{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "22c8be3a-ee0c-49b2-a194-90d100f6415b",
          "code": "650-51-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=650-51-1",
          "code_system": "CAS",
          "references": [
            "53c152b3-4e32-473b-9ef3-40911af4a623",
            "eed103c6-9c7f-43bd-975b-37b848bf5e45"
          ]
        },
        {
          "uuid": "d1874dac-7085-493a-b03e-a7a651b38664",
          "code": "81001",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3909",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "53c152b3-4e32-473b-9ef3-40911af4a623"
          ]
        },
        {
          "uuid": "06ec84e2-5e47-46fd-9d7a-82ee1aa9948f",
          "code": "m11062",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11062?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "53c152b3-4e32-473b-9ef3-40911af4a623"
          ]
        },
        {
          "uuid": "97b92e86-25d3-4b38-9b3e-a18ec84f73ee",
          "code": "23681045",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23681045",
          "code_system": "PUBCHEM",
          "references": [
            "53c152b3-4e32-473b-9ef3-40911af4a623"
          ]
        },
        {
          "uuid": "5bfc89c0-2493-45ee-a107-d530603a685e",
          "code": "211-479-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.437",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "53c152b3-4e32-473b-9ef3-40911af4a623"
          ]
        },
        {
          "uuid": "8fe3d47b-3cd0-3ed1-61a5-e1af70cf1db1",
          "code": "6737",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6737",
          "code_system": "HSDB",
          "references": [
            "5307f7b4-79af-0550-dead-fb188bc37b06"
          ]
        },
        {
          "uuid": "234d9c7e-d976-35e7-8838-f91f96187f6a",
          "code": "DTXSID6034924",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6034924",
          "code_system": "EPA CompTox",
          "references": [
            "c3a31a1a-f9da-c288-45a3-ecb59fe7ace6"
          ]
        },
        {
          "uuid": "babc58e1-d204-423d-bb5c-c331ebfb95bb",
          "code": "2N76A3BRJ0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bd5ec89e-7f51-203c-ab0a-76a10bc91ef5",
          "code": "Sodium trichloroacetate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sodium_trichloroacetate",
          "code_system": "WIKIPEDIA",
          "references": [
            "01f4904d-8dbc-4f40-9a97-87a932f1476a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b3305931-a4a8-410e-b991-10eb79a1899c",
          "amount": {
            "uuid": "bdef3068-c22a-4f66-8c7f-7b228f159bd3"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "6318c734-2c7e-4a0e-8483-93891e6d8894",
            "refuuid": "0af47d55-bfe1-4744-9166-36c9bf0d81ce",
            "name": "Trichloroacetic acid",
            "unii": "5V2JDO056X",
            "linking_id": "5V2JDO056X",
            "ref_pname": "Trichloroacetic acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d89ae9cd-d38c-450c-889c-c689c5d758f6",
          "name": "ACETIC ACID, 2,2,2-TRICHLORO-, SODIUM SALT (1:1)",
          "stdName": "ACETIC ACID, 2,2,2-TRICHLORO-, SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "ca0b363e-024b-4a3e-84a9-94f88aa436c7"
          ],
          "display_name": false
        },
        {
          "uuid": "5e1459ff-b6b0-4add-b259-9b1ca1267909",
          "name": "ACETIC ACID, TRICHLORO-, SODIUM SALT",
          "stdName": "ACETIC ACID, TRICHLORO-, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "917c25e3-5ab5-411d-81a2-50e44901df45"
          ],
          "display_name": false
        },
        {
          "uuid": "79a7e1bb-ce0d-4cc3-a63a-a5061de22b45",
          "name": "KONESTA",
          "stdName": "KONESTA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "b461087e-a0db-4a95-8930-3c59a806ef45"
          ],
          "display_name": false
        },
        {
          "uuid": "89f79f9a-b756-466f-8417-98f96d4d1aea",
          "name": "ORISTAR TCA",
          "stdName": "ORISTAR TCA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "917c25e3-5ab5-411d-81a2-50e44901df45"
          ],
          "display_name": false
        },
        {
          "uuid": "dcfe62ed-f978-4c8b-8870-a4b9d8151ec6",
          "name": "Sodium Trichloroacetate",
          "stdName": "SODIUM TRICHLOROACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "34dd6237-acf3-4bfe-a0a3-ed49f0345e29",
            "5bf12d91-a339-498e-a727-b9a6697c17e3",
            "917c25e3-5ab5-411d-81a2-50e44901df45"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4a128d12-cf96-4bc1-9dda-d0ec385aa12a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e911d37d-8b4b-4e4b-9c88-17f01bbd4b40",
          "name": "TCA-sodium",
          "stdName": "TCA-SODIUM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8f18ae2-4fef-4216-b791-beb8fbc13418"
          ],
          "display_name": false,
          "domains": [
            "Pesticide"
          ],
          "name_orgs": [
            {
              "uuid": "f83b77d9-9cb3-4c67-9a24-5a598197508f",
              "name_org": "ISO"
            }
          ]
        },
        {
          "uuid": "c68a2457-0350-4af6-84c4-2f9733b1c82b",
          "name": "TCA-sodium [HSDB]",
          "stdName": "TCA-SODIUM [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "586b5aa0-d213-4e9c-a5f2-502e96b61363"
          ],
          "display_name": false
        },
        {
          "uuid": "4565707f-f85d-4d1c-b8c4-5d35d0c2ef44",
          "name": "TCA-sodium [ISO]",
