{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1c923751-19c9-4938-8375-cf5394505b59",
          "code": "35564-86-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=35564-86-4",
          "code_system": "CAS",
          "references": [
            "57234374-7874-4aad-87ea-1e7fdf5894a2",
            "ef8d4b7a-6bf4-4057-ac2b-d58f7aee9957"
          ]
        },
        {
          "uuid": "c1a0a1e7-b908-4d3e-9960-0084496cb5cd",
          "code": "44630381",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44630381",
          "code_system": "PUBCHEM",
          "references": [
            "57234374-7874-4aad-87ea-1e7fdf5894a2"
          ]
        },
        {
          "uuid": "260fc1e0-fd71-4c24-b94a-3e1620f207a6",
          "code": "2IG86HL9XM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "58c336ab-ee34-44c2-54a9-cb00338022e6",
          "code": "DTXSID40956956",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40956956",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "18abf835-2cb7-49f2-8206-77298f17a625",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "d9bb32e4-814e-4791-944a-6168715ef59c",
            "refuuid": "c1f32019-0a5b-470a-a4b1-1b38653f84e3",
            "name": "MEGLUMINE",
            "unii": "6HG8UB2MUY",
            "linking_id": "6HG8UB2MUY",
            "ref_pname": "MEGLUMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9bb7ac30-ad2b-44a3-9fc7-7a1146d0187e",
          "name": "D-(-)-N-METHYLGLUCAMINIUM CHLORIDE",
          "stdName": "D-(-)-N-METHYLGLUCAMINIUM CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cebb18f-1e1e-4515-b338-13e6a99f2840",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294"
          ],
          "display_name": false
        },
        {
          "uuid": "9ed4c466-9282-4df2-9d0a-f3507f2b1a19",
          "name": "D-GLUCITOL, 1-DEOXY-1-(METHYLAMINO)-, HYDROCHLORIDE",
          "stdName": "D-GLUCITOL, 1-DEOXY-1-(METHYLAMINO)-, HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cebb18f-1e1e-4515-b338-13e6a99f2840",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294"
          ],
          "display_name": false
        },
        {
          "uuid": "0c44f59f-960d-46c8-a573-b809f06ea2ae",
          "name": "D-GLUCITOL, 1-DEOXY-1-(METHYLAMINO)-, HYDROCHLORIDE (1:1)",
          "stdName": "D-GLUCITOL, 1-DEOXY-1-(METHYLAMINO)-, HYDROCHLORIDE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cebb18f-1e1e-4515-b338-13e6a99f2840",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294"
          ],
          "display_name": false
        },
        {
          "uuid": "186c128c-ddd1-44a9-916f-fcaa7cd1ee72",
          "name": "MEGLUMINE HYDROCHLORIDE",
          "stdName": "MEGLUMINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cebb18f-1e1e-4515-b338-13e6a99f2840",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294"
          ],
          "display_name": false
        },
        {
          "uuid": "01a1563d-5dfb-46a0-b5de-787dfaffc0b3",
          "name": "METHYLGLUCAMINE CHLORIDE",
          "stdName": "METHYLGLUCAMINE CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cebb18f-1e1e-4515-b338-13e6a99f2840",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294"
          ],
          "display_name": false
        },
        {
          "uuid": "0738a349-68bf-4b3c-a7a3-f749608a01c8",
          "name": "METHYLGLUCAMINE HCL",
          "stdName": "METHYLGLUCAMINE HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "66f1347e-a495-44fa-bacd-6587c6bb1bff",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294",
            "46b07e36-3d62-4fb3-ba1e-bede00a14dca"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9c47c0cb-4a47-44d5-9010-56b5c25dff90",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "28b9c4de-8e37-4f10-91a2-84a42dfa4704",
          "name": "METHYLGLUCAMINE HYDROCHLORIDE",
          "stdName": "METHYLGLUCAMINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66f1347e-a495-44fa-bacd-6587c6bb1bff",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294"
          ],
          "display_name": true
        },
        {
          "uuid": "56180317-ab4c-4217-a330-1cd8d0fbccc2",
          "name": "N-METHYL GLUCAMINE HYDROCHLORIDE",
          "stdName": "N-METHYL GLUCAMINE HYDROCHLORIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66f1347e-a495-44fa-bacd-6587c6bb1bff",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294"
          ],
          "display_name": false
        },
        {
          "uuid": "8f05bb90-33f8-474b-ad23-028aca7481da",
          "name": "N-METHYL-D-GLUCAMINE HYDROCHLORIDE",
          "stdName": "N-METHYL-D-GLUCAMINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cebb18f-1e1e-4515-b338-13e6a99f2840",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294"
          ],
          "display_name": false
