{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1df7af11-5940-4b9b-b528-214f2cd2d564",
          "code": "6358-53-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6358-53-8",
          "code_system": "CAS",
          "references": [
            "4a51bd70-2dcd-45db-9021-61d977cdb505",
            "22113fa0-514d-4a3e-ab86-0bef996ea60b"
          ]
        },
        {
          "uuid": "26a33bb9-7d83-4523-be75-d761160d1ef9",
          "code": "C007081",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67007081",
          "code_system": "MESH",
          "references": [
            "4a51bd70-2dcd-45db-9021-61d977cdb505"
          ]
        },
        {
          "uuid": "7eeddbae-1ccc-486a-88d1-f28ad0421ed9",
          "code": "CITRUS RED 2",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Citrus_Red_2",
          "code_system": "WIKIPEDIA",
          "references": [
            "4a51bd70-2dcd-45db-9021-61d977cdb505"
          ]
        },
        {
          "uuid": "13218004-ebc8-4a8b-acd9-46e823641038",
          "code": "C75670",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75670",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4a51bd70-2dcd-45db-9021-61d977cdb505"
          ]
        },
        {
          "uuid": "ebdb1324-1c8b-4e6a-b53f-0ae8f0d77f80",
          "code": "21CFR74.302",
          "comments": "PART 74 -- LISTING OF COLOR ADDITIVES SUBJECT TO CERTIFICATION|Subpart A--Foods|Sec.74.302 Citrus Red No.2.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=74.302",
          "code_system": "CFR",
          "references": [
            "4a51bd70-2dcd-45db-9021-61d977cdb505"
          ]
        },
        {
          "uuid": "ce169a7d-6cdf-4045-9693-3e42c49d94a9",
          "code": "m3602",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3602?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4a51bd70-2dcd-45db-9021-61d977cdb505"
          ]
        },
        {
          "uuid": "cbabd9cd-bc80-422d-a8eb-3e8568d784fc",
          "code": "228-778-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.162",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4a51bd70-2dcd-45db-9021-61d977cdb505"
          ]
        },
        {
          "uuid": "db782f18-a57a-04a5-0a50-535f3d39754d",
          "code": "2948",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2948",
          "code_system": "HSDB",
          "references": [
            "04f984a6-7b74-6f98-2e17-cfe5f3889f16"
          ]
        },
        {
          "uuid": "ac98c4b2-5b06-aff6-6c88-b66f71d46a1d",
          "code": "DTXSID6024838",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6024838",
          "code_system": "EPA CompTox",
          "references": [
            "18f286c9-8272-a5d1-968e-21918e45a1e4"
          ]
        },
        {
          "uuid": "608a2f56-aa1b-ede0-10ce-39a79e3f5630",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1fbf539c-8f27-a62d-a71e-0d35423c6cf8"
          ]
        },
        {
          "uuid": "a6db37a2-b7de-4c3b-8c65-5bb68777271c",
          "code": "2QE5Y68984",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ef04015c-acc1-4ea0-b96d-88651c3330c5",
          "name": "1-(2,5-DIMETHOXYPHENYLAZO)-2-NAPHTHOL",
          "stdName": "1-(2,5-DIMETHOXYPHENYLAZO)-2-NAPHTHOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47ffb920-5d87-4197-bbda-d44f55c32b88",
            "abcd05dc-97f4-406c-ba26-8321b83d652b"
          ],
          "display_name": false
        },
        {
          "uuid": "47ce60fe-39ec-4db3-88cb-f82c38dc554d",
          "name": "C.I. 12156",
          "stdName": "C.I. 12156",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54a1ec9c-adf7-41ea-b973-f828b6e8d786",
            "736d3554-f2c6-448f-925e-e9289a2cff20"
          ],
          "display_name": false
        },
        {
          "uuid": "6f3695f5-f71c-4a62-ba4f-c961a3d6453a",
          "name": "C.I. SOLVENT RED 80",
          "stdName": "C.I. SOLVENT RED 80",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47ffb920-5d87-4197-bbda-d44f55c32b88",
            "08c68948-4d5c-43fb-8afa-76ebdba2e7bd"
          ],
          "display_name": false
        },
        {
          "uuid": "eb10b2d3-3c3f-4c5f-a21d-137ff388e942",
          "name": "CI 12156",
          "stdName": "CI 12156",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "736d3554-f2c6-448f-925e-e9289a2cff20",
            "a90b67ef-e37c-4fed-9317-b5d3ceee0d0d"
          ],
          "display_name": false
        },
        {
          "uuid": "634b0601-6aaa-4b19-be38-0134b61a22b6",
          "name": "CITRUS RED 2",
          "stdName": "CITRUS RED 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "736d3554-f2c6-448f-925e-e9289a2cff20",
            "b174b5f9-e11f-4de3-83d8-bba57cc22b5f",
            "aaa84af8-a4f7-408f-9dea-8dda7311a556",
            "790b69c9-5e24-4754-b5cd-3e8ab8944abf",
            "5b5c736a-1785-4a0a-99ed-8915849975f9",
            "a599271f-8155-4245-bca3-fed5d113ae95",
            "76580b23-fe7d-47af-9238-5154688be85b",
