{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d455d81b-0b48-4b1b-b45a-c97a5e66070d",
          "code": "M01AB08",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Acetic acid derivatives and related substances|etodolac",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M01AB08&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "d9bb3a36-80fd-42e3-8474-1839955f3000",
          "code": "N0000175721",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Chemical Classes for Pharmacologic Classification [Chemical/Ingredient]|Nonsteroidal Anti-inflammatory Compounds [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175721",
          "code_system": "NDF-RT",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "d8059af2-cebe-4ac2-953b-d9ea024166e6",
          "code": "N0000000160",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Cyclooxygenase Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000160",
          "code_system": "NDF-RT",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "9c51b589-82c0-4826-85d1-feebd580db4d",
          "code": "N0000175722",
          "comments": "Established Pharmacologic Class [EPC]|Nonsteroidal Anti-inflammatory Drug [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175722",
          "code_system": "NDF-RT",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "8defbb2a-0afb-4253-9d1b-1817e883cb3a",
          "code": "QM01AB08",
          "comments": "VATC|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Acetic acid derivatives and related substances|etodolac",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM01AB08&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "77fb5448-eeca-415b-9d05-97142d508e8b",
          "code": "41340-25-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41340-25-4",
          "code_system": "CAS",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94",
            "b96d9290-15a4-4bd5-8466-5b0e3b62c09a"
          ]
        },
        {
          "uuid": "8263c935-6d46-4c63-afa8-26ccc6dc157d",
          "code": "D017308",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68017308",
          "code_system": "MESH",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "a5974867-3a7f-4d6c-a3f1-4d2b81d62bd3",
          "code": "NBK548686",
          "comments": "LiverTox|Analgesic|Mild-Moderate Pain|NSAID",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548686/",
          "code_system": "LIVERTOX",
          "references": [
            "912bdd64-05c5-d3a0-3850-e81e06501814"
          ]
        },
        {
          "uuid": "1fcfc8e3-8eb8-40fe-8393-82875ccd4e36",
          "code": "ETODOLAC",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Etodolac",
          "code_system": "WIKIPEDIA",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "ba15cdca-ebc6-4053-b3cf-2879867a1926",
          "code": "21 CFR 522.870",
          "comments": "PART 522 IMPLANTATION OR INJECTABLE DOSAGE FORM NEW ANIMAL DRUGS|Sec. 522.870 Etodolac.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=522.870",
          "code_system": "CFR",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "67d0a69c-5981-430b-9134-2a35e441ca29",
          "code": "SUB07316MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "73d37f44-2436-4bc6-ae7b-8cccdcc30b10",
          "code": "3715",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3715",
          "code_system": "INN",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "6bdfb38b-7380-4194-b954-b2ab0d3fb960",
          "code": "7185",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7185",
          "code_system": "IUPHAR",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "39dfad8a-2538-40e3-bdec-cf8567d4aede",
          "code": "C47526",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47526",
          "code_system": "NCI_THESAURUS",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "2a176673-e352-498d-83e2-ea02860ae268",
          "code": "24605",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/24605/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "b155eedc-7483-47ef-a555-3056e9bde2e2",
          "code": "m5190",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5190?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "31bb6aa3-d391-43cb-984f-11a403fd38d3",
          "code": "DB00749",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00749",
          "code_system": "DRUG BANK",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "d42d854a-5181-408d-be0e-02c327eaf941",
          "code": "87226-38-8",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87226-38-8",
          "code_system": "CAS",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94",
            "b24250d9-5b04-4aa7-b1bf-1d47911454ad"
          ]
        },
        {
          "uuid": "9f2e746c-cc26-405d-863a-e2d4d0596cd9",
          "code": "21 CFR 520.870",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.870 Etodolac.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.870",
