{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b7605cad-2732-4ea4-9b3f-a74b0403cf4c",
          "code": "64506-49-6",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=64506-49-6",
          "code_system": "CAS",
          "references": [
            "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0",
            "d73c75c0-8d38-4195-8004-17da86d47052"
          ]
        },
        {
          "uuid": "c5f5bd49-a858-43a0-a0f1-0f606b98aa26",
          "code": "C81118",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81118",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0"
          ]
        },
        {
          "uuid": "e44c9416-e7a6-4cf8-ba84-fedaa7b8e1f0",
          "code": "C035032",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67035032",
          "code_system": "MESH",
          "references": [
            "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0"
          ]
        },
        {
          "uuid": "ebaeb8fa-76d2-4bf6-a0f8-15beb63c8b01",
          "code": "SOFALCONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sofalcone",
          "code_system": "WIKIPEDIA",
          "references": [
            "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0"
          ]
        },
        {
          "uuid": "77dc7857-e471-41cf-b402-08a9e6cb57e6",
          "code": "SUB10574MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0"
          ]
        },
        {
          "uuid": "4b0c14dc-0e59-45bf-9419-27c7c8d214b1",
          "code": "5321",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5321",
          "code_system": "INN",
          "references": [
            "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0"
          ]
        },
        {
          "uuid": "778e6bd1-4afe-41bf-ac4c-6bffb72777f8",
          "code": "m10098",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10098?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0"
          ]
        },
        {
          "uuid": "4496f87a-421e-4d3a-93a3-1aa97505c3f3",
          "code": "CHEMBL1441961",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1441961",
          "code_system": "ChEMBL",
          "references": [
            "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0"
          ]
        },
        {
          "uuid": "25591b89-08d8-4030-9c8c-311f80c9f53d",
          "code": "153175-87-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=153175-87-2",
          "code_system": "CAS",
          "references": [
            "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0",
            "121d2d56-2417-4e32-a34f-19cf856d87db"
          ]
        },
        {
          "uuid": "b6ee8104-ccf1-3789-1599-4c5a0947df7c",
          "code": "C1745",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Polyphenol[C28203]|Flavonoid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1745",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8e65331b-c9f4-8584-c7c8-3557111afbe7"
          ]
        },
        {
          "uuid": "a73b47e7-4393-c47f-6581-e4411de4acb9",
          "code": "5282219",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5282219",
          "code_system": "PUBCHEM",
          "references": [
            "d2678a9a-43fe-6476-8d5d-24533cc05efa"
          ]
        },
        {
          "uuid": "fff2b797-d6e0-4d3b-beae-389270c68007",
          "code": "2B668TJX8E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "adfa4fcf-b686-2f1d-3515-9395fb4e99c1",
          "code": "DB05197",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB05197",
          "code_system": "DRUG BANK",
          "references": [
            "8e65331b-c9f4-8584-c7c8-3557111afbe7"
          ]
        },
        {
          "uuid": "9db35dce-c67c-ef87-476f-c7401b841d8c",
          "code": "2456",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2456",
          "code_system": "DRUG CENTRAL",
          "references": [
            "8e65331b-c9f4-8584-c7c8-3557111afbe7"
          ]
        },
        {
          "uuid": "2bdc5c04-6639-5a7e-9d52-eaf182c4bbb2",
          "code": "100000084062",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c32a6a61-5117-8db9-aa54-bf69558baafc"
          ]
        },
        {
          "uuid": "adcd252e-cb86-df1a-776c-e125f2d22d39",
          "code": "135732",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:135732",
          "code_system": "CHEBI",
          "references": [
            "8e65331b-c9f4-8584-c7c8-3557111afbe7"
          ]
        },
        {
          "uuid": "1f093169-9088-8081-33a3-fd7334b51f99",
          "code": "DTXSID50860797",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50860797",
          "code_system": "EPA CompTox",
          "references": [
            "6e50c10e-4737-6c84-1a01-d292dd6d9ca6"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d847bc7b-cde0-4025-ab61-d4248f9ed06b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "bd174a48-3216-4fb2-a1ce-f249acee79b9",
            "refuuid": "31bac0dd-3b78-49ed-89ee-1080bcc49b25",
            "name": "SOFALCONE",
            "unii": "2B668TJX8E",
            "linking_id": "2B668TJX8E",
            "ref_pname": "SOFALCONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6569ad09-fa7c-4e17-a87f-cbdc2ae1dba6",
          "name": "(5-((3-METHYL-2-BUTENYL)OXY)-2-(P-((3-METHYL-2-BUTENYL)OXY)CINNAMOYL)PHENOXY)ACETIC ACID",
          "stdName": "(5-((3-METHYL-2-BUTENYL)OXY)-2-(P-((3-METHYL-2-BUTENYL)OXY)CINNAMOYL)PHENOXY)ACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "526431d7-c9db-4f7d-9437-59dd7117aaa3"
          ],
          "display_name": false
        },
        {
          "uuid": "ad936620-3494-46bb-ab01-a008013f30ea",
          "name": "ACETIC ACID, 2-(5-((3-METHYL-2-BUTEN-1-YL)OXY)-2-((2E)-3-(4-((3-METHYL-2-BUTEN-1-YL)OXY)PHENYL)-1-OXO-2-PROPEN-1-YL)PHENOXY)-",
