{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "60bfdbe7-3c09-4d07-9279-87ecc82477fb",
          "code": "13393-93-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13393-93-6",
          "code_system": "CAS",
          "references": [
            "e97339f4-e4cf-4d49-9774-34897e08eac4",
            "8491b27c-3dc8-436f-94c3-cb8d0ebd0bb2"
          ]
        },
        {
          "uuid": "70bbbf09-0806-4f26-9f5b-765735850f90",
          "code": "236-476-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.033.146",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e97339f4-e4cf-4d49-9774-34897e08eac4"
          ]
        },
        {
          "uuid": "d7a2076d-a873-45ee-99be-79fee67b5b07",
          "code": "SUB180273",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e97339f4-e4cf-4d49-9774-34897e08eac4"
          ]
        },
        {
          "uuid": "cb026277-d8b3-496a-99e2-9a888c7297af",
          "code": "114506",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/114506",
          "code_system": "PUBCHEM",
          "references": [
            "e97339f4-e4cf-4d49-9774-34897e08eac4"
          ]
        },
        {
          "uuid": "266d6b01-2357-c6e2-4e9c-41f900e95582",
          "code": "DTXSID8027745",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8027745",
          "code_system": "EPA CompTox",
          "references": [
            "22cfb672-b686-eb90-cce9-1e9eeacaa0e2"
          ]
        },
        {
          "uuid": "853ad41f-0ab1-42bd-b05b-82778711f04a",
          "code": "2RMS84XMDF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d653120d-940d-73e7-9f17-97bcdff1a1ac",
          "code": "100000166231",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "83f02ab8-1512-f116-daeb-5e2fd5fcb5c7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "87b37a15-4303-4fe8-887e-11028c7d5180",
          "name": "1-PHENANTHRENEMETHANOL, TETRADECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-",
          "stdName": "1-PHENANTHRENEMETHANOL, TETRADECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8cffa47-4766-4eb5-a459-6ffd9873f177",
            "e498df4e-4a2c-454d-bee2-bb6b3bac8d3d"
          ],
          "display_name": false
        },
        {
          "uuid": "4e3872d9-0cc4-4763-9d41-05811332eed0",
          "name": "1-PHENANTHRENEMETHANOL, TETRADECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, (1R,4AR,4BS,10AR)-",
          "stdName": "1-PHENANTHRENEMETHANOL, TETRADECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, (1R,4AR,4BS,10AR)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8cffa47-4766-4eb5-a459-6ffd9873f177",
            "e498df4e-4a2c-454d-bee2-bb6b3bac8d3d"
          ],
          "display_name": false
        },
        {
          "uuid": "64e0a565-2727-47eb-a553-2105975c1a4d",
          "name": "ABIETYL ALCOHOL, TETRAHYDRO-",
          "stdName": "ABIETYL ALCOHOL, TETRAHYDRO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8cffa47-4766-4eb5-a459-6ffd9873f177",
            "e498df4e-4a2c-454d-bee2-bb6b3bac8d3d"
          ],
          "display_name": false
        },
        {
          "uuid": "817a8075-4148-4b62-bfeb-dc607eb78e6a",
          "name": "ABITOL(TM) E HYDROABIETYL ALCOHOL",
          "stdName": "ABITOL(TM) E HYDROABIETYL ALCOHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af68e28e-54c4-4e97-b449-9dd4dc9a6bcc",
            "b8cffa47-4766-4eb5-a459-6ffd9873f177"
          ],
          "display_name": false
        },
        {
          "uuid": "c2627206-c657-44c9-a728-abf08caee376",
          "name": "TETRADECAHYDRO-7-ISOPROPYL-1,4A-DIMETHYLPHENANTHREN-1-METHANOL",
          "stdName": "TETRADECAHYDRO-7-ISOPROPYL-1,4A-DIMETHYLPHENANTHREN-1-METHANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8cffa47-4766-4eb5-a459-6ffd9873f177",
            "daafbe7f-e235-4393-80e0-5ec3e3eb228d"
          ],
          "display_name": false
        },
        {
          "uuid": "5979a437-6ff6-4a65-8036-502e24152937",
          "name": "TETRAHYDROABIETYL ALCOHOL",
          "stdName": "TETRAHYDROABIETYL ALCOHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8cffa47-4766-4eb5-a459-6ffd9873f177",
            "e498df4e-4a2c-454d-bee2-bb6b3bac8d3d"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "daafbe7f-e235-4393-80e0-5ec3e3eb228d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b8cffa47-4766-4eb5-a459-6ffd9873f177",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e498df4e-4a2c-454d-bee2-bb6b3bac8d3d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af68e28e-54c4-4e97-b449-9dd4dc9a6bcc",
          "citation": "http://ws.eastman.com/ProductCatalogApps/PageControllers/MSDSShow_PC.aspx",
          "url": "http://ws.eastman.com/ProductCatalogApps/PageControllers/MSDSShow_PC.aspx",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e97339f4-e4cf-4d49-9774-34897e08eac4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391383000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89758690-cbd5-43f0-bf4c-75f6fe59da77",
