{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9d18cf69-db69-4ba4-b467-f60511f762a4",
          "code": "473798-59-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=473798-59-3",
          "code_system": "CAS",
          "references": [
            "2ed43be2-fa8a-4c63-aa53-56e277634bff",
            "9c09981e-b510-4ec0-a736-5d29d1eb7a0c"
          ]
        },
        {
          "uuid": "6529f216-13fe-4981-951b-011f58e1a6aa",
          "code": "90109",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:633",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "2ed43be2-fa8a-4c63-aa53-56e277634bff"
          ]
        },
        {
          "uuid": "f259cc43-2b22-4807-8b8f-01289bde9b6c",
          "code": "11493665",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11493665",
          "code_system": "PUBCHEM",
          "references": [
            "2ed43be2-fa8a-4c63-aa53-56e277634bff"
          ]
        },
        {
          "uuid": "82c01c06-7826-31a8-b547-06c2542cd76e",
          "code": "DTXSID2074742",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2074742",
          "code_system": "EPA CompTox",
          "references": [
            "3aea41f9-c7be-e1f0-6319-355dc2e5847b"
          ]
        },
        {
          "uuid": "c41a73e0-ebcd-4af7-901b-0a7db358ffa4",
          "code": "2N3SPH9RQG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "22e19cbd-401b-6c57-c8b8-fed5e143d22e",
          "code": "83327",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83327",
          "code_system": "CHEBI",
          "references": [
            "f2fcf84c-3b2c-2889-7e7b-5e3b1fb59cc5"
          ]
        },
        {
          "uuid": "e0ea3674-a51c-1de1-e5c1-1492795b452c",
          "code": "fenpyrazamine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenpyrazamine.html",
          "code_system": "ALANWOOD",
          "references": [
            "341b8210-0b44-f0cd-1172-1e029197fe2d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8e3951e9-38dc-444c-97f2-5cee7fa2ccb2",
          "name": "FENPYRAZAMINE",
          "stdName": "FENPYRAZAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd9709d3-77dc-4178-9d93-9806f2c8f4af",
            "0e6b04bd-4afd-4750-adbf-00909fc9df68",
            "9b9f4ce8-0d4b-4579-9794-a95da109bacd",
            "1f3c378a-861b-4b9d-99f9-5636feaca48a"
          ],
          "display_name": true
        },
        {
          "uuid": "24074427-12c6-419e-9e2a-5daab0e9d048",
          "name": "FENPYRAZAMINE [ISO]",
          "stdName": "FENPYRAZAMINE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e6b04bd-4afd-4750-adbf-00909fc9df68",
            "9b9f4ce8-0d4b-4579-9794-a95da109bacd"
          ],
          "display_name": false
        },
        {
          "uuid": "187b6db3-2ee6-4369-bed5-32d34874a128",
          "name": "S-2-PROPEN-1-YL 5-AMINO-2,3-DIHYDRO-2-(1-METHYLETHYL)-4-(2-METHYLPHENYL)-3-OXO-1H-PYRAZOLE-1-CARBOTHIOATE",
          "stdName": "S-2-PROPEN-1-YL 5-AMINO-2,3-DIHYDRO-2-(1-METHYLETHYL)-4-(2-METHYLPHENYL)-3-OXO-1H-PYRAZOLE-1-CARBOTHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b872182-3a36-4db1-9d61-3d62834b196f",
            "f56902cf-f971-40bf-bf40-fb5de0d2eee3"
          ],
          "display_name": false
        },
        {
          "uuid": "ca06574b-f187-407e-9b9f-79ce46ac26ef",
          "name": "S-ALLYL 5-AMINO-2,3-DIHYDRO-2-ISOPROPYL-3-OXO-4-(O-TOLYL)PYRAZOLE-1-CARBOTHIOATE",
          "stdName": "S-ALLYL 5-AMINO-2,3-DIHYDRO-2-ISOPROPYL-3-OXO-4-(O-TOLYL)PYRAZOLE-1-CARBOTHIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b872182-3a36-4db1-9d61-3d62834b196f",
            "f4c92e7d-8ca3-4713-bef4-f77c8ea37208"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3b872182-3a36-4db1-9d61-3d62834b196f",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f56902cf-f971-40bf-bf40-fb5de0d2eee3",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4c92e7d-8ca3-4713-bef4-f77c8ea37208",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd9709d3-77dc-4178-9d93-9806f2c8f4af",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e6b04bd-4afd-4750-adbf-00909fc9df68",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b9f4ce8-0d4b-4579-9794-a95da109bacd",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ed43be2-fa8a-4c63-aa53-56e277634bff",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390986000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ce92417-8b24-4c4d-9f3b-f7b6bf079db0",
          "citation": "SRS import [2N3SPH9RQG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2N3SPH9RQG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390986000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ffb9f06-e673-480c-a57d-c1c57d87629e",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f3c378a-861b-4b9d-99f9-5636feaca48a",
