{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "db8504a2-2c49-4221-a6c7-7ea469e3a369",
          "code": "520-52-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=520-52-5",
          "code_system": "CAS",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6",
            "85a9bfb6-40ea-40af-933b-9f39363dfc50"
          ]
        },
        {
          "uuid": "394bcdc3-3e82-4db9-b890-dda8bde80b8f",
          "code": "C62529",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C62529",
          "code_system": "NCI_THESAURUS",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "25054f13-3bfd-4c17-ba06-4d866d4a1f40",
          "code": "PSILOCYBIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Psilocybin",
          "code_system": "WIKIPEDIA",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "1306d44f-b074-4de4-8fa0-da61f5e46dbc",
          "code": "D011562",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68011562",
          "code_system": "MESH",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "3926ccee-4665-4c78-ad02-de3d7a4b8d73",
          "code": "SUB10158MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "c699d9d6-0a70-45df-b0fc-ee0d81db99af",
          "code": "1218",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1218",
          "code_system": "INN",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "e54c81c2-4b7d-42b1-86ad-0efee0dbd890",
          "code": "7437",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "c44f3d1b-8583-4451-90d0-87b9b2310e51",
          "code": "m9305",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9305?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "4085960d-db22-40b3-933e-5706ed2c9d14",
          "code": "CHEMBL194378",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL194378",
          "code_system": "ChEMBL",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "20642267-6373-4214-80de-123927718bc5",
          "code": "208-294-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.542",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "e1b6aa1e-fe49-479e-a9df-b9997a98dd7a",
          "code": "10624",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10624",
          "code_system": "PUBCHEM",
          "references": [
            "10ae6188-7825-4846-b26e-1897b9e7fce6"
          ]
        },
        {
          "uuid": "77334be7-9b01-29a2-e520-48945d66174b",
          "code": "7365",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7365",
          "code_system": "HSDB",
          "references": [
            "250c2f80-2cb0-906a-61ce-ad2cdc70e343"
          ]
        },
        {
          "uuid": "a43300a8-c118-981c-e580-ae4faa57fca2",
          "code": "DTXSID0048898",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0048898",
          "code_system": "EPA CompTox",
          "references": [
            "253fda00-d9de-bdcf-8e9a-9708ea1f14cd"
          ]
        },
        {
          "uuid": "79888f69-7ab9-1a02-f519-9890e22833df",
          "code": "C47794",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Serotonin Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47794",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e7efdaa8-a489-020a-4c86-a0e1d5d26e45"
          ]
        },
        {
          "uuid": "c176bcd0-aff3-8a37-0fdc-a2e2f8e02ea1",
          "code": "C221",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Alkaloid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C221",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e7efdaa8-a489-020a-4c86-a0e1d5d26e45"
          ]
        },
        {
          "uuid": "651eec83-96a4-4a23-bbbf-2f1d0ea1b327",
          "code": "2RV7212BP0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4341782e-e687-d235-6b75-458b2c96596d",
          "code": "DB11664",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11664",
          "code_system": "DRUG BANK",
          "references": [
            "e7efdaa8-a489-020a-4c86-a0e1d5d26e45"
          ]
        },
        {
          "uuid": "3d7a9a59-afa0-031e-bfe2-00786de2617e",
          "code": "139072",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:139072",
          "code_system": "CHEBI",
          "references": [
            "e7efdaa8-a489-020a-4c86-a0e1d5d26e45"
          ]
        },
        {
          "uuid": "5c6a020a-36a1-5759-8f59-be2e50e66f45",
          "code": "8614",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8614",
          "code_system": "CHEBI",
          "references": [
            "e7efdaa8-a489-020a-4c86-a0e1d5d26e45"
          ]
        },
        {
          "uuid": "eb4819ba-9ef9-b7e3-d5bd-c67b86fb93db",
          "code": "843421",
