{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "efac9ef4-0479-4d36-8a77-0c8c9487c54b",
          "code": "68697-67-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68697-67-6",
          "code_system": "CAS",
          "references": [
            "ef85bdb8-181b-4dfe-b2fc-c90f94393c77",
            "83d8409d-cea8-4379-87be-32b5dd10f558"
          ]
        },
        {
          "uuid": "7c66e79c-aaf8-4636-b643-c158b1fe3531",
          "code": "20332432",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20332432",
          "code_system": "PUBCHEM",
          "references": [
            "ef85bdb8-181b-4dfe-b2fc-c90f94393c77"
          ]
        },
        {
          "uuid": "27ff04da-17c9-4cbe-84f6-cf8b2bdbebb0",
          "code": "2TCW7MIT5C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "39805d3a-3cb8-92db-900b-0de60cb6002d",
          "code": "DTXSID60988390",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60988390",
          "code_system": "EPA CompTox",
          "references": [
            "587f34a2-7362-fbe7-295a-b1ca4860e5f5"
          ]
        },
        {
          "uuid": "efdd3f25-39c2-965a-e1ef-49f2eb44f5fe",
          "code": "1920",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1920/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "9c4761cb-64b1-1d9e-5d1e-48f999164356"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a88f8a72-494e-4155-9f3f-0e1d0560589c",
          "name": "(±)-1-(3-(METHYLTHIO)-BUTYRYL)-2,6,6-TRIMETHYLCYCLOHEXENE",
          "stdName": "(+/-)-1-(3-(METHYLTHIO)-BUTYRYL)-2,6,6-TRIMETHYLCYCLOHEXENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d884d93b-e99c-4824-9844-8c560c2bcbc8",
            "35b18381-7091-452f-8a35-9515549cbc06"
          ],
          "display_name": false
        },
        {
          "uuid": "8d8a300d-c686-4258-9f64-54d43109174a",
          "name": "1-(3-(METHYLTHIO)-BUTYRYL)-2,6,6-TRIMETHYLCYCLOHEXENE",
          "stdName": "1-(3-(METHYLTHIO)-BUTYRYL)-2,6,6-TRIMETHYLCYCLOHEXENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d884d93b-e99c-4824-9844-8c560c2bcbc8",
            "1efdf5d2-6b2e-4a13-8a0b-860d211b2c0f"
          ],
          "display_name": true
        },
        {
          "uuid": "58c1e0a2-984e-4a49-ab78-3ee32b150a95",
          "name": "1-(3-(METHYLTHIO)-BUTYRYL)-2,6,6-TRIMETHYLCYCLOHEXENE, (±)-",
          "stdName": "1-(3-(METHYLTHIO)-BUTYRYL)-2,6,6-TRIMETHYLCYCLOHEXENE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d884d93b-e99c-4824-9844-8c560c2bcbc8",
            "35b18381-7091-452f-8a35-9515549cbc06"
          ],
          "display_name": false
        },
        {
          "uuid": "3f1d27b0-0eb2-4aee-b2b2-41d945174b3f",
          "name": "1-BUTANONE, 3-(METHYLTHIO)-1-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-",
          "stdName": "1-BUTANONE, 3-(METHYLTHIO)-1-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d884d93b-e99c-4824-9844-8c560c2bcbc8",
            "b0820228-3e95-4073-981f-2be826d2ea80"
          ],
          "display_name": false
        },
        {
          "uuid": "ed532963-4053-4928-83a9-43f7bae3d327",
          "name": "3-(METHYLTHIO)-1-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-1-BUTANONE",
          "stdName": "3-(METHYLTHIO)-1-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-1-BUTANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d884d93b-e99c-4824-9844-8c560c2bcbc8",
            "e0f0821c-bb37-4d67-b7f1-14b6805633d7"
          ],
          "display_name": false
        },
        {
          "uuid": "3b7ed99c-5bb6-453f-b829-3db126018877",
          "name": "FEMA NO. 4569",
          "stdName": "FEMA NO. 4569",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d884d93b-e99c-4824-9844-8c560c2bcbc8",
            "e0f0821c-bb37-4d67-b7f1-14b6805633d7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1efdf5d2-6b2e-4a13-8a0b-860d211b2c0f",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d884d93b-e99c-4824-9844-8c560c2bcbc8",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0820228-3e95-4073-981f-2be826d2ea80",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0f0821c-bb37-4d67-b7f1-14b6805633d7",
          "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35b18381-7091-452f-8a35-9515549cbc06",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef85bdb8-181b-4dfe-b2fc-c90f94393c77",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391423000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb2d4412-2de7-49ad-bd66-05c1e3611439",
          "citation": "SRS import [2TCW7MIT5C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2TCW7MIT5C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391423000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83d8409d-cea8-4379-87be-32b5dd10f558",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "587f34a2-7362-fbe7-295a-b1ca4860e5f5",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "9c4761cb-64b1-1d9e-5d1e-48f999164356",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "24610848-5286-4df9-9899-ecdefff5eac2",
          "id": "24610848-5286-4df9-9899-ecdefff5eac2",
          "molfile": "\n  Marvin  01132102022D          \n\n 16 16  0  0  0  0            999 V2000\n    7.8939   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1794   -5.1048    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4650   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.4650   -3.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7505   -5.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0360   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0360   -3.8673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3216   -5.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6071   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6071   -3.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8926   -5.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8926   -5.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6071   -6.3423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3216   -5.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1340   -5.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6037   -6.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n 14  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CC1=C(C(=O)CC(C)SC)C(C)(C)CCC1",
          "formula": "C14H24OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5a0c1abe-8feb-4290-900f-4d6e265ee0f9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "240.4064",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "627ef725-8e5e-41eb-912e-c118cfc0d4e0",
      "version": "6",
      "structure": {
        "id": "eecb3053-0cf8-4771-bcc3-e1ffe04fcdec",
        "molfile": "\n  Marvin  01132112222D          \n\n 16 16  0  0  0  0            999 V2000\n    4.3216   -5.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0360   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7505   -5.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4650   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1794   -5.1048    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8939   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4650   -3.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0360   -3.8673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3216   -5.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6071   -6.3423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8926   -5.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8926   -5.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6071   -4.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6071   -3.8673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1340   -5.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6037   -6.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  2  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n  9  1  1  0  0  0  0\n  1 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n  9 16  1  0  0  0  0\nM  END",
        "smiles": "CC1=C(C(=O)CC(C)SC)C(C)(C)CCC1",
        "formula": "C14H24OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "240.4064",
        "optical_activity": "( + / - )",
        "references": [
          "bb2d4412-2de7-49ad-bd66-05c1e3611439",
          "b0820228-3e95-4073-981f-2be826d2ea80"
        ],
        "stereo_centers": 1
      },
      "unii": "2TCW7MIT5C"
    }
  ]
}