{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b5f57e65-f7db-4ef9-8dbd-184b6fc7c60b",
          "code": "7538-44-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7538-44-5",
          "code_system": "CAS",
          "references": [
            "e0ceb485-e133-491e-8af4-e0d54f9ccde8",
            "e6cd54a2-370c-4b48-a962-46f257184b13"
          ]
        },
        {
          "uuid": "4d36a00e-a3f3-43a7-be0c-241d4356d4ef",
          "code": "231-408-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.554",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e0ceb485-e133-491e-8af4-e0d54f9ccde8"
          ]
        },
        {
          "uuid": "49385f23-2b2d-4a87-a43a-d22a3c747d4f",
          "code": "82038",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82038",
          "code_system": "PUBCHEM",
          "references": [
            "e0ceb485-e133-491e-8af4-e0d54f9ccde8"
          ]
        },
        {
          "uuid": "1d36f9c7-c457-b5f9-fac9-5f5b22773442",
          "code": "DTXSID2064735",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2064735",
          "code_system": "EPA CompTox",
          "references": [
            "442409d8-6d36-4fc6-300d-c981b14e59a7"
          ]
        },
        {
          "uuid": "de9c8466-c09d-411b-9501-9d2404953773",
          "code": "2NL7LS946D",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "e6cd54a2-370c-4b48-a962-46f257184b13"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "af2a54bc-5692-46b8-a1f0-c35732eea8bb",
          "name": "2,2′-[[3-(Triethoxysilyl)propyl]imino]bis[ethanol]",
          "stdName": "2,2'-((3-(TRIETHOXYSILYL)PROPYL)IMINO)BIS(ETHANOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6cd54a2-370c-4b48-a962-46f257184b13"
          ],
          "display_name": true
        },
        {
          "uuid": "5c3dbff2-286f-4b99-9154-3562fe086f4a",
          "name": "2-[2-Hydroxyethyl(3-triethoxysilylpropyl)amino]ethanol",
          "stdName": "2-(2-HYDROXYETHYL(3-TRIETHOXYSILYLPROPYL)AMINO)ETHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6cd54a2-370c-4b48-a962-46f257184b13"
          ],
          "display_name": false
        },
        {
          "uuid": "dde1cd33-c539-4eae-98e2-9c0c2f062551",
          "name": "3-[N,N-Bis(2-hydroxyethyl)amino]propyltriethoxysilane",
          "stdName": "3-(N,N-BIS(2-HYDROXYETHYL)AMINO)PROPYLTRIETHOXYSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6cd54a2-370c-4b48-a962-46f257184b13"
          ],
          "display_name": false
        },
        {
          "uuid": "22d4ad49-07a4-4f75-8b6a-57162b19b345",
          "name": "Ethanol, 2,2′-[[3-(triethoxysilyl)propyl]imino]bis-",
          "stdName": "ETHANOL, 2,2'-((3-(TRIETHOXYSILYL)PROPYL)IMINO)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86b57f8d-857b-4c3b-83bd-7d0590758e94",
            "8f44b408-3ae7-46ec-b9a4-31c366e14ccc"
          ],
          "display_name": false
        },
        {
          "uuid": "1f8d0f00-8e17-4d37-909c-96827216d423",
          "name": "Ethanol, 2,2′-[[3-(triethoxysilyl)propyl]imino]di-",
          "stdName": "ETHANOL, 2,2'-((3-(TRIETHOXYSILYL)PROPYL)IMINO)DI-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6cd54a2-370c-4b48-a962-46f257184b13"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8f44b408-3ae7-46ec-b9a4-31c366e14ccc",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86b57f8d-857b-4c3b-83bd-7d0590758e94",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0ceb485-e133-491e-8af4-e0d54f9ccde8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394339000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "442409d8-6d36-4fc6-300d-c981b14e59a7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7538-44-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e6cd54a2-370c-4b48-a962-46f257184b13",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ef1dd25b-4796-4700-ad58-bfb590cb667e",
          "id": "ef1dd25b-4796-4700-ad58-bfb590cb667e",
          "molfile": "\n  Marvin  01132112232D          \n\n 20 19  0  0  0  0            999 V2000\n    0.4320   -1.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1473   -1.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1482   -0.6165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8634   -0.2054    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    2.5705   -0.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2858   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0011   -0.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7081   -0.2054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4234   -0.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1305   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8458   -0.6165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7061    0.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9906    1.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9893    1.8454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3936    0.4230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1135    1.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6415    1.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3364    0.4257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5236    0.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.9126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 15  1  0  0  0  0\n  4 18  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CCO[Si](CCCN(CCO)CCO)(OCC)OCC",
          "formula": "C13H31NO5Si",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a73028de-b762-4c73-873b-1683d61200ad"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "309.4748",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f5c94b39-e465-4032-aeec-2766fb06196d",
      "version": "5",
      "structure": {
        "id": "a4b50410-1d08-4b93-8bce-306ee968a530",
        "molfile": "\n  Marvin  01132108332D          \n\n 20 19  0  0  0  0            999 V2000\n    1.8634   -0.2054    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    1.1482   -0.6165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1473   -1.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4320   -1.8454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3936    0.4230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1135    1.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6415    1.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3364    0.4257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5236    0.2843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.9126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5705   -0.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2858   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0011   -0.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7081   -0.2054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4234   -0.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1305   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8458   -0.6165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7061    0.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9906    1.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9893    1.8454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 14 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "CCO[Si](CCCN(CCO)CCO)(OCC)OCC",
        "formula": "C13H31NO5Si",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "309.4748",
        "optical_activity": "NONE",
        "references": [
          "8f44b408-3ae7-46ec-b9a4-31c366e14ccc"
        ],
        "stereo_centers": 0
      },
      "unii": "2NL7LS946D"
    }
  ]
}