          "comments": "ORPHAN DRUG|Designated|Treatment of Fragile X Syndrome",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=843421",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "e7efdaa8-a489-020a-4c86-a0e1d5d26e45"
          ]
        },
        {
          "uuid": "fa0d3272-b6b5-2abf-fd84-1df7cfc8ac46",
          "code": "100000080863",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "389aed35-dd74-e3c6-46ae-c016b5c31917"
          ]
        },
        {
          "uuid": "339d01f0-8046-43c7-9f4c-5161968e5e34",
          "code": "Psilocybin_mushroom",
          "type": "GENERIC (FAMILY)",
          "url": "https://en.wikipedia.org/wiki/Psilocybin_mushroom",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "40310542-e9cf-0861-e880-0ef308bc16c0",
          "code": "LM-236",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/LM-236/relevant/1/",
          "code_system": "USAN",
          "references": [
            "f6727e81-38ab-f6d1-4f24-032c4f75159b"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "58c7a325-76f8-41a4-9ce8-6d1c6f82095b",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e0004b16-9716-4cff-8db4-022fe87eacf8",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36a43cfd-0014-4cc8-b8a3-18fee362f50f",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0dcb9c00-de9f-488f-95bb-2bb7824bfbc3",
          "citation": "dose",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b9c0f0e-bf9e-4f1c-9c72-a77089306e07",
          "citation": "INN Proposed List 12",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL12.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "96a0d346-d19e-4ab5-8090-a0d5a151392c",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b289baac-41aa-48fd-9b9c-fddfdfddf199",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2716aba8-c33a-4c08-a57c-b2a13275d594",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "953905d1-f486-4a61-8a9f-8183b116c9a2",
          "citation": "wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6415a0b2-1e80-431d-a221-6c5c50ad29ff",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10ae6188-7825-4846-b26e-1897b9e7fce6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31764343-4d7c-47a2-80bc-9ccb71bc319d",
          "citation": "SRS import [2RV7212BP0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2RV7212BP0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390763000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26309b33-0681-4386-84ec-4b90185080ac",
          "citation": "PSILOCYBINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6cf449ec-a491-43e5-bc2c-18232568a97b",
          "citation": "PSILOCYBINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "11fcde36-9546-4de0-82c0-739e24105d45",
          "citation": "PSILOCYBIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "919c196d-fbf5-410e-aa26-021890cf0e3a",
          "citation": "PSILOCYBINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01a12d83-0b39-4ae7-932a-ea991efbdcfb",
          "citation": "PSILOCYBINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "250c2f80-2cb0-906a-61ce-ad2cdc70e343",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+520-52-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "253fda00-d9de-bdcf-8e9a-9708ea1f14cd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=520-52-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "389aed35-dd74-e3c6-46ae-c016b5c31917",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e7efdaa8-a489-020a-4c86-a0e1d5d26e45",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "85a9bfb6-40ea-40af-933b-9f39363dfc50",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0354b754-565d-4fb1-8756-8266bdd29028",
          "citation": "https://www.sciencedirect.com/topics/neuroscience/psilocybin",
          "url": "https://www.sciencedirect.com/topics/neuroscience/psilocybin",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ac4da3cc-1055-4c3e-a103-6e40627cd325",
          "citation": "CHEMDRAW",
          "doc_type": "CHEMDRAW_IUPAC_NAME",
          "public_domain": true
        },
        {
          "uuid": "c24d3706-ff57-4ece-54c0-75e48933d5a5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f6727e81-38ab-f6d1-4f24-032c4f75159b",
          "citation": "USAN COUN 2024",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "acf5ff22-acda-4822-8d31-fb1d5410b510",
          "citation": "https://en.wikipedia.org/wiki/Psilocybin_mushroom",
          "url": "https://en.wikipedia.org/wiki/Psilocybin_mushroom",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "9d7d650e-3231-4a64-99b5-eb933b285449",
          "citation": "https://en.wikipedia.org/wiki/Psilocybin_mushroom",
