{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "82702a53-f56b-447d-a1a1-cd748fd968cc", "code": "81-27-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=81-27-6", "code_system": "CAS", "references": [ "5e15cce9-ec9e-4bf8-895a-0347a6ea42d3", "b8215c07-89fa-4afb-b33b-b6cf3dac42b8" ] }, { "uuid": "162b3b0b-d775-4026-bb94-ddf67325dfeb", "code": "201-339-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.219", "code_system": "ECHA (EC/EINECS)", "references": [ "5e15cce9-ec9e-4bf8-895a-0347a6ea42d3" ] }, { "uuid": "72e140e7-8a31-4d04-ad85-540e4e96927d", "code": "m9864", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m9864?q=authorize", "code_system": "MERCK INDEX", "references": [ "5e15cce9-ec9e-4bf8-895a-0347a6ea42d3" ] }, { "uuid": "0e2992c4-041f-4288-b68c-9e75001aae7c", "code": "SUB15223MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "5e15cce9-ec9e-4bf8-895a-0347a6ea42d3" ] }, { "uuid": "461bf099-5976-4bcf-a74a-811bd563f058", "code": "73111", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73111", "code_system": "PUBCHEM", "references": [ "5e15cce9-ec9e-4bf8-895a-0347a6ea42d3" ] }, { "uuid": "edb7a06c-f422-65e1-9292-0e81c0f2098f", "code": "DTXSID1023576", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1023576", "code_system": "EPA CompTox", "references": [ "02830b83-2ece-ecfc-fc03-494f0f79c7a9" ] }, { "uuid": "d34a2813-8be8-4ed5-a3ac-8d86177b9f4c", "code": "2F1O30GVXH", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "80da8821-bfbe-500f-f9ea-bac2c9e2fbff", "code": "1612018", "type": "PRIMARY", "url": "https://store.usp.org/product/1612018", "code_system": "RS_ITEM_NUM", "references": [ "5be13255-aea2-6643-28e7-3b7b1c16109b" ] }, { "uuid": "c22c58f4-acd6-1953-3675-6f6011958c4d", "code": "112929", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=112929", "code_system": "NSC", "references": [ "cc294df9-2efe-be57-8b0a-312241270fa9" ] }, { "uuid": "4da0d8f7-4665-c95f-58f2-1a09bed7060b", "code": "100000078409", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "fa7f00cf-adf0-bde5-e43f-e42e3cb58ac8" ] } ], "relationships": [ { "uuid": "d1bd4adf-2984-4f37-acb0-e938d1647223", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "865144ef-8a48-4aeb-9def-90f211ae56a7", "refuuid": "2e33dad7-f1da-4e62-b4fe-19faf1b054b7", "name": "SENNOSIDE A", "unii": "2F1O30GVXH", "linking_id": "2F1O30GVXH", "ref_pname": "SENNOSIDE A", "substance_class": "reference" } }, { "uuid": "a8a931d5-865b-4a02-b591-281e677fd30e", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "b702ce27-3a4a-4583-8186-41a66c089708", "refuuid": "5ee6fd0f-ac31-419b-aa33-4a35acea5a9c", "name": "SENNOSIDE A CALCIUM", "unii": "0ZS912W56A", "linking_id": "0ZS912W56A", "ref_pname": "SENNOSIDE A CALCIUM", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "bc66674a-9588-4b23-8e31-ee3a0fcf6c95", "name": "(9,9'-BIANTHRACENE)-2,2'-DICARBOXYLIC ACID, 5,5'-BIS(.BETA.-D-GLUCOPYRANOSYLOXY)-9,9',10,10'-TETRAHYDRO-4,4'-DIHYDROXY-10,10'-DIOXO-, (9R,9'R)-", "stdName": "(9,9'-BIANTHRACENE)-2,2'-DICARBOXYLIC ACID, 5,5'-BIS(.BETA.-D-GLUCOPYRANOSYLOXY)-9,9',10,10'-TETRAHYDRO-4,4'-DIHYDROXY-10,10'-DIOXO-, (9R,9'R)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dfc871a7-d1e7-47bf-a1e2-44a2192a3204", "e8347356-3b1e-4db5-8ab7-55e5e581a998" ], "display_name": false }, { "uuid": "3f5ec0b9-04f3-4d8a-ace4-4d1e38888670", "name": "(9R,9R)-5,5-BIS(.BETA.-D-GLUCOPYRANOSYLOXY)-9,9,10,10-TETRAHYDRO-4,4-DIHYDROXY-10,10-DIOXO(9,9-BIANTHRACENE)-2,2-DICARBOXYLIC ACID", "stdName": "(9R,9R)-5,5-BIS(.BETA.-D-GLUCOPYRANOSYLOXY)-9,9,10,10-TETRAHYDRO-4,4-DIHYDROXY-10,10-DIOXO(9,9-BIANTHRACENE)-2,2-DICARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e8347356-3b1e-4db5-8ab7-55e5e581a998", "b629a655-5808-4119-975f-b33578031f1a" ], "display_name": false }, { "uuid": "66a14086-9db9-42a1-b62a-2541dfc9044e", "name": "(R*,R*)-5,5'-BIS(.BETA.-D-GLUCOPYRANOSYLOXY)-9,9',10,10'-TETRAHYDRO-4,4'-DIHYDROXY-10,10'-DIOXO(9,9'-BIANTHRACENE)-2,2'-DICARBOXYLIC ACID", "stdName": "(R*,R*)-5,5'-BIS(.BETA.-D-GLUCOPYRANOSYLOXY)-9,9',10,10'-TETRAHYDRO-4,4'-DIHYDROXY-10,10'-DIOXO(9,9'-BIANTHRACENE)-2,2'-DICARBOXYLIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e8347356-3b1e-4db5-8ab7-55e5e581a998", "b629a655-5808-4119-975f-b33578031f1a" ], "display_name": false }, { "uuid": "ddb4b7cd-6215-4915-ad13-bdcdca51bbba", "name": "NSC-112929", "stdName": "NSC-112929", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "7f80310b-3835-45f7-baa8-ed1c36326154", "e8347356-3b1e-4db5-8ab7-55e5e581a998" ], "display_name": false }, { "uuid": "dcd4a71e-27d6-4467-b566-aad2b14cf069", "name": "SENNOSIDE A", "stdName": "SENNOSIDE A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c7fe2307-7c72-44e3-abd8-da40b1014b9e", "87b6ced9-9471-49c9-80cf-287c81e65c7f", "729dbdda-a9d6-4e9c-b3a9-3afd390bea37", "e8347356-3b1e-4db5-8ab7-55e5e581a998", "42d8ccd7-7b0d-4e1a-b615-6ce9403b53ca", "b629a655-5808-4119-975f-b33578031f1a" ], "display_name": true }, { "uuid": "821db2e5-06a4-4d41-8db8-da35ed4179fd", "name": "SENNOSIDE