          "code_system": "CFR",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "a447d343-d9cb-45cb-a9ca-f3829fcb8b85",
          "code": "CHEMBL622",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL622",
          "code_system": "ChEMBL",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "11548a03-0e80-46a8-9648-37be5e24f1e3",
          "code": "3308",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3308",
          "code_system": "PUBCHEM",
          "references": [
            "601b4bef-ebba-48f6-8d0d-bda4e41d1d94"
          ]
        },
        {
          "uuid": "fdb58299-1bf4-ac6c-6231-dc9e312544f1",
          "code": "DTXSID9020615",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020615",
          "code_system": "EPA CompTox",
          "references": [
            "45660695-0369-d551-13c2-553c1ea3d2c5"
          ]
        },
        {
          "uuid": "8ae80067-91b6-9a38-65bb-267859cba060",
          "code": "454614",
          "comments": "ORPHAN DRUG|Designated|Treatment of hepatocellular carcinoma",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=454614",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "44f7bb9b-035e-e32a-c46f-aa1f0b71a010",
          "code": "Etodolac",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM107/",
          "code_system": "LACTMED",
          "references": [
            "912bdd64-05c5-d3a0-3850-e81e06501814"
          ]
        },
        {
          "uuid": "90c10480-063e-7d51-c08e-4ae6b8a682dc",
          "code": "475715",
          "comments": "ORPHAN DRUG|Designated|Treatment of pancreatic cancer.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=475715",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "bdac0f28-12b6-c4dd-6423-27d233146fbe",
          "code": "484315",
          "comments": "ORPHAN DRUG|Designated|Treatment of malignant glioma.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=484315",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "6a39ea37-7e27-2a9a-ba3f-bebfc5fcaf2b",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "912bdd64-05c5-d3a0-3850-e81e06501814"
          ]
        },
        {
          "uuid": "9654dc28-8d93-48cf-97aa-f013b291889e",
          "code": "2M36281008",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6ed5ca7f-701f-7ab5-a3cf-55b74c157200",
          "code": "1103",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1103",
          "code_system": "DRUG CENTRAL",
          "references": [
            "912bdd64-05c5-d3a0-3850-e81e06501814"
          ]
        },
        {
          "uuid": "c84ca275-7b0a-e946-2312-5f8987e38ddc",
          "code": "1268706",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1268706",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "912bdd64-05c5-d3a0-3850-e81e06501814"
          ]
        },
        {
          "uuid": "b018a2e6-28b1-ec12-7bc1-c748eaccc79e",
          "code": "4909",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4909",
          "code_system": "CHEBI",
          "references": [
            "912bdd64-05c5-d3a0-3850-e81e06501814"
          ]
        },
        {
          "uuid": "3a7bfff2-6ecf-a66e-b01d-dee62e834a70",
          "code": "100000092566",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6432738d-0aec-7de4-cf66-a8e3e3ecbd26"
          ]
        },
        {
          "uuid": "a066872c-6f4f-8f8a-b8f3-c49e579b97ff",
          "code": "2M36281008",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2M36281008",
          "code_system": "DAILYMED",
          "references": [
            "0903f4fc-4778-b7e2-193e-9ae093e24a15"
          ]
        },
        {
          "uuid": "a677a011-1e9c-2587-ba5d-bc1953972fd3",
          "code": "282126",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=282126",
          "code_system": "NSC",
          "references": [
            "2b576508-5611-a65e-4a64-2ac67275d41a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "957eb26b-49de-4f2d-934c-66df3c833767",
          "amount": {
            "uuid": "754ef560-0957-4861-95e7-80f4c2124512"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a572c06f-3917-41e3-9aff-942ea464bced",
            "refuuid": "194d8e8e-96e1-4170-a569-15bf73c8fd5e",
            "name": "ETODOLAC",
            "unii": "2M36281008",
            "linking_id": "2M36281008",
            "ref_pname": "ETODOLAC",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2d818675-8b93-4514-81b8-ad1529ccffa1",
          "amount": {
            "uuid": "cf399303-1654-4605-a4ee-c8b42eb2465d"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f3a1dc81-169d-47b1-a12b-6ce93610baef",
            "refuuid": "f1475a27-2656-424c-8df3-23c189eb3995",
            "name": "ETODOLAC, (S)-",
            "unii": "1046G5D6YD",
            "linking_id": "1046G5D6YD",
            "ref_pname": "ETODOLAC, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "207a56cc-b72d-456f-a1d5-12d08238d2ed",
          "amount": {
