{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f492f769-7dd9-4a4d-b3bc-5d063c268056",
          "code": "96489-71-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=96489-71-3",
          "code_system": "CAS",
          "references": [
            "8badd93f-8d8f-4bd8-9300-716f901256b9",
            "4a9e184a-4b50-4b60-823f-5ec0dc61553e"
          ]
        },
        {
          "uuid": "bb676844-5256-4963-9e31-d74482f18c86",
          "code": "C428725",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67428725",
          "code_system": "MESH",
          "references": [
            "8badd93f-8d8f-4bd8-9300-716f901256b9"
          ]
        },
        {
          "uuid": "faaf31ab-0dbc-4db3-82f9-46f46df0158c",
          "code": "129105",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3660",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "8badd93f-8d8f-4bd8-9300-716f901256b9"
          ]
        },
        {
          "uuid": "5127b2a6-6164-44e0-9f8b-e21499a69daf",
          "code": "m9348",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9348?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8badd93f-8d8f-4bd8-9300-716f901256b9"
          ]
        },
        {
          "uuid": "ccfb887a-e21c-4be0-9df6-1a17fd5c92d4",
          "code": "91754",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91754",
          "code_system": "PUBCHEM",
          "references": [
            "8badd93f-8d8f-4bd8-9300-716f901256b9"
          ]
        },
        {
          "uuid": "dc3204a6-5b75-7a70-9c3e-6c9d25b0b8cd",
          "code": "7052",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7052",
          "code_system": "HSDB",
          "references": [
            "6af7660d-29a6-f66e-3175-f3afc1146c3b"
          ]
        },
        {
          "uuid": "24483839-5c06-8468-806f-ad373a9279ff",
          "code": "DTXSID5032573",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5032573",
          "code_system": "EPA CompTox",
          "references": [
            "1b416e91-1eac-739d-f32f-a915ce723f2a"
          ]
        },
        {
          "uuid": "0d37350e-8614-4329-97bb-73bd82c16a91",
          "code": "2E4JBA5272",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "577779f8-5f5e-7a24-822a-95bbccb4f6be",
          "code": "38626",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38626",
          "code_system": "CHEBI",
          "references": [
            "a2e99df1-259a-d106-2440-4376541c579e"
          ]
        },
        {
          "uuid": "a968ac88-cd92-1a02-4570-00d5539258e0",
          "code": "pyridaben",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/pyridaben.html",
          "code_system": "ALANWOOD",
          "references": [
            "31a62bf0-0f3e-c870-a67d-d971895dccb0"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a4d88729-251f-41f0-bdcc-f9ab29dbbed0",
          "name": "2-TERT-BUTYL-5-(4-TERT-BUTYLBENZYLTHIO)-4-CHLOROPYRIDAZIN-3(2H)-ONE",
          "stdName": "2-TERT-BUTYL-5-(4-TERT-BUTYLBENZYLTHIO)-4-CHLOROPYRIDAZIN-3(2H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b78d09c-1f07-4e74-9ffd-398fee987108",
            "a60468e1-97d8-4d24-ab8f-e903c8a0eb08"
          ],
          "display_name": false
        },
        {
          "uuid": "3cc00734-e462-485b-b0c9-e96c0b253210",
          "name": "3(2H)-PYRIDAZINONE, 4-CHLORO-2-(1,1-DIMETHYLETHYL)-5-(((4-(1,1-DIMETHYLETHYL)PHENYL)METHYL)THIO)-",
          "stdName": "3(2H)-PYRIDAZINONE, 4-CHLORO-2-(1,1-DIMETHYLETHYL)-5-(((4-(1,1-DIMETHYLETHYL)PHENYL)METHYL)THIO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "286a67f6-a4ec-4d1e-b482-3be831237a20",
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721"
          ],
          "display_name": false
        },
        {
          "uuid": "fc643ea3-3c57-41f7-9f47-564111e8aa2e",
          "name": "4-CHLORO-2-(1,1-DIMETHYLETHYL)-5-(((4-(1,1-DIMETHYLETHYL)PHENYL)METHYL)THIO)-3(2H)-PYRIDAZINONE",
          "stdName": "4-CHLORO-2-(1,1-DIMETHYLETHYL)-5-(((4-(1,1-DIMETHYLETHYL)PHENYL)METHYL)THIO)-3(2H)-PYRIDAZINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "158ed770-8dba-482a-8afc-2649bea70bd6",
            "a60468e1-97d8-4d24-ab8f-e903c8a0eb08"
          ],
          "display_name": false
        },
        {
          "uuid": "3387fe63-ba25-4343-9e64-6b74972807f2",
          "name": "DAMANLIN",
          "stdName": "DAMANLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "286a67f6-a4ec-4d1e-b482-3be831237a20",
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721"
          ],
          "display_name": false
        },
        {
          "uuid": "2a96e650-e121-4550-9a3f-204316d1ab1b",
          "name": "GWN 1715",
          "stdName": "GWN 1715",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "286a67f6-a4ec-4d1e-b482-3be831237a20",
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721"
          ],
          "display_name": false
        },
        {
          "uuid": "a54d18b1-13bc-4661-88b8-f42c51d86f46",
          "name": "NCI 129",
          "stdName": "NCI 129",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721",
            "84b95e99-0569-41f2-9992-19d042cb0976"
          ],
          "display_name": false
        },
        {
          "uuid": "93033d6f-a0c0-4b09-bfbd-da9666a56e15",
          "name": "PYRAMITE",
          "stdName": "PYRAMITE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "286a67f6-a4ec-4d1e-b482-3be831237a20",
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721"
          ],
          "display_name": false
        },
        {
          "uuid": "5bb12b4c-57b1-4aca-a60f-be2d4538dca2",
          "name": "PYRIDABEN",
          "stdName": "PYRIDABEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721",
            "97b4783e-5d9c-4e6c-8cf5-78e1a9098a2a",
            "9355dcaf-333e-41fc-b5dd-394490d7438c",
            "05a04120-f027-4dae-b5d4-5a5e9942ebc6",
            "301bd042-eee6-46eb-8fb1-0762bd606d96",
            "6875a1ee-ff6f-449a-a65b-596754d4b81d",
            "0b7a611f-0a51-470b-b7ca-f2f648159fd6",
            "61c76d0b-a727-4531-947e-e82dd19ccb66"
          ],
          "display_name": true
        },
        {
          "uuid": "070e7cb9-e914-4e96-b62a-dffbeac74fcb",
          "name": "PYRIDABEN [HSDB]",
          "stdName": "PYRIDABEN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721",
            "9355dcaf-333e-41fc-b5dd-394490d7438c"
          ],
          "display_name": false
        },
        {
          "uuid": "f3019025-9f8c-4462-9936-1c434658e018",
          "name": "PYRIDABEN [ISO]",
          "stdName": "PYRIDABEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97b4783e-5d9c-4e6c-8cf5-78e1a9098a2a",
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721"
          ],
          "display_name": false
        },
        {
          "uuid": "a52d6a68-2f21-45fd-a586-bf2075034fc2",
          "name": "PYRIDABEN [MI]",
          "stdName": "PYRIDABEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721",
            "6875a1ee-ff6f-449a-a65b-596754d4b81d"
          ],
          "display_name": false
        },
        {
