{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "17be2e9f-1cd9-4637-a1f2-6b19cdf8adfa", "code": "R03AC12", "comments": "ATC|RESPIRATORY SYSTEM|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS, INHALANTS|Selective beta-2-adrenoreceptor agonists|salmeterol", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=R03AC12&showdescription=yes", "code_system": "WHO-ATC", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "20036d83-a208-41f1-aeda-e58f60078d55", "code": "N0000009922", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Adrenergic Receptor Interactions [MoA]|Adrenergic Agonists [MoA]|Adrenergic beta-Agonists [MoA]|Adrenergic beta2-Agonists [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000009922", "code_system": "NDF-RT", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "b097aee6-9a1f-4b9b-a0de-54bdf8498df5", "code": "N0000175779", "comments": "Established Pharmacologic Class [EPC]|beta2-Adrenergic Agonist [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175779", "code_system": "NDF-RT", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "8d839b46-e554-4375-bb26-6755be4b6c05", "code": "QR03AK06", "comments": "VATC|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS, INHALANTS|Adrenergics in combination with corticosteroids or other drugs, excl. anticholinergics|salmeterol and fluticasone", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR03AK06&showdescription=yes", "code_system": "WHO-VATC", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "5d11ce0b-c19d-4ebb-93da-4e5d817105c1", "code": "QR03AC12", "comments": "VATC|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS, INHALANTS|Selective beta-2-adrenoreceptor agonists|salmeterol", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR03AC12&showdescription=yes", "code_system": "WHO-VATC", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "91b8e2cc-2b7c-4ce6-94d6-cdb5f6686ee5", "code": "89365-50-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=89365-50-4", "code_system": "CAS", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d", "1e507c3d-1d83-49be-9e5c-fecca97ba715" ] }, { "uuid": "11b9bced-64f1-43d3-9071-660e2b33c181", "code": "C29443", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29443", "code_system": "NCI_THESAURUS", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "08049a48-62af-42b8-899d-ffd99c76857a", "code": "C057823", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67057823", "code_system": "MESH", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "b55dd9b1-9f1d-4a00-b9a9-bc0fbbcacdd0", "code": "869", "comments": "LiverTox|Respiratory|Bronchodilation|Beta 2 adrenergic agonist", "type": "PRIMARY", "url": "https://livertox.nlm.nih.gov/Beta2AdrenergicAgonists.htm", "code_system": "LIVERTOX", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "7689920f-6599-47ca-891e-02036720cfb0", "code": "SALMETEROL", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Salmeterol", "code_system": "WIKIPEDIA", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "a597451e-f35b-4c3f-9e1a-cfa96c876e34", "code": "R03AK06", "comments": "ATC|RESPIRATORY SYSTEM|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS, INHALANTS|Adrenergics in combination with corticosteroids or other drugs, excl. anticholinergics|salmeterol and fluticasone", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=R03AK06&showdescription=yes", "code_system": "WHO-ATC", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "22277e4d-60cf-48da-a4de-49156b277036", "code": "SUB10430MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "cb4fd023-76d2-46d8-a57f-ee0c36b2bdb7", "code": "5578", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5578", "code_system": "INN", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "0c46e5c0-cba6-4639-b41c-2163cdaf4414", "code": "559", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=559", "code_system": "IUPHAR", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "6ecf0f12-ef42-442a-8259-632926760182", "code": "36117", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/36117/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "e5ab542d-ba90-4cb7-9c89-066f3a6984e4", "code": "m9745", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m9745?q=authorize", "code_system": "MERCK INDEX", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "1981bb6e-139c-4c92-bd0b-77a020a8b5e4", "code": "DB00938", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00938", "code_system": "DRUG BANK", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "9417262a-be83-4668-9b53-05cbb2c12c02", "code": "LABAZENIT (REFUSED: