{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "dad507da-47e0-428e-b9ca-c69620ba108d", "code": "1313234", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1313234/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "d8a87ee7-6535-4e27-aeb6-59d60989e1be" ] }, { "uuid": "5047b2ec-d890-4db8-ac60-67360ee384e0", "code": "69286", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69286", "code_system": "PUBCHEM", "references": [ "deebb545-1bd1-f70a-a5b3-e18ae18fbad3" ] }, { "uuid": "2f2943c8-3159-466c-a9e7-979e80f6f3f3", "code": "210-647-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.681", "code_system": "ECHA (EC/EINECS)", "references": [ "d8a87ee7-6535-4e27-aeb6-59d60989e1be" ] }, { "uuid": "d206ce4c-7ce7-428e-884d-aff797c80c6c", "code": "620-67-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=620-67-7", "code_system": "CAS", "references": [ "d8a87ee7-6535-4e27-aeb6-59d60989e1be", "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5", "f2eb783f-2dc7-a6ee-4ccc-bff1fc910a77" ] }, { "uuid": "806af074-feb3-4464-8a1f-78772df8dbc8", "code": "C531010", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67531010", "code_system": "MESH", "references": [ "d8a87ee7-6535-4e27-aeb6-59d60989e1be" ] }, { "uuid": "cd0dffad-7938-4fa8-ad85-ff8e11b29cd7", "code": "TRIHEPTANOIN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Triheptanoin", "code_system": "WIKIPEDIA", "references": [ "d8a87ee7-6535-4e27-aeb6-59d60989e1be" ] }, { "uuid": "f48e92a5-6e3f-ae84-a846-10fc1bd4257a", "code": "220306", "comments": "ORPHAN DRUG|Designated|Treatment of fatty acid disorders", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=220306", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "96be832b-9361-6559-fc3b-4a82277f6b0e", "code": "220406", "comments": "ORPHAN DRUG|Designated|Treatment of glycogen storage disorder II (Pompe disease)", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=220406", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "ee8f5cfe-a214-4141-94a8-e2d17c052ccb", "code": "10893", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=10893", "code_system": "INN", "references": [ "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5" ] }, { "uuid": "e8ad8724-9b29-de87-69c5-ddfd474bbd3f", "code": "EU/3/12/1081", "comments": "EU ORPHAN DRUG|Withdrawn|Treatment of very-long-chain 3-hydroxyacyl-CoA-dehydrogenase deficiency", "type": "PRIMARY", "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3121081", "code_system": "EU-Orphan Drug", "references": [ "1d66b541-218a-386e-ee8e-12dd7cf294ea" ] }, { "uuid": "7af7fd97-ddaa-7b83-1807-0c7d5af9daac", "code": "C166587", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C166587", "code_system": "NCI_THESAURUS", "references": [ "ddcf9e63-7e02-0a8b-50f3-39fd13d06f60" ] }, { "uuid": "e0c90111-4b1a-48f4-95a9-903746e86bf2", "code": "2P6O7CFW5K", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b144671a-ae18-e1a9-233a-507212b48020", "code": "DB11677", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB11677", "code_system": "DRUG BANK", "references": [ "1d66b541-218a-386e-ee8e-12dd7cf294ea" ] }, { "uuid": "90121669-e2ef-9ffe-2560-0dff46cb1698", "code": "DTXSID40862306", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40862306", "code_system": "EPA CompTox", "references": [ "1d66b541-218a-386e-ee8e-12dd7cf294ea" ] }, { "uuid": "85632816-86db-1783-62f9-eaa1ab5e2506", "code": "DE-154", "type": "PRIMARY", "url": "https://searchusan.ama-assn.org/finder/usan/search/DE-154/relevant/1/", "code_system": "USAN", "references": [ "a353d6e8-a9ef-3639-20c1-62915a99c159" ] }, { "uuid": "308ffdc8-053a-0e74-a86e-3306799e5f47", "code": "m12212", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m12212", "code_system": "MERCK INDEX", "references": [ "563fea09-63ab-67d5-1002-0bddc268f4c9" ] }, { "uuid": "953bb987-fd96-700c-edfd-bb7fb3923ba2", "code": "2P6O7CFW5K", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2P6O7CFW5K", "code_system": "DAILYMED", "references": [ "3962d158-f92a-2e7f-4a66-5fe703cf7132" ] }, { "uuid": "65fa41df-505b-03c0-0fa7-4da17af674f1", "code": "100000174404", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "90ed5803-4445-7302-4079-33467c817e99" ] }, { "uuid": "a61ca110-f044-ac65-d3f1-b643ba52dcbe", "code": "426414", "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of glucose transporter type-1 deficiency syndrome", "codeText": "ORPHAN DRUG|Designated/Withdrawn|Treatment of glucose transporter type-1 deficiency syndrome", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=426414", "code_system": "FDA ORPHAN DRUG" }, { "uuid": "1990f13f-c6c8-2f10-6c2b-1bbfc9578109", "code": "474015", "comments": "ORPHAN DRUG|Designated/Approved|Treatment of fatty acid oxidation disorders", "codeText": "ORPHAN DRUG|Designated/Approved|Treatment