{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "92851afa-428d-4025-85f9-af5a8fa93952",
          "code": "66332-96-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=66332-96-5",
          "code_system": "CAS",
          "references": [
            "4b3c39e2-91b2-4605-8d2d-3cba96ae22c0",
            "16acac59-3acb-45ba-90f1-ab5f4066afc5"
          ]
        },
        {
          "uuid": "ab8e2866-3117-49e6-9651-2635d1815e97",
          "code": "C475882",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67475882",
          "code_system": "MESH",
          "references": [
            "4b3c39e2-91b2-4605-8d2d-3cba96ae22c0"
          ]
        },
        {
          "uuid": "f6e752c5-dd9d-47b7-abb4-ad6d7d3b2add",
          "code": "128975",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2413",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "4b3c39e2-91b2-4605-8d2d-3cba96ae22c0"
          ]
        },
        {
          "uuid": "57e75f06-1d0d-4926-b7c3-b3de1e24476c",
          "code": "m5511",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5511?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4b3c39e2-91b2-4605-8d2d-3cba96ae22c0"
          ]
        },
        {
          "uuid": "6e13d734-1a35-49f5-9233-f1aef93e1285",
          "code": "47898",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/47898",
          "code_system": "PUBCHEM",
          "references": [
            "4b3c39e2-91b2-4605-8d2d-3cba96ae22c0"
          ]
        },
        {
          "uuid": "3bcd9d41-493c-37e6-1e5b-483f2fe28017",
          "code": "DTXSID8024109",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8024109",
          "code_system": "EPA CompTox",
          "references": [
            "adafd131-6d31-3a0b-80ff-49679f37a4c4"
          ]
        },
        {
          "uuid": "f04d271b-4995-412d-8031-84e07f6c714e",
          "code": "2USL6Y9JZ4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e1e3dbfa-956a-659c-c950-c809e8cb3763",
          "code": "81792",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81792",
          "code_system": "CHEBI",
          "references": [
            "4e632d29-c1a8-f5b3-24a7-6e4999df0236"
          ]
        },
        {
          "uuid": "1f10f58d-97ff-a563-a2bf-61691ab50d4e",
          "code": "flutolanil",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/flutolanil.html",
          "code_system": "ALANWOOD",
          "references": [
            "fb09af8c-bde5-1798-d337-9467dbef5200"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eacf7ebe-e046-4b12-8f2c-f93a0ed4ab3f",
          "name": ".ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-3'-ISOPROPOXY-O-TOLUANILIDE",
          "stdName": ".ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-3'-ISOPROPOXY-O-TOLUANILIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "174f23a1-49fc-41fd-8133-c2516c44b7ce",
            "02821f6b-6baf-4501-8f97-51d3114f39ff"
          ],
          "display_name": false
        },
        {
          "uuid": "859fdda6-0ddf-4462-be72-349dea44b163",
          "name": "FLUTOLANIL",
          "stdName": "FLUTOLANIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ca396b9-d117-431b-9705-dfa84879792c",
            "b1f41237-b03b-45d1-90f0-f6b5580b98be",
            "87517726-3cfe-42b2-adb9-b5fb844a11b4",
            "4a93edb6-459c-4f51-9efd-3fc7fce70b53",
            "168d61b6-fe8c-4a23-9917-c7ed745705f4",
            "60eee95e-4fb0-4126-abb7-8e62fdf91cd7"
          ],
          "display_name": true
        },
        {
          "uuid": "12880820-1a87-4129-ab94-571c877a27b2",
          "name": "FLUTOLANIL [ISO]",
          "stdName": "FLUTOLANIL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1f41237-b03b-45d1-90f0-f6b5580b98be",
            "60eee95e-4fb0-4126-abb7-8e62fdf91cd7"
          ],
          "display_name": false
        },
        {
          "uuid": "149fb21f-ecec-4e5d-bcb9-9cafea5de418",
          "name": "FLUTOLANIL [MI]",
          "stdName": "FLUTOLANIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ca396b9-d117-431b-9705-dfa84879792c",
            "60eee95e-4fb0-4126-abb7-8e62fdf91cd7"
          ],
          "display_name": false
        },
        {
          "uuid": "a9a950f5-90f9-4124-92d2-f73daa3709fe",
          "name": "MONCUT",
          "stdName": "MONCUT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c2df179-694b-4420-977f-b5c4d207feb6",
            "60eee95e-4fb0-4126-abb7-8e62fdf91cd7"
          ],
          "display_name": false
        },
        {
          "uuid": "0e902182-5665-4b78-b9bb-d7a20c415cc2",
          "name": "N-(3-(1-METHYLETHOXY)PHENYL)-2-(TRIFLUOROMETHYL)BENZAMIDE",
          "stdName": "N-(3-(1-METHYLETHOXY)PHENYL)-2-(TRIFLUOROMETHYL)BENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "174f23a1-49fc-41fd-8133-c2516c44b7ce",
            "86c17a5e-b1f1-4375-959e-4c1f73c3b15c"
          ],
          "display_name": false
        },
        {
          "uuid": "c1ad198c-c23c-4816-8c06-c7f509a57d5e",
          "name": "NNF-136",
          "stdName": "NNF-136",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2301ba8-8f18-4982-ad24-518cc5516ffe",
            "60eee95e-4fb0-4126-abb7-8e62fdf91cd7"
          ],
          "display_name": false
        },
        {
          "uuid": "8592db5c-b964-4742-8af0-1c692b2ab535",
          "name": "O-TRIFLUOROMETHYL-M'-ISOPROPOXYBENZOIC ANILIDE",
          "stdName": "O-TRIFLUOROMETHYL-M'-ISOPROPOXYBENZOIC ANILIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2301ba8-8f18-4982-ad24-518cc5516ffe",
            "60eee95e-4fb0-4126-abb7-8e62fdf91cd7"
          ],
          "display_name": false
        },
        {
          "uuid": "e4dceb6a-19ee-4416-86f6-5022c5a7f042",
          "name": "PROSTAR",
          "stdName": "PROSTAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c2df179-694b-4420-977f-b5c4d207feb6",
