{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2e234e28-4dec-4e1a-8a5a-7498ba9ca2b5",
          "code": "531-95-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=531-95-3",
          "code_system": "CAS",
          "references": [
            "fa8ee0d1-23ef-4342-ab27-4d25ac08066d",
            "37770e6b-fd24-4cf1-a87d-7973bc3d3aea"
          ]
        },
        {
          "uuid": "caddbe6a-9207-48ff-9504-7e489aa87c07",
          "code": "208-522-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.749",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fa8ee0d1-23ef-4342-ab27-4d25ac08066d"
          ]
        },
        {
          "uuid": "a3f72e3e-6b8d-493c-b44f-5b50fd7be2fd",
          "code": "C120313",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C120313",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fa8ee0d1-23ef-4342-ab27-4d25ac08066d"
          ]
        },
        {
          "uuid": "45222423-1381-4570-83e8-63b07edd8e2e",
          "code": "m4971",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4971?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "fa8ee0d1-23ef-4342-ab27-4d25ac08066d"
          ]
        },
        {
          "uuid": "59f9ac8f-1615-4919-9110-bccbe47e1de8",
          "code": "CHEMBL198877",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL198877",
          "code_system": "ChEMBL",
          "references": [
            "fa8ee0d1-23ef-4342-ab27-4d25ac08066d"
          ]
        },
        {
          "uuid": "3739a86c-ce06-46ad-883f-ce4fd1c887ea",
          "code": "1803717",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1803717/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "fa8ee0d1-23ef-4342-ab27-4d25ac08066d"
          ]
        },
        {
          "uuid": "ad653dbe-df85-41c0-b596-16c42c7a251b",
          "code": "91469",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91469",
          "code_system": "PUBCHEM",
          "references": [
            "fa8ee0d1-23ef-4342-ab27-4d25ac08066d"
          ]
        },
        {
          "uuid": "0c9f6aa1-420d-4732-0c09-e7a80d8b0698",
          "code": "DTXSID0022309",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0022309",
          "code_system": "EPA CompTox",
          "references": [
            "91421b58-a76a-4b7a-5d39-74b249356d5b"
          ]
        },
        {
          "uuid": "a73b36e2-8a28-4c62-af0a-6990316928f5",
          "code": "Equol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Equol",
          "code_system": "WIKIPEDIA",
          "references": [
            "af827abe-a65e-fc4b-d35d-d8010fe002f9"
          ]
        },
        {
          "uuid": "781d13e2-f010-a7d3-a895-cda6f89778cf",
          "code": "C2182",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Estrogen[C483]|Non-Steroidal Estrogen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2182",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4209b41d-9b46-da00-e70b-80c1cf18303b"
          ]
        },
        {
          "uuid": "70d01e3b-6d63-9966-ee2a-4c39e8429ffe",
          "code": "DB11674",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11674",
          "code_system": "DRUG BANK",
          "references": [
            "4209b41d-9b46-da00-e70b-80c1cf18303b"
          ]
        },
        {
          "uuid": "11c9702d-0b11-41a7-a621-91f73fe8dc0f",
          "code": "2T6D2HPX7Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "28809d97-5c02-8b57-feae-cd9da12c65ac",
          "code": "300000025997",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a586a615-02c0-11bf-ffcf-657d4a16aaa1"
          ]
        },
        {
          "uuid": "2565e2d4-1c87-2b71-be7b-e2883ee6ff9b",
          "code": "2T6D2HPX7Q",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2T6D2HPX7Q",
          "code_system": "DAILYMED",
          "references": [
            "0d3f112e-2b36-e5d1-f436-d0dd2eecde13"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "abb11665-bc93-4ce3-a39a-6b7a77b53920",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "cfc1d930-8ac6-43d2-aade-0dd97560dbe3",
            "refuuid": "a0887d60-01fc-43eb-a61c-2bddcdb003fe",
            "name": "EQUOL",
            "unii": "2T6D2HPX7Q",
