{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "357c95ca-1e05-4792-a4a6-90d96b415b4d", "code": "123968-25-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=123968-25-2", "code_system": "CAS", "references": [ "b6076c93-9f7d-416c-82a8-cdd8879a34c1", "b042e945-7f2f-40b9-a4e6-f1b64fceeac2" ] }, { "uuid": "6b2fa4e8-55ee-45a6-bb94-5baf63d0ff73", "code": "FCN NO. 1057", "comments": "FCN|STABILIZER|POLYSTYRENE", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=1057", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "b6076c93-9f7d-416c-82a8-cdd8879a34c1" ] }, { "uuid": "b3ca0d0a-b1a2-4ecc-bafc-6ab2716c108c", "code": "FCN NO. 494", "comments": "FCN|STABILIZER|POLYSTYRENE", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=494", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "b6076c93-9f7d-416c-82a8-cdd8879a34c1" ] }, { "uuid": "8151b646-3758-4973-ad36-6de6d47ba798", "code": "10907737", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10907737", "code_system": "PUBCHEM", "references": [ "b6076c93-9f7d-416c-82a8-cdd8879a34c1" ] }, { "uuid": "6dafdb38-4636-9aa4-3588-0a30c955302b", "code": "DTXSID7051630", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7051630", "code_system": "EPA CompTox", "references": [ "0ec65024-6d0f-7740-01e5-4aa4fa4b5a79" ] }, { "uuid": "ff5044f3-a61c-42fc-8916-c8b7592304b3", "code": "2BBL73FIEU", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f986bcc8-721b-d9ee-6fa8-89af722cc386", "code": "2BBL73FIEU", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2BBL73FIEU", "code_system": "DAILYMED", "references": [ "0096e850-c4a2-7d10-49e2-3f7022c9c77f" ] } ], "substance_class": "chemical", "names": [ { "uuid": "3d67fbe9-8049-49ff-8e3f-57b929993685", "name": "2,2'-ETHYLIDENEBIS(4,6-DI-TERT-AMYLPHENOL) MONOACRYLATE", "stdName": "2,2'-ETHYLIDENEBIS(4,6-DI-TERT-AMYLPHENOL) MONOACRYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "354edf21-8ccc-4f18-8283-dc46be17490a" ], "display_name": false }, { "uuid": "ad29ad5c-11fd-481f-9969-870e1cd8ac55", "name": "2,4-DI-TERT-PENTYL-6-(1-(3,5-DI-TERT- PENTYL-2-HYDROXYPHENYL)ETHYL)PHENYL ACRYLATE", "stdName": "2,4-DI-TERT-PENTYL-6-(1-(3,5-DI-TERT- PENTYL-2-HYDROXYPHENYL)ETHYL)PHENYL ACRYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0401d1a7-83e2-4c3d-b8a3-842866e08042" ], "display_name": false }, { "uuid": "34504672-bd62-49f3-98ee-02a81b13f8bc", "name": "2,4-DI-TERT-PENTYL-6-(1-(3,5-DI-TERT-PENTYL-2-HYDROXYPHENYL)ETHYL)PHENYL ACRYLATE", "stdName": "2,4-DI-TERT-PENTYL-6-(1-(3,5-DI-TERT-PENTYL-2-HYDROXYPHENYL)ETHYL)PHENYL ACRYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ec15ed99-0ee5-4d9f-936d-54a277cc6c34" ], "display_name": false }, { "uuid": "1da64bd4-e6b6-425a-8071-3bb9292f7917", "name": "2-(1-(2-HYDROXY-3,5-DI-TERT-PENTYLPHENYL)ETHYL)-4,6-DI-TERT- PENTYLPHENYL ACRYLATE", "stdName": "2-(1-(2-HYDROXY-3,5-DI-TERT-PENTYLPHENYL)ETHYL)-4,6-DI-TERT- PENTYLPHENYL ACRYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c346ebe5-e562-46f8-ba38-d2ce4b22849a" ], "display_name": false }, { "uuid": "a28ae85b-383f-4901-81a8-065a4214a828", "name": "2-PROPENOIC ACID, 2-(1-(3,5-BIS(1,1-DIMETHYLPROPYL)-2- HYDROXYPHENYL)ETHYL)-4,6-BIS(1,1-DIMETHYLPROPYL)PHENYL ESTER", "stdName": "2-PROPENOIC ACID, 2-(1-(3,5-BIS(1,1-DIMETHYLPROPYL)-2- HYDROXYPHENYL)ETHYL)-4,6-BIS(1,1-DIMETHYLPROPYL)PHENYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c346ebe5-e562-46f8-ba38-d2ce4b22849a" ], "display_name": false }, { "uuid": "3abc2e34-6f23-4a2c-acc2-9541524fc3f5", "name": "ANTIOXIDANT GS", "stdName": "ANTIOXIDANT GS", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "354edf21-8ccc-4f18-8283-dc46be17490a" ], "display_name": true }, { "uuid": "2b591224-6e4f-43a4-99c1-82c7060cc393", "name": "KY-500", "stdName": "KY-500", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "5a3268c7-504f-4c02-88e4-2f1b17741805" ], "display_name": false }, { "uuid": "e6c0709d-c93d-48cd-99e9-bb75750855d7", "name": "SUMILIZER GS", "stdName": "SUMILIZER GS", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "354edf21-8ccc-4f18-8283-dc46be17490a" ], "display_name": false } ], "references": [ { "uuid": "ec15ed99-0ee5-4d9f-936d-54a277cc6c34", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c346ebe5-e562-46f8-ba38-d2ce4b22849a", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0401d1a7-83e2-4c3d-b8a3-842866e08042", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "354edf21-8ccc-4f18-8283-dc46be17490a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5a3268c7-504f-4c02-88e4-2f1b17741805", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b6076c93-9f7d-416c-82a8-cdd8879a34c1", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391756000, "tags": [ "NOMEN" ] }, { "uuid": "09170ca0-235c-4f78-b004-76a065fccdf7", "citation": "SRS import [2BBL73FIEU]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2BBL73FIEU", "doc_type": "SRS", "public_domain": true, "document_date": 1493391756000, "tags": [ "NOMEN" ] }, { "uuid": "0ec65024-6d0f-7740-01e5-4aa4fa4b5a79", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=123968-25-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b042e945-7f2f-40b9-a4e6-f1b64fceeac2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0096e850-c4a2-7d10-49e2-3f7022c9c77f", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c4cf174b-6644-404f-8d1f-170765bbf333", "id": "c4cf174b-6644-404f-8d1f-170765bbf333", "molfile": "\n Marvin 01132110102D \n\n 40 41 0 0 0 0 999 V2000\n 8.1449 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4300 -2.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7197 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3032 -3.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1316 -3.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 -2.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2901 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 -2.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8603 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.1456 -2.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8603 -3.