{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "809ca424-5a1a-4b6c-a10e-a13fca5c83e3",
          "code": "33171-05-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33171-05-0",
          "code_system": "CAS",
          "references": [
            "d64cb3bc-116a-4872-b62c-97d8f037a033",
            "d9b28a98-98bf-4700-ab87-11cf1119ad64"
          ]
        },
        {
          "uuid": "8139c5cc-5fda-490b-ba6e-7c9a131f3607",
          "code": "5315472",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5315472",
          "code_system": "PUBCHEM",
          "references": [
            "d64cb3bc-116a-4872-b62c-97d8f037a033"
          ]
        },
        {
          "uuid": "aa0026e4-a484-fe67-5a25-cd91bd9d0f57",
          "code": "Curcumin III",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Curcumin_III",
          "code_system": "WIKIPEDIA",
          "references": [
            "2621ff35-93fc-7065-1649-ab0e7fb374b8"
          ]
        },
        {
          "uuid": "3b1012ab-4ef1-6bc4-a34a-415bf4f2b01a",
          "code": "DTXSID00872663",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00872663",
          "code_system": "EPA CompTox",
          "references": [
            "b6338ff4-353a-9d75-d5f4-d696d9e21ef5"
          ]
        },
        {
          "uuid": "32035b89-497c-6a2d-6e4a-76594c3127cd",
          "code": "3710 (Number of products:81)",
          "comments": "Dietary Supplement Label Database|chemical|Curcuminoid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3710&item=Curcuminoid",
          "code_system": "DSLD",
          "references": [
            "4d161e4b-635a-0714-be75-a8439a5d9c40"
          ]
        },
        {
          "uuid": "31ca69b4-26ab-4442-b606-583b3a74e270",
          "code": "2EFO1BP34R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c02fa40a-d6dc-d9a3-fef3-f2eb66d0df5d",
          "code": "1075305",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1075305",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "4d161e4b-635a-0714-be75-a8439a5d9c40"
          ]
        },
        {
          "uuid": "4fcae5e2-3402-fc35-bc5b-7182f24265aa",
          "code": "71045",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:71045",
          "code_system": "CHEBI",
          "references": [
            "4d161e4b-635a-0714-be75-a8439a5d9c40"
          ]
        },
        {
          "uuid": "00db3ac6-139f-c6b5-0d25-63e6109d7a3b",
          "code": "300000009705",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "66ccf1d9-3fae-773c-939e-400767d9c93b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "41aa0178-c3c9-4946-8edd-ba71003ee479",
          "name": "1,6-HEPTADIENE-3,5-DIONE, 1,7-BIS(4-HYDROXYPHENYL)-, (1E,6E)-",
          "stdName": "1,6-HEPTADIENE-3,5-DIONE, 1,7-BIS(4-HYDROXYPHENYL)-, (1E,6E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "6aca954a-c6bb-4de4-98bc-33c71cc663b3"
          ],
          "display_name": false
        },
        {
          "uuid": "73f47bf3-e5f9-415d-987a-54c59288098b",
          "name": "1,7-BIS-(4-HYDROXYPHENYL)-HEPTA-1,6-DIENE-3,5-DIONE",
          "stdName": "1,7-BIS-(4-HYDROXYPHENYL)-HEPTA-1,6-DIENE-3,5-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "e34a55a0-999f-4039-9430-ca303c132b66"
          ],
          "display_name": false
        },
        {
          "uuid": "5c8ce130-e744-4909-adb3-199d64a0aadd",
          "name": "BIS-DEMETHOXYCURCUMIN",
          "stdName": "BIS-DEMETHOXYCURCUMIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "81360bad-0ca1-41cd-9a5f-76a27d0b6eb5",
            "eea6ae49-4eb4-4516-a68e-321258f1b8cf"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ca3b5c8e-61cc-44a4-84f4-2e6293b50e67",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8eb17114-e6de-4ed9-aedd-74188d101f2e",
          "name": "BISDEMETHOXYCURCUMIN",
          "stdName": "BISDEMETHOXYCURCUMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "6aca954a-c6bb-4de4-98bc-33c71cc663b3"
          ],
          "display_name": true
        },
        {
          "uuid": "00555a5d-fc86-4b2e-91ee-80a29d23da54",
          "name": "BISDESMETHOXYCURCUMIN",
          "stdName": "BISDESMETHOXYCURCUMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6aca954a-c6bb-4de4-98bc-33c71cc663b3",
            "31a066db-d890-4ff8-83db-0e18c694cbc5"
          ],
          "display_name": false
        },
        {
          "uuid": "04cd4905-3de8-4dd9-842b-fd9d14fe4157",
          "name": "BISDESMETHOXYCURCUMIN (CONSTITUENT OF TURMERIC) [DSC]",
          "stdName": "BISDESMETHOXYCURCUMIN (CONSTITUENT OF TURMERIC) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "42c1e7e3-c538-4d37-b7db-1e4d5e16e0f4"
          ],
          "display_name": false
        },
        {
          "uuid": "9a670b5f-dbbd-a2b3-a0e4-fcdc7f6a67af",
          "name": "BISDESMETHOXYCURCUMIN [USP-RS]",
          "stdName": "BISDESMETHOXYCURCUMIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e10767aa-202b-15f1-b772-7ad19bdf452b"
          ],
          "display_name": false
        },
        {
          "uuid": "cd853233-7380-4572-9953-2d931a6133e1",
          "name": "CURCUMIN III",
          "stdName": "CURCUMIN III",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "6aca954a-c6bb-4de4-98bc-33c71cc663b3"
          ],
          "display_name": false
        },
        {
          "uuid": "861ab752-79db-42a1-9ff1-a86e19d619a8",
          "name": "DIDEMETHOXYCURCUMIN",
          "stdName": "DIDEMETHOXYCURCUMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "6aca954a-c6bb-4de4-98bc-33c71cc663b3"
          ],
          "display_name": false
        },
        {
          "uuid": "f744f588-59b6-4859-a7df-ddcf7c1b9a23",
          "name": "E-100(III)",
          "stdName": "E-100(III)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "e34a55a0-999f-4039-9430-ca303c132b66"
          ],
          "display_name": false
        },
        {
          "uuid": "70e85bc8-1183-4c95-aae0-a0ec7758442e",
          "name": "INS NO.100(III)",
          "stdName": "INS NO.100(III)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "e34a55a0-999f-4039-9430-ca303c132b66"
          ],
          "display_name": false
        },
        {
          "uuid": "fbe303d9-6f18-4534-87b9-cabc79d21df6",
          "name": "INS-100(III)",
          "stdName": "INS-100(III)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