            "linking_id": "2T6D2HPX7Q",
            "ref_pname": "EQUOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4730df0c-0737-4274-b338-7aba08d58241",
          "amount": {
            "uuid": "cf6e07ef-8cb0-4406-aefd-4fab0bafaa15",
            "average": 16,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "interaction_type": "BINDING",
          "references": [
            "76e8affe-8e8d-d01f-48e5-b9a3e5d8d0b0"
          ],
          "related_substance": {
            "uuid": "e0de111e-5d99-4521-8d96-71ddeeeec1c3",
            "refuuid": "76ca6a0a-c020-48da-84b0-eaa4bbf232c9",
            "name": "ESTROGEN RECEPTOR BETA",
            "unii": "FO7FW4DL8V",
            "linking_id": "FO7FW4DL8V",
            "ref_pname": "ESTROGEN RECEPTOR BETA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fb2eb833-583a-4f3b-a288-e95205f2c389",
          "amount": {
            "uuid": "84d98ae2-e899-466c-854a-d63d2232c008",
            "average": 200,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "references": [
            "76e8affe-8e8d-d01f-48e5-b9a3e5d8d0b0"
          ],
          "related_substance": {
            "uuid": "f0285ad4-b05a-4632-bc89-5b984410ff9b",
            "refuuid": "4673cf81-dd46-4a8d-8696-823ccebce65d",
            "name": "ESTROGEN RECEPTOR",
            "unii": "SIDP85PFD6",
            "linking_id": "SIDP85PFD6",
            "ref_pname": "ESTROGEN RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a8e03451-388f-4a71-b0e0-09663184d4f9",
          "amount": {
            "uuid": "d9bef7e8-1ed0-4056-b69a-40577a41f78f",
            "average": 65,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "76e8affe-8e8d-d01f-48e5-b9a3e5d8d0b0"
          ],
          "related_substance": {
            "uuid": "cf6309c6-6da9-4c6c-9787-88de1ff3257a",
            "refuuid": "76ca6a0a-c020-48da-84b0-eaa4bbf232c9",
            "name": "ESTROGEN RECEPTOR BETA",
            "unii": "FO7FW4DL8V",
            "linking_id": "FO7FW4DL8V",
            "ref_pname": "ESTROGEN RECEPTOR BETA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a54a64d2-9f45-40d7-821c-de67535dfd04",
          "comments": "Produced by intestinal microbiota. Similar activity as estrodiol",
          "type": "PARENT->METABOLITE ACTIVE",
          "mediator_substance": {
            "uuid": "a040288c-1d7e-4fa7-80a5-b31d50fb7dd0",
            "refuuid": "972618ba-8691-475a-8b8a-c1b9009f5946",
            "name": "FECAL MICROBIOTA",
            "unii": "Q805XO2F7C",
            "linking_id": "Q805XO2F7C",
            "ref_pname": "FECAL MICROBIOTA",
            "substance_class": "reference"
          },
          "references": [
            "344b96c6-fb7e-490f-bb85-c44bf6e4fce9"
          ],
          "related_substance": {
            "uuid": "c9a51d6b-b718-4033-b3b5-aae46a4b979d",
            "refuuid": "d3c67d86-2d2d-46a5-b542-310c18702cde",
            "name": "DAIDZEIN",
            "unii": "6287WC5J2L",
            "linking_id": "6287WC5J2L",
            "ref_pname": "DAIDZEIN"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4deae9dd-9521-4676-acd6-62f347a2fcf6",
          "name": "(3S)-3,4-DIHYDRO-3-(4-HYDROXYPHENYL)-2H-1-BENZOPYRAN-7-OL",
          "stdName": "(3S)-3,4-DIHYDRO-3-(4-HYDROXYPHENYL)-2H-1-BENZOPYRAN-7-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c60e740-44df-4f34-9ea0-060d2339d4fa",
            "21e83db6-bbdf-4a74-904b-e11ef017a91b"
          ],
          "display_name": false
        },
        {
          "uuid": "45597cf4-0965-42a0-8bb9-9854512a4c07",
          "name": "2H-1-BENZOPYRAN-7-OL, 3,4-DIHYDRO-3-(4-HYDROXYPHENYL)-, (3S)-",
          "stdName": "2H-1-BENZOPYRAN-7-OL, 3,4-DIHYDRO-3-(4-HYDROXYPHENYL)-, (3S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43420c99-959c-465d-9023-ddb2fd2b52fe"
          ],
          "display_name": false
        },
        {
          "uuid": "60315eca-d480-4173-bab9-952d29b9f846",
          "name": "EQUOL",
          "stdName": "EQUOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b77840c8-bf95-40c8-aa76-2b406b78bbd3",
            "e4315294-b32b-4543-a864-8ca208a063f1",
            "8adfadd4-ee18-4acb-9c30-ae022afe4f93",
            "2c0b8e22-da13-43e9-9af1-b9b4aa7128f9",
