{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "60630d69-fd9a-42b0-a641-44bba62d4248",
          "code": "97791-84-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=97791-84-9",
          "code_system": "CAS",
          "references": [
            "ca330810-fabe-4cc5-ad25-200600c53a44",
            "33caa6e4-01e2-4dc7-9af3-b969397e92f2"
          ]
        },
        {
          "uuid": "5264bda2-f81a-40d0-b5e0-8f5279f6f3f3",
          "code": "7010718",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7010718",
          "code_system": "PUBCHEM",
          "references": [
            "ca330810-fabe-4cc5-ad25-200600c53a44"
          ]
        },
        {
          "uuid": "fba05466-c8bb-eed6-b104-8f6e020f165c",
          "code": "DTXSID30243246",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30243246",
          "code_system": "EPA CompTox",
          "references": [
            "72cb9df1-20eb-f562-f2df-dc352830b200"
          ]
        },
        {
          "uuid": "1bb8fd63-b0e5-fec7-345d-c8935286d85d",
          "code": "73606",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:73606",
          "code_system": "CHEBI",
          "references": [
            "1569cf68-a929-6806-f4e7-ab2e68f0209c"
          ]
        },
        {
          "uuid": "88265683-acad-469c-963e-a6fb0b4e3544",
          "code": "2ER636Q88S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "885c6a4b-da6c-452b-a1fb-42a449a11049",
          "name": "DIPEPTIDE KT",
          "stdName": "DIPEPTIDE KT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b69e023-ef7b-4955-82c6-ba3f24a82779",
            "b16f1e7f-beba-4d5c-a870-66d287670cac"
          ],
          "display_name": false
        },
        {
          "uuid": "09741984-4122-4ff5-afb0-f497d92de069",
          "name": "DIPEPTIDE-7",
          "stdName": "DIPEPTIDE-7",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "3b69e023-ef7b-4955-82c6-ba3f24a82779",
            "14de6277-7afe-4b29-8246-37a2da625c7c",
            "b16f1e7f-beba-4d5c-a870-66d287670cac",
            "73779bfc-0a47-486e-a403-7fd80f7c299b"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c6f29f4b-4223-4ff4-9b5e-eeaabb4ec796",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "caf86163-2798-4eda-a957-11cc3c037687",
          "name": "L-LYSYL-L-THREONINE",
          "stdName": "L-LYSYL-L-THREONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b69e023-ef7b-4955-82c6-ba3f24a82779",
            "e74f3e12-8c49-4159-b921-dc6c50de7a4b"
          ],
          "display_name": false
        },
        {
          "uuid": "429b3251-8e68-4d70-b9c7-962dfb393f4d",
          "name": "L-THREONINE, L-LYSYL-",
          "stdName": "L-THREONINE, L-LYSYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b69e023-ef7b-4955-82c6-ba3f24a82779",
            "b16f1e7f-beba-4d5c-a870-66d287670cac"
          ],
          "display_name": false
        },
        {
          "uuid": "abfe7d54-7315-483e-8b1c-cf213bf53f49",
          "name": "L-THREONINE, N-L-LYSYL-",
          "stdName": "L-THREONINE, N-L-LYSYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b69e023-ef7b-4955-82c6-ba3f24a82779",
            "fcb9d896-acc8-4cbe-8c80-d05f60157cc7"
          ],
          "display_name": false
        },
        {
          "uuid": "deab151d-2417-430b-9719-df0c0998bcfe",
          "name": "LYSYL THREONINE",
          "stdName": "LYSYL THREONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b69e023-ef7b-4955-82c6-ba3f24a82779",
            "e74f3e12-8c49-4159-b921-dc6c50de7a4b"
          ],
          "display_name": false
        },
        {
          "uuid": "0fe73144-df46-4b12-aa86-be8e1aa02004",
          "name": "LYSYLTHREONINE",
          "stdName": "LYSYLTHREONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b69e023-ef7b-4955-82c6-ba3f24a82779",
            "e74f3e12-8c49-4159-b921-dc6c50de7a4b"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "b16f1e7f-beba-4d5c-a870-66d287670cac",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3b69e023-ef7b-4955-82c6-ba3f24a82779",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e74f3e12-8c49-4159-b921-dc6c50de7a4b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcb9d896-acc8-4cbe-8c80-d05f60157cc7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14de6277-7afe-4b29-8246-37a2da625c7c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca330810-fabe-4cc5-ad25-200600c53a44",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391330000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d92a317f-3162-4bda-9fec-fcc6424e86cf",
          "citation": "SRS import [2ER636Q88S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2ER636Q88S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391330000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73779bfc-0a47-486e-a403-7fd80f7c299b",
          "citation": "DIPEPTIDE-7 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "72cb9df1-20eb-f562-f2df-dc352830b200",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=97791-84-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "33caa6e4-01e2-4dc7-9af3-b969397e92f2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1569cf68-a929-6806-f4e7-ab2e68f0209c",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bb8812d9-1b82-4e1e-9a41-83b333991e09",
          "id": "bb8812d9-1b82-4e1e-9a41-83b333991e09",
          "molfile": "\n  Marvin  01132109422D          \n\n 17 16  0  0  1  0            999 V2000\n    3.5191   -4.0047    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.8046   -4.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2335   -4.4172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5191   -3.1797    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.8046   -2.7673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0901   -3.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0901   -4.0047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3757   -2.7673    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.6612   -3.1797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3757   -1.9423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0901   -1.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0901   -0.7047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8046   -0.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8046    0.5327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2335   -2.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9480   -3.1797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2335   -1.9423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  6  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4 15  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\nM  END",
          "smiles": "C[C@H]([C@@H](C(=O)O)NC(=O)[C@H](CCCCN)N)O",
          "formula": "C10H21N3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "97923078-f9f4-4228-a2e0-343aba6cc6b1"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "247.2918",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1dbb26df-db17-4061-ac44-7fcc584c7243",
      "version": "5",
      "structure": {
        "id": "d0b99391-af1e-4274-8623-084901f3abdf",
        "molfile": "\n  Marvin  01132110472D          \n\n 18 17  0  0  1  0            999 V2000\n    2.8046    0.5327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8046   -0.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0901   -0.7047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0901   -1.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3757   -1.9423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3757   -2.7673    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0901   -3.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8046   -2.7673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5191   -3.1797    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.2335   -2.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9480   -3.1797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2335   -1.9423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5191   -4.0047    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.8046   -4.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2335   -4.4172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8046   -3.5922    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0901   -4.0047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6612   -3.1797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  1  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n  9 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  6  0  0  0\n  9 16  1  1  0  0  0\n  7 17  2  0  0  0  0\n 18  6  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]([C@@]([H])(C(=O)O)NC(=O)[C@H](CCCCN)N)O",
        "formula": "C10H21N3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "247.2918",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b16f1e7f-beba-4d5c-a870-66d287670cac",
          "d92a317f-3162-4bda-9fec-fcc6424e86cf"
        ],
        "stereo_centers": 3
      },
      "unii": "2ER636Q88S"
    }
  ]
}