{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "53a481f5-8db6-4256-aa6b-6e9caf63faa2", "code": "194655-98-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=194655-98-6", "code_system": "CAS", "references": [ "4b0b28fe-b457-4f7e-b9e9-6c7ede73fa15", "8227184c-7ec4-4f41-ba70-3bb1066a5444" ] }, { "uuid": "7fcc341d-af9f-424b-a868-75df3b6a1973", "code": "10935343", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10935343", "code_system": "PUBCHEM", "references": [ "4b0b28fe-b457-4f7e-b9e9-6c7ede73fa15" ] }, { "uuid": "dc5a211b-1f3a-803c-e12a-07bf6d55c555", "code": "DTXSID70448975", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70448975", "code_system": "EPA CompTox" }, { "uuid": "108564fc-c8b4-4bd0-aaf0-68b65bb91083", "code": "2A63N2W5T4", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "8227184c-7ec4-4f41-ba70-3bb1066a5444" ] } ], "substance_class": "chemical", "names": [ { "uuid": "90ced1df-e5b9-4ef3-a74f-ffdca0f00e0f", "name": "4,4'-Bis(N-ethyl-N-methylamino)benzophenone", "stdName": "4,4'-BIS(N-ETHYL-N-METHYLAMINO)BENZOPHENONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e580bf32-6835-4842-9548-92735f63c11e" ], "display_name": false }, { "uuid": "df568cb5-ee57-4901-bd3b-2eccdcfea5a7", "name": "4,4′-Bis(ethylmethylamino)benzophenone", "stdName": "4,4'-BIS(ETHYLMETHYLAMINO)BENZOPHENONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8227184c-7ec4-4f41-ba70-3bb1066a5444" ], "display_name": true }, { "uuid": "aefa7e57-03b1-4c32-880b-96a1d3427f7c", "name": "Bis[4-(ethylmethylamino)phenyl]methanone", "stdName": "BIS(4-(ETHYLMETHYLAMINO)PHENYL)METHANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8227184c-7ec4-4f41-ba70-3bb1066a5444" ], "display_name": false }, { "uuid": "84838d48-6e1a-4338-9224-6560913176e9", "name": "Methanone, bis[4-(ethylmethylamino)phenyl]-", "stdName": "METHANONE, BIS(4-(ETHYLMETHYLAMINO)PHENYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "19a4f1ef-c0c6-47e0-bdc2-072960b2347a" ], "display_name": false } ], "references": [ { "uuid": "19a4f1ef-c0c6-47e0-bdc2-072960b2347a", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4b0b28fe-b457-4f7e-b9e9-6c7ede73fa15", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392093000, "tags": [ "NOMEN" ] }, { "uuid": "8227184c-7ec4-4f41-ba70-3bb1066a5444", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "e580bf32-6835-4842-9548-92735f63c11e", "citation": "PUBCHEM", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10935343", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "933782c8-e6e0-489d-a87f-3d35d406e9c4", "id": "933782c8-e6e0-489d-a87f-3d35d406e9c4", "molfile": "\n Marvin 01132107382D \n\n 22 23 0 0 0 0 999 V2000\n 0.0000 -2.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7133 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4352 -2.4837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4352 -3.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1485 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8618 -2.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5837 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5837 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8618 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1485 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0102 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0102 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7321 -2.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4455 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4455 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7321 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1588 -2.4837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1588 -3.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8806 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5939 -2.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 11 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 2 0 0 0 0\n 14 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 19 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "CCN(C)c1ccc(cc1)C(=O)c2ccc(cc2)N(C)CC", "formula": "C19H24N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c15c4565-2df0-4ebd-8c36-dee6268ac743" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "296.4074", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c3a6345a-f67d-4c26-acdb-fc71268d2fd2", "version": "6", "structure": { "id": "cf673630-4ad7-4774-bf44-9d9014f0ccb6", "molfile": "\n Marvin 01132110432D \n\n 22 23 0 0 0 0 999 V2000\n 4.2970 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0102 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5837 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1485 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4455 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4352 -2.4837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1588 -2.4837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2970 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5837 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7321 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0102 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8618 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7321 -2.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8618 -2.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4455 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1485 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7133 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8806 -2.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1588 -3.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4352 -3.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5939 -2.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 1 8 2 0 0 0 0\n 2 10 1 0 0 0 0\n 2 11 2 0 0 0 0\n 3 9 2 0 0 0 0\n 3 12 1 0 0 0 0\n 4 16 1 0 0 0 0\n 4 6 1 0 0 0 0\n 4 14 2 0 0 0 0\n 5 15 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 13 2 0 0 0 0\n 6 17 1 0 0 0 0\n 6 20 1 0 0 0 0\n 7 18 1 0 0 0 0\n 7 19 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 15 2 0 0 0 0\n 11 13 1 0 0 0 0\n 12 16 2 0 0 0 0\n 17 21 1 0 0 0 0\n 18 22 1 0 0 0 0\nM END", "smiles": "CCN(C)c1ccc(cc1)C(=O)c2ccc(cc2)N(C)CC", "formula": "C19H24N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "296.4074", "optical_activity": "NONE", "references": [ "19a4f1ef-c0c6-47e0-bdc2-072960b2347a" ], "stereo_centers": 0 }, "unii": "2A63N2W5T4" } ] }