of fatty acid oxidation disorders", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=474015", "code_system": "FDA ORPHAN DRUG" } ], "substance_class": "chemical", "references": [ { "uuid": "54f2bca2-ab13-49fd-a4fa-59e46ba7da50", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5806da00-0bdb-4d05-bf47-7f30c638f22b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d8a87ee7-6535-4e27-aeb6-59d60989e1be", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389857000, "tags": [ "NOMEN" ] }, { "uuid": "b23c108e-2d46-434e-a585-b7c972318713", "citation": "SRS import [2P6O7CFW5K]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2P6O7CFW5K", "doc_type": "SRS", "public_domain": true, "document_date": 1493389857000, "tags": [ "NOMEN" ] }, { "uuid": "91294307-4cb7-4e38-8ff1-62000682dd81", "citation": "TRIHEPTANOIN [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "90ed5803-4445-7302-4079-33467c817e99", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5", "citation": "USAN COUN 2018", "doc_type": "USANCOUN", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "deebb545-1bd1-f70a-a5b3-e18ae18fbad3", "citation": "PUBCHEM", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69286#section=2D-Structure", "doc_type": "NLM", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "47830eea-6d1c-ebb3-cdaf-8464118250ce", "citation": "Mochel, Fanny, et al. \"Pyruvate carboxylase deficiency: clinical and biochemical response to anaplerotic diet therapy.\" Molecular genetics and metabolism 84.4 (2005): 305-312.", "url": "https://www.sciencedirect.com/science/article/pii/S109671920400246X", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f2eb783f-2dc7-a6ee-4ccc-bff1fc910a77", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "55199f40-b9a5-8956-92ee-f4d8d7c7c7a2", "citation": "INN Proposed List 120", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL120.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a353d6e8-a9ef-3639-20c1-62915a99c159", "citation": "USAD COUN", "doc_type": "USANCOUN", "public_domain": true }, { "uuid": "563fea09-63ab-67d5-1002-0bddc268f4c9", "citation": "MERCK", "doc_type": "MERCK INDEX", "public_domain": true }, { "uuid": "1d66b541-218a-386e-ee8e-12dd7cf294ea", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "b78c8155-3d03-f0b0-d66b-c2276fdd95c3", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "e07d2929-d57d-c9f0-f8e2-4781ca959330", "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2020/213687s000lbl.pdf", "doc_type": "DRUGS@FDA", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ddcf9e63-7e02-0a8b-50f3-39fd13d06f60", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "bc7daeb1-adb2-43d8-8a87-fb87057e7df2", "citation": "OB", "url": "https://www.fda.gov/drugs/drug-approvals-and-databases/approved-drug-products-therapeutic-equivalence-evaluations-orange-book", "doc_type": "ORANGE BOOK", "public_domain": true }, { "uuid": "3962d158-f92a-2e7f-4a66-5fe703cf7132", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "aa3b8af9-b28f-4d7e-b179-5d5379c45b8c", "id": "aa3b8af9-b28f-4d7e-b179-5d5379c45b8c", "molfile": "\n Marvin 01132108502D \n\n 30 29 0 0 0 0 999 V2000\n 1.8740 -4.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1652 -3.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4484 -4.3334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2550 -3.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9854 -4.3039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6888 -3.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4057 -4.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4272 -5.1067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1118 -3.8582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7266 -2.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4421 -2.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1602 -1.3049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1372 -1.1223 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5196 -0.5799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6888 0.2309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7357 -0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1262 -0.2819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6632 -0.5316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2699 0.0242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0567 -0.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6715 0.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2258 -2.1184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4445 -2.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2834 -3.1843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8323 -1.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0510 -2.0808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5665 -1.