{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e93a93c1-0854-4224-a8d2-724c08ac8068",
          "code": "54060-92-3",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54060-92-3",
          "code_system": "CAS",
          "references": [
            "4f150430-a052-41c1-9d98-eb6c6c27574c",
            "26dfd44d-0be5-41b7-b004-f0315f689820"
          ]
        },
        {
          "uuid": "17fa89ad-3b83-4a81-b342-d12d5e2e0c5a",
          "code": "258-946-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.053.570",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4f150430-a052-41c1-9d98-eb6c6c27574c"
          ]
        },
        {
          "uuid": "5bf44191-332e-8c95-b793-57812ecf1d2c",
          "code": "40979",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/40979",
          "code_system": "PUBCHEM",
          "references": [
            "07549a00-77ef-6eb5-7092-1719ac0d5c5b"
          ]
        },
        {
          "uuid": "dfacda74-771b-487a-92df-71c1da18f1d6",
          "code": "2HJO358I4S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7f873118-bece-eeff-151d-a833eb0a9cfb",
          "code": "DTXSID20879816",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20879816",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d29ee996-ce54-404b-9b16-514cba8c8f68",
          "name": "3H-INDOLIUM, 2-((2-(4-METHOXYPHENYL)-2-METHYLHYDRAZINYLIDENE)METHYL)-1,3,3-TRIMETHYL-, METHYL SULFATE (1:1)",
          "stdName": "3H-INDOLIUM, 2-((2-(4-METHOXYPHENYL)-2-METHYLHYDRAZINYLIDENE)METHYL)-1,3,3-TRIMETHYL-, METHYL SULFATE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ea33a42-0981-4645-a336-34e192bcbd9a",
            "6b233935-e5a7-4a25-b95a-1cfa39f4ddf3"
          ],
          "display_name": false
        },
        {
          "uuid": "9127ff19-1ba5-4b83-b886-d16b28eb1f7d",
          "name": "BASIC YELLOW 28",
          "stdName": "BASIC YELLOW 28",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2698629-5b93-4a24-a32e-6060f8a369cf",
            "7d55ca57-a8f8-4d6f-9768-8ee64e95ab08",
            "6b233935-e5a7-4a25-b95a-1cfa39f4ddf3"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "37f24cec-5b92-498e-89c3-00df69947fb3",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "44c797ab-faf4-4e96-9ae0-574c2610dd95",
          "name": "C.I. BASIC YELLOW 28",
          "stdName": "C.I. BASIC YELLOW 28",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ea33a42-0981-4645-a336-34e192bcbd9a",
            "6b233935-e5a7-4a25-b95a-1cfa39f4ddf3"
          ],
          "display_name": false
        },
        {
          "uuid": "6a9e1015-7de5-4d7e-9f68-06dd46249ba3",
          "name": "LOWACRYL YELLOW 28",
          "stdName": "LOWACRYL YELLOW 28",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2698629-5b93-4a24-a32e-6060f8a369cf",
            "6b233935-e5a7-4a25-b95a-1cfa39f4ddf3"
          ],
          "display_name": false
        },
        {
          "uuid": "5e363b50-87b7-4756-a0db-5ef012aa598a",
          "name": "VIOCRYL YELLOW AGL",
          "stdName": "VIOCRYL YELLOW AGL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ea33a42-0981-4645-a336-34e192bcbd9a",
            "6b233935-e5a7-4a25-b95a-1cfa39f4ddf3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c2698629-5b93-4a24-a32e-6060f8a369cf",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6b233935-e5a7-4a25-b95a-1cfa39f4ddf3",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ea33a42-0981-4645-a336-34e192bcbd9a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f150430-a052-41c1-9d98-eb6c6c27574c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391866000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "129a1708-aaad-4943-9590-a567eb2a7ef3",
          "citation": "SRS import [2HJO358I4S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2HJO358I4S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391866000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d55ca57-a8f8-4d6f-9768-8ee64e95ab08",
          "citation": "BASIC YELLOW 28 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "07549a00-77ef-6eb5-7092-1719ac0d5c5b",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "26dfd44d-0be5-41b7-b004-f0315f689820",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c419362e-f114-44fb-b345-42b751da4750",
          "id": "c419362e-f114-44fb-b345-42b751da4750",
          "molfile": "\n  Marvin  01132110082D          \n\n  6  5  0  0  0  0            999 V2000\n    5.9672   -6.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3647   -6.9042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1826   -6.9042    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0151   -6.9042    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.1826   -7.7366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1826   -6.0949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "COS(=O)(=O)[O-]",
          "formula": "CH3O4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ab186941-e28e-46b9-ba29-5e2af9f9f9a6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "111.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "63a331f1-315b-48fc-9b30-1e4fba4bef23",
          "id": "63a331f1-315b-48fc-9b30-1e4fba4bef23",
          "molfile": "\n  Marvin  01132105102D          \n\n 24 26  0  0  0  0            999 V2000\n   12.1423   -6.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5677   -5.5141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1509   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3287   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9091   -4.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3287   -3.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1509   -3.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5677   -4.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9091   -2.6537    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   11.3374   -1.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0984   -2.6537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6873   -3.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8738   -3.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3735   -4.0336    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6236   -4.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5859   -3.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8757   -4.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1542   -3.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1542   -2.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8757   -2.5330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5859   -2.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3821   -2.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9945   -2.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2096   -1.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  8  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  9  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  3  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  3  0  0  0\n 14 13  1  0  0  0  0\n 22 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\nM  CHG  1   9   1\nM  END",
          "smiles": "CC1(C)c2ccccc2N(C)C1=CN=[N+](C)c3ccc(cc3)OC",
          "formula": "C20H24N3O",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "af6298a4-5257-47f0-a26f-24dcc80eb204"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "322.4248",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "759405fc-32a1-4216-8986-9c579b4ef2ea",
      "version": "5",
      "structure": {
        "id": "41b8dd2f-6870-43f0-a9ac-d3e721656ff0",
        "molfile": "\n  Marvin  01132103282D          \n\n 30 31  0  0  0  0            999 V2000\n    7.1690   -6.8911    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3526   -6.8911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9559   -6.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1690   -7.7219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1690   -6.0833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9998   -6.8911    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.5859   -3.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5859   -2.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3821   -2.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9945   -2.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2096   -1.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8738   -3.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3735   -4.0336    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.6236   -4.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6873   -3.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0984   -2.6537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9091   -2.6537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3287   -3.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1509   -3.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5677   -4.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1509   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5677   -5.5141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1423   -6.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3287   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9091   -4.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3374   -1.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8757   -2.5330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1542   -2.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1542   -3.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8757   -4.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  7 13  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 21  1  0  0  0  0\n 18 25  1  0  0  0  0\n 25 24  2  0  0  0  0\n 17 26  1  0  0  0  0\n  8 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 29 28  1  0  0  0  0\n  7 30  1  0  0  0  0\n 30 29  2  0  0  0  0\nM  CHG  2   6  -1  13   1\nM  END",
        "smiles": "CC1(C)c2ccccc2[N+](=C1/C=N/N(C)c3ccc(cc3)OC)C.COS(=O)(=O)[O-]",
        "formula": "C20H24N3O.CH3O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "433.5231",
        "optical_activity": "NONE",
        "references": [
          "8ea33a42-0981-4645-a336-34e192bcbd9a",
          "129a1708-aaad-4943-9590-a567eb2a7ef3"
        ],
        "stereo_centers": 0
      },
      "unii": "2HJO358I4S"
    }
  ]
}