          "citation": "SRS import [2RMS84XMDF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2RMS84XMDF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391383000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22cfb672-b686-eb90-cce9-1e9eeacaa0e2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13393-93-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "83f02ab8-1512-f116-daeb-5e2fd5fcb5c7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8491b27c-3dc8-436f-94c3-cb8d0ebd0bb2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0f0caa80-71b1-4566-be88-46cf420446e8",
          "id": "0f0caa80-71b1-4566-be88-46cf420446e8",
          "molfile": "\n  Marvin  01132101012D          \n\n 21 23  0  0  1  0            999 V2000\n    8.3462   -5.5124    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.3462   -4.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0962   -4.2908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7875   -4.7448    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.7875   -5.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0550   -5.9283    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.0550   -6.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3404   -7.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6168   -6.7279    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.8727   -7.1351    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.0866   -7.9319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4538   -7.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6677   -8.6466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1902   -6.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1902   -5.8755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9401   -5.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6168   -5.9047    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.6168   -5.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5520   -4.3259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5520   -3.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2580   -4.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  6  1  1  0  0  0  0\n  1 17  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n 19  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  1  0  0  0\n 10  9  1  0  0  0  0\n  9 17  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 14 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C1CC[C@H]2C(CC[C@H]3[C@@](C)(CCC[C@]23C)CO)C1",
          "formula": "C20H36O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "57bf1a99-94bc-4a6a-a8d7-0eb3fe91c0e4"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "292.5",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "995039ee-f6fd-48c2-9087-aeff9f90d570",
      "version": "4",
      "structure": {
        "id": "f1facd5b-9b07-4deb-bcc0-b4b330ba3c1d",
        "molfile": "\n  Marvin  01132112332D          \n\n 23 25  0  0  1  0            999 V2000\n    7.6312   -5.9159    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0722   -5.9395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6312   -6.7407    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8857   -7.1486    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3620   -5.5228    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.8060   -5.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8060   -4.7538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4660   -7.8589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0722   -6.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3562   -7.1633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3620   -4.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1134   -4.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5720   -4.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9533   -5.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6803   -8.6630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6312   -5.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2019   -6.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1000   -7.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2019   -5.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5720   -3.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2793   -4.7538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3620   -6.3386    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6312   -7.5625    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  6  1  0  0  0  0\n  4  8  1  6  0  0  0\n  9  2  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14  1  1  0  0  0  0\n 15  8  1  0  0  0  0\n  1 16  1  1  0  0  0\n 17  4  1  0  0  0  0\n  4 18  1  1  0  0  0\n 19 14  1  0  0  0  0\n 20 13  1  0  0  0  0\n 21 13  1  0  0  0  0\n  5 22  1  6  0  0  0\n  3 23  1  6  0  0  0\n  9 10  1  0  0  0  0\n 19 17  1  0  0  0  0\n 12  7  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C1CC[C@@]2([H])C(CC[C@@]3([H])[C@@](C)(CCC[C@]23C)CO)C1",
        "formula": "C20H36O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "292.5",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "89758690-cbd5-43f0-bf4c-75f6fe59da77",
          "e498df4e-4a2c-454d-bee2-bb6b3bac8d3d"
        ],
        "stereo_centers": 6
      },
      "unii": "2RMS84XMDF"
    }
  ]
}