          "url": "https://en.wikipedia.org/wiki/Psilocybin_mushroom",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "e2508303-7171-447a-8346-6100771470ba",
          "citation": "Gotvaldová, Klára, et al. \"Stability of psilocybin and its four analogs in the biomass of the psychotropic mushroom Psilocybe cubensis.\" Drug testing and analysis 13.2 (2021): 439-446.",
          "url": "https://analyticalsciencejournals.onlinelibrary.wiley.com/doi/full/10.1002/dta.2950",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "92e5b6ec-957b-4422-83a2-efe6ab785ff7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9494fa88-b00e-422c-ab14-661236522ad0",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "4ad0a1a3-5752-9fe8-bd86-265f28d75b4e",
          "citation": "USAN COUN 2023",
          "doc_type": "USANCOUN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2c1fd67e-7477-b181-3339-f0ac2fb93f56",
          "id": "2c1fd67e-7477-b181-3339-f0ac2fb93f56",
          "molfile": "\n  CDK     08022412142D\n\n 19 20  0  0  0  0  0  0  0  0999 V2000\n   29.9417   -4.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4158   -5.2210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3721   -4.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9334   -6.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4074   -7.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9251   -8.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.8403   -9.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9251  -11.0393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4483  -10.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0963  -11.3305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7443  -10.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7443   -8.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0963   -8.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4483   -8.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0963   -6.6505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7453   -5.8705    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3943   -5.0905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5253   -4.5196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9653   -7.2215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n  6 14  1  0  0  0  0\n  9 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  END",
          "smiles": "CN(C)CCc1c[nH]c2cccc(c12)OP(=O)(O)O",
          "formula": "C12H17N2O4P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6fee2fc5-6564-4990-8cf9-f31406c07ceb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "284.2486",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4eaee696-f5df-41cd-8bf8-19a5a0e3e949",
      "version": "42",
      "structure": {
        "id": "ecb23bf1-bae4-4b89-aaff-917073aac94a",
        "molfile": "\n   JSDraw208022412142D\n\n 19 20  0  0  0  0              0 V2000\n   29.9417   -4.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4158   -5.2210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3721   -4.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9334   -6.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4074   -7.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9251   -8.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.8403   -9.7705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9251  -11.0393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4483  -10.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0963  -11.3305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7443  -10.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7443   -8.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0963   -8.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4483   -8.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0963   -6.6505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7453   -5.8705    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3943   -5.0905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5253   -4.5196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9653   -7.2215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n  6 14  1  0  0  0  0\n  9 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  END",
        "smiles": "CN(C)CCc1c[nH]c2cccc(c12)OP(=O)(O)O",
        "formula": "C12H17N2O4P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "284.2486",
        "optical_activity": "NONE",
        "references": [
          "31764343-4d7c-47a2-80bc-9ccb71bc319d",
          "36a43cfd-0014-4cc8-b8a3-18fee362f50f",
          "6b9c0f0e-bf9e-4f1c-9c72-a77089306e07"
        ],
        "stereo_centers": 0
      },
      "unii": "2RV7212BP0",
      "relationships": [
        {