        },
        {
          "uuid": "8da18e07-b4d4-4fbc-bed7-5b0187ca350f",
          "name": "N-METHYLGLUCAMINE HYDROCHLORIDE",
          "stdName": "N-METHYLGLUCAMINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cebb18f-1e1e-4515-b338-13e6a99f2840",
            "f2ff87cc-6668-41ee-a36e-919d06ef4294"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "66f1347e-a495-44fa-bacd-6587c6bb1bff",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f2ff87cc-6668-41ee-a36e-919d06ef4294",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cebb18f-1e1e-4515-b338-13e6a99f2840",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57234374-7874-4aad-87ea-1e7fdf5894a2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391544000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e378969e-c87a-4963-be01-e5318e883d72",
          "citation": "SRS import [2IG86HL9XM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2IG86HL9XM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391544000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46b07e36-3d62-4fb3-ba1e-bede00a14dca",
          "citation": "METHYLGLUCAMINE HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef8d4b7a-6bf4-4057-ac2b-d58f7aee9957",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1444d223-6f24-4cf9-abd9-7a50aa92ffdc",
          "id": "1444d223-6f24-4cf9-abd9-7a50aa92ffdc",
          "molfile": "\n  Marvin  01132101152D          \n\n  1  0  0  0  1  0            999 V2000\n   13.4341   -8.7055    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1687bfa7-d62f-44af-a515-051f5bb62687"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b5218223-cde3-4dd7-b2ec-a11e97148cb5",
          "id": "b5218223-cde3-4dd7-b2ec-a11e97148cb5",
          "molfile": "\n  Marvin  01132109232D          \n\n 13 12  0  0  1  0            999 V2000\n    9.8000   -7.2682    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.7958   -8.0949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0860   -6.8632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3720   -7.2765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5139   -6.8549    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.5097   -6.0282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2279   -7.2682    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.2237   -8.0949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9419   -6.8549    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.9377   -6.0282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6559   -7.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3699   -6.8507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0838   -7.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\nM  END",
          "smiles": "CNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O",
          "formula": "C7H17NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3a505682-eb04-469a-a59a-c8850841fc0f"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "195.2139",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "34612162-a015-4392-80fb-ea82e8b468b5",
      "version": "4",
      "structure": {
        "id": "f7129196-41a0-4d47-ba3d-2e99e06e181e",
        "molfile": "\n  Marvin  01132112482D          \n\n 14 12  0  0  1  0            999 V2000\n   10.5139   -6.8549    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.2279   -7.2682    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.9419   -6.8549    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.8000   -7.2682    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.9377   -6.0282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6559   -7.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3699   -6.8507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0838   -7.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2237   -8.0949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7958   -8.0949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0860   -6.8632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3720   -7.2765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5097   -6.0282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4341   -8.7055    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  3  5  1  1  0  0  0\n  6  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  2  9  1  1  0  0  0\n  4 10  1  6  0  0  0\n 11  4  1  0  0  0  0\n 12 11  1  0  0  0  0\n  1 13  1  1  0  0  0\nM  END",
        "smiles": "CNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O.Cl",
        "formula": "C7H17NO5.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "231.6748",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3cebb18f-1e1e-4515-b338-13e6a99f2840",
          "e378969e-c87a-4963-be01-e5318e883d72"
        ],
        "stereo_centers": 4
      },
      "unii": "2IG86HL9XM"
    }
  ]
}