{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bc83c0e0-7a82-46a1-98a5-2ddf588d286d",
          "code": "16039-53-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16039-53-5",
          "code_system": "CAS",
          "references": [
            "c0383ff8-6784-4382-8824-225173bee8f3",
            "0283accf-ea53-4c48-aaee-a75f5b9a79d7"
          ]
        },
        {
          "uuid": "06bece38-3390-4a4e-9897-0106c70e0e78",
          "code": "240-178-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.510",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c0383ff8-6784-4382-8824-225173bee8f3"
          ]
        },
        {
          "uuid": "f0aa50e7-5ace-4747-b5fb-fa6b01e0d71a",
          "code": "C84249",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84249",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c0383ff8-6784-4382-8824-225173bee8f3"
          ]
        },
        {
          "uuid": "e17d38f1-bd0f-410b-89ce-27e998099423",
          "code": "1305755",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1305755/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c0383ff8-6784-4382-8824-225173bee8f3"
          ]
        },
        {
          "uuid": "bd8e6d40-b18a-4401-a043-18a70efc3572",
          "code": "m11611",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11611?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c0383ff8-6784-4382-8824-225173bee8f3"
          ]
        },
        {
          "uuid": "d3ec1850-ef56-4e91-80bd-968153a0b9e2",
          "code": "3007856",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3007856",
          "code_system": "PUBCHEM",
          "references": [
            "c0383ff8-6784-4382-8824-225173bee8f3"
          ]
        },
        {
          "uuid": "2ef80a7b-f274-14e6-30ae-13da038948a5",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "26f334ab-8e65-dac5-b273-4adb17fd262e"
          ]
        },
        {
          "uuid": "4d8fe284-40de-4f40-8972-8e3ab75fc102",
          "code": "2GXR25858Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "051ec02b-3d52-d302-cf33-957beaffaa92",
          "code": "2GXR25858Y",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2GXR25858Y",
          "code_system": "DAILYMED",
          "references": [
            "5ff3a2af-70a6-21df-de83-d313fae05686"
          ]
        },
        {
          "uuid": "79541053-3aed-54af-bbd8-e89e2d24fe5a",
          "code": "100000164626",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "643ea492-6687-db60-10b4-dd41499d91fd"
          ]
        },
        {
          "uuid": "676689d3-d258-6c71-0c2f-3126c8284fb2",
          "code": "DTXSID70970746",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70970746",
          "code_system": "EPA CompTox",
          "references": [
            "26f334ab-8e65-dac5-b273-4adb17fd262e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "63eeb3fa-eb8e-4e7f-aee7-2d6b6f00b670",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2d0622ce-8432-4de9-837c-dda10cfff91c",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1dd7b12c-b736-4cd0-8353-67ecd119352b",
          "name": "ZINC LACTATE",
          "stdName": "ZINC LACTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b8f71bc-5609-4826-b80d-df7f33aee3a4",
            "315fefaa-e5e3-4d0b-a6c1-9e1e179a20a5",
            "cbf45055-531d-4409-8483-a4658e8e0240",
            "7b6ccf38-baeb-4e0c-80f6-a9f383c9345f",
            "14a93b08-cf09-4630-a8dd-211f2253b9a3",
            "c5c65286-2d0d-44d4-911d-c90435fb6dc5",
            "e3883655-5ca4-4f3c-b283-0042e75d0205",
            "0b0420b1-1153-4471-b539-c3fe52d03770",
            "79158f2b-9d6f-43f4-b0a7-3e7c59a0eb9b",
            "1f3cf6bb-47bd-477e-b9ca-8d152f26091f",
            "dfe59aee-ebaa-44dd-959b-9b14fdae1991"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "9d23c212-f557-425e-bd56-d4c334c3e2d0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "be553f1e-9025-4687-94b4-4ec58193a270",
          "name": "ZINC LACTATE [MART.]",
          "stdName": "ZINC LACTATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b6ccf38-baeb-4e0c-80f6-a9f383c9345f",
            "1f3cf6bb-47bd-477e-b9ca-8d152f26091f"
          ],
          "display_name": false
        },
        {
          "uuid": "1296bf45-640a-434f-930c-cf747a2bbf36",
          "name": "ZINC LACTATE [MI]",
          "stdName": "ZINC LACTATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5c65286-2d0d-44d4-911d-c90435fb6dc5",
            "1f3cf6bb-47bd-477e-b9ca-8d152f26091f"
          ],
          "display_name": false
        },
        {
          "uuid": "b0c9f3a6-650c-4bea-b497-c0fd5b034919",
          "name": "ZINC, BIS(2-(HYDROXY-.KAPPA.O)PROPANOATO-.KAPPA.O)-, (T-4)-",
          "stdName": "ZINC, BIS(2-(HYDROXY-.KAPPA.O)PROPANOATO-.KAPPA.O)-, (T-4)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82b8730c-2662-467c-97a4-57a20d1e2b82",
            "1f3cf6bb-47bd-477e-b9ca-8d152f26091f"
          ],
          "display_name": false
        },
        {
          "uuid": "6e3c188b-3263-442a-b358-921a2fcad108",
          "name": "ZINC, BIS(LACTATO)-",
          "stdName": "ZINC, BIS(LACTATO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82b8730c-2662-467c-97a4-57a20d1e2b82",
            "1f3cf6bb-47bd-477e-b9ca-8d152f26091f"
          ],
          "display_name": false
        },
        {
          "uuid": "5d038ba3-9813-3e04-e5ca-a3dda7e2e9dc",
          "name": "Zinc lactate [WHO-DD]",
