{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cc214e88-19de-49d3-b587-cc665db867a2",
          "code": "5794-13-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5794-13-8",
          "code_system": "CAS",
          "references": [
            "75a2c191-4579-4854-adb6-d705e60fcb0f",
            "f2bc7742-9ea9-478a-9d87-0d63132204e8"
          ]
        },
        {
          "uuid": "67c77480-b19b-4cb9-bc11-cab209f27492",
          "code": "C87433",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87433",
          "code_system": "NCI_THESAURUS",
          "references": [
            "75a2c191-4579-4854-adb6-d705e60fcb0f"
          ]
        },
        {
          "uuid": "06cc7fe0-acc9-4b88-8e72-f78593103d9e",
          "code": "1666924",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1666924/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "75a2c191-4579-4854-adb6-d705e60fcb0f"
          ]
        },
        {
          "uuid": "f363276d-9f0d-420d-985a-6e3ac128237e",
          "code": "SUB26049",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "75a2c191-4579-4854-adb6-d705e60fcb0f"
          ]
        },
        {
          "uuid": "fbff4dc7-6213-4db1-85c7-c7794e4fa247",
          "code": "SUB127325",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "75a2c191-4579-4854-adb6-d705e60fcb0f"
          ]
        },
        {
          "uuid": "5d6d8642-2fe8-4079-9171-64cf3825cc78",
          "code": "170358",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/170358",
          "code_system": "PUBCHEM",
          "references": [
            "75a2c191-4579-4854-adb6-d705e60fcb0f"
          ]
        },
        {
          "uuid": "20133bc7-3835-b75a-5fc9-cef09834bc43",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b332267e-3793-5ea0-3297-61ac53c59f4b"
          ]
        },
        {
          "uuid": "a8604b63-1bb5-4333-990e-de42bb01e9d3",
          "code": "2PD79VF521",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5ed86847-2a53-4179-fb47-80917ea9d276",
          "code": "1043513",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1043513",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "b332267e-3793-5ea0-3297-61ac53c59f4b"
          ]
        },
        {
          "uuid": "6b08359a-5d76-c9a5-c480-daf4e0531b59",
          "code": "100000153357",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "dcd0e6c6-0bfb-03ef-8a57-2c03f849a197"
          ]
        },
        {
          "uuid": "7ff892ab-ca40-48b4-c1cd-bc32a595cdd4",
          "code": "2PD79VF521",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2PD79VF521",
          "code_system": "DAILYMED",
          "references": [
            "19f2c478-d5d1-cd23-fb99-0b3637efa567"
          ]
        },
        {
          "uuid": "0d417265-8a11-322e-7edf-1f26d95971d5",
          "code": "DTXSID90973512",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90973512",
          "code_system": "EPA CompTox",
          "references": [
            "b332267e-3793-5ea0-3297-61ac53c59f4b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2553acdb-b5e4-48c7-bab9-34dc48d0cb38",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "2da992ff-db40-49d2-9940-98e4518434cc",
            "refuuid": "d9f1a0ef-b126-42e5-b70d-97e0713f1243",
            "name": "ASPARAGINE",
            "unii": "5Z33R5TKO7",
            "linking_id": "5Z33R5TKO7",
            "ref_pname": "ASPARAGINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c4d42c3a-5b74-4393-b897-7f7be7eb6675",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "515940b9-ee96-4ccb-b74d-fd1c0cb3dcd0",
            "refuuid": "d9f1a0ef-b126-42e5-b70d-97e0713f1243",
            "name": "ASPARAGINE",
            "unii": "5Z33R5TKO7",
            "linking_id": "5Z33R5TKO7",
            "ref_pname": "ASPARAGINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "80163807-493a-2d23-540e-b46a74234e08",
          "amount": {
            "uuid": "80ae491b-495f-4cfa-b760-59f365f6fc37"
          },
          "type": "ANHYDROUS->SOLVATE",
          "references": [
            "f5ce61c4-5960-4b90-aa31-0305fee5180f"
          ],
          "related_substance": {
            "uuid": "16708405-55bb-4824-bcf3-6613a1bc5643",
            "refuuid": "d9f1a0ef-b126-42e5-b70d-97e0713f1243",
            "name": "ASPARAGINE",
            "unii": "5Z33R5TKO7",
            "linking_id": "5Z33R5TKO7",
            "ref_pname": "ASPARAGINE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "96cdaa63-8320-4c04-8a66-e1ded905dad1",
          "name": "ASPARAGINE MONOHYDRATE",
          "stdName": "ASPARAGINE MONOHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37831fed-861d-4b55-acd3-a6f0728b41eb",
            "876f5447-c3b7-4267-a065-f00666eb6dfc",
            "cf8c198f-c641-46ff-9123-afa8d1cd9781",
            "fbfdb5fc-a92a-4908-b983-6c3e928d9c99",
            "65d83c53-67c3-49ed-a3d7-20f88f7e24f8",
            "d75efbb5-7c40-4c9b-b1b0-d4db5b70b9df",
            "963f3941-38a5-42a5-98b8-f075efc1408f"
          ],
          "display_name": true
        },
        {
          "uuid": "e2e39abf-7386-e5f5-4058-f8820df027ac",
          "name": "ASPARAGINE MONOHYDRATE [EP IMPURITY]",
          "stdName": "ASPARAGINE MONOHYDRATE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fbfdb5fc-a92a-4908-b983-6c3e928d9c99"
          ],
          "display_name": false
        },
        {
          "uuid": "092bac03-7f10-966d-687f-1b58f3cacef1",
          "name": "ASPARAGINE MONOHYDRATE [EP MONOGRAPH]",
          "stdName": "ASPARAGINE MONOHYDRATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18210101-96a6-486e-8d9a-1ac72cc2718d"
          ],
          "display_name": false
        },
        {
          "uuid": "9859fb86-455d-4b2a-b79c-26f72e42821e",
          "name": "ASPARAGINE MONOHYDRATE [USP-RS]",
          "stdName": "ASPARAGINE MONOHYDRATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d75efbb5-7c40-4c9b-b1b0-d4db5b70b9df"
          ],
          "display_name": false
        },
        {
