{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "70803b71-c68f-4cac-8e31-c71b22804290",
          "code": "65731-84-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=65731-84-2",
          "code_system": "CAS",
          "references": [
            "bf2a9bc2-7076-4782-8e89-5d09c5afb29f",
            "42dddfec-781e-48ef-a30f-9251c5bf5af6"
          ]
        },
        {
          "uuid": "f78409f7-ae3f-4773-9c63-a2601626a33f",
          "code": "265-898-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.059.890",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bf2a9bc2-7076-4782-8e89-5d09c5afb29f"
          ]
        },
        {
          "uuid": "de92ea86-cf7e-4164-b746-3343326e6cfa",
          "code": "93357",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/93357",
          "code_system": "PUBCHEM",
          "references": [
            "bf2a9bc2-7076-4782-8e89-5d09c5afb29f"
          ]
        },
        {
          "uuid": "6573f6f9-c41f-adbd-e49a-60bfe448b9d8",
          "code": "DTXSID80274146",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80274146",
          "code_system": "EPA CompTox",
          "references": [
            "5843e920-f862-e3cc-dfbc-fd153d695147"
          ]
        },
        {
          "uuid": "a9028578-2a8d-4ec3-b44e-b7e5bcea74d6",
          "code": "2TF5M1O25X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e31ce6b0-2122-40a9-8f53-5a0fad5d42b4",
          "name": "CYCLOPROPANECARBOXYLIC ACID, 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYL-, (S)-CYANO(3-PHENOXYPHENYL)METHYL ESTER, (1R,3R)-",
          "stdName": "CYCLOPROPANECARBOXYLIC ACID, 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYL-, (S)-CYANO(3-PHENOXYPHENYL)METHYL ESTER, (1R,3R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0601b3fb-d44b-4532-9d4c-aa2c9accb005",
            "93b3cb4a-1350-43f5-908f-b33055a116fd"
          ],
          "display_name": false
        },
        {
          "uuid": "b5f5c33c-2db0-4a0e-8eba-72307c411237",
          "name": "CYCLOPROPANECARBOXYLIC ACID, 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYL-, (S)-CYANO(3-PHENOXYPHENYL)METHYL ESTER, (1R,3R)-(+)-",
          "stdName": "CYCLOPROPANECARBOXYLIC ACID, 3-(2,2-DICHLOROETHENYL)-2,2-DIMETHYL-, (S)-CYANO(3-PHENOXYPHENYL)METHYL ESTER, (1R,3R)-(+)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13aec415-70a2-4909-8d96-eb42869efd4a",
            "0601b3fb-d44b-4532-9d4c-aa2c9accb005"
          ],
          "display_name": false
        },
        {
          "uuid": "199dea3a-6259-44d5-84e8-8af5a48c5813",
          "name": "CYPERMETHRIN, S(1R,3R)-",
          "stdName": "CYPERMETHRIN, S(1R,3R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13aec415-70a2-4909-8d96-eb42869efd4a",
            "0601b3fb-d44b-4532-9d4c-aa2c9accb005"
          ],
          "display_name": true
        },
        {
          "uuid": "3ec71148-3ac0-4474-b4e7-b993f719cb40",
          "name": "NRDC-168S",
          "stdName": "NRDC-168S",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0601b3fb-d44b-4532-9d4c-aa2c9accb005",
            "93b3cb4a-1350-43f5-908f-b33055a116fd"
          ],
          "display_name": false
        },
        {
          "uuid": "c4fa5930-98d5-46d7-a8d2-0784f6b0fc7b",
          "name": "RU-24501",
          "stdName": "RU-24501",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0601b3fb-d44b-4532-9d4c-aa2c9accb005",
            "93b3cb4a-1350-43f5-908f-b33055a116fd"
          ],
          "display_name": false
        },
        {
          "uuid": "a4bce8ad-4bd7-4b87-bcc2-7f4fc9f7c320",
          "name": "WL-48281",
          "stdName": "WL-48281",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0601b3fb-d44b-4532-9d4c-aa2c9accb005",
            "93b3cb4a-1350-43f5-908f-b33055a116fd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "93b3cb4a-1350-43f5-908f-b33055a116fd",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0601b3fb-d44b-4532-9d4c-aa2c9accb005",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13aec415-70a2-4909-8d96-eb42869efd4a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf2a9bc2-7076-4782-8e89-5d09c5afb29f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392162000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be16319c-baf3-4ef2-b93a-946aa2f51713",
          "citation": "SRS import [2TF5M1O25X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2TF5M1O25X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392162000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5843e920-f862-e3cc-dfbc-fd153d695147",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=65731-84-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "42dddfec-781e-48ef-a30f-9251c5bf5af6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4b465506-5822-438b-8a50-2f8ff90299a1",
          "id": "4b465506-5822-438b-8a50-2f8ff90299a1",
          "molfile": "\n  Marvin  01132103562D          \n\n 28 30  0  0  1  0            999 V2000\n    8.9925   -5.4790    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.2781   -5.0665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5636   -5.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5636   -6.3040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8491   -5.0665    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.0241   -5.0665    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.3097   -5.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5952   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5952   -4.2415    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.8808   -5.4790    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.4367   -4.3520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8047   -3.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0687   -3.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9925   -6.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9925   -7.1290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7070   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7070   -4.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4215   -3.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1360   -4.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1360   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8505   -5.4790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5650   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2794   -5.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9939   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9939   -4.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2794   -3.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5650   -4.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4215   -5.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 14  1  0  0  0  0\n  1 16  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  6  0  0  0\n  6  5  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 11  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 15  3  0  0  0  0\n 16 17  1  0  0  0  0\n 16 28  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 28 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)O[C@H](C#N)c2cccc(c2)Oc3ccccc3",
          "formula": "C22H19Cl2NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4590fcf3-6faf-4c87-8f83-4f5144b6c79c"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "416.2979",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c2d7723c-20a3-4398-95eb-91b3d47b7f63",
      "version": "4",
      "structure": {
        "id": "6e3e8e55-bb66-408c-bb44-d50b0a44f57d",
        "molfile": "\n  Marvin  01132105442D          \n\n 28 30  0  0  1  0            999 V2000\n    7.5636   -5.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8491   -5.0665    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4367   -4.3520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8047   -3.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0687   -3.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0241   -5.0665    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3097   -5.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5952   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5952   -4.2415    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.8808   -5.4790    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.5636   -6.3040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2781   -5.0665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9925   -5.4790    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.7070   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7070   -4.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4215   -3.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1360   -4.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1360   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8505   -5.4790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5650   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2794   -5.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9939   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9939   -4.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2794   -3.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5650   -4.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4215   -5.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9925   -6.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9925   -7.1290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  3  1  0  0  0  0\n  2  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  1 11  2  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 20 25  2  0  0  0  0\n 26 18  1  0  0  0  0\n 14 26  2  0  0  0  0\n 13 27  1  1  0  0  0\n 27 28  3  0  0  0  0\nM  END",
        "smiles": "CC1(C)[C@@H](C=C(Cl)Cl)[C@H]1C(=O)O[C@H](C#N)c2cccc(c2)Oc3ccccc3",
        "formula": "C22H19Cl2NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "416.2979",
        "optical_activity": "( + )",
        "references": [
          "93b3cb4a-1350-43f5-908f-b33055a116fd",
          "be16319c-baf3-4ef2-b93a-946aa2f51713"
        ],
        "stereo_centers": 3
      },
      "unii": "2TF5M1O25X"
    }
  ]
}