{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "607ad8f7-fbaa-44a6-ad5c-d0b2164348f1",
          "code": "DIOCTYL ADIPATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=5972",
          "code_system": "JECFA EVALUATION",
          "references": [
            "efcb2b44-6c7a-4fee-9b34-3d57599c32a2"
          ]
        },
        {
          "uuid": "d2d9f36e-7a56-4027-b836-c2b5792bc0bc",
          "code": "123-79-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=123-79-5",
          "code_system": "CAS",
          "references": [
            "efcb2b44-6c7a-4fee-9b34-3d57599c32a2",
            "2401d141-b02a-4888-b600-1de34be50976"
          ]
        },
        {
          "uuid": "bca224f9-386e-4ed8-aeaf-0dc95823e229",
          "code": "DIOCTYL ADIPATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dioctyl_adipate",
          "code_system": "WIKIPEDIA",
          "references": [
            "efcb2b44-6c7a-4fee-9b34-3d57599c32a2"
          ]
        },
        {
          "uuid": "d4adf47d-8cdf-4001-8422-75ff0590c1b1",
          "code": "204-652-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.231",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "efcb2b44-6c7a-4fee-9b34-3d57599c32a2"
          ]
        },
        {
          "uuid": "2fa57db3-7b70-47c2-8a4a-ae02846abdf1",
          "code": "SUB35121",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "efcb2b44-6c7a-4fee-9b34-3d57599c32a2"
          ]
        },
        {
          "uuid": "e5e72cad-5c93-4239-93c1-3f3b4a1842ba",
          "code": "31271",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31271",
          "code_system": "PUBCHEM",
          "references": [
            "efcb2b44-6c7a-4fee-9b34-3d57599c32a2"
          ]
        },
        {
          "uuid": "abb420b6-acc4-dea1-8d80-a198081ca159",
          "code": "366",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/366",
          "code_system": "HSDB",
          "references": [
            "2614707b-15f0-7128-f4df-0730a1df04b2"
          ]
        },
        {
          "uuid": "f5c47a31-3841-b747-493b-51bdb26f652d",
          "code": "DTXSID2021606",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2021606",
          "code_system": "EPA CompTox",
          "references": [
            "dd18fce4-218b-056b-47eb-a48de32f66d3"
          ]
        },
        {
          "uuid": "3d1ec76e-338f-48bc-b834-963cdd61bf1d",
          "code": "2BD76YG9SI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "662b5d14-7f4c-23ba-3f6e-72d0430144b8",
          "code": "34675",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34675",
          "code_system": "CHEBI",
          "references": [
            "073c262e-1487-5e51-0bf8-cdde232136f2"
          ]
        },
        {
          "uuid": "eaf81acf-f3de-64d7-d01b-1ea16fdc664e",
          "code": "100000128281",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c88e81b9-aec3-625d-2650-272357197d9a"
          ]
        },
        {
          "uuid": "b94e8485-d17c-4a3f-2aa7-8f30c56fd39d",
          "code": "16201",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=16201",
          "code_system": "NSC",
          "references": [
            "e28060cb-52cc-99b2-71d9-fec14c538317"
          ]
        },
        {
          "uuid": "a73bab21-9a23-af88-6a6d-64d5182ce61b",
          "code": "1946",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1946/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "8b9c6441-300f-28dc-0f5e-bb5f963b4cdd"
          ]
        },
        {
          "uuid": "7b587d28-4d7c-79b2-306b-a1de3aaae722",
          "code": "2BD76YG9SI",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(2BD76YG9SI)",
          "code_system": "DAILYMED",
          "references": [
            "b6a779b2-853c-908e-9f4f-fae14b3ecb4b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1a54972c-fe39-4b41-b1ba-89188e2630f9",
          "name": "ADIPIC ACID DIOCTYL ESTER",
          "stdName": "ADIPIC ACID DIOCTYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ac2f708-7a74-4630-b05f-ee0be49e158c",
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0"
          ],
          "display_name": false
        },
        {
          "uuid": "f3211506-ee29-4ca1-81da-b92d99f61c69",
          "name": "ADIPIC ACID, DIOCTYL ESTER",
          "stdName": "ADIPIC ACID, DIOCTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dea4ccf2-b3e0-462b-abfb-1da3e4ecb8c4",
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0"
          ],
          "display_name": false
        },
        {
          "uuid": "3cab4fd0-4fb6-4d46-8a06-eadcfc493b40",
          "name": "DI-N-OCTYL ADIPATE",
          "stdName": "DI-N-OCTYL ADIPATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78394cb5-f309-4065-ad06-8e59b701b835",
            "e5a90c88-c354-4c7f-8702-7e4e8ebac651",
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0",
            "87db12dd-50a2-48fb-9f38-8618e674ffec"
          ],
