{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7ed1f82a-7047-46a7-9e85-19ebeeca75b9", "code": "507-30-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=507-30-2", "code_system": "CAS", "references": [ "44542e52-d81b-4443-82ef-f2597e6bce68", "5e40645e-3ec2-4f06-95ac-3f8bb92824f1" ] }, { "uuid": "5bfb6622-3241-44e0-9d37-e8586804d738", "code": "SUB06218MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "44542e52-d81b-4443-82ef-f2597e6bce68" ] }, { "uuid": "d43d3220-dbf1-4c5f-9f0c-b161d4898241", "code": "1322", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1322", "code_system": "INN", "references": [ "44542e52-d81b-4443-82ef-f2597e6bce68" ] }, { "uuid": "f1be03a6-9319-44c5-b2db-2dfdea507af7", "code": "CHEMBL2104182", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104182", "code_system": "ChEMBL", "references": [ "44542e52-d81b-4443-82ef-f2597e6bce68" ] }, { "uuid": "88143749-6a9f-41c3-8d91-0afe63d412a2", "code": "20055440", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20055440", "code_system": "PUBCHEM", "references": [ "44542e52-d81b-4443-82ef-f2597e6bce68" ] }, { "uuid": "1955f134-8c5d-2c62-96d3-3e35948e4f27", "code": "C166581", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C166581", "code_system": "NCI_THESAURUS", "references": [ "4afb7137-f3da-1f8f-faa0-0152038ab26d" ] }, { "uuid": "afd6915f-c212-41e6-b34f-d0a82eecbda2", "code": "2M607MGJ8U", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "45982816-239e-561d-aac0-e8d957b14afb", "code": "100000081897", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "113af3bf-83b8-c217-0f7c-aea86f761fdb" ] }, { "uuid": "4ac4f536-68d0-2c0a-6276-bd845fd65e2b", "code": "DTXSID90964940", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90964940", "code_system": "EPA CompTox", "references": [ "cae12235-1b6a-f6ce-235c-ef2e62757bf6" ] } ], "relationships": [ { "uuid": "90e9450e-de8c-4092-9d4f-43b8c6b48b29", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "ede21fb6-c30d-4bba-a593-cc3f10286ad4", "refuuid": "711f5bb4-f5ba-4dc2-b426-f7f9862acf17", "name": "CHOLINE", "unii": "N91BDP6H0X", "linking_id": "N91BDP6H0X", "ref_pname": "CHOLINE", "substance_class": "reference" } }, { "uuid": "02aed91e-e6dd-414b-a6a7-c7632b367104", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "b69c3eb0-96a4-4747-bca8-01730f49466d", "refuuid": "20ccd816-7e70-49cc-835e-aa74b6a05e8c", "name": "Gluconic Acid", "unii": "R4R8J0Q44B", "linking_id": "R4R8J0Q44B", "ref_pname": "Gluconic Acid", "substance_class": "reference" } }, { "uuid": "112b37ff-832f-47e5-825b-4de0ace89edf", "amount": { "uuid": "129221a2-3b58-4801-900c-ee716ca96157" }, "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "041f379c-a0be-4a82-9402-f92eeb0edfa1", "refuuid": "20ccd816-7e70-49cc-835e-aa74b6a05e8c", "name": "Gluconic Acid", "unii": "R4R8J0Q44B", "linking_id": "R4R8J0Q44B", "ref_pname": "Gluconic Acid", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "5df138cd-ca96-4983-9d76-27b99227e00b", "name": "(2-HYDROXYETHYL)TRIMETHYLAMMONIUM D-GLUCONATE", "stdName": "(2-HYDROXYETHYL)TRIMETHYLAMMONIUM D-GLUCONATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "96a38784-b205-4be7-a78a-2b6aae0f5a75" ], "display_name": false }, { "uuid": "2e71f141-1e9f-40a6-b54a-e57c28af844e", "name": "CHOLINE D-GLUCONATE", "stdName": "CHOLINE D-GLUCONATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5533beb1-03d4-40e4-9951-0d6f59a09fb3" ], "display_name": false }, { "uuid": "1f057286-2dbc-4890-a1d0-a09212ee9531", "name": "CHOLINE GLUCONATE", "stdName": "CHOLINE GLUCONATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "2a62c0dd-d25e-4ee3-85e8-defa67600c09", "75523da0-3da6-480d-955f-802a92157176", "997f6455-3e1f-448e-8b13-e3dba0cb0450" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "a0c64230-a7f3-4715-b62d-a745476f74e5", "name_org": "INN" } ] }, { "uuid": "f09136ea-f737-4dee-b34d-82db62b62d67", "name": "choline gluconate [INN]", "stdName": "CHOLINE GLUCONATE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "75523da0-3da6-480d-955f-802a92157176" ], "display_name": false } ], "references": [ { "uuid": "997f6455-3e1f-448e-8b13-e3dba0cb0450", "citation": "USP SDICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5533beb1-03d4-40e4-9951-0d6f59a09fb3", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "96a38784-b205-4be7-a78a-2b6aae0f5a75", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "75523da0-3da6-480d-955f-802a92157176", "citation": "INN Proposed List 110", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL110.