{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "4eaed71e-97d1-4738-b4fd-d9412f6d699b", "code": "14170-43-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=14170-43-5", "code_system": "CAS", "references": [ "a2831406-7088-4772-af95-494761099312", "1fbec5d1-e30a-4469-8d82-f45cd1efd4a2" ] }, { "uuid": "9421d7d5-730e-45b9-a1fa-f193b6783637", "code": "238-014-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.034.543", "code_system": "ECHA (EC/EINECS)", "references": [ "a2831406-7088-4772-af95-494761099312" ] }, { "uuid": "d27e4abb-2517-4140-92be-99bedd3def40", "code": "84232", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/84232", "code_system": "PUBCHEM", "references": [ "a2831406-7088-4772-af95-494761099312" ] }, { "uuid": "204eb7c2-8ff7-485a-b7a2-db6aadec1a2b", "code": "2U5SV2A4DH", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7a45a7af-bb42-486b-9404-08c9b723cd92", "code": "52085-24-2", "type": "NON-SPECIFIC STOICHIOMETRY", "url": "https://commonchemistry.cas.org/detail?cas_rn=52085-24-2", "code_system": "CAS", "references": [ "1fbec5d1-e30a-4469-8d82-f45cd1efd4a2" ] }, { "uuid": "d58b4c23-0e0e-1c20-dfb7-cb5042812e65", "code": "DTXSID10966446", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10966446", "code_system": "EPA CompTox" }, { "uuid": "0e56706c-c3f7-581b-1d09-291fb99f9b62", "code": "9836", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9836", "code_system": "NSC", "references": [ "5c809bbb-74bd-3995-6488-c5b0bcd70d94" ] } ], "relationships": [ { "uuid": "97449866-7d93-48a7-b24b-3d287a04e9a5", "amount": { "uuid": "bed3ebde-9a7e-4fd3-8ac3-38db17afcd2e" }, "type": "PARENT->SALT/SOLVATE", "references": [ "1fbec5d1-e30a-4469-8d82-f45cd1efd4a2" ], "related_substance": { "uuid": "c497d429-4b00-4c0e-8f28-b2b22d142d0a", "refuuid": "01fc5203-383a-43e8-acd7-cadd81bf0690", "name": "3-AMINO-1,5-NAPHTHALENEDISULFONIC ACID", "unii": "X5M28DHP3K", "linking_id": "X5M28DHP3K", "ref_pname": "3-AMINO-1,5-NAPHTHALENEDISULFONIC ACID", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "a511143a-d588-4a73-a7eb-184eb6d41bfb", "name": "1,5-NAPHTHALENEDISULFONIC ACID, 3-AMINO-, SODIUM SALT (1:2)", "stdName": "1,5-NAPHTHALENEDISULFONIC ACID, 3-AMINO-, SODIUM SALT (1:2)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1fbec5d1-e30a-4469-8d82-f45cd1efd4a2" ], "display_name": false }, { "uuid": "d1bfaad7-0cbb-40b0-8bef-b2051e7819ef", "name": "DISODIUM 3-AMINO-1,5-NAPHTHALENEDISULFONATE", "stdName": "DISODIUM 3-AMINO-1,5-NAPHTHALENEDISULFONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1fbec5d1-e30a-4469-8d82-f45cd1efd4a2" ], "display_name": true }, { "uuid": "fd38d125-d5a6-00c6-2155-d3b709846cd7", "name": "NSC-9836", "stdName": "NSC-9836", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "5c809bbb-74bd-3995-6488-c5b0bcd70d94" ], "display_name": false } ], "references": [ { "uuid": "6cfde421-4e3a-40a5-9813-cb3fd359871c", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a2831406-7088-4772-af95-494761099312", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392230000, "tags": [ "NOMEN" ] }, { "uuid": "5c809bbb-74bd-3995-6488-c5b0bcd70d94", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "1fbec5d1-e30a-4469-8d82-f45cd1efd4a2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "770d68e2-23b6-41f5-800b-335c84fccbab", "id": "770d68e2-23b6-41f5-800b-335c84fccbab", "molfile": "\n Marvin 07142113592D \n\n 1 0 0 0 0 0 999 V2000\n 7.9750 -4.1025 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "42a15763-aba2-4026-8739-7eeae166228b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "277bb4cf-15c7-45e7-9264-ca25b5b574b5", "id": "277bb4cf-15c7-45e7-9264-ca25b5b574b5", "molfile": "\n Marvin 07142113592D \n\n 19 20 0 0 0 0 999 V2000\n 12.2936 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5791 -3.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5791 -4.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2936 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0080 -4.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7226 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4370 -4.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4370 -3.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7226 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0080 -3.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7226 -1.5950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5476 -2.4200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8976 -2.4200 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 13.7226 -2.4200 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2936 -6.5450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4686 -5.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1186 -5.7200 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 12.2936 -5.7200 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1514 -4.8950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 10 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 18 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 10 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 7 19 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 14 9 1 0 0 0 0\n 14 11 2 0 0 0 0\n 14 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 18 15 2 0 0 0 0\n 18 16 2 0 0 0 0\n 18 17 1 0 0 0 0\nM CHG 2 13 -1 17 -1\nM END", "smiles": "c1cc2c(cc(cc2S(=O)(=O)[O-])N)c(c1)S(=O)(=O)[O-]", "formula": "C10H7NO6S2", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ef2ef472-0679-4da9-80e9-0d30639bf724" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "301.2982", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "95d91dfb-eb2e-4b80-b822-c0a8f1547ca2", "version": "11", "structure": { "id": "7449ff99-0678-4ac4-ae60-f16582e50c5a", "molfile": "1,5-Naphthalenedisulfonic acid, 3-amino-, sodium salt (1:?)\n JSDraw207142113592D\n\n 21 20 0 0 0 0 0 V2000\n 23.2460 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8951 -6.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8951 -8.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2460 -9.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5970 -8.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9481 -9.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2990 -8.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2990 -6.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9481 -6.1360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5970 -6.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9481 -3.0160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5081 -4.5760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3881 -4.5760 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 25.9481 -4.5760 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2461 -12.3760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6860 -10.8160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8060 -10.8160 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 23.2460 -10.8160 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6500 -9.2560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0800 -7.7575 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 15.0800 -7.7575 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 10 5 1 0 0 0 0\n 1 10 1 0 0 0 0\n 14 11 2 0 0 0 0\n 14 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 9 1 0 0 0 0\n 18 15 2 0 0 0 0\n 18 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 18 4 1 0 0 0 0\n 7 19 1 0 0 0 0\nM STY 1 1 MUL\nM SAL 1 2 20 21\nM SPA 1 1 20\nM SDI 1 4 13.8840 -8.7975 13.8840 -6.7175\nM SDI 1 4 16.7440 -6.7175 16.7440 -8.7975\nM SMT 1 2\nM CHG 4 13 -1 17 -1 20 1 21 1\nM END", "smiles": "c1cc2c(cc(cc2S(=O)(=O)[O-])N)c(c1)S(=O)(=O)[O-].[Na+].[Na+]", "formula": "C10H7NO6S2.2Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "347.2778", "optical_activity": "NONE", "references": [ "6cfde421-4e3a-40a5-9813-cb3fd359871c", "1fbec5d1-e30a-4469-8d82-f45cd1efd4a2" ], "stereo_centers": 0 }, "unii": "2U5SV2A4DH" } ] }