          "uuid": "dc9165bb-32d6-428e-81a8-22a2ced9c250",
          "name": "SANMITE",
          "stdName": "SANMITE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721",
            "84b95e99-0569-41f2-9992-19d042cb0976"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "05a04120-f027-4dae-b5d4-5a5e9942ebc6",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "eaf860cd-7f24-4a8a-a1c3-cbcfa33a5721",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "286a67f6-a4ec-4d1e-b482-3be831237a20",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84b95e99-0569-41f2-9992-19d042cb0976",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a60468e1-97d8-4d24-ab8f-e903c8a0eb08",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "158ed770-8dba-482a-8afc-2649bea70bd6",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b78d09c-1f07-4e74-9ffd-398fee987108",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6875a1ee-ff6f-449a-a65b-596754d4b81d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9355dcaf-333e-41fc-b5dd-394490d7438c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97b4783e-5d9c-4e6c-8cf5-78e1a9098a2a",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8badd93f-8d8f-4bd8-9300-716f901256b9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390906000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb406189-c833-4c12-b2d9-55887b83801e",
          "citation": "SRS import [2E4JBA5272]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2E4JBA5272",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390906000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9598a140-3997-4ee8-ac2c-6cf11e10712a",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b7a611f-0a51-470b-b7ca-f2f648159fd6",
          "citation": "PYRIDABEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "301bd042-eee6-46eb-8fb1-0762bd606d96",
          "citation": "PYRIDABEN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "61c76d0b-a727-4531-947e-e82dd19ccb66",
          "citation": "PYRIDABEN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6af7660d-29a6-f66e-3175-f3afc1146c3b",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+96489-71-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b416e91-1eac-739d-f32f-a915ce723f2a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=96489-71-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31a62bf0-0f3e-c870-a67d-d971895dccb0",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4a9e184a-4b50-4b60-823f-5ec0dc61553e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a2e99df1-259a-d106-2440-4376541c579e",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a131f563-0f72-4eeb-8a94-ec4d488798f5",
          "id": "a131f563-0f72-4eeb-8a94-ec4d488798f5",
          "molfile": "\n  Marvin  01132108222D          \n\n 24 25  0  0  0  0            999 V2000\n    0.4772   -8.2352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4772   -7.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3432   -7.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3022   -7.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4772   -6.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1850   -6.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1850   -5.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4659   -4.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4659   -4.1129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2446   -3.7028    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2446   -2.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4690   -2.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4690   -1.6413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2446   -1.2236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9582   -1.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6718   -1.2320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9582   -2.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6716   -2.8812    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2446   -0.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2446    0.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5803   -0.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0696   -0.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2425   -5.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2425   -6.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 24  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 23  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(cc1)CSc2cnn(c(=O)c2Cl)C(C)(C)C",
          "formula": "C19H25ClN2OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "db810185-bfed-460f-b705-891041708e3d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "364.9343",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a832fea8-ce5a-40d3-839f-b891b84b008e",
      "version": "7",
      "structure": {
        "id": "0f94117b-644b-4758-9a29-04515e7096d3",
        "molfile": "\n  Marvin  01132101022D          \n\n 24 25  0  0  0  0            999 V2000\n   -0.2446    0.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2446   -0.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5803   -0.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0696   -0.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2446   -1.2236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9582   -1.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9582   -2.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2446   -2.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4690   -2.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4690   -1.6413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2446   -3.7028    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4659   -4.1129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4659   -4.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1850   -5.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1850   -6.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4772   -6.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4772   -7.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4772   -8.2352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3432   -7.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3022   -7.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2425   -6.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2425   -5.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6716   -2.8812    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6718   -1.2320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10  5  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 13 22  1  0  0  0  0\n 23  7  1  0  0  0  0\n  6 24  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(cc1)CSc2cnn(c(=O)c2Cl)C(C)(C)C",
        "formula": "C19H25ClN2OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "364.9343",
        "optical_activity": "NONE",
        "references": [
          "cb406189-c833-4c12-b2d9-55887b83801e",
          "9598a140-3997-4ee8-ac2c-6cf11e10712a"
        ],
        "stereo_centers": 0
      },
      "unii": "2E4JBA5272"
    }
  ]
}