          "display_name": false
        },
        {
          "uuid": "ae41fa5d-43f4-4bd8-9828-c7ef6c694346",
          "name": "DI-N-OCTYL ADIPATE [HSDB]",
          "stdName": "DI-N-OCTYL ADIPATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5a90c88-c354-4c7f-8702-7e4e8ebac651",
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0"
          ],
          "display_name": false
        },
        {
          "uuid": "a65691e5-c1c6-4773-b537-0b76a5e27c1a",
          "name": "DICAPRYLYL ADIPATE",
          "stdName": "DICAPRYLYL ADIPATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ac2f708-7a74-4630-b05f-ee0be49e158c",
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0"
          ],
          "display_name": false
        },
        {
          "uuid": "091ac15e-07df-4b31-957a-702f4697a81b",
          "name": "DIOCTYL ADIPATE",
          "stdName": "DIOCTYL ADIPATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0",
            "9792ec00-25b7-44c6-ae11-afbb9531c9f0",
            "7fa78dc4-6506-47ec-a4ae-698c82997944",
            "d0f7c69e-77e2-48ba-ab7f-7d4b71d55b4d"
          ],
          "display_name": true
        },
        {
          "uuid": "95c9ea41-7c25-4133-a763-388bb8b12b5c",
          "name": "DIOCTYL HEXANEDIOATE",
          "stdName": "DIOCTYL HEXANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ac2f708-7a74-4630-b05f-ee0be49e158c",
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0"
          ],
          "display_name": false
        },
        {
          "uuid": "dcca8f38-582b-0c87-67c6-7a3821eea7a2",
          "name": "Dioctyl adipate [WHO-DD]",
          "stdName": "DIOCTYL ADIPATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f128476-ca0e-0111-551e-54ea8bd2e792"
          ],
          "display_name": false
        },
        {
          "uuid": "2fadb0a3-2e6e-4c2d-8566-e782a3f97828",
          "name": "FEMA NO. 4476",
          "stdName": "FEMA NO. 4476",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0",
            "c2d844c3-ed0a-492d-be4e-fcce2d10d71c"
          ],
          "display_name": false
        },
        {
          "uuid": "8aa6c87e-4137-4c65-a45d-c5bea6515a98",
          "name": "HEXANEDIOIC ACID DIOCTYL ESTER",
          "stdName": "HEXANEDIOIC ACID DIOCTYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ac2f708-7a74-4630-b05f-ee0be49e158c",
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0"
          ],
          "display_name": false
        },
        {
          "uuid": "da4ca6d7-d1b8-4654-9235-b9b04cca7b2a",
          "name": "NSC-16201",
          "stdName": "NSC-16201",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dea4ccf2-b3e0-462b-abfb-1da3e4ecb8c4",
            "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "87db12dd-50a2-48fb-9f38-8618e674ffec",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c2d844c3-ed0a-492d-be4e-fcce2d10d71c",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66b2e6a0-b1d1-4ad3-a25d-04e671c0f6b0",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dea4ccf2-b3e0-462b-abfb-1da3e4ecb8c4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ac2f708-7a74-4630-b05f-ee0be49e158c",
          "citation": "http://www.thegoodscentscompany.com/data/rw1299581.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1299581.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5a90c88-c354-4c7f-8702-7e4e8ebac651",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0f7c69e-77e2-48ba-ab7f-7d4b71d55b4d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fa78dc4-6506-47ec-a4ae-698c82997944",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efcb2b44-6c7a-4fee-9b34-3d57599c32a2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391222000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58ef0e66-441d-4ce3-a423-b9576e1ddb8f",
          "citation": "SRS import [2BD76YG9SI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2BD76YG9SI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391222000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e87e497-d5be-4e7b-bd19-36a9e1e4ece4",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78394cb5-f309-4065-ad06-8e59b701b835",
          "citation": "DI-N-OCTYL ADIPATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9792ec00-25b7-44c6-ae11-afbb9531c9f0",
          "citation": "DIOCTYL ADIPATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2614707b-15f0-7128-f4df-0730a1df04b2",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+123-79-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd18fce4-218b-056b-47eb-a48de32f66d3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=123-79-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c88e81b9-aec3-625d-2650-272357197d9a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "073c262e-1487-5e51-0bf8-cdde232136f2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4f128476-ca0e-0111-551e-54ea8bd2e792",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2401d141-b02a-4888-b600-1de34be50976",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e28060cb-52cc-99b2-71d9-fec14c538317",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "92a75e66-041e-fcd5-441e-e42cb1f94527",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8b9c6441-300f-28dc-0f5e-bb5f963b4cdd",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        },