          "stdName": "ACETIC ACID, 2-(5-((3-METHYL-2-BUTEN-1-YL)OXY)-2-((2E)-3-(4-((3-METHYL-2-BUTEN-1-YL)OXY)PHENYL)-1-OXO-2-PROPEN-1-YL)PHENOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19860723-dd04-4a32-9109-d3de80ecbaa4"
          ],
          "display_name": false
        },
        {
          "uuid": "174e15ca-36d0-4d83-99b7-d5f040d93370",
          "name": "SOFALCONE",
          "stdName": "SOFALCONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e796227-e121-4f97-8fb1-cc19bb92e5a6",
            "8f099b38-4449-464a-b3ec-386f3d1730cf",
            "4194fa0c-3f85-45e1-bd55-d30cb3d16fe6",
            "8da41099-9dae-4061-906b-47c4ddb2dcb7",
            "33d137be-559e-4ff4-b27e-490f9eeb9fce",
            "ad6a21fe-fca3-417b-b8fa-340fac3ac33a",
            "9b117e2c-5bf8-4f99-ae9d-4791acd02912",
            "714ed381-4176-4bb2-8e37-fdb20ea45f66",
            "71af2005-13b4-4364-87f7-79653e1096a0",
            "991f88bd-9296-4d6e-ad32-f4b119e02587",
            "13bca813-cef7-457f-b2db-d911b81004f6"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "74d833f0-3d06-4173-b7b5-bc55754862d1",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "5ea6561b-2010-429e-ac4e-7d23621b313a",
          "name": "SOFALCONE [JAN]",
          "stdName": "SOFALCONE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8da41099-9dae-4061-906b-47c4ddb2dcb7"
          ],
          "display_name": false
        },
        {
          "uuid": "ea15d562-60b8-4b07-b64b-eed6c526f332",
          "name": "SOFALCONE [MART.]",
          "stdName": "SOFALCONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "991f88bd-9296-4d6e-ad32-f4b119e02587"
          ],
          "display_name": false
        },
        {
          "uuid": "3246dee9-404d-49f0-8ec6-836815ecf79d",
          "name": "SOFALCONE [MI]",
          "stdName": "SOFALCONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13bca813-cef7-457f-b2db-d911b81004f6"
          ],
          "display_name": false
        },
        {
          "uuid": "3901d5a4-2c9e-9a01-7496-f0bc47291e96",
          "name": "SOLON",
          "stdName": "SOLON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd6181d3-2e5c-96df-7f7e-b6bfefaa2bf0"
          ],
          "display_name": false
        },
        {
          "uuid": "b074b61f-172d-45b9-57b0-f3aa39aebe32",
          "name": "SU-88",
          "stdName": "SU-88",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd6181d3-2e5c-96df-7f7e-b6bfefaa2bf0"
          ],
          "display_name": false
        },
        {
          "uuid": "e526d83a-f9dc-19e3-7c97-fdb9c00fd706",
          "name": "Sofalcone [WHO-DD]",
          "stdName": "SOFALCONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a55c5e88-9406-d443-fe95-f359df3646c4"
          ],
          "display_name": false
        },
        {
          "uuid": "971d76c2-7dae-4811-89ae-6033f63e732d",
          "name": "sofalcone [INN]",
          "stdName": "SOFALCONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "714ed381-4176-4bb2-8e37-fdb20ea45f66"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8f099b38-4449-464a-b3ec-386f3d1730cf",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "526431d7-c9db-4f7d-9437-59dd7117aaa3",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "714ed381-4176-4bb2-8e37-fdb20ea45f66",
          "citation": "INN Proposed List 49",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL49.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8da41099-9dae-4061-906b-47c4ddb2dcb7",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "991f88bd-9296-4d6e-ad32-f4b119e02587",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13bca813-cef7-457f-b2db-d911b81004f6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad6a21fe-fca3-417b-b8fa-340fac3ac33a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19860723-dd04-4a32-9109-d3de80ecbaa4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9770c2e9-fc9b-43ef-bd52-c6fcac1c1bc0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390166000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ad82b22-b80b-49f0-8e36-b298273eb40d",
          "citation": "SRS import [2B668TJX8E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2B668TJX8E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390166000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4194fa0c-3f85-45e1-bd55-d30cb3d16fe6",
          "citation": "SOFALCONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2e796227-e121-4f97-8fb1-cc19bb92e5a6",
          "citation": "SOFALCONE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "33d137be-559e-4ff4-b27e-490f9eeb9fce",
          "citation": "SOFALCONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "71af2005-13b4-4364-87f7-79653e1096a0",
          "citation": "SOFALCONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9b117e2c-5bf8-4f99-ae9d-4791acd02912",
          "citation": "SOFALCONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "63fc28d7-2d7d-265f-4234-3bcf6fc2abbd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=64506-49-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bd6181d3-2e5c-96df-7f7e-b6bfefaa2bf0",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "c32a6a61-5117-8db9-aa54-bf69558baafc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8e65331b-c9f4-8584-c7c8-3557111afbe7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "121d2d56-2417-4e32-a34f-19cf856d87db",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d73c75c0-8d38-4195-8004-17da86d47052",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d2678a9a-43fe-6476-8d5d-24533cc05efa",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "a55c5e88-9406-d443-fe95-f359df3646c4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6e50c10e-4737-6c84-1a01-d292dd6d9ca6",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9e09f085-0290-4f45-89ca-494ed65906f8",
          "id": "9e09f085-0290-4f45-89ca-494ed65906f8",