            "uuid": "11d4a9a4-9dec-4791-b4eb-8289bd7daeea"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "3065c9c9-5b18-4474-9386-542e6f4483ed",
            "refuuid": "627166a8-9b0a-4c8f-8adc-a9c70416e561",
            "name": "ETODOLAC, (R)-",
            "unii": "Y1RAH31T6K",
            "linking_id": "Y1RAH31T6K",
            "ref_pname": "ETODOLAC, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c35e8cb7-3e2b-4f2b-8bca-0b4c4352817a",
          "amount": {
            "uuid": "a4f54a60-6097-457c-9ee0-3c0e6fa522e0"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "1640c72d-83d8-458f-a067-6c9a29901d65",
            "refuuid": "d9f19d0e-d8f5-4e62-917f-9e166432bd2b",
            "name": "ETODOLAC SODIUM",
            "unii": "VIQ282YI0V",
            "linking_id": "VIQ282YI0V",
            "ref_pname": "ETODOLAC SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e7575aeb-7567-4050-b79f-8940d1f812d7",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "39ac281f-f065-4ab8-bce9-4ccb5a8cedf3",
            "refuuid": "b75fd22d-8605-401c-a076-453c4bedac0f",
            "name": "ETODOLAC POTASSIUM",
            "unii": "37X66034VL",
            "linking_id": "37X66034VL",
            "ref_pname": "ETODOLAC POTASSIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4195082d-1a99-4250-8def-553e6fdf8d7b",
          "type": "METABOLITE INACTIVE->PARENT",
          "related_substance": {
            "uuid": "76c41396-d9f0-446a-84e1-af5c0b041147",
            "refuuid": "132f89a1-470a-49bd-a13d-c0cc7171bc7e",
            "name": "RAK-901",
            "unii": "JCH8N6A1AY",
            "linking_id": "JCH8N6A1AY",
            "ref_pname": "RAK-901"
          }
        },
        {
          "uuid": "a9a642af-7b0d-4187-b804-d75a1bc0f67b",
          "type": "METABOLITE INACTIVE->PARENT",
          "related_substance": {
            "uuid": "2025dcdc-249d-44d6-8455-c3b33e4b907b",
            "refuuid": "eebc8e9c-587b-494b-b553-4a1501ae740b",
            "name": "7-HYDROXYETODOLAC",
            "unii": "2AP8GSV2ZD",
            "linking_id": "2AP8GSV2ZD",
            "ref_pname": "7-HYDROXYETODOLAC"
          }
        },
        {
          "uuid": "c69f1266-699a-446a-8ec3-f3d695ed3bb3",
          "type": "METABOLITE INACTIVE->PARENT",
          "related_substance": {
            "uuid": "925aa5cd-1552-4459-a9c7-63540172e05f",
            "refuuid": "654efd3a-6556-4244-970c-9f49de846f71",
            "name": "8-HYDROXYETHYL-ETODOLAC",
            "unii": "5QYZ6JSC9U",
            "linking_id": "5QYZ6JSC9U",
            "ref_pname": "8-HYDROXYETHYL-ETODOLAC"
          }
        },
        {
          "uuid": "844e3469-66e7-40ab-9012-1928cac2aab2",
          "amount": {
            "uuid": "deadecef-61c0-4a56-9686-5f89e650768c"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "7b919be2-1267-4fe9-a3cd-a07c64ad475d"
          ],
          "related_substance": {
            "uuid": "f5792b4d-a282-400c-95ae-628d55c0c590",
            "refuuid": "8625f53e-9ef3-4422-9297-be727c14a379",
            "name": "8-Desethyl etodolac",
            "unii": "6E49GA3BVW",
            "linking_id": "6E49GA3BVW",
            "ref_pname": "8-Desethyl etodolac"
          }
        },
        {
          "uuid": "f5067dbe-ef74-477c-aa88-5c5e6612f314",
          "amount": {
            "uuid": "6d994107-8398-4167-b962-5e696d41a6b0"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "f0569357-5e2f-4e0c-9d7a-d0722ee8761f",
            "1d394bb6-d62b-412e-a1cb-9c7cab5d04f8"
          ],
          "related_substance": {
            "uuid": "016f6adc-7548-4f29-a5c5-ff0647fee1d2",
            "refuuid": "43132dd3-04ba-44de-9197-bcbb58108cee",
            "name": "ETODOLAC METHYL ESTER",
            "unii": "9ZJE4H85SV",
            "linking_id": "9ZJE4H85SV",
            "ref_pname": "ETODOLAC METHYL ESTER"
          }
        },
        {
          "uuid": "c2ea3670-d716-4ee5-89f0-972999e10fd8",
          "amount": {
            "uuid": "eb04f699-8e1f-4803-849a-19e08aa6c3ba"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "87c24cab-e7d4-425c-89d7-31054099ec7a"
          ],
          "related_substance": {
            "uuid": "438fa0d1-c634-422c-9095-4d6d268d7c7a",
            "refuuid": "b3be02e2-acc8-4020-a5b1-d1ef011baa1c",
            "name": "8-METHYL ETODOLAC",
            "unii": "816MKG734F",
            "linking_id": "816MKG734F",
            "ref_pname": "8-METHYL ETODOLAC",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "17aea33f-6c50-443b-b3f2-bef6f54896ae",
          "amount": {
            "uuid": "4efe38cf-512e-484e-bdf4-14e029036850"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "b224fbe4-caea-4cfb-8252-49ac8ca58dc5"
          ],
          "related_substance": {
            "uuid": "5a744909-4650-4456-8b69-943eb2e548bb",
            "refuuid": "de3e8287-f8b3-44c0-b179-49263b3361b0",
            "name": "8-Isopropyl etodolac",
            "unii": "2P45MG8YLT",
            "linking_id": "2P45MG8YLT",