          "stdName": "TCA-SODIUM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "86d5dd42-51f1-4d81-9896-4d9391f698ca"
          ],
          "display_name": false
        },
        {
          "uuid": "f6058ae1-41ec-4c36-a88c-c228a14ebac8",
          "name": "TRICHLOROACETIC ACID SODIUM SALT [MI]",
          "stdName": "TRICHLOROACETIC ACID SODIUM SALT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "b461087e-a0db-4a95-8930-3c59a806ef45"
          ],
          "display_name": false
        },
        {
          "uuid": "5e1712b5-8b6d-4927-a46d-1a1f513d5093",
          "name": "TRICHLOROACETIC ACID, SODIUM SALT",
          "stdName": "TRICHLOROACETIC ACID, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "917c25e3-5ab5-411d-81a2-50e44901df45"
          ],
          "display_name": false
        },
        {
          "uuid": "13ac87fd-64b9-474a-b530-c6fefb56fbba",
          "name": "VARITOX",
          "stdName": "VARITOX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
            "ca0b363e-024b-4a3e-84a9-94f88aa436c7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5bf12d91-a339-498e-a727-b9a6697c17e3",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "586b5aa0-d213-4e9c-a5f2-502e96b61363",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20d0c0b7-f4fa-4976-ba5f-731dfec2831f",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "917c25e3-5ab5-411d-81a2-50e44901df45",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca0b363e-024b-4a3e-84a9-94f88aa436c7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b461087e-a0db-4a95-8930-3c59a806ef45",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86d5dd42-51f1-4d81-9896-4d9391f698ca",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53c152b3-4e32-473b-9ef3-40911af4a623",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391096000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "516cb694-13d1-4ea3-864c-5f2ef3e139fa",
          "citation": "SRS import [2N76A3BRJ0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2N76A3BRJ0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391096000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6232016-2ac6-429e-973f-cb322104cc6d",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34dd6237-acf3-4bfe-a0a3-ed49f0345e29",
          "citation": "SODIUM TRICHLOROACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5307f7b4-79af-0550-dead-fb188bc37b06",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+650-51-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c3a31a1a-f9da-c288-45a3-ecb59fe7ace6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=650-51-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "01f4904d-8dbc-4f40-9a97-87a932f1476a",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "eed103c6-9c7f-43bd-975b-37b848bf5e45",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b8f18ae2-4fef-4216-b791-beb8fbc13418",
          "citation": "http://www.bcpcpesticidecompendium.org/index_rn_frame.html",
          "url": "http://www.bcpcpesticidecompendium.org/index_rn_frame.html",
          "doc_type": "ISO",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8a24d717-af93-419a-9f59-cedae746541f",
          "id": "8a24d717-af93-419a-9f59-cedae746541f",
          "molfile": "\n  Marvin  01132107112D          \n\n  1  0  0  0  0  0            999 V2000\n    8.8172   -5.4586    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a32bf1f9-f2d0-4664-8741-15721e86b63a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "56cbaf5d-5ccc-4835-8d9b-300f3f609991",
          "id": "56cbaf5d-5ccc-4835-8d9b-300f3f609991",
          "molfile": "\n  Marvin  01132104312D          \n\n  7  6  0  0  0  0            999 V2000\n    6.5072   -4.2113    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.5072   -5.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5144   -5.3617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7541   -5.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0012   -5.7129    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.0914   -6.1426    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4215   -4.6130    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "C(=O)(C(Cl)(Cl)Cl)[O-]",
          "formula": "C2Cl3O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "25057519-cd61-4fc0-a097-6f322e4cf351"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "162.3791",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b7ec8a35-4134-4712-8a4d-a3b599551826",
      "version": "8",
      "structure": {
        "id": "78d975ee-5347-4a62-a7ed-c9a20827b1bd",
        "molfile": "\n  Marvin  01132106172D          \n\n  8  6  0  0  0  0            999 V2000\n    5.7541   -5.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5072   -5.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5072   -4.2113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5144   -5.3617    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.0012   -5.7129    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.0914   -6.1426    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4215   -4.6130    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.8172   -5.4586    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  0  0  0  0\nM  CHG  2   4  -1   8   1\nM  END",
        "smiles": "C(=O)(C(Cl)(Cl)Cl)[O-].[Na+]",
        "formula": "C2Cl3O2.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "185.3689",
        "optical_activity": "NONE",
        "references": [
          "c6232016-2ac6-429e-973f-cb322104cc6d",
          "516cb694-13d1-4ea3-864c-5f2ef3e139fa"
        ],
        "stereo_centers": 0
      },
      "unii": "2N76A3BRJ0"
    }
  ]
}