ASTHMA)", "comments": "EMA EPAR|DISEASES|IMMUNE SYSTEM DISEASES|HYPERSENSITIVITY|HYPERSENSITIVITY, IMMEDIATE|RESPITORY HYPERSENSITIVITY|ASTHMA", "type": "PRIMARY", "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/002201/human_med_001648.jsp&mid=WC0b01ac058001d124", "code_system": "EMA ASSESSMENT REPORTS", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "cd8128ac-7e40-4565-9c5c-36a07a054f90", "code": "CHEMBL1263", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1263", "code_system": "ChEMBL", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "a95b6118-1d8a-4e33-8d03-69aa5e5f673b", "code": "R03AK12", "comments": "ATC|RESPIRATORY SYSTEM|DRUGS FOR OBSTRUCTIVE AIRWAY DISEASES|ADRENERGICS, INHALANTS|Adrenergics in combination with corticosteroids or other drugs, excl. anticholinergics|salmeterol and budesonide", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=R03AK12&showdescription=yes", "code_system": "WHO-ATC", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "9987e5a4-5d2e-4706-90cf-de56f36583c1", "code": "5152", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5152", "code_system": "PUBCHEM", "references": [ "57131a3d-a515-44d3-a357-d9b61d94494d" ] }, { "uuid": "eb31735c-2a88-3654-9167-d6807c5f2ee8", "code": "7315", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7315", "code_system": "HSDB", "references": [ "5b98df08-648a-89f4-842f-dbde9a226574" ] }, { "uuid": "c36d0e9a-4e53-cded-3d9d-8e9417bc6498", "code": "DTXSID6023571", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6023571", "code_system": "EPA CompTox", "references": [ "615b7a8c-3e0b-a050-31f0-f5d9196a1b3f" ] }, { "uuid": "a5c85923-41fc-cd48-cd28-8b8b3cbcaa53", "code": "Salmeterol", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM243/", "code_system": "LACTMED", "references": [ "12f71a65-fc9e-f7a8-4f1b-d3c7da2ac755" ] }, { "uuid": "fff6c8d3-2cd5-71da-eedd-e4752d23c1ed", "code": "C319", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Anti-asthmatic Agent[C29712]|Bronchodilator", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C319", "code_system": "NCI_THESAURUS", "references": [ "12f71a65-fc9e-f7a8-4f1b-d3c7da2ac755" ] }, { "uuid": "769f4d8d-f553-475d-9982-949b9c0077b0", "code": "2I4BC502BT", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "82bfa2a6-0662-f471-e4f0-e8e9c34a6860", "code": "2419", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/2419", "code_system": "DRUG CENTRAL", "references": [ "12f71a65-fc9e-f7a8-4f1b-d3c7da2ac755" ] }, { "uuid": "2ea8d028-052d-fc83-6545-4606df152f98", "code": "9011", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9011", "code_system": "CHEBI", "references": [ "12f71a65-fc9e-f7a8-4f1b-d3c7da2ac755" ] }, { "uuid": "b33d70ba-211e-6dfa-e23c-b4b1b80c3be3", "code": "X-46", "type": "PRIMARY", "url": "https://searchusan.ama-assn.org/finder/usan/search/X-46/relevant/1/", "code_system": "USAN", "references": [ "8bc4826a-6696-3e4d-945d-1e45245b4574" ] }, { "uuid": "91d4ccf7-415e-69d9-e0dd-70fc4bb2fc77", "code": "2I4BC502BT", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2I4BC502BT", "code_system": "DAILYMED", "references": [ "ad690047-f054-a98f-649b-369b91b57b38" ] }, { "uuid": "aa3265c8-1a87-8d96-3f3d-67b3a08674ab", "code": "100000080527", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "7506b3a2-f3ad-4c75-b89e-6ffd708017fc" ] } ], "substance_class": "chemical", "references": [ { "uuid": "d2baff5a-4143-448a-bf53-b83d306c378d", "citation": "ACD 9.0 (INN-MEDNET)", "doc_type": "ACD", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ddd65e12-4c48-42df-b09b-197e025c9e64", "citation": "USP Dictionary", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "97421af7-c591-4113-80bf-e0122125b70d", "citation": "USP DICTIONARY 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cf7a8692-7f55-44e6-bf0a-914aab5cffea", "citation": "INN Proposed List 55", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL55.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c51d69c8-16dd-4ae0-b1fb-5faaa2672a0f", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b0e2da46-6306-43e7-8bec-6c50082ceef0", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "30b7eea5-9992-4aa7-ad6b-adf8cd27b910", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aebeffbb-6121-427c-889f-1b96f42b8269", "citation": "clinicaltrials.gov", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "62a54e9b-53f0-4780-86b5-aeca7f0c8e42", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "70cf42c2-4ab0-466b-b3a3-00ee1b20f33c", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9b720657-6c5f-4a2e-826d-6b039aafd19b", "citation": "USP