{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8dc7f9da-4c67-4ffb-b2db-0141218266eb",
          "code": "28768-32-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28768-32-3",
          "code_system": "CAS",
          "references": [
            "1a8afea0-838f-4786-8793-9ae69be54c43",
            "325f21d1-e73d-443a-ade1-b557111a6d1e"
          ]
        },
        {
          "uuid": "68909664-5085-4395-9b38-81cd32dc7e53",
          "code": "91593",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91593",
          "code_system": "PUBCHEM",
          "references": [
            "1a8afea0-838f-4786-8793-9ae69be54c43"
          ]
        },
        {
          "uuid": "aa2f744c-9a0b-4a0b-9909-1522c4686032",
          "code": "249-204-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.717",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1a8afea0-838f-4786-8793-9ae69be54c43"
          ]
        },
        {
          "uuid": "4aec2ddf-4092-2e73-21a0-f50b665c4094",
          "code": "DTXSID0042248",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0042248",
          "code_system": "EPA CompTox",
          "references": [
            "7e60b044-31ad-7af3-ffb7-7fcd2df2f756"
          ]
        },
        {
          "uuid": "f1c44c0f-9824-4c0f-9612-38d56ddb39cb",
          "code": "2I8ZB2RX2U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ba374798-3701-107d-b7c3-278f07d53135",
          "code": "300000053560",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9cd974fa-400c-a624-cc60-3559ad48c00a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "19cfc684-2d9a-4516-a898-7421e58c6076",
          "name": "2-OXIRANEMETHANAMINE, N,N'-(METHYLENEDI-4,1-PHENYLENE)BIS(N-(2-OXIRANYLMETHYL)-",
          "stdName": "2-OXIRANEMETHANAMINE, N,N'-(METHYLENEDI-4,1-PHENYLENE)BIS(N-(2-OXIRANYLMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "1dadb689-220c-4e72-95a2-5f83b7bf6781",
          "name": "4,4'-METHYLENEBIS(N,N-BIS(OXIRANYLMETHYL)ANILINE)",
          "stdName": "4,4'-METHYLENEBIS(N,N-BIS(OXIRANYLMETHYL)ANILINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "317cec86-6198-4910-9146-9b82388e803f",
          "name": "4,4'-METHYLENEBIS(N,N-DIGLYCIDYLANILINE)",
          "stdName": "4,4'-METHYLENEBIS(N,N-DIGLYCIDYLANILINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf08acf8-5c65-4665-bc14-bcb644cb8a92"
          ],
          "display_name": false
        },
        {
          "uuid": "1ff31dee-3fed-42f8-b908-67141b6f5310",
          "name": "ANILINE, 4,4'-METHYLENEBIS(N,N-BIS(2,3-EPOXYPROPYL)-",
          "stdName": "ANILINE, 4,4'-METHYLENEBIS(N,N-BIS(2,3-EPOXYPROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "5504ab36-c6b1-4112-93a3-e71b46354b4d",
          "name": "BIS(4-(DIGLYCIDYLAMINO)PHENYL)METHANE",
          "stdName": "BIS(4-(DIGLYCIDYLAMINO)PHENYL)METHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "0e5a4e96-c61a-41c2-8e02-16e28a9bfb96",
          "name": "N,N,N',N'-TETRAGLYCIDYL-4,4'-DIAMINODIPHENYLMETHANE",
          "stdName": "N,N,N',N'-TETRAGLYCIDYL-4,4'-DIAMINODIPHENYLMETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "e0a6f68c-45d8-47e1-ad09-4a5ebd2fefba",
          "name": "N,N,N',N'-TETRAGLYCIDYL-4,4'-METHYLENEBISBENZENAMINE",
          "stdName": "N,N,N',N'-TETRAGLYCIDYL-4,4'-METHYLENEBISBENZENAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "cc8a6d42-af19-45e0-8190-8d115e41d228",
          "name": "N,N,N',N'-TETRAGLYCIDYL-4,4'-METHYLENEDIANILINE",
          "stdName": "N,N,N',N'-TETRAGLYCIDYL-4,4'-METHYLENEDIANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "c8734098-c3d4-434d-9e90-230d24e6e54d",
          "name": "N,N,N',N'-TETRAGLYCIDYLBIS(P-AMINOPHENYL)METHANE",
          "stdName": "N,N,N',N'-TETRAGLYCIDYLBIS(P-AMINOPHENYL)METHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "d457bbca-33ed-44e8-92d4-7fd7d9b75279",
          "name": "OXIRANEMETHANAMINE, N,N'-(METHYLENEDI-4,1-PHENYLENE)BIS(N-(OXIRANYLMETHYL)-",
          "stdName": "OXIRANEMETHANAMINE, N,N'-(METHYLENEDI-4,1-PHENYLENE)BIS(N-(OXIRANYLMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "0814db36-3af5-425a-9a68-4f2832651039",
          "name": "TETRAGLYCIDYL 4,4'-DIAMINODIPHENYLMETHANE",
          "stdName": "TETRAGLYCIDYL 4,4'-DIAMINODIPHENYLMETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": false
        },
        {
          "uuid": "a473a89f-93ea-4de6-bdec-df37d9c8ac56",
          "name": "TETRAGLYCIDYL METHYLENEDIANILINE",
          "stdName": "TETRAGLYCIDYL METHYLENEDIANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2486ea36-e82a-4387-9229-785fd9f4ca6b"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "bf08acf8-5c65-4665-bc14-bcb644cb8a92",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2486ea36-e82a-4387-9229-785fd9f4ca6b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a8afea0-838f-4786-8793-9ae69be54c43",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393306000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "300df120-ca69-4bc8-9782-52e068d54114",
          "citation": "SRS import [2I8ZB2RX2U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2I8ZB2RX2U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393306000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e60b044-31ad-7af3-ffb7-7fcd2df2f756",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28768-32-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "325f21d1-e73d-443a-ade1-b557111a6d1e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9cd974fa-400c-a624-cc60-3559ad48c00a",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7a9a9663-9b25-4089-8ef4-c6cd1f887859",
          "id": "7a9a9663-9b25-4089-8ef4-c6cd1f887859",