          "uuid": "75a632a7-9be5-4139-8794-8bad8d921d59",
          "amount": {
            "uuid": "919f3b0f-ff03-40bc-a586-7c99e7a784d6"
          },
          "type": "METABOLITE ACTIVE->PRODRUG",
          "references": [
            "0354b754-565d-4fb1-8756-8266bdd29028"
          ],
          "related_substance": {
            "uuid": "31de6f5e-b49d-4ded-bb98-b1b16643d547",
            "refuuid": "22a4fee8-605f-4bb0-a9e0-63305b11aece",
            "name": "PSILOCIN",
            "unii": "CMS88KUW0G",
            "linking_id": "CMS88KUW0G",
            "ref_pname": "PSILOCIN"
          }
        },
        {
          "uuid": "0a09ec64-0332-401e-b949-b9094293b229",
          "amount": {
            "uuid": "2bb83ce7-955f-4692-a246-ba4a0e97b304"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "cd12bd97-8606-4a6a-8202-3c46832ba356",
            "refuuid": "41396f97-15eb-4653-85df-751938dfa9ec",
            "name": "Psilocybin trihydrate",
            "unii": "YG63V98ZDB",
            "linking_id": "YG63V98ZDB",
            "ref_pname": "Psilocybin trihydrate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "43084437-0546-4a0d-8614-17463a4d1391",
          "amount": {
            "uuid": "3b0b2174-ad7f-4c5d-b286-ee9790c6e365"
          },
          "type": "PARENT->ACTIVE CONSTITUENT ALWAYS PRESENT",
          "references": [
            "acf5ff22-acda-4822-8d31-fb1d5410b510"
          ],
          "related_substance": {
            "uuid": "a985a2dd-cc36-457a-aad5-4e46790ddf2c",
            "refuuid": "2a570328-53b3-41d6-b67c-36b37ed74386",
            "name": "PSILOCYBE SEMILANCEATA FRUITING BODY",
            "unii": "00O651747I",
            "linking_id": "00O651747I",
            "ref_pname": "PSILOCYBE SEMILANCEATA FRUITING BODY",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "28f39595-e9af-439b-a3cf-0c3d4b81edda",
          "amount": {
            "uuid": "e84c9a10-a6fa-4f3f-8cf1-f510eb583379",
            "type": "WEIGHT PERCENT",
            "average": 0.88,
            "units": "%",
            "non_numeric_value": "in Cap"
          },
          "comments": "There was approximately 50% less PSILOCYBINE in the stripes compared to the cap.",
          "type": "PARENT->ACTIVE CONSTITUENT ALWAYS PRESENT",
          "interaction_type": "MAJOR",
          "references": [
            "9d7d650e-3231-4a64-99b5-eb933b285449",
            "e2508303-7171-447a-8346-6100771470ba"
          ],
          "related_substance": {
            "uuid": "fcf9e6c6-0ac8-473e-91d7-0e167f19b22d",
            "refuuid": "4d832ba3-b103-442b-a8b6-75ab1a23f058",
            "name": "PSILOCYBE CUBENSIS FRUITING BODY",
            "unii": "I46VCD771R",
            "linking_id": "I46VCD771R",
            "ref_pname": "PSILOCYBE CUBENSIS FRUITING BODY",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ea7475e8-6e6c-4217-aded-a114fb381d1e",
          "amount": {
            "uuid": "8a0e5373-a2f4-446f-963b-7d1fd425c26e"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "92e5b6ec-957b-4422-83a2-efe6ab785ff7",
            "9494fa88-b00e-422c-ab14-661236522ad0"
          ],
          "related_substance": {
            "uuid": "a219b959-d6be-40ce-8d65-81a7e8bb69f4",
            "refuuid": "41396f97-15eb-4653-85df-751938dfa9ec",
            "name": "Psilocybin trihydrate",
            "unii": "YG63V98ZDB",
            "linking_id": "YG63V98ZDB",
            "ref_pname": "Psilocybin trihydrate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "40b89939-7781-4366-89fd-c29744c192bc",
          "amount": {
            "uuid": "b6406510-453a-4c44-b0d0-ca35663dfdad"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a9f2f8c9-df86-45fa-9be2-2a89400b0908",
            "refuuid": "22a4fee8-605f-4bb0-a9e0-63305b11aece",
            "name": "PSILOCIN",
            "unii": "CMS88KUW0G",
            "linking_id": "CMS88KUW0G",
            "ref_pname": "PSILOCIN",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "4526cdfb-6bff-4e70-ad8c-91ca7aad64ed",
          "name": "1H-Indol-4-ol, 3-[2-(dimethylamino)ethyl]-, 4-(dihydrogen phosphate)",
          "stdName": "1H-INDOL-4-OL, 3-(2-(DIMETHYLAMINO)ETHYL)-, 4-(DIHYDROGEN PHOSPHATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6727e81-38ab-f6d1-4f24-032c4f75159b"
          ],
          "display_name": false
        },
        {
          "uuid": "dee8c8d4-4c47-4a2d-9ea6-475745409210",
          "name": "3-[2-(dimethylamino)ethyl]-1H-indol-4-yl dihydrogen phosphate",
          "stdName": "3-(2-(DIMETHYLAMINO)ETHYL)-1H-INDOL-4-YL DIHYDROGEN PHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac4da3cc-1055-4c3e-a103-6e40627cd325",
            "f6727e81-38ab-f6d1-4f24-032c4f75159b"
          ],
