{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "90f3a4ef-3ee7-44de-82ce-4ad67332e371",
          "code": "COPPER USNATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Copper_usnate",
          "code_system": "WIKIPEDIA",
          "references": [
            "fbe41dce-2c00-457e-97d3-74901a54f8c6"
          ]
        },
        {
          "uuid": "abd7c40e-8b25-4b89-b034-1691e0f7e16e",
          "code": "CHEMBL3707211",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL3707211",
          "code_system": "ChEMBL",
          "references": [
            "fbe41dce-2c00-457e-97d3-74901a54f8c6"
          ]
        },
        {
          "uuid": "e67c1f36-a382-1a6a-b114-2c9dcd16fa98",
          "code": "G01AX15",
          "comments": "ATC|GENITO URINARY SYSTEM AND SEX HORMONES|GYNECOLOGICAL ANTIINFECTIVES AND ANTISEPTICS|ANTIINFECTIVES AND ANTISEPTICS, EXCL. COMBINATIONS WITH CORTICOSTEROIDS|Other antiinfectives and antiseptics|copper usnate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=G01AX15&showdescription=yes",
          "code_system": "WHO-ATC"
        },
        {
          "uuid": "c9adec36-79cc-9d8b-8497-462bdab60f2f",
          "code": "DB13830",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB13830",
          "code_system": "DRUG BANK",
          "references": [
            "09ef8b2b-3cc3-69e2-9f0e-e59debec34e8"
          ]
        },
        {
          "uuid": "c2042ed9-2d9a-452c-9d9e-4640eaf2ccf3",
          "code": "2EV5P25E2S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bc330666-661a-a223-d85f-d44dc5787da9",
          "code": "165411912",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165411912",
          "code_system": "PUBCHEM",
          "references": [
            "41a14f70-ca8a-2dc3-68e9-f03cb1c021cb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7f24e32b-e816-4a8f-aaa9-92175e9fe53a",
          "name": "COPPER USNATE",
          "stdName": "COPPER USNATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e344fc3-fa71-42af-b81a-20869bc4c841",
            "6b8383d6-6ff5-4a39-83ba-5b1274366522",
            "59b68c6b-5f43-4a82-a8f3-bae55ae06016"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "13982d6e-37d3-429c-b260-e7e225790b15",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "45cd2751-d977-4145-9d9e-6e2f01f1ac11",
          "name": "Usnate copper [WHO-DD]",
          "stdName": "USNATE COPPER [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12ee193-91de-4ba4-8483-b974a999572f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6b8383d6-6ff5-4a39-83ba-5b1274366522",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2e344fc3-fa71-42af-b81a-20869bc4c841",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fbe41dce-2c00-457e-97d3-74901a54f8c6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393195000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49a8dcd2-75b1-436a-80ec-af417fb5d008",
          "citation": "SRS import [2EV5P25E2S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2EV5P25E2S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393195000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1296ecb5-980c-4339-8dcf-91c45d884632",
          "citation": "https://en.wikipedia.org/wiki/Copper_usnate",
          "url": "https://en.wikipedia.org/wiki/Copper_usnate",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59b68c6b-5f43-4a82-a8f3-bae55ae06016",
          "citation": "COPPER USNATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09ef8b2b-3cc3-69e2-9f0e-e59debec34e8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "41a14f70-ca8a-2dc3-68e9-f03cb1c021cb",
          "citation": "PubChem",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "c12ee193-91de-4ba4-8483-b974a999572f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "47e05acc-d9a8-4bd5-be65-a7fa398d33ca",
          "id": "47e05acc-d9a8-4bd5-be65-a7fa398d33ca",
          "molfile": "\n  Marvin  01132103462D          \n\n  1  0  0  0  0  0            999 V2000\n   18.2185   -7.0583    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Cu+2]",
          "formula": "Cu",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7a2b7cdd-29e7-444a-b36b-6aabc8069bf0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "63.5456",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "5bbb8c02-6fb3-41f4-a235-65c20b9e7153",
          "id": "5bbb8c02-6fb3-41f4-a235-65c20b9e7153",
          "molfile": "\n  Marvin  01132104452D          \n\n 25 27  0  0  0  0            999 V2000\n   13.0792   -6.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2951   -6.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8122   -5.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9914   -6.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5038   -5.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6829   -5.4902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8371   -4.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6534   -6.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1364   -7.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9572   -7.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4447   -8.0729    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.8030   -8.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8325   -6.9111    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.2951   -5.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0792   -5.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -5.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5105   -5.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2238   -5.1584    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.5105   -6.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -6.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -7.6333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2238   -6.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9372   -6.4004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2238   -7.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9959   -7.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n 15  1  1  0  0  0  0\n 20  1  1  0  0  0  0\n 25  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n 10  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n 14  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  8  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 12  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 22 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 23 22  2  0  0  0  0\n 24 22  1  0  0  0  0\nM  CHG  3  11  -1  13  -1  18  -1\nM  END",
          "smiles": "Cc1c(c(C(=O)C)c2c(c1[O-])C3(C)C(=CC(=C(C(=O)C)C3=O)[O-])O2)[O-]",
          "formula": "C18H13O7",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6c2e6550-cd3e-46a6-a48b-076135593bde"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "341.2923",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        },
        {
          "uuid": "c869cf8a-967f-49d4-8dd4-88feefa66ef2",
          "id": "c869cf8a-967f-49d4-8dd4-88feefa66ef2",
          "molfile": "\n  Marvin  01132110212D          \n\n  1  0  0  0  0  0            999 V2000\n   20.6075   -6.8444    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "45e99374-2097-4af2-82dc-380f18c8faa6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1c23e4fe-c101-460c-866a-4313d32595ea",
      "version": "8",
      "structure": {
        "id": "b7999749-de39-4433-a1ef-e22da61f9f11",
        "molfile": "\n  Marvin  01132109302D          \n\n 27 27  0  0  0  0            999 V2000\n   18.2185   -7.0583    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\n   13.0792   -6.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2951   -6.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8122   -5.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9914   -6.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5038   -5.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6829   -5.4902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8371   -4.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6534   -6.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1364   -7.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9572   -7.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4447   -8.0729    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.8030   -8.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8325   -6.9111    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.2951   -5.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0792   -5.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -5.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5105   -5.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2238   -5.1584    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.5105   -6.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -6.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -7.6333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2238   -6.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9372   -6.4004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2238   -7.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9959   -7.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6075   -6.8444    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11  3  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 10  1  0  0  0  0\n 14  9  1  0  0  0  0\n 15  4  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16  2  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21  2  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 20  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 23  1  0  0  0  0\n 26  2  1  0  0  0  0\nM  CHG  5   1   2  12  -1  14  -1  19  -1  27   1\nM  END",
        "smiles": "Cc1c(c(C(=O)C)c2c(c1[O-])C3(C)C(=CC(=C(C(=O)C)C3=O)[O-])O2)[O-].[Cu+2].[H+]",
        "formula": "C18H13O7.Cu.H",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "405.8459",
        "optical_activity": "( + / - )",
        "references": [
          "1296ecb5-980c-4339-8dcf-91c45d884632",
          "49a8dcd2-75b1-436a-80ec-af417fb5d008"
        ],
        "stereo_centers": 1
      },
      "unii": "2EV5P25E2S"
    }
  ]
}