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "44542e52-d81b-4443-82ef-f2597e6bce68", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389723000, "tags": [ "NOMEN" ] }, { "uuid": "1dc6d67c-bb00-48bd-bd97-268d13e5010e", "citation": "SRS import [2M607MGJ8U]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2M607MGJ8U", "doc_type": "SRS", "public_domain": true, "document_date": 1493389723000, "tags": [ "NOMEN" ] }, { "uuid": "2a62c0dd-d25e-4ee3-85e8-defa67600c09", "citation": "CHOLINE GLUCONATE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "113af3bf-83b8-c217-0f7c-aea86f761fdb", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "4afb7137-f3da-1f8f-faa0-0152038ab26d", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "5e40645e-3ec2-4f06-95ac-3f8bb92824f1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "cae12235-1b6a-f6ce-235c-ef2e62757bf6", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "35a7b1ec-cb00-4bfb-9e4c-dec880ce1bab", "id": "35a7b1ec-cb00-4bfb-9e4c-dec880ce1bab", "molfile": "\n Marvin 01132102512D \n\n 7 6 0 0 1 0 999 V2000\n -1.4399 0.1842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0171 -0.5399 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n -0.6111 0.1842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3014 -0.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7329 -0.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4487 -0.5442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1644 -0.9586 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\nM CHG 2 2 1 7 -1\nM END", "smiles": "C[N+](C)(C)CC[O-]", "formula": "C5H13NO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "46fc23c0-5c6c-43ed-a2d5-9ff171b8cd5a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "103.163", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "6e64c908-43ae-43df-8349-1d8af9a5b886", "id": "6e64c908-43ae-43df-8349-1d8af9a5b886", "molfile": "\n Marvin 01132105442D \n\n 13 12 0 0 1 0 999 V2000\n 2.7682 -0.5386 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 2.7599 0.2881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0542 -0.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3403 -0.5428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4822 -0.9437 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.4739 -1.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1962 -0.5303 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.1879 0.2964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9102 -0.9437 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.9018 -1.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6241 -0.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3381 -0.9394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6158 0.2964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 5 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 6 1 6 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 6 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 6 0 0 0\n 9 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 11 2 0 0 0 0\nM END", "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O", "formula": "C6H12O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "87b0a6f7-32e7-4e46-b3fa-c1dd81fca027" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "196.1555", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "49f5bfd6-d920-4f91-8d0b-f686eddd41f4", "version": "10", "structure": { "id": "07dec8d0-b0a5-497c-9622-2b8bdd2313d1", "molfile": "\n Marvin 01132100412D \n\n 20 18 0 0 1 0 999 V2000\n 4.9102 -0.9437 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.1962 -0.5303 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.4822 -0.9437 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.6241 -0.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7682 -0.5386 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.3381 -0.9394 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.6158 0.2964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9018 -1.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1879 0.2964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4739 -1.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7599 0.2881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3403 -0.5428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0542 -0.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0146 -0.5386 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -3.1565 -0.9562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7286 -0.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4363 0.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6096 0.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3006 -0.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4426 -0.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 3 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 4 2 0 0 0 0\n 1 8 1 6 0 0 0\n 2 9 1 6 0 0 0\n 3 10 1 6 0 0 0\n 5 11 1 1 0 0 0\n 12 13 1 0 0 0 0\n 13 5 1 0 0 0 0\n 2 1 1 0 0 0 0\n 15 20 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 14 1 0 0 0 0\n 18 14 1 0 0 0 0\n 19 14 1 0 0 0 0\n 20 16 1 0 0 0 0\nM CHG 2 6 -1 14 1\nM END", "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C[N+](C)(C)CCO", "formula": "C6H11O7.C5H14NO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "299.3186", "optical_activity": "UNSPECIFIED", "references": [ "1dc6d67c-bb00-48bd-bd97-268d13e5010e", "96a38784-b205-4be7-a78a-2b6aae0f5a75", "75523da0-3da6-480d-955f-802a92157176" ], "stereo_centers": 4 }, "unii": "2M607MGJ8U" } ] }