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 -4.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 -5.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8603 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1456 -5.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1456 -4.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2158 -3.6975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5056 -4.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5056 -4.9376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7908 -3.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0759 -4.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4307 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0601 -6.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6070 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4307 -6.2967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7158 -6.7086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2901 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7020 -6.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8782 -6.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 -5.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7197 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 -1.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8603 -1.3499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2901 -1.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 -1.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2901 -0.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8782 0.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4664 -0.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 -0.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 0.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 6 3 1 0 0 0 0\n 6 7 1 0 0 0 0\n 35 6 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 8 32 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 16 11 2 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 27 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 15 22 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 22 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 27 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 36 39 1 0 0 0 0\n 39 40 1 0 0 0 0\nM END", "smiles": "C=CC(=O)Oc1c(cc(cc1C(C)(C)CC)C(C)(C)CC)C(C)c2cc(cc(c2O)C(C)(C)CC)C(C)(C)CC", "formula": "C37H56O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e4e42cad-799a-4816-a06c-501826d42703" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "548.8401", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "04b1dbd0-a9d6-4667-81fd-6a5fc7bd1623", "version": "4", "structure": { "id": "7374e667-9de8-408a-9371-4048465ff57d", "molfile": "\n Marvin 01132105592D \n\n 40 41 0 0 0 0 999 V2000\n 1.5056 -4.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7908 -3.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0759 -4.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5056 -4.9376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2158 -3.6975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1456 -4.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8603 -3.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 -4.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 -5.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8603 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1456 -5.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4307 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4307 -6.2967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7158 -6.7086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0601 -6.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6070 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2901 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 -5.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7197 -5.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7020 -6.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8782 -6.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8603 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1456 -2.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 -2.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 -1.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2901 -1.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 -1.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 -2.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2901 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7197 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4300 -2.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1449 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3032 -3.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1316 -3.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2901 -0.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 -0.1096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0048 0.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8782 0.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4664 -0.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8603 -1.3499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 1 4 2 0 0 0 0\n 1 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 6 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 12 15 1 0 0 0 0\n 12 16 1 0 0 0 0\n 9 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 17 20 1 0 0 0 0\n 17 21 1 0 0 0 0\n 7 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 24 29 2 0 0 0 0\n 28 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 30 33 1 0 0 0 0\n 30 34 1 0 0 0 0\n 26 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 35 38 1 0 0 0 0\n 35 39 1 0 0 0 0\n 25 40 1 0 0 0 0\nM END", "smiles": "C=CC(=O)Oc1c(cc(cc1C(C)(C)CC)C(C)(C)CC)C(C)c2cc(cc(c2O)C(C)(C)CC)C(C)(C)CC", "formula": "C37H56O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "548.8401", "optical_activity": "( + / - )", "references": [ "09170ca0-235c-4f78-b004-76a065fccdf7", "c346ebe5-e562-46f8-ba38-d2ce4b22849a" ], "stereo_centers": 1 }, "unii": "2BBL73FIEU" } ] }