          "uuid": "ebae252c-fff6-4c77-9391-672285d002d9",
          "name": "ASPARAGINE, L-, MONOHYDRATE",
          "stdName": "ASPARAGINE, L-, MONOHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f12a4758-fbdc-4b42-9ff4-2c77c813c663"
          ],
          "display_name": false
        },
        {
          "uuid": "96fcd947-5a8b-5446-b1cb-e848f4b5a2e0",
          "name": "Asparagine monohydrate [WHO-DD]",
          "stdName": "ASPARAGINE MONOHYDRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3e1c741-9559-6cda-9d93-1e641cb0ea2e"
          ],
          "display_name": false
        },
        {
          "uuid": "6da71101-3332-4d70-8685-6288b11384b5",
          "name": "L-ASPARAGINE MONOHYDRATE",
          "stdName": "L-ASPARAGINE MONOHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "963f3941-38a5-42a5-98b8-f075efc1408f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "963f3941-38a5-42a5-98b8-f075efc1408f",
          "citation": "NF 27",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fbfdb5fc-a92a-4908-b983-6c3e928d9c99",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d75efbb5-7c40-4c9b-b1b0-d4db5b70b9df",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65d83c53-67c3-49ed-a3d7-20f88f7e24f8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f12a4758-fbdc-4b42-9ff4-2c77c813c663",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75a2c191-4579-4854-adb6-d705e60fcb0f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389700000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4116946d-4a9e-4eea-922b-ec27d73cb790",
          "citation": "SRS import [2PD79VF521]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2PD79VF521",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389700000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3acce852-3696-4be0-8045-bdf5ad5bae34",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf8c198f-c641-46ff-9123-afa8d1cd9781",
          "citation": "ASPARAGINE MONOHYDRATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "37831fed-861d-4b55-acd3-a6f0728b41eb",
          "citation": "ASPARAGINE MONOHYDRATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "876f5447-c3b7-4267-a065-f00666eb6dfc",
          "citation": "ASPARAGINE MONOHYDRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dcd0e6c6-0bfb-03ef-8a57-2c03f849a197",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b332267e-3793-5ea0-3297-61ac53c59f4b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5feffa83-fb14-5d71-177a-639d747147f7",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "f2bc7742-9ea9-478a-9d87-0d63132204e8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c6cc7b10-db6b-2fc7-6833-67514f08e324",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "18210101-96a6-486e-8d9a-1ac72cc2718d",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "19f2c478-d5d1-cd23-fb99-0b3637efa567",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c3e1c741-9559-6cda-9d93-1e641cb0ea2e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f5ce61c4-5960-4b90-aa31-0305fee5180f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3a9b47b0-7096-4624-a381-787720330fd7",
          "id": "3a9b47b0-7096-4624-a381-787720330fd7",
          "molfile": "\n  Marvin  01132103072D          \n\n  1  0  0  0  1  0            999 V2000\n    6.1637   -1.6008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "O",
          "formula": "H2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ef5e7400-73d8-409a-b68b-ed6c9842af74"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "18.0153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "0bb63f79-89be-4e6a-b8f8-3badf0941de9",
          "id": "0bb63f79-89be-4e6a-b8f8-3badf0941de9",
          "molfile": "\n  Marvin  01132100512D          \n\n  9  8  0  0  1  0            999 V2000\n    3.6094   -1.5771    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.6328   -0.7337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8965   -1.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1937   -1.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4756   -1.9624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1859   -0.7337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3331   -1.9832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3331   -2.8263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0694   -1.5927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H](C(=O)O)N)C(=O)N",
          "formula": "C4H8N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "16cf677a-272b-461a-9126-de7d541d9214"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "132.1181",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "14c19755-9a26-41a2-95f4-c6eec07d7322",
      "version": "17",
      "structure": {
        "id": "ad4468a3-4d9c-4966-8436-c10e7c34f4f7",
        "molfile": "\n  Marvin  01132108592D          \n\n 10  8  0  0  1  0            999 V2000\n    2.8967   -1.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3334   -1.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1939   -1.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6097   -1.5772    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3334   -2.8265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1861   -0.7338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4757   -1.9625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6331   -0.7338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0698   -1.5928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1628   -1.6006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  3  2  0  0  0  0\n  7  3  1  0  0  0  0\n  4  8  1  6  0  0  0\n  9  2  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H](C(=O)O)N)C(=O)N.O",
        "formula": "C4H8N2O3.H2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "150.1334",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4116946d-4a9e-4eea-922b-ec27d73cb790",
          "3acce852-3696-4be0-8045-bdf5ad5bae34"
        ],
        "stereo_centers": 1
      },
      "unii": "2PD79VF521"
    }
  ]
}