DICTIONARY", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "57131a3d-a515-44d3-a357-d9b61d94494d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390723000, "tags": [ "NOMEN" ] }, { "uuid": "88877f94-8c0e-42f7-9dd8-571c844cf474", "citation": "DMD MAY 1996 VOL. 24 NO. 5 555-559", "url": "http://www.accessdata.fda.gov/spl/data/e96f8cfb-3613-4b43-86eb-25efe9f2e601/e96f8cfb-3613-4b43-86eb-25efe9f2e601.xml", "doc_type": "JOURNAL ARTICLE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b7f9150f-de7c-4416-af6a-5ae753cc6890", "citation": "SRS import [2I4BC502BT]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2I4BC502BT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390723000, "tags": [ "NOMEN" ] }, { "uuid": "9ca56be5-c6e7-4bdb-acec-273c987d122a", "citation": "SALMETEROL [USAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c07e2822-95df-44a4-8f79-a5a57979a859", "citation": "SALMETEROL [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3e3630f2-a59c-47ee-b1e4-f0d95cd2b9f6", "citation": "SALMETEROL [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "731fc250-b26a-49c0-8040-a1dae203afcf", "citation": "SALMETEROL [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2864bc7c-5be0-454f-8e16-0c9a208ce8fc", "citation": "SALMETEROL [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b62fb76e-9b3a-4955-a2fd-75c96557c757", "citation": "SALMETEROL [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "5b98df08-648a-89f4-842f-dbde9a226574", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+89365-50-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "615b7a8c-3e0b-a050-31f0-f5d9196a1b3f", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=89365-50-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "cd25536c-1186-8b60-9939-a8ff1efe459e", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+89365-50-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "69322509-616c-4d31-7727-d79ae0cf808f", "citation": "Obach, R. S., Huynh, P., Allen, M. C. and Beedham, C. (2004), Human Liver Aldehyde Oxidase: Inhibition by 239 Drugs. The Journal of Clinical Pharmacology, 44: 7–19. doi:10.1177/0091270003260336", "url": "http://onlinelibrary.wiley.com/doi/10.1177/0091270003260336/epdf", "doc_type": "JA", "public_domain": true }, { "uuid": "7506b3a2-f3ad-4c75-b89e-6ffd708017fc", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "bbb7d11e-e9d0-55ae-4b6f-b0ae85010e8c", "citation": "https://www.clinicalkey.com/pharmacology/monograph/554?sec=monphar", "doc_type": "CLINICAL PHARMACOLOGY", "public_domain": true }, { "uuid": "12f71a65-fc9e-f7a8-4f1b-d3c7da2ac755", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "1e507c3d-1d83-49be-9e5c-fecca97ba715", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "8bc4826a-6696-3e4d-945d-1e45245b4574", "citation": "USAD COUN", "doc_type": "USANCOUN", "public_domain": true }, { "uuid": "3f3453d4-90bf-e95e-9b07-32dd81091640", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "ad690047-f054-a98f-649b-369b91b57b38", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "57b43a0a-1552-4a65-8ff8-e06064ea0aa5", "id": "57b43a0a-1552-4a65-8ff8-e06064ea0aa5", "molfile": "\n Marvin 01132104332D \n\n 30 31 0 0 0 0 999 V2000\n -1.3462 -1.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0368 -1.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0529 -2.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3355 -2.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3221 -3.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0529 -3.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7892 -3.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7892 -2.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4905 -2.3324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6127 -3.9286 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -0.5965 -4.7347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1317 -3.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8411 -3.9286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5585 -3.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2841 -3.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9988 -3.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6921 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3961 -3.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1297 -3.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8364 -3.5040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5727 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3062 -3.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0129 -3.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7465 -3.