            "ref_pname": "8-Isopropyl etodolac",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2183d23a-7075-40ab-9919-99d4bba1db7b",
          "amount": {
            "uuid": "8cf9b983-4f27-4770-9154-cfd76668c6b6"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "65ee51f1-8089-4320-8ed0-32d7abcc4f42"
          ],
          "related_substance": {
            "uuid": "2a019803-fb59-40d0-80f1-6dabe82216e8",
            "refuuid": "449af58e-e40d-45bb-a2ba-1a8dd6fd6bb1",
            "name": "3-[7-Ethyl-3-(2-hydroxyethyl)-1H-indol-2-yl]-3-(7-ethyl-1H-indol-3-yl)pentanoic acid",
            "unii": "G783T3F8R8",
            "linking_id": "G783T3F8R8",
            "ref_pname": "3-[7-Ethyl-3-(2-hydroxyethyl)-1H-indol-2-yl]-3-(7-ethyl-1H-indol-3-yl)pentanoic acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ef2b0baf-8e31-40af-9d72-b91bd4669552",
          "amount": {
            "uuid": "629d08f7-88b5-4a0a-9ed0-a205ed6ba250"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "d6ad0cce-0031-4469-b812-7ea454833376"
          ],
          "related_substance": {
            "uuid": "b799043f-e5ae-4d1a-a23e-5187b0889dd5",
            "refuuid": "6fa804e8-e2e6-4577-9711-1ad54b20e575",
            "name": "1-Isopropyl etodolac",
            "unii": "URS7HRT7E6",
            "linking_id": "URS7HRT7E6",
            "ref_pname": "1-Isopropyl etodolac",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "26f9f420-c15b-47f2-8afd-e05f0ba621af",
          "amount": {
            "uuid": "bffb1bf7-9198-4a0f-876d-bd81d460d9d1"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "b46923c9-59ec-433f-a26a-41fe8c27947c"
          ],
          "related_substance": {
            "uuid": "5d34cd7f-5e42-42be-a557-8a04f2f8a565",
            "refuuid": "def1fe48-a6cb-4f45-9db8-ff70468b4677",
            "name": "1-Propyl etodolac",
            "unii": "4VC974VC57",
            "linking_id": "4VC974VC57",
            "ref_pname": "1-Propyl etodolac",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "969680f5-2d4d-4b74-9372-534317a63fab",
          "amount": {
            "uuid": "6ed2712a-0b66-44ef-8b33-83a1341546bb"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "9bfecb08-e3db-4370-8a7f-719fca0fc6f9"
          ],
          "related_substance": {
            "uuid": "3e1578a8-7a00-4b1e-b30a-14b5dc4553eb",
            "refuuid": "4dfa2ac2-6297-4528-8607-498509f8d682",
            "name": "8-Propyl etodolac",
            "unii": "8TP6S95KL7",
            "linking_id": "8TP6S95KL7",
            "ref_pname": "8-Propyl etodolac",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "03d7f3ee-17aa-443e-b698-34339cf8111c",
          "amount": {
            "uuid": "8faef109-c6a0-4261-a727-b7b9afdf3b4d"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "f53e0340-6c36-485e-a6a4-1a5b164c5026"
          ],
          "related_substance": {
            "uuid": "74a9789c-7902-4044-81ba-d8b3706eb052",
            "refuuid": "bc08a3aa-3e1a-4c84-8553-4cc08274d1f4",
            "name": "7-ETHYLTRYPTOPHOL",
            "unii": "JJ4LB8KM8O",
            "linking_id": "JJ4LB8KM8O",
            "ref_pname": "7-ETHYLTRYPTOPHOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d52798dd-9d49-414b-ba3d-3e0b519a4ec1",
          "amount": {
            "uuid": "ff89f0c0-a64b-405c-b18f-113e6ac282c3"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "d5664268-5949-413a-b5d7-365c385f4d2f"
          ],
          "related_substance": {
            "uuid": "7405c174-cc22-42fe-9b91-04c8f1f3a50e",
            "refuuid": "970f3e4b-b657-4ac3-93bc-3d8fdc0479b0",
            "name": "Decarboxy etodolac",
            "unii": "4J2J13T0DI",
            "linking_id": "4J2J13T0DI",
            "ref_pname": "Decarboxy etodolac",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9f1429b3-e710-4b07-9423-62f4a4ece4bd",
          "name": "(RS)-ETODOLIC ACID",
          "stdName": "(RS)-ETODOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "1e3f3055-eb79-4d38-a899-8c18d476ce2d",
          "name": "(±)-1,8-DIETHYL-1,3,4,9-TETRAHYDROPYRANO(3,4-B)INDOLE-1-ACETIC ACID",
          "stdName": "(+/-)-1,8-DIETHYL-1,3,4,9-TETRAHYDROPYRANO(3,4-B)INDOLE-1-ACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bed58743-33cc-4bcd-b374-bdc16e973854"
          ],
          "display_name": false
        },
        {
          "uuid": "7627938b-53b9-47a6-8366-c6c5abc46928",
          "name": "(±)-ETODOLAC",
          "stdName": "(+/-)-ETODOLAC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "64790d23-aff3-467b-8a8c-c44e139f0b0a",
          "name": "1,8-DIETHYL-1,3,4,9-TETRAHYDROPYRANO(3,4-B)INDOL-1-ACETIC ACID",
          "stdName": "1,8-DIETHYL-1,3,4,9-TETRAHYDROPYRANO(3,4-B)INDOL-1-ACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "94833d48-2adb-4482-bf45-bcf7c8d6d91c",
          "name": "1,8-Diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indole-1-acetic acid",
          "stdName": "1,8-DIETHYL-1,3,4,9-TETRAHYDROPYRANO(3,4-B)INDOLE-1-ACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "3725eb34-ea45-48a8-b48e-9a72a861d95a",