            "7c60e740-44df-4f34-9ea0-060d2339d4fa",
            "21e83db6-bbdf-4a74-904b-e11ef017a91b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ceded879-eca6-411f-a556-0891a299caf2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8aced703-6bdd-41f6-85ec-5098db2d743d",
          "name": "EQUOL (S)-FORM",
          "stdName": "EQUOL (S)-FORM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f516f26-ba2b-4e01-9c3a-9b1f97cfe2a1",
            "7c60e740-44df-4f34-9ea0-060d2339d4fa"
          ],
          "display_name": false
        },
        {
          "uuid": "066d11fd-b52a-4234-9743-76ad7b63a709",
          "name": "EQUOL [MI]",
          "stdName": "EQUOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c60e740-44df-4f34-9ea0-060d2339d4fa",
            "21e83db6-bbdf-4a74-904b-e11ef017a91b"
          ],
          "display_name": false
        },
        {
          "uuid": "9debe7da-94c1-422f-a8bf-ad69d3b019c7",
          "name": "EQUOL, (-)-",
          "stdName": "EQUOL, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f516f26-ba2b-4e01-9c3a-9b1f97cfe2a1",
            "7c60e740-44df-4f34-9ea0-060d2339d4fa"
          ],
          "display_name": false
        },
        {
          "uuid": "8e2ba129-53ba-447a-9801-3ac8d21b3708",
          "name": "EQUOL, (S)-",
          "stdName": "EQUOL, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f516f26-ba2b-4e01-9c3a-9b1f97cfe2a1",
            "7c60e740-44df-4f34-9ea0-060d2339d4fa"
          ],
          "display_name": false
        },
        {
          "uuid": "608beb4a-e16e-4d6c-b5ee-74d4e09229e8",
          "name": "S-EQUOL",
          "stdName": "S-EQUOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43420c99-959c-465d-9023-ddb2fd2b52fe"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "43420c99-959c-465d-9023-ddb2fd2b52fe",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6f516f26-ba2b-4e01-9c3a-9b1f97cfe2a1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c60e740-44df-4f34-9ea0-060d2339d4fa",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4315294-b32b-4543-a864-8ca208a063f1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21e83db6-bbdf-4a74-904b-e11ef017a91b",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c0b8e22-da13-43e9-9af1-b9b4aa7128f9",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa8ee0d1-23ef-4342-ab27-4d25ac08066d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390812000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92160495-bc0d-4a51-bbfc-6f98a2b04c9f",
          "citation": "SRS import [2T6D2HPX7Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2T6D2HPX7Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390812000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8adfadd4-ee18-4acb-9c30-ae022afe4f93",
          "citation": "EQUOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b77840c8-bf95-40c8-aa76-2b406b78bbd3",
          "citation": "EQUOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "91421b58-a76a-4b7a-5d39-74b249356d5b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=531-95-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "af827abe-a65e-fc4b-d35d-d8010fe002f9",
          "citation": "Equol",
          "url": "https://en.wikipedia.org/wiki/Equol",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "76e8affe-8e8d-d01f-48e5-b9a3e5d8d0b0",
          "citation": "uthyala, Rajeev S; Ju, Young H; Sheng, Shubin; Williams, Lee D; Doerge, Daniel R; Katzenellenbogen, Benita S; Helferich, William G; Katzenellenbogen, John A (2004). \"Equol, a natural estrogenic metabolite from soy isoflavones\". Bioorganic & Medicinal Chemistry. 12 (6): 1559–1567. doi:10.1016/j.bmc.2003.11.035. ISSN 0968-0896",
          "url": "https://www.sciencedirect.com/science/article/pii/S0968089604000239?via%3Dihub",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a586a615-02c0-11bf-ffcf-657d4a16aaa1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "4209b41d-9b46-da00-e70b-80c1cf18303b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "344b96c6-fb7e-490f-bb85-c44bf6e4fce9",
