{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "907804f7-cdd3-4c9c-9193-b24f314e1dc6", "code": "52915299", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/52915299", "code_system": "PUBCHEM", "references": [ "c3a53eac-4e97-443b-804d-11af4ab5c0c5" ] }, { "uuid": "5130445f-715e-4f6e-a083-d636fe369061", "code": "2J86RN9BGD", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "6e6c365d-cefd-4792-a486-b4b6ce898da1", "code": "919005-14-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=919005-14-4", "code_system": "CAS", "references": [ "7e93ef4f-247a-4897-a8e6-4bafd95c1676" ] } ], "relationships": [ { "uuid": "4cb8392b-07a5-45c3-b1fe-98029e4fa56c", "amount": { "uuid": "2ce1c2ee-790d-4a53-b951-2516a17bf17f" }, "type": "SALT/SOLVATE->PARENT", "references": [ "7e93ef4f-247a-4897-a8e6-4bafd95c1676" ], "related_substance": { "uuid": "35dbeb88-c3cb-4aea-a0de-8d322ac8ae42", "refuuid": "a505859a-fb5b-434e-927c-3eeedf6e2a64", "name": "Ammonium 2,2,3-trifluoro-3-(1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy)propanoate", "unii": "LYR4WFU3BX", "linking_id": "LYR4WFU3BX", "ref_pname": "Ammonium 2,2,3-trifluoro-3-(1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy)propanoate", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "9a739f3b-e575-4e1b-8e1f-3fd40c0ef08d", "name": "2,2,3-Trifluoro-3-(1,1,2,2,3,3-hexafluoro-3-[trifluoromethoxy]propoxy)propionic acid", "stdName": "2,2,3-TRIFLUORO-3-(1,1,2,2,3,3-HEXAFLUORO-3-(TRIFLUOROMETHOXY)PROPOXY)PROPIONIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7e93ef4f-247a-4897-a8e6-4bafd95c1676" ], "display_name": false }, { "uuid": "e8870502-93c0-4a6b-94f1-1315fef50746", "name": "2,2,3-Trifluoro-3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]propanoic acid", "stdName": "2,2,3-TRIFLUORO-3-(1,1,2,2,3,3-HEXAFLUORO-3-(TRIFLUOROMETHOXY)PROPOXY)PROPANOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7e93ef4f-247a-4897-a8e6-4bafd95c1676" ], "display_name": true }, { "uuid": "69e62791-8f49-4fb4-b292-b8958bd30528", "name": "3H-Perfluoro-3-[(3-methoxy-propoxy)propanoic acid]", "stdName": "3H-PERFLUORO-3-((3-METHOXY-PROPOXY)PROPANOIC ACID)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7e93ef4f-247a-4897-a8e6-4bafd95c1676" ], "display_name": false }, { "uuid": "67efe885-ca0c-45aa-8899-0228b5c56e7d", "name": "Propanoic acid, 2,2,3-trifluoro-3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethoxy)propoxy]-", "stdName": "PROPANOIC ACID, 2,2,3-TRIFLUORO-3-(1,1,2,2,3,3-HEXAFLUORO-3-(TRIFLUOROMETHOXY)PROPOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7e93ef4f-247a-4897-a8e6-4bafd95c1676" ], "display_name": false } ], "references": [ { "uuid": "7e93ef4f-247a-4897-a8e6-4bafd95c1676", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c3a53eac-4e97-443b-804d-11af4ab5c0c5", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "99ec7569-6523-4a0b-b921-f07143851ac9", "id": "99ec7569-6523-4a0b-b921-f07143851ac9", "molfile": "\n CDK 02122511442D\n\n 23 22 0 0 0 0 0 0 0 0999 V2000\n 24.1791 -4.1097 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8281 -4.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4771 -5.6697 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6080 -6.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8281 -7.5915 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -6.2405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9480 -7.5915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2990 -6.8116 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5970 -8.3715 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7280 -8.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0790 -8.1626 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3769 -9.7225 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5079 -10.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8589 -9.5136 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1569 -11.0735 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2879 -11.6444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8479 -11.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4078 -11.6444 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8479 -10.0844 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8479 -13.2043 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0481 -3.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4881 -3.5387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8281 -2.1877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 17 20 1 0 0 0 0\n 2 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\nM END", "smiles": "C(C(C(=O)O)(F)F)(F)OC(C(C(F)(F)OC(F)(F)F)(F)F)(F)F", "formula": "C7H2F12O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d818597f-d21e-41a4-a771-eb7aa17d6197" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "378.0695", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "9a1c4556-92ae-425c-9039-0dc604dc5ea4", "version": "3", "structure": { "id": "569a325d-0b42-436c-b3a8-699981839600", "molfile": "\n JSDraw202122511442D\n\n 23 22 0 0 0 0 0 V2000\n 24.1791 -4.1097 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8281 -4.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.4771 -5.6697 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6080 -6.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8281 -7.5915 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -6.2405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9480 -7.5915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2990 -6.8116 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5970 -8.3715 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7280 -8.9425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0790 -8.1626 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3769 -9.7225 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5079 -10.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8589 -9.5136 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1569 -11.0735 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2879 -11.6444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8479 -11.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.4078 -11.6444 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8479 -10.0844 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8479 -13.2043 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0481 -3.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4881 -3.5387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8281 -2.1877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 17 20 1 0 0 0 0\n 2 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\nM END", "smiles": "C(C(C(=O)O)(F)F)(F)OC(C(C(F)(F)OC(F)(F)F)(F)F)(F)F", "formula": "C7H2F12O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "378.0695", "optical_activity": "( + / - )", "references": [ "7e93ef4f-247a-4897-a8e6-4bafd95c1676" ], "stereo_centers": 1 }, "unii": "2J86RN9BGD" } ] }