            "60eee95e-4fb0-4126-abb7-8e62fdf91cd7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "168d61b6-fe8c-4a23-9917-c7ed745705f4",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "174f23a1-49fc-41fd-8133-c2516c44b7ce",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02821f6b-6baf-4501-8f97-51d3114f39ff",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86c17a5e-b1f1-4375-959e-4c1f73c3b15c",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ca396b9-d117-431b-9705-dfa84879792c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60eee95e-4fb0-4126-abb7-8e62fdf91cd7",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2301ba8-8f18-4982-ad24-518cc5516ffe",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c2df179-694b-4420-977f-b5c4d207feb6",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1f41237-b03b-45d1-90f0-f6b5580b98be",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b3c39e2-91b2-4605-8d2d-3cba96ae22c0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29cd46bc-86a6-4ec0-9450-635bfba6cfbc",
          "citation": "SRS import [2USL6Y9JZ4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2USL6Y9JZ4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b4d075e-2e28-419f-b720-edae6fad50ac",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87517726-3cfe-42b2-adb9-b5fb844a11b4",
          "citation": "FLUTOLANIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4a93edb6-459c-4f51-9efd-3fc7fce70b53",
          "citation": "FLUTOLANIL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "adafd131-6d31-3a0b-80ff-49679f37a4c4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=66332-96-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fb09af8c-bde5-1798-d337-9467dbef5200",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4e632d29-c1a8-f5b3-24a7-6e4999df0236",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "16acac59-3acb-45ba-90f1-ab5f4066afc5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b7548cea-fc6a-4f98-8f6a-fd3158a04f65",
          "id": "b7548cea-fc6a-4f98-8f6a-fd3158a04f65",
          "molfile": "\n  Marvin  01132109292D          \n\n 23 24  0  0  0  0            999 V2000\n    2.8697   -5.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5842   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5842   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2987   -5.4612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0131   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0131   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7276   -7.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4421   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4421   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1565   -5.4612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8710   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8710   -6.6987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5855   -5.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5855   -4.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2999   -4.2237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0144   -4.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0144   -5.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2999   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2999   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0969   -6.9122    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4781   -6.6268    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1567   -7.5112    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7276   -5.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 23  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 23  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)Oc1cccc(c1)NC(=O)c2ccccc2C(F)(F)F",
          "formula": "C17H16F3NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "53191eec-f023-4e8a-ba02-86dadf7a952c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "323.3103",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ad900737-c6f9-40b2-88b6-1a54dba196b7",
      "version": "5",
      "structure": {
        "id": "19ae6d3e-28c0-4d62-81d8-e49b7ff5ae62",
        "molfile": "\n  Marvin  01132101312D          \n\n 23 24  0  0  0  0            999 V2000\n    8.5855   -5.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2999   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0144   -5.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0144   -4.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2999   -4.2237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5855   -4.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2999   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0969   -6.9122    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4781   -6.6268    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1567   -7.5112    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8710   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1565   -5.4612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4421   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7276   -5.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0131   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0131   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7276   -7.1112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4421   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2987   -5.4612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5842   -5.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8697   -5.4612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5842   -6.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8710   -6.6987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 13 18  2  0  0  0  0\n 15 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 11 23  2  0  0  0  0\nM  END",
        "smiles": "CC(C)Oc1cccc(c1)NC(=O)c2ccccc2C(F)(F)F",
        "formula": "C17H16F3NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "323.3103",
        "optical_activity": "NONE",
        "references": [
          "9b4d075e-2e28-419f-b720-edae6fad50ac",
          "29cd46bc-86a6-4ec0-9450-635bfba6cfbc"
        ],
        "stereo_centers": 0
      },
      "unii": "2USL6Y9JZ4"
    }
  ]
}