          "name": "AY-24,236",
          "stdName": "AY-24,236",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78fd2162-8a13-4ac6-937c-2bbccfbecdb3"
          ],
          "display_name": false
        },
        {
          "uuid": "f1664388-459d-42bd-b913-596936abde5a",
          "name": "AY-24-236",
          "stdName": "AY-24-236",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0dddb85c-99e1-4edb-bda5-ef050c7b6d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "4b16a0c3-5c74-4dda-900e-75428dfae231",
          "name": "AY-24236",
          "stdName": "AY-24236",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e4a853d-21d7-4110-b22b-b053304d143f"
          ],
          "display_name": false
        },
        {
          "uuid": "ebd8999a-6c27-4ec7-9903-bb3365ce09f6",
          "name": "ECCOXOLAC",
          "stdName": "ECCOXOLAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "20dddbac-450d-4e6d-94c3-1843fb0c8618",
          "name": "EDOLAN",
          "stdName": "EDOLAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "8a4b9539-2651-4f4f-a3f8-76a581cc5653",
          "name": "ETODOLAC",
          "stdName": "ETODOLAC",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05c64e6f-f740-4342-a695-eace4fdfa09e",
            "5112888a-385f-4124-ba60-7b415f4a31b9",
            "ea435f60-0266-40ea-9727-2ab6d1455139",
            "e9c1fbbd-43e2-46cf-9f18-f57a83691d90",
            "f1dbad05-2405-473f-a68e-f40422ba01f2",
            "a79ab4b8-b579-4634-87a6-b729c349a5cd",
            "95325425-4a6e-42d1-89f0-1089bda4e7aa",
            "96a5b77e-4e82-4f11-89c8-433fbf1645a8",
            "b9a7d318-c847-4784-983a-610251bc1bd1",
            "5a09f6dd-ef01-44c3-86c9-d9e3973ec2d2",
            "e6fc5551-cccf-42f3-bbcc-28078ed978d8",
            "5518c707-3f7b-4952-bec3-ed2d025c09c2",
            "e4e568ca-e47a-4896-a5f4-006c89fa4703",
            "4cb1a74d-3b1a-4d10-a9d3-10668d1f38a5",
            "d91f6cdb-ec97-48bf-b4e1-275491b20765",
            "1158bdcf-7117-4112-b593-cddcd014d4b8",
            "66456a24-44b7-4ea9-8452-2c74428e5c48",
            "b479a7a2-fe98-4a70-bdf7-d2f48d466da1",
            "9b06927e-e6ef-440c-a44c-576341433c5c",
            "2653cef5-d10f-4eef-940f-04691c3289ad",
            "6a9afa9b-4043-4afc-9708-3c8dce174a8f",
            "acf7a7f2-44ab-4541-bb01-520a5a52dac3",
            "11dec110-ac8e-4cd8-a6a6-6fd723e8784a"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "edf07417-de9f-43b9-9183-4a7826171818",
              "name_org": "INN"
            },
            {
              "uuid": "a2635714-5186-4f9c-b62f-0d5c5f929a9d",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "d8dabae9-19a6-a5fa-3a51-afb603200933",
          "name": "ETODOLAC [EP MONOGRAPH]",
          "stdName": "ETODOLAC [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2bc6bf83-a2aa-9e3e-b62f-37853a2c13c1"
          ],
          "display_name": false
        },
        {
          "uuid": "e31b583d-7b79-4435-bc90-92989d3163fe",
          "name": "ETODOLAC [GREEN BOOK]",
          "stdName": "ETODOLAC [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11dec110-ac8e-4cd8-a6a6-6fd723e8784a"
          ],
          "display_name": false
        },
        {
          "uuid": "408fbd35-b0fd-2ba1-32a1-5c6336e2cec8",
          "name": "ETODOLAC [JAN]",
          "stdName": "ETODOLAC [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "881eaccc-d7e4-e80f-79b6-572740f1eb4e"
          ],
          "display_name": false
        },
        {
          "uuid": "99f6e752-e620-400b-abae-fc551ed8dfe4",
          "name": "ETODOLAC [MART.]",
          "stdName": "ETODOLAC [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4e568ca-e47a-4896-a5f4-006c89fa4703"
          ],
          "display_name": false
        },
        {
          "uuid": "629a4abf-c4dd-427f-abbe-8c9789ba90c7",
          "name": "ETODOLAC [MI]",
          "stdName": "ETODOLAC [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b479a7a2-fe98-4a70-bdf7-d2f48d466da1"
          ],
          "display_name": false
        },
        {
          "uuid": "fdc2e676-e91e-4ba0-8c57-e8692f1a9422",
          "name": "ETODOLAC [ORANGE BOOK]",
          "stdName": "ETODOLAC [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95325425-4a6e-42d1-89f0-1089bda4e7aa"
          ],
          "display_name": false
        },
        {
          "uuid": "25f98e61-2602-43d4-91d3-61c455887ba0",
          "name": "ETODOLAC [USAN]",
          "stdName": "ETODOLAC [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66456a24-44b7-4ea9-8452-2c74428e5c48"
          ],
          "display_name": false
        },
        {
          "uuid": "08f5573d-4345-b8dc-77cd-032a0784a8d9",
          "name": "ETODOLAC [USP MONOGRAPH]",
          "stdName": "ETODOLAC [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db6ec91f-cbcb-b364-3c05-d7c3c1c20039"
          ],
          "display_name": false
        },
        {