          "citation": "https://en.wikipedia.org/wiki/Equol#:~:text=Equol%20(4'%2C7%2D,equol%20is%20a%20nonsteroidal%20estrogen.",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "37770e6b-fd24-4cf1-a87d-7973bc3d3aea",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0d3f112e-2b36-e5d1-f436-d0dd2eecde13",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ac02ff0a-b564-4888-b494-12fc0baa6f9b",
          "id": "ac02ff0a-b564-4888-b494-12fc0baa6f9b",
          "molfile": "\n  Marvin  01132108552D          \n\n 18 20  0  0  1  0            999 V2000\n    4.7962   -3.8926    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.7942   -4.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0766   -5.1287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3655   -4.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6526   -5.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9396   -4.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2244   -5.1294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9405   -3.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6513   -3.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3675   -3.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0806   -3.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5092   -3.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2225   -3.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9379   -3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9412   -2.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6566   -2.2524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2232   -2.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5107   -2.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 11  1  0  0  0  0\n  1 12  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n 10  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 18 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1[C@@H]2Cc3ccc(cc3OC2)O)O",
          "formula": "C15H14O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9915e863-a1a7-494e-83c4-eae935e50408"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "242.2704",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a0887d60-01fc-43eb-a61c-2bddcdb003fe",
      "version": "14",
      "structure": {
        "id": "9a3a8c88-ad76-4fbe-a919-ef29b7b16a71",
        "molfile": "\n  Marvin  01132108012D          \n\n 18 20  0  0  1  0            999 V2000\n   12.7555   -4.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7546   -5.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4676   -5.5101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4663   -3.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1826   -4.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1805   -5.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8917   -5.5063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6093   -5.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6113   -4.2702    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.8956   -3.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3243   -3.8596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0376   -4.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7530   -3.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7563   -3.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0383   -2.6262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3258   -3.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4717   -2.6300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0394   -5.5070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11 12  2  0  0  0  0\n  2  3  1  0  0  0  0\n 12 13  1  0  0  0  0\n  3  6  2  0  0  0  0\n 13 14  2  0  0  0  0\n  1  2  2  0  0  0  0\n 14 15  1  0  0  0  0\n  5  4  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 11  1  0  0  0  0\n  9 11  1  1  0  0  0\n  4  1  1  0  0  0  0\n 14 17  1  0  0  0  0\n  5 10  1  0  0  0  0\n  2 18  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1[C@@H]2Cc3ccc(cc3OC2)O)O",
        "formula": "C15H14O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "242.2704",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "92160495-bc0d-4a51-bbfc-6f98a2b04c9f",
          "43420c99-959c-465d-9023-ddb2fd2b52fe"
        ],
        "stereo_centers": 1
      },
      "unii": "2T6D2HPX7Q"
    }
  ]
}