{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8edbc617-be18-4b99-bcc3-1bc54ce8c18f", "code": "2RAF5TL6V2", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8594b7e8-ac19-558a-e2aa-cfca3b55e586", "code": "DTXSID30427741", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30427741", "code_system": "EPA CompTox", "references": [ "101b5944-2975-3942-a4b8-09b5bbd01487" ] }, { "uuid": "6a3bb17c-7b60-4b91-9971-3062c9d6b5a4", "code": "5571-36-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=5571-36-8", "code_system": "CAS", "references": [ "7343c042-15f3-4fae-9c61-44935e5ff034" ] }, { "uuid": "dcb29d66-251e-37af-541d-a879364a5beb", "code": "7076399", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7076399", "code_system": "PUBCHEM", "references": [ "139311ef-d293-a3d0-c7f7-c1f0e315dfa8" ] }, { "uuid": "a6a7bb8b-97f1-03cc-a941-e46783898b25", "code": "300000052936", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "53e1fa40-21b1-e117-76a5-adb690657d28" ] } ], "substance_class": "chemical", "names": [ { "uuid": "f3d3bcef-c599-42e0-91f1-a26e2e3dcfa4", "name": "3,3-(Ethylenedioxy)estra-5(10),9(11)-dien-17-one", "stdName": "3,3-(ETHYLENEDIOXY)ESTRA-5(10),9(11)-DIEN-17-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7343c042-15f3-4fae-9c61-44935e5ff034" ], "display_name": true }, { "uuid": "029eb2f0-7666-47ee-8f5d-ae505d9eb32a", "name": "Estra-5(10),9(11)-diene-3,17-dione, cyclic 3-(1,2-ethanediyl acetal)", "stdName": "ESTRA-5(10),9(11)-DIENE-3,17-DIONE, CYCLIC 3-(1,2-ETHANEDIYL ACETAL)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7343c042-15f3-4fae-9c61-44935e5ff034" ], "display_name": false }, { "uuid": "95f5c2b4-e15f-47cc-a6dd-7b40ec184165", "name": "Estradiene dione-3-keta", "stdName": "ESTRADIENE DIONE-3-KETA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7343c042-15f3-4fae-9c61-44935e5ff034" ], "display_name": false }, { "uuid": "7292a0f2-0660-446b-8425-8749cc5a338f", "name": "Ethylene deltenone", "stdName": "ETHYLENE DELTENONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7343c042-15f3-4fae-9c61-44935e5ff034" ], "display_name": false } ], "references": [ { "uuid": "139311ef-d293-a3d0-c7f7-c1f0e315dfa8", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "7343c042-15f3-4fae-9c61-44935e5ff034", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "101b5944-2975-3942-a4b8-09b5bbd01487", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "53e1fa40-21b1-e117-76a5-adb690657d28", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "73bb1cf4-abfe-4a9f-af73-e81405b81c11", "id": "73bb1cf4-abfe-4a9f-af73-e81405b81c11", "molfile": "\n Marvin 03242311482D \n\n 25 29 0 0 1 0 999 V2000\n -1.1959 0.7563 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7834 0.0418 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.4979 -0.3707 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.4979 -1.1957 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.7834 -1.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4391 -2.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2825 -1.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5374 -2.2352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2825 -0.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7674 -0.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4391 0.4522 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7834 0.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0689 1.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0689 -0.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0689 -1.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6455 0.0418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3600 -0.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0745 0.0418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0745 0.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8282 0.5313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3802 1.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1607 1.6873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9677 1.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6455 0.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3600 1.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 2 12 1 0 0 0 0\n 2 14 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 9 1 0 0 0 0\n 3 11 1 6 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 1 0 0 0\n 4 7 1 0 0 0 0\n 5 15 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 10 1 0 0 0 0\n 9 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 24 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 24 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 22 1 0 0 0 0\n 19 25 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 23 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 25 1 0 0 0 0\nM END", "smiles": "C[C@@]12CC=C3C4=C(CC[C@@]3([H])[C@]2([H])CCC1=O)CC5(CC4)OCCO5", "formula": "C20H26O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cb0e7bdf-7332-460b-a6fa-375d06be4e5f" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "314.4194", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "9fee214b-c473-4ef2-bb1f-e2084b7aa162", "version": "9", "structure": { "id": "e927a467-922c-4044-ba8c-c192ad98a3c7", "molfile": "Estra-5(10),9(11)-dien-3-one, 17-hydroxy-17-(1-propyn-1-yl)-, cyclic 1,2-etha...\n JSDraw203242314102D\n\n 25 29 0 0 1 0 0 V2000\n 28.5921 -4.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5921 -7.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2318 -7.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5921 -5.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.0702 -7.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8901 -7.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2318 -9.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1003 -5.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2691 -4.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0020 -6.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5298 -7.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8901 -5.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8528 -10.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5298 -9.5202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1882 -7.1641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1509 -10.2841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8092 -7.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8092 -9.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3918 -8.8364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6277 -11.0375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.3340 -9.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0979 -11.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3559 -8.5887 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3218 -9.1087 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 30.4098 -4.0484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 23 1 6 0 0 0\n 3 6 1 0 0 0 0\n 3 7 1 0 0 0 0\n 3 24 1 1 0 0 0\n 4 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 5 10 1 0 0 0 0\n 6 11 1 0 0 0 0\n 6 12 2 0 0 0 0\n 7 13 1 0 0 0 0\n 8 10 1 0 0 0 0\n 9 12 1 0 0 0 0\n 11 14 2 0 0 0 0\n 11 15 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 21 22 1 0 0 0 0\n 8 25 2 0 0 0 0\nM END", "smiles": "C[C@@]12CC=C3C4=C(CC[C@@]3([H])[C@]2([H])CCC1=O)CC5(CC4)OCCO5", "formula": "C20H26O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "314.4194", "optical_activity": "UNSPECIFIED", "references": [ "7343c042-15f3-4fae-9c61-44935e5ff034" ], "stereo_centers": 3 }, "unii": "2RAF5TL6V2" } ] }