{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "49b5ef17-2251-4f33-a42d-0eb7cce7c782",
          "code": "20554-84-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20554-84-1",
          "code_system": "CAS",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded",
            "57736e16-8fcb-4599-a145-abad46678325"
          ]
        },
        {
          "uuid": "79880075-a948-44d1-b62d-ffbabfd1b0a6",
          "code": "C002669",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67002669",
          "code_system": "MESH",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "a42188c5-a500-4562-8d23-5ac535fd3df4",
          "code": "PARTHENOLIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Parthenolide",
          "code_system": "WIKIPEDIA",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "8d2564f4-28bc-45a6-a205-0836e961a29c",
          "code": "N0000185508",
          "comments": "Established Pharmacologic Class [EPC]|Standardized Chemical Allergen [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000185508",
          "code_system": "NDF-RT",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "4982f139-3a70-4c6d-89b2-9d463814d6d4",
          "code": "32941",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/32941/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "8f3f76eb-98d1-4925-b457-75309a1428cf",
          "code": "m8422",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8422?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "4258b25c-d0e6-46b0-b6f0-cc8a65ca2f3f",
          "code": "SUB176432",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "5caab865-5a61-478f-ac29-022149fe2adc",
          "code": "N0000171131",
          "comments": "Allergens [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000171131",
          "code_system": "NDF-RT",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "14922982-7242-4db7-9a10-983368f97d5e",
          "code": "N0000184306",
          "comments": "Cell-mediated Immunity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000184306",
          "code_system": "NDF-RT",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "10f4f0c6-25f0-49bf-bf17-894bfc7e1e94",
          "code": "N0000175629",
          "comments": "Increased Histamine Release [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175629",
          "code_system": "NDF-RT",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "3f1020b7-a717-4323-8223-9b55b027c9d5",
          "code": "5420805",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5420805",
          "code_system": "PUBCHEM",
          "references": [
            "054c28ec-1f85-46a3-a30a-127c834fdded"
          ]
        },
        {
          "uuid": "7a14ca10-9861-4756-3b00-095746d46be2",
          "code": "DTXSID2040579",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2040579",
          "code_system": "EPA CompTox",
          "references": [
            "aae5fde5-e047-afe0-5c21-bfa2e4d986eb"
          ]
        },
        {
          "uuid": "7b10c7b4-e4a4-caf0-18b9-75c28b9515d0",
          "code": "3154 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|chemical|Parthenolide",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3154&item=Parthenolide",
          "code_system": "DSLD",
          "references": [
            "6942daa4-8606-ea15-faad-094892a55909"
          ]
        },
        {
          "uuid": "173e3467-8dd3-f697-0fb9-c1c0d107923c",
          "code": "DB13063",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13063",
          "code_system": "DRUG BANK",
          "references": [
            "6942daa4-8606-ea15-faad-094892a55909"
          ]
        },
        {
          "uuid": "4a4a7eec-42c1-44d9-a399-1640ceb1730f",
          "code": "2RDB26I5ZB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3af92312-c275-58f0-241d-b2d0c73219b0",
          "code": "7939",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:7939",
          "code_system": "CHEBI",
          "references": [
            "6942daa4-8606-ea15-faad-094892a55909"
          ]
        },
        {
          "uuid": "7552dbea-9c2f-c0b9-a211-0215ecc2a0a5",
          "code": "1500400",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1500400",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "6942daa4-8606-ea15-faad-094892a55909"
          ]
        },
        {
          "uuid": "cb882187-a31a-ba4f-75dd-9de5525a3287",
          "code": "157035",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=157035",
          "code_system": "NSC",
