{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1e961aff-e459-4290-b704-3c9c28c9d0b9",
          "code": "15435-29-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15435-29-7",
          "code_system": "CAS",
          "references": [
            "d1bb7b0d-ad1a-4f14-b676-02d105399f24",
            "eed4a263-e37a-4714-9118-7083c384d82a"
          ]
        },
        {
          "uuid": "076f415b-3832-4d9e-9314-4ae05827aaa4",
          "code": "C013422",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67013422",
          "code_system": "MESH",
          "references": [
            "d1bb7b0d-ad1a-4f14-b676-02d105399f24"
          ]
        },
        {
          "uuid": "1e110b6a-39cb-420d-bd20-0bc5ed92d926",
          "code": "239-446-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.845",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d1bb7b0d-ad1a-4f14-b676-02d105399f24"
          ]
        },
        {
          "uuid": "42f8071a-41f9-4ea6-8d12-1d54280cb7de",
          "code": "SUB13123MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d1bb7b0d-ad1a-4f14-b676-02d105399f24"
          ]
        },
        {
          "uuid": "0fe82a7b-f04e-42d5-99be-259dee8be0f5",
          "code": "SUB75115",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d1bb7b0d-ad1a-4f14-b676-02d105399f24"
          ]
        },
        {
          "uuid": "60274ed8-71da-4361-93fc-3a288c1d70b9",
          "code": "84907",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/84907",
          "code_system": "PUBCHEM",
          "references": [
            "d1bb7b0d-ad1a-4f14-b676-02d105399f24"
          ]
        },
        {
          "uuid": "b0366bdb-e34e-4cf4-acd5-28d3375519c1",
          "code": "DTXSID90165596",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90165596",
          "code_system": "EPA CompTox",
          "references": [
            "e886d74c-6c6e-606b-874f-14fcfbc7e5ba"
          ]
        },
        {
          "uuid": "6e01e90f-ee84-48f6-ae54-e299f98e9418",
          "code": "2JZV1D2GW7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "528018c8-5227-396b-a12c-b0fc88e912a1",
          "code": "100000136886",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "14f8e1a4-4720-a793-d630-736a93dd4095"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2cae661c-1a9f-48b7-b618-f76487967bb0",
          "name": "2,2'-METHYLENEBIS(6-BROMO-4-CHLOROPHENOL)",
          "stdName": "2,2'-METHYLENEBIS(6-BROMO-4-CHLOROPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "552cfff7-1ced-4f15-98bf-a37d7e415959",
            "ae614955-3217-4d86-9eb3-97f37da5af7b"
          ],
          "display_name": false
        },
        {
          "uuid": "003abc4d-80fc-4f3a-b6be-2a3dcc59603f",
          "name": "2-BROMO-6-((3-BROMO-5-CHLORO-2-HYDROXYPHENYL)METHYL)-4-CHLOROPHENOL",
          "stdName": "2-BROMO-6-((3-BROMO-5-CHLORO-2-HYDROXYPHENYL)METHYL)-4-CHLOROPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "552cfff7-1ced-4f15-98bf-a37d7e415959",
            "ae614955-3217-4d86-9eb3-97f37da5af7b"
          ],
          "display_name": false
        },
        {
          "uuid": "55f0808d-1940-4c4c-8d1e-91b19205b4de",
          "name": "6,6'-DIBROM-4,4'-DICHLOR-2,2'-METHYLENDIPHENOL",
          "stdName": "6,6'-DIBROM-4,4'-DICHLOR-2,2'-METHYLENDIPHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73a420da-dcb2-4b48-ba6a-948def33a252"
          ],
          "display_name": false
        },
        {
          "uuid": "1fd0884f-354f-4ab9-87ac-311fd70f5d76",
          "name": "BROMCHLOROPHEN",
          "stdName": "BROMCHLOROPHEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0af9fc07-94b9-4b3b-93ec-d4e6df4f9fcd",
            "5498e274-b379-4073-9d96-6e192a4451f8",
            "25cefa0a-79e2-4f96-81d5-1738ab5981e7",
            "ae614955-3217-4d86-9eb3-97f37da5af7b"
          ],
          "display_name": false
        },
        {
          "uuid": "9f90e841-4fe8-4c10-b5eb-db4030b871d2",
          "name": "BROMCHLOROPHEN [MART.]",
          "stdName": "BROMCHLOROPHEN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0af9fc07-94b9-4b3b-93ec-d4e6df4f9fcd"
          ],
          "display_name": false
        },
        {
          "uuid": "5b68ab54-6fb2-4aa6-a0ce-0b1fb6c5521b",
          "name": "BROMCHLOROPHENE",
          "stdName": "BROMCHLOROPHENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6523b55b-749c-46cc-9f64-79665774759d",
            "e3c1e5c3-5eb4-4a1d-9d5e-222bffb313cc",
            "ed3aab45-301c-4ea8-b2b0-2cd5fcdb2e44",
            "ae614955-3217-4d86-9eb3-97f37da5af7b"
          ],
          "display_name": false
        },
        {
          "uuid": "e0ce0fba-a406-4373-80bb-65af5c5fccdc",
          "name": "BROMOCHLOROFEN",
          "stdName": "BROMOCHLOROFEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73a420da-dcb2-4b48-ba6a-948def33a252"
          ],
          "display_name": false
        },
        {
          "uuid": "a8ffe500-1dec-49f0-8498-23e4dfc1a7db",
          "name": "BROMOCHLOROPHEN",
          "stdName": "BROMOCHLOROPHEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "552cfff7-1ced-4f15-98bf-a37d7e415959"
          ],
          "display_name": true
        },
        {
          "uuid": "686e1b05-d8b4-4eb7-b4cc-8b52e11dd932",
          "name": "BROMOCHLOROPHENE",
          "stdName": "BROMOCHLOROPHENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "eb246aa5-dcbd-4cf7-b9a3-2e70eb9909b1",
            "552cfff7-1ced-4f15-98bf-a37d7e415959",
            "ae614955-3217-4d86-9eb3-97f37da5af7b",
            "814094dc-48d0-46f5-b31c-09978ae90d01"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b82e9bc8-09c4-444a-ab29-d2065f159f25",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "94b7edbd-fd6f-4f59-a533-9f5f865d9d3b",
          "name": "BROPHEN",
          "stdName": "BROPHEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ebbc98aa-0f89-43aa-a1e0-e1b8d5e43264"
          ],
          "display_name": false
        },
        {
          "uuid": "6c50e098-ec4c-95ff-ca8c-1f2992ac266f",
          "name": "Bromchlorophene [WHO-DD]",
          "stdName": "BROMCHLOROPHENE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64c159fc-f770-96ea-f8f1-16293821ef90"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "552cfff7-1ced-4f15-98bf-a37d7e415959",
