{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9c7a4b18-0f0a-4444-a5de-43cc022ca697",
          "code": "126-00-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126-00-1",
          "code_system": "CAS",
          "references": [
            "bfd406d9-793d-4b2e-9245-001b23ee85d9",
            "0276bc4f-8511-4ed8-913d-9e96604c1098"
          ]
        },
        {
          "uuid": "f9e5783c-6072-41cd-9cf3-f716804f39c3",
          "code": "DIPHENOLIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diphenolic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "bfd406d9-793d-4b2e-9245-001b23ee85d9"
          ]
        },
        {
          "uuid": "06eca533-9cfe-45a2-b09e-3703c8a60f15",
          "code": "204-763-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.331",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bfd406d9-793d-4b2e-9245-001b23ee85d9"
          ]
        },
        {
          "uuid": "99ddd372-7951-499a-9646-3d3a2f1a866e",
          "code": "m4612",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4612?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bfd406d9-793d-4b2e-9245-001b23ee85d9"
          ]
        },
        {
          "uuid": "fa551e70-0849-439e-93b8-85a00d8f3d8e",
          "code": "67174",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67174",
          "code_system": "PUBCHEM",
          "references": [
            "bfd406d9-793d-4b2e-9245-001b23ee85d9"
          ]
        },
        {
          "uuid": "99aa5ee8-7226-30e5-051e-55a781a9e6b6",
          "code": "DTXSID0022436",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0022436",
          "code_system": "EPA CompTox",
          "references": [
            "e8e88e02-52e2-6d22-2fd3-3452e6035404"
          ]
        },
        {
          "uuid": "c99242e1-a860-4b6a-bbe6-7b14197699fa",
          "code": "2SIZ2CO5L3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6606b84e-f99c-ab21-4442-763710b4c1cf",
          "code": "3371",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3371",
          "code_system": "NSC",
          "references": [
            "c178bbd3-4b58-f0e4-1a90-a0743722da4a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9d6674be-922d-49a6-ac89-c32d88e45498",
          "name": ".GAMMA.,.GAMMA.-BIS-(P-HYDROXYPHENYL)VALERIC ACID",
          "stdName": ".GAMMA.,.GAMMA.-BIS-(P-HYDROXYPHENYL)VALERIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "283387c6-e649-428c-a980-11693ee3831f",
            "908c8ee1-ebc9-4cfc-9f41-b2ca4dacdaaa"
          ],
          "display_name": false
        },
        {
          "uuid": "1be1e519-e17f-4d69-b2ea-5b72660395fd",
          "name": "4,4-BIS(4'-HYDROXYPHENYL)PENTANOIC ACID",
          "stdName": "4,4-BIS(4'-HYDROXYPHENYL)PENTANOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "283387c6-e649-428c-a980-11693ee3831f",
            "908c8ee1-ebc9-4cfc-9f41-b2ca4dacdaaa"
          ],
          "display_name": false
        },
        {
          "uuid": "6bf1d4f3-c078-4a79-bdfa-4acb81b9b894",
          "name": "4,4-BIS(4-HYDROXYPHENYL)VALERIC ACID",
          "stdName": "4,4-BIS(4-HYDROXYPHENYL)VALERIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "283387c6-e649-428c-a980-11693ee3831f",
            "2d578c28-e405-4c57-acbd-69cb45bb1d66"
          ],
          "display_name": false
        },
        {
          "uuid": "2a99409f-b8c1-498b-9a71-d460a577d4bb",
          "name": "4-HYDROXY-.GAMMA.-(4-HYDROXYPHENYL)-.GAMMA.-METHYLBENZENEBUTANOIC ACID",
          "stdName": "4-HYDROXY-.GAMMA.-(4-HYDROXYPHENYL)-.GAMMA.-METHYLBENZENEBUTANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "283387c6-e649-428c-a980-11693ee3831f",
            "908c8ee1-ebc9-4cfc-9f41-b2ca4dacdaaa"
          ],
          "display_name": false
        },
        {
          "uuid": "129402e9-584e-45fd-b945-96612af7f2fb",
          "name": "DIPHENOLIC ACID",
          "stdName": "DIPHENOLIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92e92d0a-3de9-4a6e-b9d3-e1aa39ee2471",
            "283387c6-e649-428c-a980-11693ee3831f",
            "6f8cf0ce-5da7-4d5d-810c-8ba8e4dcff66",
            "51479e58-e50e-4b12-a98c-6004ca01413b",
            "5307ff5b-de51-47c3-9481-c8631f65043d",
            "46919176-f8f8-47ae-a0b9-fb20909b74c5"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2f25fc20-0f2f-45d0-9798-12e7c8ac7d2a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "42f43ba6-acd4-47f5-b655-9c4038432d89",
          "name": "DIPHENOLIC ACID [MI]",
          "stdName": "DIPHENOLIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "283387c6-e649-428c-a980-11693ee3831f",
            "51479e58-e50e-4b12-a98c-6004ca01413b"
          ],
          "display_name": false
        },
        {
          "uuid": "88375a79-54dd-41fc-b0ef-659eb2f8dc31",
          "name": "NSC-3371",
          "stdName": "NSC-3371",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "283387c6-e649-428c-a980-11693ee3831f",
            "02c15c38-e8b9-4785-bcae-5a6f9fedad1a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6f8cf0ce-5da7-4d5d-810c-8ba8e4dcff66",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "51479e58-e50e-4b12-a98c-6004ca01413b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "283387c6-e649-428c-a980-11693ee3831f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "908c8ee1-ebc9-4cfc-9f41-b2ca4dacdaaa",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02c15c38-e8b9-4785-bcae-5a6f9fedad1a",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46919176-f8f8-47ae-a0b9-fb20909b74c5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d578c28-e405-4c57-acbd-69cb45bb1d66",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfd406d9-793d-4b2e-9245-001b23ee85d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390881000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3385ca2e-eeeb-4d7c-ac34-d73d7fef4197",