          "references": [
            "95a2ebe5-e737-f090-8cb0-151cb7c6902f"
          ]
        },
        {
          "uuid": "f4466c05-15fd-373d-30cb-ebae3ccc3169",
          "code": "2RDB26I5ZB",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2RDB26I5ZB",
          "code_system": "DAILYMED",
          "references": [
            "e0f14277-1d28-d4f0-16fa-5eb55a435154"
          ]
        },
        {
          "uuid": "8a10edff-402b-84b1-96a6-1eaf23e500e8",
          "code": "100000162612",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7df24b66-569a-70a0-8651-2da6ec57020c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "09e7f539-c959-4d54-a857-dc3593453dc4",
          "amount": {
            "uuid": "d6fa4b3d-f710-4869-85ec-034ac1667c9d"
          },
          "type": "PARENT->ACTIVE CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "9da5dfc9-de22-4a00-a158-fa8fe51b46c5",
            "refuuid": "f709653d-32e2-4500-896d-6f11aee38aae",
            "name": "FEVERFEW",
            "unii": "Z64FK7P217",
            "linking_id": "Z64FK7P217",
            "ref_pname": "FEVERFEW",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b3e055d3-c570-4584-b69e-49a423bd752a",
          "amount": {
            "uuid": "ea467b4a-bb11-464f-a323-53bbbb14bedf"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b4e98f16-ec90-4878-8590-5b46e2b12b39",
            "refuuid": "a031e532-e1bc-42dc-bb30-84692f721f8b",
            "name": "PARTHENOLIDE",
            "unii": "2RDB26I5ZB",
            "linking_id": "2RDB26I5ZB",
            "ref_pname": "PARTHENOLIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9431a264-7a63-4608-b4a6-d8ee8913f016",
          "amount": {
            "uuid": "6a7db19b-4630-4e2b-87d3-31ea6fdb0249"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "9cb9d435-c762-4b9c-b1d1-28070083c2f0"
          ],
          "related_substance": {
            "uuid": "558f3c47-b5a8-49e0-83ff-9850151fc68b",
            "refuuid": "1f663232-f6c2-c430-fbaa-c6f45f3fce14",
            "name": "NF-KAPPA-B P105-P50 COMPLEX",
            "unii": "7PI2F660EL",
            "linking_id": "7PI2F660EL",
            "ref_pname": "NF-KAPPA-B P105-P50 COMPLEX",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "355e65d8-cf86-4ab8-a290-964bbe60d681",
          "amount": {
            "uuid": "1d667204-6acb-4a0e-b02d-641edfb86d7b"
          },
          "type": "TARGET->AGONIST",
          "references": [
            "0d3b0fdf-64c8-41ca-ab7c-8c7db355c2c9"
          ],
          "related_substance": {
            "uuid": "19f12413-2607-495a-8bdb-f2bbdcd18b99",
            "refuuid": "c1952f84-846d-5324-d1e6-f1b6c13244cd",
            "name": "ADIPONECTIN RECEPTOR PROTEIN 2",
            "unii": "EM7D17Z5WS",
            "linking_id": "EM7D17Z5WS",
            "ref_pname": "ADIPONECTIN RECEPTOR PROTEIN 2",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5e66347e-cda2-43ab-bf14-98896670a3d5",
          "name": "(1AR,4E,7AS,10AS,10BS)-2,3,6,7,7A,8,10A,10B-OCTAHYDRO-1A,5-DIMETHYL-8-METHYLENEOXIRENO(9,10)CYCLODECA(1,2-B)FURAN-9(1AH)-ONE",
          "stdName": "(1AR,4E,7AS,10AS,10BS)-2,3,6,7,7A,8,10A,10B-OCTAHYDRO-1A,5-DIMETHYL-8-METHYLENEOXIRENO(9,10)CYCLODECA(1,2-B)FURAN-9(1AH)-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3594349f-0f1d-4572-8818-f982a8c19dc1",
            "0f11106e-b201-4b0f-8426-93f770c40464"
          ],
          "display_name": false
        },
        {
          "uuid": "25d1b2ef-7d72-40d3-86be-d3815b98e4f8",
          "name": "4,5.ALPHA.-EPOXY-6.BETA.-HYDROXY-GERMACRA-1(10),11(13)-DIEN-12-OIC ACID .GAMMA.-LACTONE",
          "stdName": "4,5.ALPHA.-EPOXY-6.BETA.-HYDROXY-GERMACRA-1(10),11(13)-DIEN-12-OIC ACID .GAMMA.-LACTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3594349f-0f1d-4572-8818-f982a8c19dc1",
            "0f11106e-b201-4b0f-8426-93f770c40464"
          ],
          "display_name": false
        },
        {
          "uuid": "3b11c43a-7c0c-461e-9f39-b47341bbf78c",
          "name": "NSC-157035",
          "stdName": "NSC-157035",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3594349f-0f1d-4572-8818-f982a8c19dc1",
            "0f11106e-b201-4b0f-8426-93f770c40464"
          ],
          "display_name": false
        },
        {
          "uuid": "3940636b-2b7a-430c-b653-69bc62818bf6",
          "name": "PARTHENOLIDE",
          "stdName": "PARTHENOLIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9306675c-29f9-4c09-b3f6-36e14eeb9f97",
            "f84540aa-6353-4f80-934f-c2e9e87de095",