          "citation": "http://www.chemicalregister.com/Bromochlorophene/Suppliers/pid50833.htm",
          "url": "http://www.chemicalregister.com/Bromochlorophene/Suppliers/pid50833.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ae614955-3217-4d86-9eb3-97f37da5af7b",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25cefa0a-79e2-4f96-81d5-1738ab5981e7",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0af9fc07-94b9-4b3b-93ec-d4e6df4f9fcd",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb246aa5-dcbd-4cf7-b9a3-2e70eb9909b1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6523b55b-749c-46cc-9f64-79665774759d",
          "citation": "who-dd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebbc98aa-0f89-43aa-a1e0-e1b8d5e43264",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73a420da-dcb2-4b48-ba6a-948def33a252",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed3aab45-301c-4ea8-b2b0-2cd5fcdb2e44",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1bb7b0d-ad1a-4f14-b676-02d105399f24",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390922000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72bca6ff-1eef-4730-ac2e-176df377cd44",
          "citation": "SRS import [2JZV1D2GW7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2JZV1D2GW7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390922000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5498e274-b379-4073-9d96-6e192a4451f8",
          "citation": "BROMCHLOROPHEN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "814094dc-48d0-46f5-b31c-09978ae90d01",
          "citation": "BROMOCHLOROPHENE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3c1e5c3-5eb4-4a1d-9d5e-222bffb313cc",
          "citation": "BROMCHLOROPHENE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e886d74c-6c6e-606b-874f-14fcfbc7e5ba",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15435-29-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "14f8e1a4-4720-a793-d630-736a93dd4095",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "eed4a263-e37a-4714-9118-7083c384d82a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "64c159fc-f770-96ea-f8f1-16293821ef90",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ace4d705-6a62-4e18-8422-ce6b2f201eb8",
          "id": "ace4d705-6a62-4e18-8422-ce6b2f201eb8",
          "molfile": "\n  Marvin  01132108582D          \n\n 19 20  0  0  0  0            999 V2000\n    1.9010   -2.6680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6197   -2.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3319   -2.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3348   -3.5100    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.0531   -2.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0633   -1.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7779   -1.0377    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.3487   -1.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6323   -1.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9100   -1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1963   -1.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1963   -2.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4741   -2.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4726   -3.4890    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2349   -2.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2355   -1.4253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9391   -1.0013    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    0.4843   -1.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4912   -0.1908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  9  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 18 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "C(c1cc(cc(c1O)Br)Cl)c2cc(cc(c2O)Br)Cl",
          "formula": "C13H8Br2Cl2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dbc84aeb-e36d-44f8-b5f7-6b9d9466f0dc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "426.9148",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "40f9a385-dcb6-4f4f-a348-9534d68d3237",
      "version": "8",
      "structure": {
        "id": "4fd2c838-bf6e-434b-9ca5-f984b967a704",
        "molfile": "\n  Marvin  01132104102D          \n\n 19 20  0  0  0  0            999 V2000\n    1.1963   -1.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6323   -1.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4843   -1.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6197   -2.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2355   -1.4253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3319   -2.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9100   -1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2349   -2.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0531   -2.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1963   -2.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3487   -1.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0633   -1.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4741   -2.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9391   -1.0013    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.3348   -3.5100    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    1.9010   -2.6680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4912   -0.1908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7779   -1.0377    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.4726   -3.4890    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 12  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 10  2  0  0  0  0\n 14  5  1  0  0  0  0\n 15  6  1  0  0  0  0\n 16  4  1  0  0  0  0\n 17  3  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 13  1  0  0  0  0\n  8  5  2  0  0  0  0\n  9  6  2  0  0  0  0\nM  END",
        "smiles": "C(c1cc(cc(c1O)Br)Cl)c2cc(cc(c2O)Br)Cl",
        "formula": "C13H8Br2Cl2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "426.9148",
        "optical_activity": "NONE",
        "references": [
          "72bca6ff-1eef-4730-ac2e-176df377cd44",
          "552cfff7-1ced-4f15-98bf-a37d7e415959"
        ],
        "stereo_centers": 0
      },
      "unii": "2JZV1D2GW7"
    }
  ]
}