            "14c3b856-0057-4575-9bd1-9ef4a64dafe0"
          ],
          "display_name": false
        },
        {
          "uuid": "fc0437f6-7a9b-45d7-b1fb-ffd9eca792b8",
          "name": "CITRUS RED 2 [HSDB]",
          "stdName": "CITRUS RED 2 [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "736d3554-f2c6-448f-925e-e9289a2cff20",
            "a599271f-8155-4245-bca3-fed5d113ae95"
          ],
          "display_name": false
        },
        {
          "uuid": "9654a576-8475-44cb-932a-beefebc3fdfb",
          "name": "CITRUS RED 2 [MART.]",
          "stdName": "CITRUS RED 2 [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "790b69c9-5e24-4754-b5cd-3e8ab8944abf"
          ],
          "display_name": false
        },
        {
          "uuid": "38c19d03-9b62-48e8-8005-c0375403c1b5",
          "name": "CITRUS RED 2 [MI]",
          "stdName": "CITRUS RED 2 [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "736d3554-f2c6-448f-925e-e9289a2cff20",
            "76580b23-fe7d-47af-9238-5154688be85b"
          ],
          "display_name": false
        },
        {
          "uuid": "5ef60352-a783-4750-ae82-f953a737eb40",
          "name": "CITRUS RED NO. 2",
          "stdName": "CITRUS RED NO. 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47ffb920-5d87-4197-bbda-d44f55c32b88",
            "abcd05dc-97f4-406c-ba26-8321b83d652b"
          ],
          "display_name": true
        },
        {
          "uuid": "b80a7264-0ed8-e78e-a8a3-c0a79153bb22",
          "name": "CITRUS RED NO. 2 [IARC]",
          "stdName": "CITRUS RED NO. 2 [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93264cee-243b-8355-049d-1c83498d9489"
          ],
          "display_name": false
        },
        {
          "uuid": "ef172dfc-ca49-488f-9400-4ebb43211131",
          "name": "E-121",
          "stdName": "E-121",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "736d3554-f2c6-448f-925e-e9289a2cff20",
            "42a643b1-7774-46c1-95cd-d2e8681d93f0"
          ],
          "display_name": false
        },
        {
          "uuid": "b5082352-7440-42aa-855c-d512b3714773",
          "name": "SOLVENT RED 80",
          "stdName": "SOLVENT RED 80",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "736d3554-f2c6-448f-925e-e9289a2cff20",
            "42a643b1-7774-46c1-95cd-d2e8681d93f0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "47ffb920-5d87-4197-bbda-d44f55c32b88",
          "citation": "ChemIDPlus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "abcd05dc-97f4-406c-ba26-8321b83d652b",
          "citation": "21CFR74.302",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "269ba967-ac99-4012-86d2-c288319ea5b6",
          "citation": "ACD 8.0(MERCK13)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08c68948-4d5c-43fb-8afa-76ebdba2e7bd",
          "citation": "MERCK13",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54a1ec9c-adf7-41ea-b973-f828b6e8d786",
          "citation": "Merck Index 13th Edition",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "736d3554-f2c6-448f-925e-e9289a2cff20",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a90b67ef-e37c-4fed-9317-b5d3ceee0d0d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14c3b856-0057-4575-9bd1-9ef4a64dafe0",
          "citation": "Wikipedia",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "790b69c9-5e24-4754-b5cd-3e8ab8944abf",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76580b23-fe7d-47af-9238-5154688be85b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a599271f-8155-4245-bca3-fed5d113ae95",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42a643b1-7774-46c1-95cd-d2e8681d93f0",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a51bd70-2dcd-45db-9021-61d977cdb505",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389937000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6eb51083-6225-4ef9-bd37-3c96509b4894",
          "citation": "SRS import [2QE5Y68984]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2QE5Y68984",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389937000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a994528f-7e59-427f-b91b-ca05c0e1e03b",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b174b5f9-e11f-4de3-83d8-bba57cc22b5f",
          "citation": "CITRUS RED 2 [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5b5c736a-1785-4a0a-99ed-8915849975f9",
          "citation": "CITRUS RED 2 [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aaa84af8-a4f7-408f-9dea-8dda7311a556",
          "citation": "CITRUS RED 2 [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "04f984a6-7b74-6f98-2e17-cfe5f3889f16",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+6358-53-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "18f286c9-8272-a5d1-968e-21918e45a1e4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6358-53-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "93264cee-243b-8355-049d-1c83498d9489",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "1fbf539c-8f27-a62d-a71e-0d35423c6cf8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "22113fa0-514d-4a3e-ab86-0bef996ea60b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d95d0bc3-cf47-4c45-b4ad-3d104fa95e65",