          "uuid": "28eac046-853b-4fee-9064-ffa06e076f27",
          "name": "ETODOLAC [USP-RS]",
          "stdName": "ETODOLAC [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9a7d318-c847-4784-983a-610251bc1bd1"
          ],
          "display_name": false
        },
        {
          "uuid": "84f3a8fa-bc99-45ad-badf-52abd6116b02",
          "name": "ETODOLAC [VANDF]",
          "stdName": "ETODOLAC [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1158bdcf-7117-4112-b593-cddcd014d4b8"
          ],
          "display_name": false
        },
        {
          "uuid": "4c995773-b5fe-4ccb-94f0-bd26224ba6e9",
          "name": "ETODOLIC ACID",
          "stdName": "ETODOLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "caf060f5-b174-4efa-8fcc-5d4b50b990a4"
          ],
          "display_name": false
        },
        {
          "uuid": "1aaa17aa-8c72-e769-9c6f-294498769c06",
          "name": "Etodolac [WHO-DD]",
          "stdName": "ETODOLAC [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfa21474-c69d-b713-c07d-933811a17a10"
          ],
          "display_name": false
        },
        {
          "uuid": "87ea7395-d7d1-4a4d-ba45-e8aa0368e6fa",
          "name": "FLANCOX",
          "stdName": "FLANCOX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "47dd3eee-6bdf-4eb1-839e-f930459d4dda",
          "name": "LODIN XL",
          "stdName": "LODIN XL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "978a07bc-33c0-4c7f-a872-23b45c9463bf",
          "name": "LODINE",
          "stdName": "LODINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78fd2162-8a13-4ac6-937c-2bbccfbecdb3"
          ],
          "display_name": false
        },
        {
          "uuid": "1326268e-324f-4656-a6c0-ef66cc04b676",
          "name": "NAPILAC",
          "stdName": "NAPILAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "a25803db-9d2f-41d5-9cfd-7b699aa53451",
          "name": "NIH-9918",
          "stdName": "NIH-9918",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "bb3e23df-87b2-4dca-802a-1b058431c3ca",
          "name": "NSC-282126",
          "stdName": "NSC-282126",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "8ee3f1c3-8d59-4990-946d-f1f29d772a82",
          "name": "PYRANO(3,4-B)INDOLE-1-ACETIC ACID, 1,8-DIETHYL-1,3,4,9-TETRAHYDRO-",
          "stdName": "PYRANO(3,4-B)INDOLE-1-ACETIC ACID, 1,8-DIETHYL-1,3,4,9-TETRAHYDRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "62ef137a-64b6-42cb-87bf-109624bb297e",
          "name": "PYRANO(3,4-B)INDOLE-1-ACETIC ACID, 1,8-DIETHYL-1,3,4,9-TETRAHYDRO-(±)-",
          "stdName": "PYRANO(3,4-B)INDOLE-1-ACETIC ACID, 1,8-DIETHYL-1,3,4,9-TETRAHYDRO-(+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0dddb85c-99e1-4edb-bda5-ef050c7b6d5d"
          ],
          "display_name": false
        },
        {
          "uuid": "954b4894-5e14-4f59-8c12-948e7081c8fa",
          "name": "RAMODAR",
          "stdName": "RAMODAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "3e8d296d-a1bd-4238-ac6c-be16d7a50714",
          "name": "TEDOLAN",
          "stdName": "TEDOLAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "dca4636f-646d-4464-8350-c092c0bb8a78",
          "name": "ULTRADOL",
          "stdName": "ULTRADOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "357a5c0b-7459-49f0-8fc5-0eb5ba7e6a1b",
          "name": "ZEDOLAC",
          "stdName": "ZEDOLAC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4143db53-43d6-4790-978b-10a1e5d1e140"
          ],
          "display_name": false
        },
        {
          "uuid": "75e4f6fa-32bc-4dd1-938a-d18bc318685d",
          "name": "etodolac [INN]",
          "stdName": "ETODOLAC [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b06927e-e6ef-440c-a44c-576341433c5c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5a09f6dd-ef01-44c3-86c9-d9e3973ec2d2",
          "citation": "ETODOLAC [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "acf7a7f2-44ab-4541-bb01-520a5a52dac3",
          "citation": "ETODOLAC [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a79ab4b8-b579-4634-87a6-b729c349a5cd",
          "citation": "ETODOLAC [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "05c64e6f-f740-4342-a695-eace4fdfa09e",
          "citation": "ETODOLAC [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4cb1a74d-3b1a-4d10-a9d3-10668d1f38a5",
          "citation": "ETODOLAC [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d91f6cdb-ec97-48bf-b4e1-275491b20765",
          "citation": "ETODOLAC [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e9c1fbbd-43e2-46cf-9f18-f57a83691d90",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "caf060f5-b174-4efa-8fcc-5d4b50b990a4",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bed58743-33cc-4bcd-b374-bdc16e973854",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0dddb85c-99e1-4edb-bda5-ef050c7b6d5d",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78fd2162-8a13-4ac6-937c-2bbccfbecdb3",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e4a853d-21d7-4110-b22b-b053304d143f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b06927e-e6ef-440c-a44c-576341433c5c",
