{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8636e9d8-6f8e-4ea3-a471-1d364d3b424f", "code": "58872-39-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=58872-39-2", "code_system": "CAS", "references": [ "c3f09e32-6b3c-4966-b82d-7a2c01ed134e", "42f63fa3-268c-4732-9e03-dd5b2aef0073" ] }, { "uuid": "056f456e-2eaf-401f-bb8d-b7430fe61d64", "code": "9818200", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9818200", "code_system": "PUBCHEM", "references": [ "c3f09e32-6b3c-4966-b82d-7a2c01ed134e" ] }, { "uuid": "88c0b447-7bf8-4dd8-8caf-38a56fd1f480", "code": "2U1R84870F", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "472df5ad-f335-9fb6-5172-1c044060a276", "code": "73696", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:73696", "code_system": "CHEBI", "references": [ "f47f3c76-97d8-4c92-33f4-5e90b1349338" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0e020da6-bb47-495a-8dfe-6ea394e4e067", "name": "L-PROLINE, 1-(1-L-VALYL-L-PROLYL)-", "stdName": "L-PROLINE, 1-(1-L-VALYL-L-PROLYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f1cb5a9f-94fb-46f5-af47-b5c42fea9a71", "0317dbdc-bba7-4a1b-bce8-ed6253efa77a" ], "display_name": false }, { "uuid": "d6e6165d-d193-4b6b-a770-4061f488220a", "name": "L-PROLINE, L-VALYL-L-PROLYL-", "stdName": "L-PROLINE, L-VALYL-L-PROLYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f1cb5a9f-94fb-46f5-af47-b5c42fea9a71", "0317dbdc-bba7-4a1b-bce8-ed6253efa77a" ], "display_name": false }, { "uuid": "c3e78f51-12d4-4eb3-b2bc-43e347b35c22", "name": "L-VALYL-L-PROLYL-L-PROLINE", "stdName": "L-VALYL-L-PROLYL-L-PROLINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f1cb5a9f-94fb-46f5-af47-b5c42fea9a71", "0317dbdc-bba7-4a1b-bce8-ed6253efa77a" ], "display_name": false }, { "uuid": "84205176-4b7d-4f50-a4f5-ff6495886400", "name": "VAL-PRO-PRO", "stdName": "VAL-PRO-PRO", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "114964db-bc97-496d-a7f0-213b07fbb734", "0317dbdc-bba7-4a1b-bce8-ed6253efa77a" ], "display_name": true } ], "references": [ { "uuid": "f1cb5a9f-94fb-46f5-af47-b5c42fea9a71", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0317dbdc-bba7-4a1b-bce8-ed6253efa77a", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "114964db-bc97-496d-a7f0-213b07fbb734", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c3f09e32-6b3c-4966-b82d-7a2c01ed134e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392049000, "tags": [ "NOMEN" ] }, { "uuid": "9e631883-6d9c-4690-b895-0773e6dc36d1", "citation": "SRS import [2U1R84870F]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2U1R84870F", "doc_type": "SRS", "public_domain": true, "document_date": 1493392049000, "tags": [ "NOMEN" ] }, { "uuid": "42f63fa3-268c-4732-9e03-dd5b2aef0073", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "f47f3c76-97d8-4c92-33f4-5e90b1349338", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c5ab30e3-4a1a-4d15-951c-5356769de92a", "id": "c5ab30e3-4a1a-4d15-951c-5356769de92a", "molfile": "\n Marvin 01132110132D \n\n 22 23 0 0 1 0 999 V2000\n 3.8498 -6.3416 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 3.8498 -7.1662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1352 -5.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1352 -5.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4206 -6.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5644 -5.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5644 -5.1048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2790 -6.3416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3615 -7.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1586 -7.3311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5709 -6.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0211 -6.0118 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.1861 -5.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5814 -4.6650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9832 -4.9674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6428 -5.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3299 -4.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0551 -4.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2305 -4.1703 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.7632 -3.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9387 -3.5931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0931 -2.7410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 6 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 6 1 0 0 0 0\n 8 9 1 0 0 0 0\n 12 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 6 0 0 0\n 13 14 2 0 0 0 0\n 15 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 19 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 6 0 0 0\n 20 21 1 0 0 0 0\n 20 22 2 0 0 0 0\nM END", "smiles": "CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N2CCC[C@H]2C(=O)O)N", "formula": "C15H25N3O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "89e7b5de-437b-42e9-9053-eba25fb7c6d6" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "311.3773", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "f6dd5a8e-a66a-4777-bf6a-b93cee9e2318", "version": "4", "structure": { "id": "42d00105-5259-4f86-aeb9-f092ff320094", "molfile": "\n Marvin 01132103312D \n\n 22 23 0 0 1 0 999 V2000\n 6.7632 -3.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2305 -4.1703 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.9832 -4.9674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6428 -5.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3299 -4.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0551 -4.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1861 -5.2147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0211 -6.0118 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.2790 -6.3416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3615 -7.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1586 -7.3311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5709 -6.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5644 -5.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8498 -6.3416 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.8498 -7.1662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1352 -5.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1352 -5.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4206 -6.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5644 -5.1048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5814 -4.6650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9387 -3.5931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0931 -2.7410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 6 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 2 6 1 0 0 0 0\n 6 5 1 0 0 0 0\n 3 7 1 0 0 0 0\n 8 7 1 6 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 8 12 1 0 0 0 0\n 12 11 1 0 0 0 0\n 9 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 1 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 13 19 2 0 0 0 0\n 7 20 2 0 0 0 0\n 1 21 2 0 0 0 0\n 1 22 1 0 0 0 0\nM END", "smiles": "CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)N2CCC[C@H]2C(=O)O)N", "formula": "C15H25N3O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "311.3773", "optical_activity": "UNSPECIFIED", "references": [ "9e631883-6d9c-4690-b895-0773e6dc36d1", "f1cb5a9f-94fb-46f5-af47-b5c42fea9a71" ], "stereo_centers": 3 }, "unii": "2U1R84870F" } ] }