{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "30c28933-5eaa-e656-c1f8-56424a2b03c5", "code": "3691-11-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3691-11-0", "code_system": "CAS", "references": [ "8d5051f0-49c5-4305-bfd0-2c115874a76f" ] }, { "uuid": "524a8796-6c5e-0839-b533-787de13a1645", "code": "94275", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94275", "code_system": "PUBCHEM", "references": [ "283d0b37-3fac-982b-7d03-4481b95d585b" ] }, { "uuid": "bcce6e0f-2eb4-625c-5ea1-9572a99b151c", "code": "DTXSID30190387", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30190387", "code_system": "EPA CompTox", "references": [ "cdff092b-efbc-c6a5-e881-412617fd2cd3" ] }, { "uuid": "51b31205-e17a-4770-8143-e2290ede9333", "code": "2U8L6FYE8U", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "1f1c3860-b170-15a4-bdbb-b12cc28619e9", "name": "(3R,3AS,5S)-3,8-DIMETHYL-5-PROP-1-EN-2-YL-1,2,3,3A,4,5,6,7-OCTAHYDROAZULENE", "stdName": "(3R,3AS,5S)-3,8-DIMETHYL-5-PROP-1-EN-2-YL-1,2,3,3A,4,5,6,7-OCTAHYDROAZULENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ed5ed2e8-19a0-6b98-0f9b-105279599df3" ], "display_name": false }, { "uuid": "7ac88a3b-5d30-4983-a1c8-9e4373c4d4a5", "name": ".ALPHA.-BULNESENE", "stdName": ".ALPHA.-BULNESENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8d5051f0-49c5-4305-bfd0-2c115874a76f" ], "display_name": false }, { "uuid": "2b6fad6c-7e85-4bb7-8307-1cebf0866ef0", "name": ".DELTA.-BULNESENE", "stdName": ".DELTA.-BULNESENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8d5051f0-49c5-4305-bfd0-2c115874a76f" ], "display_name": false }, { "uuid": "5ceb48ca-2ac5-4c1f-8131-7fd37fd8fda9", "name": ".DELTA.-GUAIENE", "stdName": ".DELTA.-GUAIENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8d5051f0-49c5-4305-bfd0-2c115874a76f" ], "display_name": true }, { "uuid": "fdaed6a9-ea3e-484e-8717-09046a58e28f", "name": "AZULENE, 1,2,3,5,6,7,8,8A-OCTAHYDRO-1,4-DIMETHYL-7-(1-METHYLETHENYL)-, (1S,7R,8AS)-", "stdName": "AZULENE, 1,2,3,5,6,7,8,8A-OCTAHYDRO-1,4-DIMETHYL-7-(1-METHYLETHENYL)-, (1S,7R,8AS)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8d5051f0-49c5-4305-bfd0-2c115874a76f" ], "display_name": false } ], "references": [ { "uuid": "283d0b37-3fac-982b-7d03-4481b95d585b", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "ed5ed2e8-19a0-6b98-0f9b-105279599df3", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "8d5051f0-49c5-4305-bfd0-2c115874a76f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "cdff092b-efbc-c6a5-e881-412617fd2cd3", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "92453091-337a-42e9-a02b-c38fadecf98a", "id": "92453091-337a-42e9-a02b-c38fadecf98a", "molfile": "\n Marvin 12202115242D \n\n 16 17 0 0 1 0 999 V2000\n 3.8191 3.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3180 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8158 3.1195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1172 3.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 2.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7795 2.1437 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.7795 1.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1345 2.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5641 2.3986 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.1345 0.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5641 1.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3302 2.4745 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.0490 1.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3302 0.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9722 1.7312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9268 2.9554 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9 1 1 1 0 0 0\n 2 10 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 2 0 0 0 0\n 12 3 1 1 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 6 16 1 6 0 0 0\n 7 10 2 0 0 0 0\n 7 11 1 0 0 0 0\n 8 12 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 15 1 0 0 0 0\n 14 15 1 0 0 0 0\nM END", "smiles": "C=C(C)[C@@H]1CCC(=C2CC[C@H](C)[C@]2([H])C1)C", "formula": "C15H24", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "eb17477e-5f30-483c-b425-082970324758" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "204.3516", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "43e89ab4-ea7f-4625-83c5-7883df8f2fb8", "version": "8", "structure": { "id": "32f6ec94-dda2-488c-b93a-cab76fc4a08c", "molfile": "\n JSDraw212202115242D\n\n 16 17 0 0 1 0 0 V2000\n 28.5613 -5.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.7230 -11.3714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8824 -5.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4523 -4.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3398 -5.7052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5956 -7.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5956 -8.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3760 -6.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0792 -6.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3760 -9.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0792 -9.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8551 -6.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9962 -8.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8551 -9.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1782 -8.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.8742 -5.7830 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9 1 1 1 0 0 0\n 2 10 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 2 0 0 0 0\n 12 3 1 1 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 6 16 1 6 0 0 0\n 7 10 2 0 0 0 0\n 7 11 1 0 0 0 0\n 8 12 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 15 1 0 0 0 0\n 14 15 1 0 0 0 0\nM END", "smiles": "C=C(C)[C@@H]1CCC(=C2CC[C@H](C)[C@]2([H])C1)C", "formula": "C15H24", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "204.3516", "optical_activity": "UNSPECIFIED", "references": [ "ed5ed2e8-19a0-6b98-0f9b-105279599df3" ], "stereo_centers": 3 }, "modifications": { "uuid": "7d9574e9-cb77-41eb-b693-ec6697755305" }, "unii": "2U8L6FYE8U" } ] }