632-3603-e355-58e0-da93ca6b5664"
          ]
        },
        {
          "uuid": "5833e0b1-169e-42e3-a1b0-08eabfc75ccc",
          "code": "2V52R0NHXW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "20a26942-30c1-0c43-9bb3-90511c110efd",
          "code": "Ascorbyl glucoside",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ascorbyl_glucoside",
          "code_system": "WIKIPEDIA",
          "references": [
            "3a78d7e0-6c23-4691-4b6a-8b450d998174"
          ]
        },
        {
          "uuid": "b396ced6-6152-9201-2820-d81924d20b7a",
          "code": "DTXSID50926423",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50926423",
          "code_system": "EPA CompTox",
          "references": [
            "2b496632-3603-e355-58e0-da93ca6b5664"
          ]
        },
        {
          "uuid": "cffe1234-169d-5873-13e8-9d1506ce8bec",
          "code": "2V52R0NHXW",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2V52R0NHXW",
          "code_system": "DAILYMED",
          "references": [
            "d826bb52-7544-f97b-8dde-ee064d0093ba"
          ]
        },
        {
          "uuid": "5bf3ea3e-0e92-1639-2cb6-3b8b5b6b4585",
          "code": "300000054506",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "01d92c2b-dcb0-6d3f-0a22-d7577c03a8bc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e09c9edb-0c76-41a5-97b5-1cb04136ba97",
          "name": "AA-2G",
          "stdName": "AA-2G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9a19f84-7813-4201-af06-4ab8da627989",
            "53ea40d9-7f97-4d89-aee2-0a5e7a759d66"
          ],
          "display_name": false
        },
        {
          "uuid": "af9607d4-1bad-4929-a052-dd36c7370034",
          "name": "AA2G",
          "stdName": "AA2G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4836462-957e-4747-8399-57fce26ef265",
            "c9a19f84-7813-4201-af06-4ab8da627989"
          ],
          "display_name": false
        },
        {
          "uuid": "c380a2b6-3001-47ae-b181-ddb35b899e97",
          "name": "ASCORBIC ACID 2-GLUCOSIDE",
          "stdName": "ASCORBIC ACID 2-GLUCOSIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4836462-957e-4747-8399-57fce26ef265",
            "c9a19f84-7813-4201-af06-4ab8da627989"
          ],
          "display_name": false
        },
        {
          "uuid": "fff177da-cb11-44ad-a014-c2ef1e3b02f7",
          "name": "ASCORBYL GLUCOSIDE",
          "stdName": "ASCORBYL GLUCOSIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8583b73c-e3cb-4def-bc88-3905ac58972b",
            "b4836462-957e-4747-8399-57fce26ef265",
            "ce069e18-4aca-4f1a-b015-b186be30c760",
            "c9a19f84-7813-4201-af06-4ab8da627989",
            "c0b217e5-af18-4b59-85c2-dc2d1d8100cc"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "925f4575-a359-4358-ba69-c09e0bd7afb7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f6e4a9a2-d2f9-9cdd-2661-92ef6f9204a5",
          "name": "Ascorbic acid 2-O-glucoside [WHO-DD]",
          "stdName": "ASCORBIC ACID 2-O-GLUCOSIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90d6f7af-e58c-38c3-4d4d-a7ef7c0a4bb8"
          ],
          "display_name": false
        },
        {
          "uuid": "6666a6ae-271c-4fb5-a1d1-eb581aebe93b",
          "name": "L-ASCORBIC ACID, 2-O-,.ALPHA.-D-GLUCOPYRANOSYL-",
          "stdName": "L-ASCORBIC ACID, 2-O-,.ALPHA.-D-GLUCOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4836462-957e-4747-8399-57fce26ef265",
            "c9a19f84-7813-4201-af06-4ab8da627989"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b4836462-957e-4747-8399-57fce26ef265",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c0b217e5-af18-4b59-85c2-dc2d1d8100cc",
          "citation": "DL CTFA",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9a19f84-7813-4201-af06-4ab8da627989",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53ea40d9-7f97-4d89-aee2-0a5e7a759d66",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8583b73c-e3cb-4def-bc88-3905ac58972b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1a1549e-b4e1-4fcc-95bf-1aa4574aefce",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d0aace4-2b37-4d27-a7ad-a946fde53d39",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391125000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24ca908d-7ab3-499d-8aea-e774777f669c",
          "citation": "SRS import [2V52R0NHXW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2V52R0NHXW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391125000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce069e18-4aca-4f1a-b015-b186be30c760",
          "citation": "ASCORBYL GLUCOSIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fa888102-cd39-4097-aecf-9d9f611c4ab6",
          "citation": "ASCORBIC ACID 2-O-GLUCOSIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3a78d7e0-6c23-4691-4b6a-8b450d998174",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "2b496632-3603-e355-58e0-da93ca6b5664",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "873f69be-5c81-4808-8331-01f815d896f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "90d6f7af-e58c-38c3-4d4d-a7ef7c0a4bb8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d826bb52-7544-f97b-8dde-ee064d0093ba",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "01d92c2b-dcb0-6d3f-0a22-d7577c03a8bc",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "da56ef68-8783-4471-b999-091d3461c451",