          "molfile": "\n  Marvin  01132108132D          \n\n 33 34  0  0  0  0            999 V2000\n   11.9124   -2.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1640   -2.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1640   -1.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5507   -2.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7038   -2.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0503   -3.1536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4298   -2.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6997   -3.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9988   -2.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9988   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2870   -1.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5714   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8596   -1.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8523   -0.7990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1296   -2.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1296   -2.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4286   -3.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7168   -2.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8626   -3.2741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1288   -2.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3841   -3.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3460   -2.8031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0834   -3.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3460   -1.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7168   -2.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4286   -1.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4286   -0.8282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7168   -0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7168    0.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4286    0.8181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0123    0.8181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7143   -1.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4298   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 33  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 32  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 26 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 25 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  2  0  0  0  0\n 32 33  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCOc1ccc(cc1)/C=C/C(=O)c2ccc(cc2OCC(=O)O)OCC=C(C)C)C",
          "formula": "C27H30O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "17a88640-6c75-4d4a-9a1f-80bcd0b1344d"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "450.5245",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "31bac0dd-3b78-49ed-89ee-1080bcc49b25",
      "version": "23",
      "structure": {
        "id": "e5a47815-4cb6-409e-9fb8-e59d2c141637",
        "molfile": "\n  Marvin  01132111532D          \n\n 33 34  0  0  0  0            999 V2000\n    3.4286   -1.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1296   -2.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7168   -2.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4286   -0.8282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1296   -2.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8596   -1.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7168   -2.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7168   -0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4286   -3.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5714   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8523   -0.7990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8626   -3.2741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7168    0.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2870   -1.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1288   -2.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4286    0.8181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0123    0.8181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9988   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3841   -3.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9988   -2.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7143   -1.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3460   -2.8031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6997   -3.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4298   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0834   -3.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3460   -1.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4298   -2.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0503   -3.1536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7038   -2.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5507   -2.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1640   -2.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9124   -2.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1640   -1.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n 10 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 13 17  2  0  0  0  0\n 14 18  1  0  0  0  0\n 15 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  2  0  0  0  0\n 19 22  2  0  0  0  0\n 20 23  2  0  0  0  0\n 21 24  1  0  0  0  0\n 22 25  1  0  0  0  0\n 22 26  1  0  0  0  0\n 23 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\n  7  9  2  0  0  0  0\n 24 27  2  0  0  0  0\nM  END",
        "smiles": "CC(=CCOc1ccc(cc1)/C=C/C(=O)c2ccc(cc2OCC(=O)O)OCC=C(C)C)C",
        "formula": "C27H30O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "450.5245",
        "optical_activity": "NONE",
        "references": [
          "8f099b38-4449-464a-b3ec-386f3d1730cf",
          "8ad82b22-b80b-49f0-8e36-b298273eb40d",
          "714ed381-4176-4bb2-8e37-fdb20ea45f66"
        ],
        "stereo_centers": 0
      },
      "unii": "2B668TJX8E"
    }
  ]
}