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3505 -1.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9626 -1.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7494 -1.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 22 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 23 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\nM END", "smiles": "CCCCCCC(=O)OCC(COC(=O)CCCCCC)OC(=O)CCCCCC", "formula": "C24H44O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d26df971-9a02-4dd8-a0bd-7ce0a3b56320" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "428.6035", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "fb65a92f-317f-4b4d-a732-abaa47ce0ad5", "version": "80", "structure": { "id": "a5652c57-abba-4eaa-8bd5-b778c5884980", "molfile": "\n JSDraw205152416462D\n\n 30 29 0 0 0 0 0 V2000\n 36.0793 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7282 -11.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3772 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0262 -11.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6751 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3241 -11.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9730 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9730 -13.5461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6220 -11.2061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2710 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9199 -11.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5690 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2180 -11.2061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8669 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8669 -13.5461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5159 -11.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1648 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8138 -11.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4628 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1117 -11.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7607 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9199 -9.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5690 -8.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2180 -9.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5690 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2180 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2180 -4.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8669 -4.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8669 -2.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5159 -1.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 11 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 23 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\nM END", "smiles": "CCCCCCC(=O)OCC(COC(=O)CCCCCC)OC(=O)CCCCCC", "formula": "C24H44O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "428.6035", "optical_activity": "NONE", "references": [ "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5", "5806da00-0bdb-4d05-bf47-7f30c638f22b", "55199f40-b9a5-8956-92ee-f4d8d7c7c7a2" ], "stereo_centers": 0 }, "unii": "2P6O7CFW5K", "relationships": [ { "uuid": "ca35d8f6-6f3c-4090-b0bc-115093149c38", "amount": { "uuid": "66cb6eab-3961-4a16-8c0c-b9e0c97de38f" }, "type": "ACTIVE MOIETY", "references": [ "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5" ], "related_substance": { "uuid": "a1fbc201-4bc3-4b2a-b061-f42180e51a4c", "refuuid": "fb65a92f-317f-4b4d-a732-abaa47ce0ad5", "name": "Triheptanoin", "unii": "2P6O7CFW5K", "linking_id": "2P6O7CFW5K", "ref_pname": "Triheptanoin", "substance_class": "reference" } }, { "uuid": "c3fccf03-8b48-4b4a-87ef-75962064b515", "amount": { "uuid": "99f51d0c-1435-4a17-aa81-510310c38e3a" }, "type": "METABOLITE->PARENT", "references": [ "47830eea-6d1c-ebb3-cdaf-8464118250ce" ], "related_substance": { "uuid": "6327070c-7a18-41fe-932f-a2f1f4281e30", "refuuid": "e12da414-f740-4410-97c1-65a30603571f", "name": "3-OXOVALERIC ACID", "unii": "090PW368EP", "linking_id": "090PW368EP", "ref_pname": "3-OXOVALERIC ACID", "substance_class": "reference" } }, { "uuid": "4a8eb4cc-7cb7-467b-8ed4-8e4b556dc7af", "amount": { "uuid": "5288e74e-9758-40ad-a1f3-ca3a3dbda189" }, "type": "METABOLITE->PARENT", "references": [ "47830eea-6d1c-ebb3-cdaf-8464118250ce" ], "related_substance": { "uuid": "5b69cd9b-ef02-42f4-a0fb-901dca223695", "refuuid": "4c74467a-a391-49a5-8e8a-be5232685296", "name": "3-HYDROXYPENTANOIC ACID", "unii": "9D6K40J6UZ", "linking_id": "9D6K40J6UZ", "ref_pname": "3-HYDROXYPENTANOIC ACID", "substance_class": "reference" } } ], "names": [ { "uuid": "cd5b361f-0cc3-4f69-9620-93787c553e86", "name": "DERMOFEEL TC 7", "stdName": "DERMOFEEL TC 7", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "fec5a841-659a-45b5-8f8a-297e8d32b504", "name": "DERMOFEEL