          "citation": "INN Proposed List 45",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL45.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "66456a24-44b7-4ea9-8452-2c74428e5c48",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a9afa9b-4043-4afc-9708-3c8dce174a8f",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5518c707-3f7b-4952-bec3-ed2d025c09c2",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95325425-4a6e-42d1-89f0-1089bda4e7aa",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4e568ca-e47a-4896-a5f4-006c89fa4703",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b479a7a2-fe98-4a70-bdf7-d2f48d466da1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11dec110-ac8e-4cd8-a6a6-6fd723e8784a",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9a7d318-c847-4784-983a-610251bc1bd1",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea435f60-0266-40ea-9727-2ab6d1455139",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1158bdcf-7117-4112-b593-cddcd014d4b8",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4143db53-43d6-4790-978b-10a1e5d1e140",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "601b4bef-ebba-48f6-8d0d-bda4e41d1d94",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390897000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58398181-86a0-4b7f-bebd-fd46fde3ee30",
          "citation": "SRS import [2M36281008]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2M36281008",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390897000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6fc5551-cccf-42f3-bbcc-28078ed978d8",
          "citation": "ETODOLAC [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2653cef5-d10f-4eef-940f-04691c3289ad",
          "citation": "ETODOLAC [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f1dbad05-2405-473f-a68e-f40422ba01f2",
          "citation": "ETODOLAC [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5112888a-385f-4124-ba60-7b415f4a31b9",
          "citation": "ETODOLAC [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "96a5b77e-4e82-4f11-89c8-433fbf1645a8",
          "citation": "ETODOLAC [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "48da4e76-6852-1b67-568d-60d74fba4c25",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+41340-25-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "45660695-0369-d551-13c2-553c1ea3d2c5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=41340-25-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6432738d-0aec-7de4-cf66-a8e3e3ecbd26",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "912bdd64-05c5-d3a0-3850-e81e06501814",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "881eaccc-d7e4-e80f-79b6-572740f1eb4e",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "b24250d9-5b04-4aa7-b1bf-1d47911454ad",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b96d9290-15a4-4bd5-8466-5b0e3b62c09a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7e65e6cc-d87b-49a8-9526-df8a3a105b1f",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "36b3c673-3291-4978-a963-0857495f9fdf",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2e1c324f-7d3f-4abb-a77e-0579cf55f448",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "40c89c05-07bf-44a0-bcc2-bcd8680787f2",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2d60a260-8c5b-4d67-88fb-b283e85fc4ce",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2406dae4-fabb-bd7f-7038-0084f1d0888a",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "db6ec91f-cbcb-b364-3c05-d7c3c1c20039",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "2bc6bf83-a2aa-9e3e-b62f-37853a2c13c1",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "2b576508-5611-a65e-4a64-2ac67275d41a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cf02a08b-a80e-4b23-9f84-0ba08b4653f2",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9bfecb08-e3db-4370-8a7f-719fca0fc6f9",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d87677f5-7800-4020-9be9-1417e1180878",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0903f4fc-4778-b7e2-193e-9ae093e24a15",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "dfa21474-c69d-b713-c07d-933811a17a10",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d2f94c08-90d8-4e00-88bb-d7b555f98840",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9ed104e3-3e58-4368-aae2-60ed9365b9d5",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b224fbe4-caea-4cfb-8252-49ac8ca58dc5",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f53e0340-6c36-485e-a6a4-1a5b164c5026",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7b919be2-1267-4fe9-a3cd-a07c64ad475d",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "87c24cab-e7d4-425c-89d7-31054099ec7a",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d6ad0cce-0031-4469-b812-7ea454833376",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b46923c9-59ec-433f-a26a-41fe8c27947c",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "65ee51f1-8089-4320-8ed0-32d7abcc4f42",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f0569357-5e2f-4e0c-9d7a-d0722ee8761f",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d394bb6-d62b-412e-a1cb-9c7cab5d04f8",