        {
          "uuid": "b6a779b2-853c-908e-9f4f-fae14b3ecb4b",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e179693b-4d17-4bee-9ad4-c0d3713f3bc4",
          "id": "e179693b-4d17-4bee-9ad4-c0d3713f3bc4",
          "molfile": "\n  Marvin  01132111402D          \n\n 26 25  0  0  0  0            999 V2000\n   -6.8419   -2.3359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.4333   -1.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.6083   -1.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2037   -0.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3788   -0.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9586   -0.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1337   -0.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7213    0.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8965    0.5127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6112    1.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2394    1.9658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7633    1.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4703    2.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3971    2.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6745    1.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6112    1.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1701    1.9081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9234    0.5357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7482    0.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1607   -0.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9856   -0.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3981   -0.8981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2191   -0.8981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6354   -1.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4642   -1.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8688   -2.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC",
          "formula": "C22H42O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b6a65df2-4a1c-4cef-9ab1-5971c7dbbbce"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "370.5673",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f9912ef3-3fdc-4ca0-8317-617947eace64",
      "version": "13",
      "structure": {
        "id": "f2a736cd-e1b3-42e1-8e2d-156d582f68ff",
        "molfile": "\n  Marvin  01132112352D          \n\n 26 25  0  0  0  0            999 V2000\n   -0.7633    1.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4703    2.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6112    1.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3971    2.1201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8965    0.5127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2394    1.9658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6745    1.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7213    0.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6112    1.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1337   -0.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9234    0.5357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1701    1.9081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9586   -0.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7482    0.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3788   -0.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1607   -0.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2037   -0.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9856   -0.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.6083   -1.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3981   -0.8981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.4333   -1.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2191   -0.8981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.8419   -2.3359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6354   -1.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4642   -1.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8688   -2.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  4  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 10 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCOC(=O)CCCCC(=O)OCCCCCCCC",
        "formula": "C22H42O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "370.5673",
        "optical_activity": "NONE",
        "references": [
          "1e87e497-d5be-4e7b-bd19-36a9e1e4ece4",
          "58ef0e66-441d-4ce3-a423-b9576e1ddb8f"
        ],
        "stereo_centers": 0
      },
      "unii": "2BD76YG9SI"
    }
  ]
}