          "display_name": false
        },
        {
          "uuid": "fe726635-70b8-473b-9a9d-c26206f8ef4e",
          "name": "COMP-360",
          "stdName": "COMP-360",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6727e81-38ab-f6d1-4f24-032c4f75159b"
          ],
          "display_name": false
        },
        {
          "uuid": "5acaf793-8e82-4746-9080-a3e0fd94c418",
          "name": "COMP360",
          "stdName": "COMP360",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6727e81-38ab-f6d1-4f24-032c4f75159b"
          ],
          "display_name": false
        },
        {
          "uuid": "e69f79bd-19d2-4c05-84aa-adc0bcbf307f",
          "name": "CY-39",
          "stdName": "CY-39",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0004b16-9716-4cff-8db4-022fe87eacf8"
          ],
          "display_name": false
        },
        {
          "uuid": "0bcb69b5-818c-47af-be3b-90851da96ac0",
          "name": "CY39",
          "stdName": "CY39",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58c7a325-76f8-41a4-9ce8-6d1c6f82095b"
          ],
          "display_name": false
        },
        {
          "uuid": "fafbf173-9e14-4b4c-a4e7-7e9959db0986",
          "name": "INDOCYBIN",
          "stdName": "INDOCYBIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0dcb9c00-de9f-488f-95bb-2bb7824bfbc3"
          ],
          "display_name": false
        },
        {
          "uuid": "5b6ed6d4-1988-4578-b4e7-c159bafe33ea",
          "name": "PSILOCYBIN [MI]",
          "stdName": "PSILOCYBIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b289baac-41aa-48fd-9b9c-fddfdfddf199"
          ],
          "display_name": false
        },
        {
          "uuid": "837306a3-19cc-8546-fe39-07d966d59cf8",
          "name": "PSILOCYBIN [USAN]",
          "stdName": "PSILOCYBIN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ad0a1a3-5752-9fe8-bd86-265f28d75b4e"
          ],
          "display_name": false
        },
        {
          "uuid": "cf756f4b-e8d4-4e33-b4ec-32ce4965ff2b",
          "name": "PSILOCYBINE [HSDB]",
          "stdName": "PSILOCYBINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2716aba8-c33a-4c08-a57c-b2a13275d594"
          ],
          "display_name": false
        },
        {
          "uuid": "d22b825c-d978-45c1-af7b-bd327c552a02",
          "name": "PSILOCYBINE [MART.]",
          "stdName": "PSILOCYBINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96a0d346-d19e-4ab5-8090-a0d5a151392c"
          ],
          "display_name": false
        },
        {
          "uuid": "c2de842e-78b8-4a4e-9ab3-27306067bc79",
          "name": "Psilocybin",
          "stdName": "PSILOCYBIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "953905d1-f486-4a61-8a9f-8183b116c9a2",
            "b289baac-41aa-48fd-9b9c-fddfdfddf199",
            "11fcde36-9546-4de0-82c0-739e24105d45",
            "f6727e81-38ab-f6d1-4f24-032c4f75159b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d93cbfa0-4daa-439a-8a98-f8db6957d789",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "605b64af-7604-483d-9aa7-b6e4ae69400e",
          "name": "Psilocybine",
          "stdName": "PSILOCYBINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36a43cfd-0014-4cc8-b8a3-18fee362f50f",
            "26309b33-0681-4386-84ec-4b90185080ac",
            "919c196d-fbf5-410e-aa26-021890cf0e3a",
            "96a0d346-d19e-4ab5-8090-a0d5a151392c",
            "6cf449ec-a491-43e5-bc2c-18232568a97b",
            "2716aba8-c33a-4c08-a57c-b2a13275d594",
            "01a12d83-0b39-4ae7-932a-ea991efbdcfb",
            "6b9c0f0e-bf9e-4f1c-9c72-a77089306e07",
            "6415a0b2-1e80-431d-a221-6c5c50ad29ff"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "4e5dfbc7-6f37-4091-a462-7c1f0a4b931b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "6433d448-98d9-8b04-7fc6-39fc5359a6c0",
          "name": "Psilocybine [WHO-DD]",
          "stdName": "PSILOCYBINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c24d3706-ff57-4ece-54c0-75e48933d5a5"
          ],
          "display_name": false
        },
        {
          "uuid": "4b63deed-4744-4473-a0b7-ea2f4a707ce3",
          "name": "TEONANACATL",
          "stdName": "TEONANACATL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0dcb9c00-de9f-488f-95bb-2bb7824bfbc3"
          ],
          "display_name": false
        },
        {
          "uuid": "7b7371ef-732f-4d04-9c83-eb67b586c921",
          "name": "psilocybine [INN]",
          "stdName": "PSILOCYBINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b9c0f0e-bf9e-4f1c-9c72-a77089306e07"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "cf37d05e-196f-4f31-8ddf-5a7f78df853f"
      }
    }
  ]
}