{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8efefedf-70ae-4933-83d5-162eda39b2b7", "code": "63387-28-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=63387-28-0", "code_system": "CAS", "references": [ "b2d9934d-caf0-4b9e-8338-671b1b9a2191", "4affde5e-4de0-420f-86fc-a5cd105b1fca" ] }, { "uuid": "927d7ecb-8cc7-44e8-9895-62b5e16b67dd", "code": "45472", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/45472", "code_system": "PUBCHEM", "references": [ "b2d9934d-caf0-4b9e-8338-671b1b9a2191" ] }, { "uuid": "f9a64a5d-bf3f-473d-a52d-f2d48a7546aa", "code": "2O56GK0P1R", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "3893c77e-25a4-aa85-3e2d-55193b9402c4", "code": "DTXSID30881107", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30881107", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "ea70f2b3-3c4a-485e-aea3-eb9448e9065f", "name": "2,2',3,3',4,4',5,5',6-NONABROMODIPHENYL ETHER", "stdName": "2,2',3,3',4,4',5,5',6-NONABROMODIPHENYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b78cdcb2-51c6-429f-9599-547563eb5ccb", "125d791d-bcf5-4381-b0cb-b7c3a099271c" ], "display_name": true }, { "uuid": "f4e99812-790a-4548-876b-a778859447a0", "name": "BENZENE, 1,2,3,4,5-PENTABROMO-6-(2,3,4,5-TETRABROMOPHENOXY)-", "stdName": "BENZENE, 1,2,3,4,5-PENTABROMO-6-(2,3,4,5-TETRABROMOPHENOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b78cdcb2-51c6-429f-9599-547563eb5ccb", "125d791d-bcf5-4381-b0cb-b7c3a099271c" ], "display_name": false }, { "uuid": "b30fecc6-419d-4782-bd80-cbd78b6fab3f", "name": "PBDE 206", "stdName": "PBDE 206", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b78cdcb2-51c6-429f-9599-547563eb5ccb", "125d791d-bcf5-4381-b0cb-b7c3a099271c" ], "display_name": false } ], "references": [ { "uuid": "125d791d-bcf5-4381-b0cb-b7c3a099271c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b78cdcb2-51c6-429f-9599-547563eb5ccb", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b2d9934d-caf0-4b9e-8338-671b1b9a2191", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391585000, "tags": [ "NOMEN" ] }, { "uuid": "e8f1df6d-451c-4b43-b863-0c7eee355f2c", "citation": "SRS import [2O56GK0P1R]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2O56GK0P1R", "doc_type": "SRS", "public_domain": true, "document_date": 1493391585000, "tags": [ "NOMEN" ] }, { "uuid": "eb924a4d-e43b-4e32-9a4b-95d5a3f0fe75", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4affde5e-4de0-420f-86fc-a5cd105b1fca", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b7c9bb15-9f54-46a9-92b4-c628227edc4b", "id": "b7c9bb15-9f54-46a9-92b4-c628227edc4b", "molfile": "\n Marvin 01132109302D \n\n 22 23 0 0 0 0 999 V2000\n 1.4265 -3.2999 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4265 -2.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1484 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1484 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8645 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5806 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3025 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3025 0.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0129 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7290 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0129 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7290 -2.4692 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3025 -2.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3025 -3.2999 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5806 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8645 -2.4692 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4265 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4265 0.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7161 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7161 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4692 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 21 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 4 17 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 15 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 9 1 0 0 0 0\n 9 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 13 2 0 0 0 0\n 14 13 1 0 0 0 0\n 13 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 19 2 0 0 0 0\n 20 19 1 0 0 0 0\n 19 21 1 0 0 0 0\n 22 21 1 0 0 0 0\nM END", "smiles": "c1c(c(c(c(c1Oc2c(c(c(c(c2Br)Br)Br)Br)Br)Br)Br)Br)Br", "formula": "C12HBr9O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "bebb5619-351c-4a69-ab61-be4f3e703030" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "880.2679", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "81e0fd7b-179a-497e-a50c-beb6eced21ac", "version": "3", "structure": { "id": "34cecf91-ceed-40f2-bbd0-297c4c95c74a", "molfile": "\n Marvin 01132102492D \n\n 22 23 0 0 0 0 999 V2000\n 4.3025 0.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7290 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7290 -2.4692 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3025 -3.2999 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8645 -2.4692 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4265 -3.2999 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4692 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.8250 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4265 0.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8645 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0129 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0129 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3025 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3025 -2.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5806 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5806 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1484 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1484 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4265 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4265 -2.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7161 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7161 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 13 1 0 0 0 0\n 2 11 1 0 0 0 0\n 3 12 1 0 0 0 0\n 4 14 1 0 0 0 0\n 5 16 1 0 0 0 0\n 6 20 1 0 0 0 0\n 7 22 1 0 0 0 0\n 8 21 1 0 0 0 0\n 9 19 1 0 0 0 0\n 10 15 1 0 0 0 0\n 10 17 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 12 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 18 20 2 0 0 0 0\n 19 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 21 22 2 0 0 0 0\nM END", "smiles": "c1c(c(c(c(c1Oc2c(c(c(c(c2Br)Br)Br)Br)Br)Br)Br)Br)Br", "formula": "C12HBr9O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "880.2679", "optical_activity": "NONE", "references": [ "e8f1df6d-451c-4b43-b863-0c7eee355f2c", "eb924a4d-e43b-4e32-9a4b-95d5a3f0fe75" ], "stereo_centers": 0 }, "unii": "2O56GK0P1R" } ] }