          "citation": "stn",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d5664268-5949-413a-b5d7-365c385f4d2f",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9b11569d-ecc7-4089-9c12-cd39c3a0fd5a",
          "id": "9b11569d-ecc7-4089-9c12-cd39c3a0fd5a",
          "molfile": "\n  Marvin  01132108032D          \n\n 21 23  0  0  0  0            999 V2000\n    1.9751   -2.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4185   -3.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6722   -3.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1001   -4.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3460   -5.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1770   -5.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7283   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5592   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1183   -5.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9027   -5.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1512   -4.5325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6076   -3.9217    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.8095   -3.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2271   -2.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2676   -3.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8785   -4.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4920   -3.3858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8734   -4.9234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8051   -4.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1399   -3.6162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4798   -4.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3 21  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 21  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 19  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 15  1  0  0  0  0\n 12 19  1  0  0  0  0\n 14 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "CCc1cccc2c3CCOC(CC)(CC(=O)O)c3[nH]c12",
          "formula": "C17H21NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "643bb7a3-e1a2-4409-946d-51847c9c7f1f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "287.3542",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "194d8e8e-96e1-4170-a569-15bf73c8fd5e",
      "version": "58",
      "structure": {
        "id": "ddf9af8f-3ed5-43e0-92de-51808b7f68fa",
        "molfile": "\n  Marvin  01132111302D          \n\n 21 23  0  0  0  0            999 V2000\n    3.8051   -4.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1399   -3.6162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5592   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6076   -3.9217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4798   -4.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7283   -4.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2676   -3.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8785   -4.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1512   -4.5325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6722   -3.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4920   -3.3858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1183   -5.4592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8734   -4.9234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9027   -5.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1770   -5.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8095   -3.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3460   -5.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1001   -4.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4185   -3.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2271   -2.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9751   -2.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  3  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  9  1  0  0  0  0\n 15  6  1  0  0  0  0\n  4 16  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 10  2  0  0  0  0\n 19 10  1  0  0  0  0\n 20 16  1  0  0  0  0\n 21 19  1  0  0  0  0\n  6  5  2  0  0  0  0\n 14 12  1  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
        "smiles": "CCc1cccc2c3CCOC(CC)(CC(=O)O)c3[nH]c12",
        "formula": "C17H21NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "287.3542",
        "optical_activity": "( + / - )",
        "references": [
          "e9c1fbbd-43e2-46cf-9f18-f57a83691d90",
          "58398181-86a0-4b7f-bebd-fd46fde3ee30",
          "9b06927e-e6ef-440c-a44c-576341433c5c"
        ],
        "stereo_centers": 1
      },
      "unii": "2M36281008"
    }
  ]
}