            "0a0d85fc-9bd6-4273-a87d-d7d65254f540",
            "3594349f-0f1d-4572-8818-f982a8c19dc1",
            "ea377fe4-97e9-4027-966e-9350ce99f661",
            "0f11106e-b201-4b0f-8426-93f770c40464",
            "2e08aeb6-45d9-47ee-b180-416d5d359a6a",
            "43e5cff8-2f88-45ea-9be7-c1fe97cd5a19"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "64a22703-8536-4bd0-851f-73df03734521",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "24c9d154-0bac-475f-8517-9cba0cda516b",
          "name": "PARTHENOLIDE (CONSTITUENT OF FEVERFEW) [DSC]",
          "stdName": "PARTHENOLIDE (CONSTITUENT OF FEVERFEW) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e06ba589-ebb5-4eab-8bbf-a143f90ad0fa",
            "0f11106e-b201-4b0f-8426-93f770c40464"
          ],
          "display_name": false
        },
        {
          "uuid": "c125458a-cae2-490f-abae-2f017430f254",
          "name": "PARTHENOLIDE [MI]",
          "stdName": "PARTHENOLIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9306675c-29f9-4c09-b3f6-36e14eeb9f97",
            "0f11106e-b201-4b0f-8426-93f770c40464"
          ],
          "display_name": false
        },
        {
          "uuid": "612dfc0d-93a1-449f-ab22-9ce9cd0ea8ab",
          "name": "PARTHENOLIDE [USP-RS]",
          "stdName": "PARTHENOLIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea377fe4-97e9-4027-966e-9350ce99f661",
            "0f11106e-b201-4b0f-8426-93f770c40464"
          ],
          "display_name": false
        },
        {
          "uuid": "c3309c0f-93f4-cc09-0b0f-9ce23f01270f",
          "name": "Parthenolide [WHO-DD]",
          "stdName": "PARTHENOLIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c1c2b96-853b-6b28-2b03-f3595b268cd9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3594349f-0f1d-4572-8818-f982a8c19dc1",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0f11106e-b201-4b0f-8426-93f770c40464",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9306675c-29f9-4c09-b3f6-36e14eeb9f97",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea377fe4-97e9-4027-966e-9350ce99f661",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a0d85fc-9bd6-4273-a87d-d7d65254f540",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e06ba589-ebb5-4eab-8bbf-a143f90ad0fa",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "054c28ec-1f85-46a3-a30a-127c834fdded",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390867000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a713c3b7-13b5-48d3-b18a-863becc31cce",
          "citation": "SRS import [2RDB26I5ZB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2RDB26I5ZB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390867000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f84540aa-6353-4f80-934f-c2e9e87de095",
          "citation": "PARTHENOLIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "43e5cff8-2f88-45ea-9be7-c1fe97cd5a19",
          "citation": "PARTHENOLIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2e08aeb6-45d9-47ee-b180-416d5d359a6a",
          "citation": "PARTHENOLIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aae5fde5-e047-afe0-5c21-bfa2e4d986eb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=20554-84-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7df24b66-569a-70a0-8651-2da6ec57020c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a05f6813-f615-8180-1f81-48ee4bb7d3a7",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "57736e16-8fcb-4599-a145-abad46678325",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0d3b0fdf-64c8-41ca-ab7c-8c7db355c2c9",
          "citation": "https://en.wikipedia.org/wiki/Parthenolide",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3ef14d82-eaa8-47a7-a1f0-ca6656c143c3",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "6942daa4-8606-ea15-faad-094892a55909",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9cb9d435-c762-4b9c-b1d1-28070083c2f0",
          "citation": "de Santana Souza, Marilia Trindade, et al. \"Structure–Activity Relationship of Terpenes with Anti‐Inflammatory Profile–A Systematic Review.\" Basic & clinical pharmacology & toxicology 115.3 (2014): 244-256.",
          "url": "https://onlinelibrary.wiley.com/doi/full/10.1111/bcpt.12221",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "95a2ebe5-e737-f090-8cb0-151cb7c6902f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9c1c2b96-853b-6b28-2b03-f3595b268cd9",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e0f14277-1d28-d4f0-16fa-5eb55a435154",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe110005-eaf8-42d4-84ce-250749497fbd",