          "id": "d95d0bc3-cf47-4c45-b4ad-3d104fa95e65",
          "molfile": "\n  Marvin  01132111162D          \n\n 23 25  0  0  0  0            999 V2000\n    5.9450   -5.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3642   -4.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9511   -4.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3653   -3.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9475   -2.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1230   -2.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7050   -1.8732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1183   -1.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7138   -3.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1252   -4.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8871   -3.3096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4738   -4.0278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6448   -4.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2321   -3.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6442   -2.5973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4071   -3.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0028   -4.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4149   -4.7424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0040   -5.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4155   -6.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2405   -6.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6550   -5.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2367   -4.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 10  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  9  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 23 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 23  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc(c(c1)/N=N/c2c3ccccc3ccc2O)OC",
          "formula": "C18H16N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "923230f0-ef93-47d4-b0a5-daabd26f8895"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "308.3319",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6f8770a8-f93a-4db8-bf8b-d210e84c020e",
      "version": "8",
      "structure": {
        "id": "581f197f-fb62-4c8b-8031-e8ee623a673c",
        "molfile": "\n  Marvin  01132104342D          \n\n 23 25  0  0  0  0            999 V2000\n    1.0040   -5.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4155   -6.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2405   -6.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6550   -5.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4149   -4.7424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2367   -4.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6448   -4.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2321   -3.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4071   -3.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0028   -4.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4738   -4.0278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8871   -3.3096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7138   -3.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1252   -4.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9511   -4.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3653   -3.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9475   -2.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1230   -2.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3642   -4.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6442   -2.5973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7050   -1.8732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1183   -1.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9450   -5.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  7 11  1  0  0  0  0\n  2  3  1  0  0  0  0\n 11 12  2  0  0  0  0\n  5  6  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1  2  2  0  0  0  0\n 13 14  2  0  0  0  0\n  6  7  2  0  0  0  0\n 14 15  1  0  0  0  0\n  3  4  2  0  0  0  0\n 15 16  2  0  0  0  0\n  7  8  1  0  0  0  0\n 16 17  1  0  0  0  0\n  4  6  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 13  1  0  0  0  0\n  8  9  2  0  0  0  0\n 15 19  1  0  0  0  0\n  5  1  1  0  0  0  0\n  8 20  1  0  0  0  0\n  9 10  1  0  0  0  0\n 18 21  1  0  0  0  0\n 10  5  2  0  0  0  0\n 21 22  1  0  0  0  0\n 19 23  1  0  0  0  0\nM  END",
        "smiles": "COc1ccc(c(c1)/N=N/c2c3ccccc3ccc2O)OC",
        "formula": "C18H16N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "308.3319",
        "optical_activity": "NONE",
        "references": [
          "a994528f-7e59-427f-b91b-ca05c0e1e03b",
          "6eb51083-6225-4ef9-bd37-3c96509b4894"
        ],
        "stereo_centers": 0
      },
      "unii": "2QE5Y68984"
    }
  ]
}