          "id": "da56ef68-8783-4471-b999-091d3461c451",
          "molfile": "\n  Marvin  01132111192D          \n\n 23 24  0  0  1  0            999 V2000\n   -1.8511   -2.1755    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -1.9085   -1.2659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6581   -2.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2100   -1.7339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2991   -2.7886    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -0.8865   -3.5030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0795   -3.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5336   -3.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0067   -2.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7211   -2.0985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4356   -2.5110    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.4356   -3.3360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1500   -3.7485    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.1500   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4356   -4.9860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8645   -3.3360    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.5790   -3.7485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8645   -2.5110    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.5790   -2.0985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1500   -2.0985    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.1500   -1.2735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7470   -2.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9185   -1.3685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 22  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 22  1  0  0  0  0\n 11 10  1  6  0  0  0\n 11 12  1  0  0  0  0\n 20 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\n 16 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  6  0  0  0\n 23 22  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@@H]1C(=O)C(=C(O)O1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)O",
          "formula": "C12H18O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "12ff608f-ff64-4bdf-a77a-360b9dd340a6"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "338.2652",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "89d6e66a-bed9-4ee9-8dc5-78b5e1191e5a",
      "version": "10",
      "structure": {
        "id": "01ac5fac-5141-4625-a95b-b46b669aad8c",
        "molfile": "\n  Marvin  01132100242D          \n\n 24 25  0  0  1  0            999 V2000\n   -0.7470   -2.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0067   -2.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0795   -3.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5336   -3.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8865   -3.5030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2991   -2.7886    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.8511   -2.1755    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -1.9085   -1.2659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6581   -2.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2100   -1.7339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9664   -3.2735    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7211   -2.0985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4356   -2.5110    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.4356   -3.3360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1500   -3.7485    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.8645   -3.3360    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8645   -2.5110    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.1500   -2.0985    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.1500   -1.2735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5790   -2.0985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5790   -3.7485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1500   -4.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4356   -4.9860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9185   -1.3685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  6  0  0  0\n 10  9  1  0  0  0  0\n  6 11  1  1  0  0  0\n 12  2  1  0  0  0  0\n 13 12  1  6  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 18 19  1  6  0  0  0\n 17 20  1  1  0  0  0\n 16 21  1  6  0  0  0\n 15 22  1  1  0  0  0\n 23 22  1  0  0  0  0\n 24  1  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]([C@]1([H])C(=C(C(=O)O1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)O)O",
        "formula": "C12H18O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "338.2652",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b4836462-957e-4747-8399-57fce26ef265",
          "24ca908d-7ab3-499d-8aea-e774777f669c"
        ],
        "stereo_centers": 7
      },
      "unii": "2V52R0NHXW"
    }
  ]
}