          "id": "fe110005-eaf8-42d4-84ce-250749497fbd",
          "molfile": "\n  Marvin  03142212272D          \n\n 20 22  0  0  1  0            999 V2000\n   11.2887   -3.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2887   -3.9356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0010   -4.3494    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.7178   -3.9356    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.4303   -4.3494    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.1472   -3.9357    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.1472   -3.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4303   -2.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7178   -3.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0010   -2.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7792   -2.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7596   -4.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4251   -5.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6052   -5.1513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6404   -6.0356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4720   -4.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5566   -3.2187    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2197   -5.1426    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5882   -4.9273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2367   -4.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 19  1  6  0  0  0\n  3 20  1  1  0  0  0\n  4  5  1  0  0  0  0\n  4 19  1  6  0  0  0\n  5  6  1  0  0  0  0\n  5 14  1  0  0  0  0\n  5 18  1  1  0  0  0\n  6  7  1  0  0  0  0\n  6 12  1  0  0  0  0\n  6 17  1  6  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 16  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  END",
          "smiles": "C/C/1=C/CC[C@]2(C)[C@@H]([C@]3([H])[C@@]([H])(CC1)C(=C)C(=O)O3)O2",
          "formula": "C15H20O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7b42058b-2f74-41b5-a245-726e13d91eed"
          },
          "defined_stereo": 4,
          "ez_centers": 1,
          "molecular_weight": "248.3181",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a031e532-e1bc-42dc-bb30-84692f721f8b",
      "version": "20",
      "structure": {
        "id": "847c5bed-5348-4cbe-9037-a28d82eb6b69",
        "molfile": "\n   JSDraw203142212272D\n\n 20 22  0  0  1  0              0 V2000\n   21.2750   -5.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2750   -7.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6175   -8.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9685   -7.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3113   -8.1971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6624   -7.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6624   -5.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3113   -5.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9685   -5.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6175   -5.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.0842   -4.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8164   -8.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1860   -9.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6408   -9.7084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.5919  -11.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.1590   -7.6790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.4338   -6.0660    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   24.9144   -9.6920    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7241   -9.2861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1770   -9.1507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  1 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  6 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  5 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 12 16  2  0  0  0  0\n  6 17  1  6  0  0  0\n  5 18  1  1  0  0  0\n  4 19  1  6  0  0  0\n  3 19  1  6  0  0  0\n  3 20  1  1  0  0  0\nM  END",
        "smiles": "C/C/1=C/CC[C@]2(C)[C@@H]([C@]3([H])[C@@]([H])(CC1)C(=C)C(=O)O3)O2",
        "formula": "C15H20O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 1,
        "molecular_weight": "248.3181",
        "optical_activity": "( - )",
        "references": [
          "3594349f-0f1d-4572-8818-f982a8c19dc1",
          "a713c3b7-13b5-48d3-b18a-863becc31cce"
        ],
        "stereo_centers": 4
      },
      "unii": "2RDB26I5ZB"
    }
  ]
}