            "e34a55a0-999f-4039-9430-ca303c132b66"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6aca954a-c6bb-4de4-98bc-33c71cc663b3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3e3581d5-a2a2-44f9-b43a-f5a27bef49a0",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eea6ae49-4eb4-4516-a68e-321258f1b8cf",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31a066db-d890-4ff8-83db-0e18c694cbc5",
          "citation": "YES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42c1e7e3-c538-4d37-b7db-1e4d5e16e0f4",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e34a55a0-999f-4039-9430-ca303c132b66",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d64cb3bc-116a-4872-b62c-97d8f037a033",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390306000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a43adff2-d3a8-4f02-ba1b-d473d59e1b5f",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5af16d6-8c9d-4d2b-bae5-c8dccfb957e0",
          "citation": "SRS import [2EFO1BP34R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2EFO1BP34R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390306000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d238374-b86f-4ce6-8610-8b0235ba766f",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81360bad-0ca1-41cd-9a5f-76a27d0b6eb5",
          "citation": "BIS-DEMETHOXYCURCUMIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2621ff35-93fc-7065-1649-ab0e7fb374b8",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Curcumin_III",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b6338ff4-353a-9d75-d5f4-d696d9e21ef5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=33171-05-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "66ccf1d9-3fae-773c-939e-400767d9c93b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "4d161e4b-635a-0714-be75-a8439a5d9c40",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d9b28a98-98bf-4700-ab87-11cf1119ad64",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e10767aa-202b-15f1-b772-7ad19bdf452b",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "880645ec-ad9d-4854-bfd8-2605774d2fbe",
          "id": "880645ec-ad9d-4854-bfd8-2605774d2fbe",
          "molfile": "\n  Marvin  01132107032D          \n\n 23 24  0  0  0  0            999 V2000\n    0.0000   -2.4896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -2.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -1.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4249   -0.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1476   -1.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1476   -2.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4326   -2.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8549   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5828   -1.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3004   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3004   -0.0155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0310   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7304   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7304    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4584   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1734   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8910   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6060   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3210   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3210   -2.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0412   -2.4792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6138   -2.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8910   -2.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 23 17  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 22  2  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1/C=C/C(=O)CC(=O)/C=C/c2ccc(cc2)O)O",
          "formula": "C19H16O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "44d3e72a-7ddf-49d9-9973-39c8e6bdb46d"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "308.3287",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c5910ded-3004-4c70-bb07-f98628587d9c",
      "version": "13",
      "structure": {
        "id": "1082ad1d-ccf6-4be8-adc3-cf149bb3e5ba",
        "molfile": "\n  Marvin  01132101052D          \n\n 23 24  0  0  0  0            999 V2000\n    6.4584   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5828   -1.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1734   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8549   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7304   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3004   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0310   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7304    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3004   -0.0155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8910   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1476   -1.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -2.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3210   -2.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1476   -2.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8910   -2.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4249   -0.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6060   -0.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3210   -1.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7150   -1.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6138   -2.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4326   -2.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0412   -2.4792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  5  2  0  0  0  0\n  9  6  2  0  0  0  0\n 10  3  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12 19  1  0  0  0  0\n 13 18  2  0  0  0  0\n 14 11  2  0  0  0  0\n 15 10  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 10  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 16  2  0  0  0  0\n 20 15  2  0  0  0  0\n 21 14  1  0  0  0  0\n 22 12  1  0  0  0  0\n 23 13  1  0  0  0  0\n 13 20  1  0  0  0  0\n 12 21  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1/C=C/C(=O)CC(=O)/C=C/c2ccc(cc2)O)O",
        "formula": "C19H16O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "308.3287",
        "optical_activity": "NONE",
        "references": [
          "1d238374-b86f-4ce6-8610-8b0235ba766f",
          "b5af16d6-8c9d-4d2b-bae5-c8dccfb957e0"
        ],
        "stereo_centers": 0
      },
      "unii": "2EFO1BP34R"
    }
  ]
}