          "molfile": "\n  Marvin  01132106222D          \n\n 31 36  0  0  0  0            999 V2000\n    8.6477   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3607   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.7783   -1.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1858   -1.9455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9449   -1.9455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9449   -1.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6477   -0.7028    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.0653    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4728   -0.7028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2319   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2319   -3.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5189   -3.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8059   -3.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0929   -3.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3799   -3.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3799   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6669   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9539   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9539   -3.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6669   -3.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2409   -1.9455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2409   -1.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5381   -0.7028    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.7130   -0.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1204    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5381   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8251   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.0000   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4074   -1.2223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8059   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5189   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 31  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 30 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 21  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 28 29  1  0  0  0  0\n 31 30  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1Cc2ccc(cc2)N(CC3CO3)CC4CO4)N(CC5CO5)CC6CO6",
          "formula": "C25H30N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "abbf1d74-9507-47de-822d-2f2a9e9b1f2d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "422.5176",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b68a9760-4161-4edf-ae99-f99c4b05954d",
      "version": "5",
      "structure": {
        "id": "4d8f87d2-62c2-4fb3-88e8-1752666dbc4a",
        "molfile": "\n  Marvin  01132104032D          \n\n 31 36  0  0  0  0            999 V2000\n    4.3799   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3799   -3.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6669   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6669   -3.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9539   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9539   -3.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0929   -3.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2319   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2319   -3.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5189   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5189   -3.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8059   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8059   -3.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9449   -1.9455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2409   -1.9455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6477   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9449   -1.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6477   -0.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3607   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2409   -1.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5381   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8251   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5381   -0.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4074   -1.2223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7130   -0.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1204    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7783   -1.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1858   -1.9455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0653    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4728   -0.7028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  2  7  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 15  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  8 14  1  0  0  0  0\n  9 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15 20  1  0  0  0  0\n 15 21  1  0  0  0  0\n 16 19  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 30  1  0  0  0  0\n 18 31  1  0  0  0  0\n 19 28  1  0  0  0  0\n 19 29  1  0  0  0  0\n 20 23  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\n 23 26  1  0  0  0  0\n 23 27  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 30 31  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1Cc2ccc(cc2)N(CC3CO3)CC4CO4)N(CC5CO5)CC6CO6",
        "formula": "C25H30N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "422.5176",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bf08acf8-5c65-4665-bc14-bcb644cb8a92",
          "300df120-ca69-4bc8-9782-52e068d54114"
        ],
        "stereo_centers": 4
      },
      "unii": "2I8ZB2RX2U"
    }
  ]
}