A (CONSTITUENT OF SENNA LEAF AND PODS) [DSC]", "stdName": "SENNOSIDE A (CONSTITUENT OF SENNA LEAF AND PODS) [DSC]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e8347356-3b1e-4db5-8ab7-55e5e581a998", "b5a7c8ab-2263-436f-bd28-45093b123da6" ], "display_name": false }, { "uuid": "eacc1db4-e262-4eee-b418-bb895f663974", "name": "SENNOSIDE A [USP-RS]", "stdName": "SENNOSIDE A [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e8347356-3b1e-4db5-8ab7-55e5e581a998", "42d8ccd7-7b0d-4e1a-b615-6ce9403b53ca" ], "display_name": false }, { "uuid": "ce82629f-17a6-42db-b24a-489a89834e8c", "name": "SENNOSIDES SENNOSIDE A [MI]", "stdName": "SENNOSIDES SENNOSIDE A [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e8347356-3b1e-4db5-8ab7-55e5e581a998", "b629a655-5808-4119-975f-b33578031f1a" ], "display_name": false }, { "uuid": "3bfa1f40-baf4-3022-bedd-6ca5a38c52b7", "name": "Sennoside a [WHO-DD]", "stdName": "SENNOSIDE A [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "052359d8-261d-a6f5-47dc-95628760d6ba" ], "display_name": false } ], "references": [ { "uuid": "b629a655-5808-4119-975f-b33578031f1a", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e8347356-3b1e-4db5-8ab7-55e5e581a998", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "42d8ccd7-7b0d-4e1a-b615-6ce9403b53ca", "citation": "USP/NF", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "87b6ced9-9471-49c9-80cf-287c81e65c7f", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dfc871a7-d1e7-47bf-a1e2-44a2192a3204", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b5a7c8ab-2263-436f-bd28-45093b123da6", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7f80310b-3835-45f7-baa8-ed1c36326154", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5e15cce9-ec9e-4bf8-895a-0347a6ea42d3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390310000, "tags": [ "NOMEN" ] }, { "uuid": "337341d4-ad29-48cf-a8d4-b6e6e5f0b2d2", "citation": "USP-DSC", "doc_type": "USP", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e44f3b5f-ed3c-4807-a6ff-3ee8d0e96d64", "citation": "SRS import [2F1O30GVXH]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2F1O30GVXH", "doc_type": "SRS", "public_domain": true, "document_date": 1493390310000, "tags": [ "NOMEN" ] }, { "uuid": "c7fe2307-7c72-44e3-abd8-da40b1014b9e", "citation": "SENNOSIDE A [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "729dbdda-a9d6-4e9c-b3a9-3afd390bea37", "citation": "SENNOSIDE A [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "02830b83-2ece-ecfc-fc03-494f0f79c7a9", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=81-27-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "fa7f00cf-adf0-bde5-e43f-e42e3cb58ac8", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "21dc2512-826b-5c0d-a081-80e36c58f5dc", "citation": "USP-RS", "doc_type": "USPNF", "public_domain": true }, { "uuid": "b8215c07-89fa-4afb-b33b-b6cf3dac42b8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5be13255-aea2-6643-28e7-3b7b1c16109b", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "cc294df9-2efe-be57-8b0a-312241270fa9", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "052359d8-261d-a6f5-47dc-95628760d6ba", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fa82c6f5-d4de-4521-806a-fd9bc6b243c1", "id": "fa82c6f5-d4de-4521-806a-fd9bc6b243c1", "molfile": "\n Marvin 01132112592D \n\n 62 69 0 0 1 0 999 V2000\n -3.3333 -9.0917 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -2.9208 -9.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4625 -10.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9083 -8.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3208 -7.6542 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -2.9000 -6.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8958 -6.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6083 -5.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6083 -4.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8958 -4.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1833 -4.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1833 -5.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4750 -6.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4833 -6.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7625 -5.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0500 -6.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0583 -6.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6625 -5.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6542 -4.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0583 -4.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7625 -4.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4750 -4.4667 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -0.5750 -2.9375 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -1.2875 -2.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0083 -2.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7208 -2.