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4505 -3.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1733 -3.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9069 -3.8694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9069 -4.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2002 -5.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4505 -4.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 8 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 30 25 2 0 0 0 0\n 27 26 2 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 2 0 0 0 0\n 29 30 1 0 0 0 0\nM END", "smiles": "C(CCCOCCCCc1ccccc1)CCNCC(c2ccc(c(c2)CO)O)O", "formula": "C25H37NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9f3f0ddf-aa77-4a5f-8f78-6b34237bec56" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "415.5665", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "ac4ee6f2-d1e1-4021-9fb4-017531f89f01", "version": "28", "structure": { "id": "23186a03-bfbb-4d1d-864f-bc579c937f47", "molfile": "\n Marvin 01132101582D \n\n 30 31 0 0 0 0 999 V2000\n -2.0529 -2.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3355 -2.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3221 -3.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7892 -2.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0529 -3.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7892 -3.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6127 -3.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8411 -3.9286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4905 -2.3324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0368 -1.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5965 -4.7347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4505 -3.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3462 -1.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8364 -3.5040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1317 -3.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5585 -3.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7465 -3.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1297 -3.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5727 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4505 -4.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1733 -3.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2841 -3.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0129 -3.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3062 -3.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3961 -3.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9988 -3.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6921 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9069 -3.8694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2002 -5.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9069 -4.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 4 2 0 0 0 0\n 7 3 1 0 0 0 0\n 8 15 1 0 0 0 0\n 9 4 1 0 0 0 0\n 10 1 1 0 0 0 0\n 11 7 1 0 0 0 0\n 12 17 1 0 0 0 0\n 13 10 1 0 0 0 0\n 14 18 1 0 0 0 0\n 15 7 1 0 0 0 0\n 16 8 1 0 0 0 0\n 17 23 1 0 0 0 0\n 18 25 1 0 0 0 0\n 19 14 1 0 0 0 0\n 20 12 2 0 0 0 0\n 21 12 1 0 0 0 0\n 22 16 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 19 1 0 0 0 0\n 25 27 1 0 0 0 0\n 26 22 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 21 2 0 0 0 0\n 29 20 1 0 0 0 0\n 30 28 1 0 0 0 0\n 3 5 2 0 0 0 0\n 29 30 2 0 0 0 0\nM END", "smiles": "C(CCCOCCCCc1ccccc1)CCNCC(c2ccc(c(c2)CO)O)O", "formula": "C25H37NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "415.5665", "optical_activity": "( + / - )", "references": [ "ddd65e12-4c48-42df-b09b-197e025c9e64", "b7f9150f-de7c-4416-af6a-5ae753cc6890", "cf7a8692-7f55-44e6-bf0a-914aab5cffea" ], "stereo_centers": 1 }, "unii": "2I4BC502BT", "relationships": [ { "uuid": "5e9a66ea-90cc-47b1-973d-738ef0724f4a", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "ecb8566a-9bb5-4a9e-b661-b30e29087442", "refuuid": "ac4ee6f2-d1e1-4021-9fb4-017531f89f01", "name": "SALMETEROL", "unii": "2I4BC502BT", "linking_id": "2I4BC502BT", "ref_pname": "SALMETEROL", "substance_class": "reference" } }, { "uuid": "9f913b30-d381-4963-84e7-35b5b557c284", "type": "METABOLITE->PARENT", "related_substance": { "uuid": "7e7856ba-8c35-4614-b291-972c471e365b", "refuuid": "1f164297-68e9-423e-888e-fa06212dbfab", "name": ".ALPHA.-HYDROXYSALMETEROL", "unii": "VN3K2MKQ9C", "linking_id": "VN3K2MKQ9C", "ref_pname": ".ALPHA.