TC-7", "stdName": "DERMOFEEL TC-7", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "8516e5b1-968a-1506-f796-f84a8d0b3509", "name": "DOJOLVI", "stdName": "DOJOLVI", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e07d2929-d57d-c9f0-f8e2-4781ca959330" ], "display_name": false }, { "uuid": "6184b8bf-5cf4-4496-bd37-872b55f125cf", "name": "DUB THG", "stdName": "DUB THG", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "cb64a70c-7849-4933-a221-67d05d265e28", "name": "GLYCEROL TRIHEPTANOATE", "stdName": "GLYCEROL TRIHEPTANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999", "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5" ], "display_name": false }, { "uuid": "0e298a21-32e4-43e8-a1a2-0e4d80846511", "name": "GLYCERYL TRIHEPTANOATE", "stdName": "GLYCERYL TRIHEPTANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "b62a2bd6-7fc7-4f5a-a767-f51ffc943dbc", "name": "HEPTANOIC ACID, 1,1',1''-(1,2,3-PROPANETRIYL) ESTER", "stdName": "HEPTANOIC ACID, 1,1',1''-(1,2,3-PROPANETRIYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5", "5806da00-0bdb-4d05-bf47-7f30c638f22b" ], "display_name": false }, { "uuid": "8b286de8-f716-483a-b11d-5947be9e34c1", "name": "HEPTANOIC ACID, 1,2,3-PROPANETRIYL ESTER", "stdName": "HEPTANOIC ACID, 1,2,3-PROPANETRIYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "3bb4e36d-db8e-462b-b8c5-e220a63852a3", "name": "HEPTANOIN, TRI-", "stdName": "HEPTANOIN, TRI-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "5323310f-6244-4ced-897f-9a52208b129b", "name": "LANOL 37 T", "stdName": "LANOL 37 T", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "164aad9f-4014-6139-c9b4-081e9e83b241", "name": "Propane-1,2,3-triyl triheptanoate", "stdName": "PROPANE-1,2,3-TRIYL TRIHEPTANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5", "55199f40-b9a5-8956-92ee-f4d8d7c7c7a2" ], "display_name": false }, { "uuid": "54a967e6-a5ce-43fb-8a06-c353e6b13a48", "name": "RADIAMULS 2375", "stdName": "RADIAMULS 2375", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "bcc121b8-6b1b-4fe3-aced-ab0d67e90ebc", "name": "TRIENANTHOIN", "stdName": "TRIENANTHOIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "62ea6038-4838-4ec0-9423-40fd87b3c9c2", "name": "TRIHEPTANOIC GLYCERIDE", "stdName": "TRIHEPTANOIC GLYCERIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "6c2b85e4-f114-a191-86f1-a1c2c58dec3b", "name": "TRIHEPTANOIN [MI]", "stdName": "TRIHEPTANOIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "563fea09-63ab-67d5-1002-0bddc268f4c9" ], "display_name": false }, { "uuid": "f38b7625-8af9-4693-a8a5-5c50d913278b", "name": "TRIHEPTANOIN [ORANGE BOOK]", "stdName": "TRIHEPTANOIN [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bc7daeb1-adb2-43d8-8a87-fb87057e7df2" ], "display_name": false }, { "uuid": "9f4acb15-f870-23c7-436a-6e9448c309b4", "name": "TRIHEPTANOIN [USAN]", "stdName": "TRIHEPTANOIN [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5" ], "display_name": false }, { "uuid": "f487a06f-5ccd-40a4-beb4-34f098282ac0", "name": "TRIOENANTHOIN", "stdName": "TRIOENANTHOIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5806da00-0bdb-4d05-bf47-7f30c638f22b", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999" ], "display_name": false }, { "uuid": "74193eb4-5053-4354-9834-cad2f0e38b04", "name": "Triheptanoin", "stdName": "TRIHEPTANOIN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "91294307-4cb7-4e38-8ff1-62000682dd81", "1cb5ee95-524e-4f3f-a2c0-d1eaa21d7999", "54f2bca2-ab13-49fd-a4fa-59e46ba7da50", "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5" ], "display_name": true, "domains": [ "drug", "cosmetic" ], "name_orgs": [ { "uuid": "c1fc2b44-a42e-43b6-b05d-f77e19e6146e", "name_org": "INCI" }, { "uuid": "8a8896c3-a7a6-4a31-b2b7-abc43c4ac415", "name_org": "INN" }, { "uuid": "8fa9e471-0b63-4c03-98da-4de471244532", "name_org": "USAN" } ] }, { "uuid": "98cfa6b2-089e-9b06-28fe-2e43fa1e32a1", "name": "Triheptanoin [WHO-DD]", "stdName": "TRIHEPTANOIN [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b78c8155-3d03-f0b0-d66b-c2276fdd95c3" ], "display_name": false }, { "uuid": "fd10116b-27cd-1855-f00e-0e53d837870e", "name": "UX-007", "stdName": "UX-007", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5" ], "display_name": false }, { "uuid": "0242d688-b8d1-c9eb-f73b-7eff4573a32c", "name": "UX007", "stdName": "UX007", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a9f0aa80-d64d-a8e1-1a8d-ef696d9018c5" ], "display_name": false }, { "uuid": "778be853-e4ea-843a-c6fd-715f4298c53c", "name": "triheptanoin [INN]", "stdName": "TRIHEPTANOIN [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "55199f40-b9a5-8956-92ee-f4d8d7c7c7a2" ], "display_name": false } ], "modifications": { "uuid": "4147dbac-3862-4725-991d-cd40d4dd771e" } } ] }