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7208 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0083 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0125 -0.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4333 0.2500 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -2.0125 0.9750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4333 1.6875 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -2.0125 2.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5500 3.0333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2583 1.6875 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -3.6708 2.4083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6708 0.9750 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -4.5000 0.9708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2583 0.2500 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -3.6708 -0.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2958 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5833 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5833 -0.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1375 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8417 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8417 -0.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5625 -1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5667 -2.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8542 -2.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1417 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2792 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2750 -3.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9917 -2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3667 -4.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3667 -3.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0792 -4.8750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1542 -7.6542 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -4.5583 -6.9375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5708 -8.3667 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -5.3958 -8.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1583 -9.0875 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -4.5833 -9.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 4 1 0 0 0 0\n 61 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 6 0 0 0\n 57 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 12 2 0 0 0 0\n 9 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 11 1 0 0 0 0\n 22 11 1 1 0 0 0\n 12 13 1 0 0 0 0\n 14 13 2 0 0 0 0\n 13 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 21 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 16 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 54 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 50 1 6 0 0 0\n 25 24 1 0 0 0 0\n 41 24 2 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 28 41 1 0 0 0 0\n 30 29 1 1 0 0 0\n 30 31 1 0 0 0 0\n 39 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 32 33 1 1 0 0 0\n 35 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 36 1 6 0 0 0\n 35 37 1 0 0 0 0\n 37 38 1 1 0 0 0\n 37 39 1 0 0 0 0\n 39 40 1 6 0 0 0\n 42 41 1 0 0 0 0\n 43 42 2 0 0 0 0\n 44 42 1 0 0 0 0\n 45 44 1 0 0 0 0\n 44 50 2 0 0 0 0\n 46 45 1 0 0 0 0\n 47 45 2 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 2 0 0 0 0\n 51 48 1 0 0 0 0\n 49 50 1 0 0 0 0\n 52 51 1 0 0 0 0\n 53 51 2 0 0 0 0\n 55 54 1 0 0 0 0\n 56 54 2 0 0 0 0\n 57 58 1 1 0 0 0\n 59 57 1 0 0 0 0\n 59 60 1 6 0 0 0\n 59 61 1 0 0 0 0\n 61 62 1 1 0 0 0\nM END", "smiles": "c1cc2[C@H](c3cc(cc(c3C(=O)c2c(c1)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)O)C(=O)O)[C@@H]5c6cccc(c6C(=O)c7c5cc(cc7O)C(=O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@@H](CO)O8)O)O)O", "formula": "C42H38O20", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "74b8e2eb-c9ae-4052-ac2b-38944d068a40" }, "defined_stereo": 12, "ez_centers": 0, "molecular_weight": "862.7408", "optical_activity": "UNSPECIFIED", "stereo_centers": 12 } ], "definition_level": "COMPLETE", "uuid": "2e33dad7-f1da-4e62-b4fe-19faf1b054b7", "version": "10", "structure": { "id": "06d807ad-b0da-4359-9ea5-8a6a1d78333d", "molfile": "\n Marvin 01132100382D \n\n 64 71 0 0 1 0 999 V2000\n -0.7625 -5.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1375 -1.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5833 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4750 -6.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1833 -5.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2958 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4750 -4.4667 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.5750 -2.9375 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.7625 -4.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1417 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3208 -7.6542 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -2.4333 0.2500 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -2.1833 -4.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2875 -2.