          "citation": "SRS import [2SIZ2CO5L3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2SIZ2CO5L3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390881000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e5f674d-c78c-40eb-a7ef-4f41a3ba90d8",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5307ff5b-de51-47c3-9481-c8631f65043d",
          "citation": "DIPHENOLIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "92e92d0a-3de9-4a6e-b9d3-e1aa39ee2471",
          "citation": "DIPHENOLIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8e88e02-52e2-6d22-2fd3-3452e6035404",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126-00-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0276bc4f-8511-4ed8-913d-9e96604c1098",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c178bbd3-4b58-f0e4-1a90-a0743722da4a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "931ab8f8-07a6-4f40-be19-0f65cd3b9488",
          "id": "931ab8f8-07a6-4f40-be19-0f65cd3b9488",
          "molfile": "\n  Marvin  01132107372D          \n\n 21 22  0  0  0  0            999 V2000\n    6.8006   -4.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3334   -4.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1381   -4.5085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4210   -3.7320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2257   -3.5892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5085   -2.8079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7575   -4.2181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4737   -5.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7564   -4.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0483   -5.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0483   -5.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3339   -6.3866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7564   -6.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4737   -5.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6731   -5.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1377   -6.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4232   -6.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2376   -7.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5161   -7.9090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7666   -6.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4827   -5.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  1  0  0  0  0\n  2 15  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 14  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 21 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CC(CCC(=O)O)(c1ccc(cc1)O)c2ccc(cc2)O",
          "formula": "C17H18O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9b34ec8c-90a9-442e-b502-cfaac2c50cd9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "286.3231",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fde49a9e-8227-4530-95da-dfca0c15048f",
      "version": "5",
      "structure": {
        "id": "a46cbfda-6c61-4f8e-8eb7-4711a4959bd8",
        "molfile": "\n  Marvin  01132108322D          \n\n 21 22  0  0  0  0            999 V2000\n    9.5085   -2.8079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2257   -3.5892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7575   -4.2181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4210   -3.7320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1381   -4.5085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3334   -4.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4737   -5.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7564   -4.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0483   -5.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0483   -5.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3339   -6.3866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7564   -6.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4737   -5.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6731   -5.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1377   -6.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4232   -6.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2376   -7.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5161   -7.9090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7666   -6.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4827   -5.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8006   -4.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13  7  2  0  0  0  0\n  6 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 14  2  0  0  0  0\n  6 21  1  0  0  0  0\nM  END",
        "smiles": "CC(CCC(=O)O)(c1ccc(cc1)O)c2ccc(cc2)O",
        "formula": "C17H18O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "286.3231",
        "optical_activity": "NONE",
        "references": [
          "3385ca2e-eeeb-4d7c-ac34-d73d7fef4197",
          "1e5f674d-c78c-40eb-a7ef-4f41a3ba90d8"
        ],
        "stereo_centers": 0
      },
      "unii": "2SIZ2CO5L3"
    }
  ]
}