          "stdName": "ZINC LACTATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adb1d74f-cac4-ae44-fea3-6bbd422fe6ba"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "82b8730c-2662-467c-97a4-57a20d1e2b82",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1f3cf6bb-47bd-477e-b9ca-8d152f26091f",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "315fefaa-e5e3-4d0b-a6c1-9e1e179a20a5",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14a93b08-cf09-4630-a8dd-211f2253b9a3",
          "citation": "MERCK OTC",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5c65286-2d0d-44d4-911d-c90435fb6dc5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b6ccf38-baeb-4e0c-80f6-a9f383c9345f",
          "citation": "MART.",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b8f71bc-5609-4826-b80d-df7f33aee3a4",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3883655-5ca4-4f3c-b283-0042e75d0205",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0383ff8-6784-4382-8824-225173bee8f3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "850f2891-14da-4503-8f65-089433d7ed69",
          "citation": "SRS import [2GXR25858Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2GXR25858Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f763ed9-a777-4a66-94f2-413347dd737b",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbf45055-531d-4409-8483-a4658e8e0240",
          "citation": "ZINC LACTATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dfe59aee-ebaa-44dd-959b-9b14fdae1991",
          "citation": "ZINC LACTATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0b0420b1-1153-4471-b539-c3fe52d03770",
          "citation": "ZINC LACTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79158f2b-9d6f-43f4-b0a7-3e7c59a0eb9b",
          "citation": "ZINC LACTATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "643ea492-6687-db60-10b4-dd41499d91fd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "26f334ab-8e65-dac5-b273-4adb17fd262e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0283accf-ea53-4c48-aaee-a75f5b9a79d7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "adb1d74f-cac4-ae44-fea3-6bbd422fe6ba",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5ff3a2af-70a6-21df-de83-d313fae05686",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "081d4a9e-8dae-43fe-927c-3c5f20b6619c",
          "id": "081d4a9e-8dae-43fe-927c-3c5f20b6619c",
          "molfile": "\n  Marvin  01132100422D          \n\n  1  0  0  0  0  0            999 V2000\n    6.8610   -2.7864    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bc31f681-338b-4b61-b5d3-b31840e25481"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "4d12227d-8c90-42b7-aa02-ee0b1c9e5a2b",
          "id": "4d12227d-8c90-42b7-aa02-ee0b1c9e5a2b",
          "molfile": "\n  Marvin  01132104012D          \n\n  6  5  0  0  0  0            999 V2000\n    3.7801   -3.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8032   -3.0246    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.1117   -2.5969    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.5356   -2.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2194   -3.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5510   -1.8337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\nM  CHG  1   3  -1\nM  END",
          "smiles": "CC(C(=O)O)[O-]",
          "formula": "C3H5O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "93723209-a8a6-41a5-a87a-963daa6032ca"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "89.0701",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9146131c-5ff8-4319-99de-eb4467b9a425",
      "version": "9",
      "structure": {
        "id": "79c8442b-3fc5-452b-8e07-a3414dbca812",
        "molfile": "\n  Marvin  01132106202D          \n\n 13 10  0  0  0  0            999 V2000\n    4.5356   -2.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2194   -3.0860    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.5510   -1.8337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8032   -3.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1117   -2.5969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7801   -3.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8610   -2.7864    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    4.5356   -2.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2194   -3.0860    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.5510   -1.8337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8032   -3.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1117   -2.5969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7801   -3.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n 11  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\nM  CHG  3   2  -1   7   2   9  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 12   1   2   3   4   5   6   8   9  10  11  12  13\nM  SPA   1  6   1   2   3   4   5   6\nM  SDI   1  4    2.6917   -4.2693    2.6917   -1.4137\nM  SDI   1  4    5.6394   -1.4137    5.6394   -4.2693\nM  SMT   1 2\nM  END",
        "smiles": "CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Zn+2]",
        "formula": "2C3H5O3.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "UNKNOWN",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "243.5358",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "850f2891-14da-4503-8f65-089433d7ed69",
          "4f763ed9-a777-4a66-94f2-413347dd737b"
        ],
        "stereo_centers": 2
      },
      "unii": "2GXR25858Y"
    }
  ]
}