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1542 -7.6542 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -3.2583 0.2500 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -4.5708 -8.3667 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -3.6708 0.9750 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -2.0125 0.9750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9083 -8.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1583 -9.0875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -3.2583 1.6875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.0500 -6.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8417 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0083 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8958 -6.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3333 -9.0917 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -2.4333 1.6875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.8542 -2.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0583 -4.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9000 -6.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0125 -0.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5667 -2.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6542 -4.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3667 -4.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2792 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5625 -1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6625 -5.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5833 -0.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4833 -6.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3667 -3.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2750 -3.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5583 -6.9375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6708 -0.4625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3958 -8.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5000 0.9708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8417 -0.4500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0583 -6.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5833 -9.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6708 2.4083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0792 -4.8750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9917 -2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0083 -2.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8958 -4.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9208 -9.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0125 2.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6083 -5.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7208 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4625 -10.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5500 3.0333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6083 -4.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7208 -2.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8958 -3.7500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1708 -3.6500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 10 2 0 0 0 0\n 3 6 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 14 1 0 0 0 0\n 7 9 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 1 2 0 0 0 0\n 10 8 1 0 0 0 0\n 11 31 1 6 0 0 0\n 12 32 1 1 0 0 0\n 13 7 1 0 0 0 0\n 14 8 1 0 0 0 0\n 15 11 1 0 0 0 0\n 16 12 1 0 0 0 0\n 17 15 1 0 0 0 0\n 18 16 1 0 0 0 0\n 19 12 1 0 0 0 0\n 20 11 1 0 0 0 0\n 21 27 1 0 0 0 0\n 22 28 1 0 0 0 0\n 23 1 1 0 0 0 0\n 24 2 1 0 0 0 0\n 25 6 2 0 0 0 0\n 26 5 1 0 0 0 0\n 27 20 1 0 0 0 0\n 28 19 1 0 0 0 0\n 29 10 1 0 0 0 0\n 30 9 1 0 0 0 0\n 31 26 1 0 0 0 0\n 32 25 1 0 0 0 0\n 33 29 2 0 0 0 0\n 34 38 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 33 1 0 0 0 0\n 37 33 1 0 0 0 0\n 38 23 2 0 0 0 0\n 39 3 2 0 0 0 0\n 40 4 2 0 0 0 0\n 41 35 2 0 0 0 0\n 42 36 2 0 0 0 0\n 15 43 1 1 0 0 0\n 16 44 1 6 0 0 0\n 17 45 1 6 0 0 0\n 18 46 1 1 0 0 0\n 47 24 1 0 0 0 0\n 48 23 1 0 0 0 0\n 21 49 1 1 0 0 0\n 22 50 1 6 0 0 0\n 51 35 1 0 0 0 0\n 52 36 1 0 0 0 0\n 53 14 2 0 0 0 0\n 54 13 1 0 0 0 0\n 27 55 1 6 0 0 0\n 28 56 1 1 0 0 0\n 57 26 2 0 0 0 0\n 58 62 2 0 0 0 0\n 59 55 1 0 0 0 0\n 60 56 1 0 0 0 0\n 61 54 2 0 0 0 0\n 62 53 1 0 0 0 0\n 7 63 1 6 0 0 0\n 8 64 1 1 0 0 0\n 34 30 2 0 0 0 0\n 5 13 2 0 0 0 0\n 61 57 1 0 0 0 0\n 2 3 1 0 0 0 0\n 25 58 1 0 0 0 0\n 37 24 2 0 0 0 0\n 17 21 1 0 0 0 0\n 18 22 1 0 0 0 0\nM END", "smiles": "c1cc2[C@]([H])(c3cc(cc(c3C(=O)c2c(c1)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)O)C(=O)O)[C@]5([H])c6cccc(c6C(=O)c7c5cc(cc7O)C(=O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@@H](CO)O8)O)O)O", "formula": "C42H38O20", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 12, "ez_centers": 0, "molecular_weight": "862.7408", "optical_activity": "UNSPECIFIED", "references": [ "e44f3b5f-ed3c-4807-a6ff-3ee8d0e96d64", "b629a655-5808-4119-975f-b33578031f1a" ], "stereo_centers": 12 }, "unii": "2F1O30GVXH" } ] }