-HYDROXYSALMETEROL", "substance_class": "reference" } }, { "uuid": "98633eef-1550-43a8-9036-ae50c1012ca9", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "0c080e30-3520-4a9f-948a-50d47647c30c", "refuuid": "362c5ef3-840f-42ec-8d7f-b10768873341", "name": "SALMETEROL XINAFOATE", "unii": "6EW8Q962A5", "linking_id": "6EW8Q962A5", "ref_pname": "SALMETEROL XINAFOATE", "substance_class": "reference" } }, { "uuid": "a3ac484c-a1ff-40f1-a04f-3da3c10e38e5", "amount": { "uuid": "1b3132d1-c35a-4bad-9c6f-23379e12efa1", "high": 98, "low": 94, "units": "%" }, "type": "BINDER->LIGAND", "interaction_type": "BINDING", "references": [ "bbb7d11e-e9d0-55ae-4b6f-b0ae85010e8c" ], "related_substance": { "uuid": "a00b479f-8c9f-4ba9-a868-efe48f81d8ab", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "8f954cbe-5698-4f37-8e38-723f57a92983", "amount": { "uuid": "79ac3228-6262-4b42-a926-51c86b2868ab", "average": 9.9, "high": 16.7, "low": 3.1, "units": "MICROMOLAR" }, "qualification": "IC50", "type": "METABOLIC ENZYME->INHIBITOR", "references": [ "69322509-616c-4d31-7727-d79ae0cf808f" ], "related_substance": { "uuid": "0541190f-0689-4951-8b5d-66d452ac6d1e", "refuuid": "393aa2e6-c500-402e-8f58-a069ed6e2771", "name": "ALDEHYDE OXIDASE", "unii": "LR0F81F33L", "linking_id": "LR0F81F33L", "ref_pname": "ALDEHYDE OXIDASE", "substance_class": "reference" } } ], "names": [ { "uuid": "75672882-4ec5-46ca-910f-a783118ace61", "name": "GR 33343 X", "stdName": "GR 33343 X", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "9b720657-6c5f-4a2e-826d-6b039aafd19b", "b0e2da46-6306-43e7-8bec-6c50082ceef0" ], "display_name": false }, { "uuid": "ed850d05-8f26-49a7-a355-f250a5fd9658", "name": "GR-33343-X", "stdName": "GR-33343-X", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "9b720657-6c5f-4a2e-826d-6b039aafd19b", "b0e2da46-6306-43e7-8bec-6c50082ceef0" ], "display_name": false }, { "uuid": "fa06ec21-ad64-4592-9267-b4367e1a884e", "name": "SALMETEROL", "stdName": "SALMETEROL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "2864bc7c-5be0-454f-8e16-0c9a208ce8fc", "c51d69c8-16dd-4ae0-b1fb-5faaa2672a0f", "30b7eea5-9992-4aa7-ad6b-adf8cd27b910", "c07e2822-95df-44a4-8f79-a5a57979a859", "62a54e9b-53f0-4780-86b5-aeca7f0c8e42", "b62fb76e-9b3a-4955-a2fd-75c96557c757", "97421af7-c591-4113-80bf-e0122125b70d", "3e3630f2-a59c-47ee-b1e4-f0d95cd2b9f6", "ddd65e12-4c48-42df-b09b-197e025c9e64", "70cf42c2-4ab0-466b-b3a3-00ee1b20f33c", "9ca56be5-c6e7-4bdb-acec-273c987d122a", "cf7a8692-7f55-44e6-bf0a-914aab5cffea", "b0e2da46-6306-43e7-8bec-6c50082ceef0", "731fc250-b26a-49c0-8040-a1dae203afcf" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "22c32ae1-1f9f-40df-b065-c6f2d562a15c", "name_org": "USAN" }, { "uuid": "74e19a0c-7eea-43de-9c21-14b85c2a970c", "name_org": "INN" } ] }, { "uuid": "592aaccd-acbd-4146-a6cc-71ecb3d17deb", "name": "SALMETEROL [HSDB]", "stdName": "SALMETEROL [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "30b7eea5-9992-4aa7-ad6b-adf8cd27b910", "b0e2da46-6306-43e7-8bec-6c50082ceef0" ], "display_name": false }, { "uuid": "21104021-6aa5-454c-b9fb-0b9ff1d75540", "name": "SALMETEROL [MI]", "stdName": "SALMETEROL [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c51d69c8-16dd-4ae0-b1fb-5faaa2672a0f", "b0e2da46-6306-43e7-8bec-6c50082ceef0" ], "display_name": false }, { "uuid": "e22ac47e-1448-4096-90de-ddb1c1ffd045", "name": "SALMETEROL [USAN]", "stdName": "SALMETEROL [USAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "97421af7-c591-4113-80bf-e0122125b70d" ], "display_name": false }, { "uuid": "b04605d1-6b2e-4a01-b9f2-8beb0144218e", "name": "SALMETEROL [VANDF]", "stdName": "SALMETEROL [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "70cf42c2-4ab0-466b-b3a3-00ee1b20f33c", "b0e2da46-6306-43e7-8bec-6c50082ceef0" ], "display_name": false }, { "uuid": "b1f20d7a-cfac-40c9-819f-2048c297b469", "name": "SN408D", "stdName": "SN408D", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "b0e2da46-6306-43e7-8bec-6c50082ceef0", "aebeffbb-6121-427c-889f-1b96f42b8269" ], "display_name": false }, { "uuid": "873182da-a0f5-e359-4b18-2dd13e27e014", "name": "Salmeterol [WHO-DD]", "stdName": "SALMETEROL [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3f3453d4-90bf-e95e-9b07-32dd81091640" ], "display_name": false }, { "uuid": "ced909e2-b7f9-40fe-922b-8821cc5078fb", "name": "salmeterol [INN]", "stdName": "SALMETEROL [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cf7a8692-7f55-44e6-bf0a-914aab5cffea" ], "display_name": false } ], "properties": [ { "uuid": "62d71235-dd2b-4e85-ab29-8222d6d61ce2", "name": "Biological Half-life", "value": { "uuid": "64fbdf64-2a7c-40c6-9587-c5dbb6464969", "average": 5, "units": "hours" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "bbb7d11e-e9d0-55ae-4b6f-b0ae85010e8c" ] } ] } ] }