          "citation": "FENPYRAZAMINE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3aea41f9-c7be-e1f0-6319-355dc2e5847b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=473798-59-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "341b8210-0b44-f0cd-1172-1e029197fe2d",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "f2fcf84c-3b2c-2889-7e7b-5e3b1fb59cc5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9c09981e-b510-4ec0-a736-5d29d1eb7a0c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c497fe2e-d5dd-48c2-9e94-47f5fc90e027",
          "id": "c497fe2e-d5dd-48c2-9e94-47f5fc90e027",
          "molfile": "\n  Marvin  01132110102D          \n\n 23 24  0  0  0  0            999 V2000\n    7.8468   -3.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9330   -4.2775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6866   -4.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2656   -4.7624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2656   -5.5873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9330   -6.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8468   -6.8928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6866   -5.7367    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3541   -6.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1078   -5.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7752   -6.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4810   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2260   -6.6270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9960   -5.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1710   -5.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7585   -5.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9336   -5.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5211   -5.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9336   -4.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7585   -4.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1710   -3.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4810   -4.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2260   -3.7228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n 22  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 12  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 22  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
          "smiles": "C=CCSC(=O)n1c(c(-c2ccccc2C)c(=O)n1C(C)C)N",
          "formula": "C17H21N3O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d4ee458b-8c27-4ceb-a460-e09bea1099b4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "331.4343",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dd91b787-7b71-4e1a-83c7-4640fc65c626",
      "version": "5",
      "structure": {
        "id": "50baa0da-e3db-44e9-b35e-efb12f103aa1",
        "molfile": "\n  Marvin  01132104122D          \n\n 23 24  0  0  0  0            999 V2000\n    7.2656   -5.5873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4810   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9960   -5.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4810   -4.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2656   -4.7624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9330   -4.2775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8468   -3.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6866   -4.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2260   -3.7228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1710   -5.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7585   -4.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9336   -4.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5211   -5.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9336   -5.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7585   -5.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1710   -3.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2260   -6.6270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9330   -6.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6866   -5.7367    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3541   -6.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1078   -5.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7752   -6.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8468   -6.8928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  4  9  2  0  0  0  0\n  3 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 10  1  0  0  0  0\n 11 16  1  0  0  0  0\n  2 17  1  0  0  0  0\n  1 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 18 23  2  0  0  0  0\nM  END",
        "smiles": "C=CCSC(=O)n1c(c(-c2ccccc2C)c(=O)n1C(C)C)N",
        "formula": "C17H21N3O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "331.4343",
        "optical_activity": "NONE",
        "references": [
          "3ffb9f06-e673-480c-a57d-c1c57d87629e",
          "8ce92417-8b24-4c4d-9f3b-f7b6bf079db0"
        ],
        "stereo_centers": 0
      },
      "unii": "2N3SPH9RQG"
    }
  ]
}