{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "20570514-0537-4c87-a08d-68a5156f0472",
          "code": "6380-28-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6380-28-5",
          "code_system": "CAS",
          "references": [
            "af971e13-693f-421f-8fb6-bd2e6aa36574",
            "b69e6c88-007f-4bd4-ba2c-a9bc47dbb13e"
          ]
        },
        {
          "uuid": "869de959-f6c3-4449-a48e-1aba98bf290a",
          "code": "228-963-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.331",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "af971e13-693f-421f-8fb6-bd2e6aa36574"
          ]
        },
        {
          "uuid": "850b015a-2df9-4347-ac79-6ac9595c8275",
          "code": "80792",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/80792",
          "code_system": "PUBCHEM",
          "references": [
            "af971e13-693f-421f-8fb6-bd2e6aa36574"
          ]
        },
        {
          "uuid": "37144e56-0a19-4b7c-bdda-d76b4820956b",
          "code": "2A2BR75B36",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "63925ab7-2268-1865-c721-7ec4d5e2f9d0",
          "code": "DTXSID40863777",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40863777",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "23dff062-b68a-37d5-b80b-7039a351e954",
          "code": "6601",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6601",
          "code_system": "NSC",
          "references": [
            "d7f34e25-fddf-c79d-7801-3421c9f96f46"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ad15f43f-f4ca-465c-a6e0-ec83ba4675cb",
          "name": "5-ISOPROPYL-O-TOLYL ACETATE",
          "stdName": "5-ISOPROPYL-O-TOLYL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "628ba60f-2fee-45ff-9fc5-087083a98558"
          ],
          "display_name": false
        },
        {
          "uuid": "d50d0f75-37b4-4189-9036-fb2e8bc68ea5",
          "name": "CARVACRYL ACETATE",
          "stdName": "CARVACRYL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4073ac24-aceb-44d7-abe8-36bde99b7e18"
          ],
          "display_name": true
        },
        {
          "uuid": "f687cc16-2380-5071-9764-70fbf781e434",
          "name": "NSC-6601",
          "stdName": "NSC-6601",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7f34e25-fddf-c79d-7801-3421c9f96f46"
          ],
          "display_name": false
        },
        {
          "uuid": "7699a844-5b8c-4e1c-9392-1f907884dc4b",
          "name": "PHENOL, 2-METHYL-5-(1-METHYLETHYL)-, ACETATE",
          "stdName": "PHENOL, 2-METHYL-5-(1-METHYLETHYL)-, ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4073ac24-aceb-44d7-abe8-36bde99b7e18"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "628ba60f-2fee-45ff-9fc5-087083a98558",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4073ac24-aceb-44d7-abe8-36bde99b7e18",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af971e13-693f-421f-8fb6-bd2e6aa36574",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392180000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12a48123-adaf-4ab5-abc0-0c838ddf908c",
          "citation": "SRS import [2A2BR75B36]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2A2BR75B36",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392180000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7f34e25-fddf-c79d-7801-3421c9f96f46",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b69e6c88-007f-4bd4-ba2c-a9bc47dbb13e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cc012c25-1129-44e0-94c5-1e3a73340448",
          "id": "cc012c25-1129-44e0-94c5-1e3a73340448",
          "molfile": "\n  Marvin  01132110322D          \n\n 14 14  0  0  0  0            999 V2000\n    0.0000   -1.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -1.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -2.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4313   -1.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4313   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -1.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -1.6515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -1.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0046   -1.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -0.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470   -1.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 14  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n  9 10  1  0  0  0  0\n 14  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
          "smiles": "CC(C)c1ccc(C)c(c1)OC(=O)C",
          "formula": "C12H16O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9c618586-792e-4593-ba75-f42de4eaef27"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "192.2547",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7603bcbd-8380-4d98-a309-3b88eb5f9eb8",
      "version": "5",
      "structure": {
        "id": "c117b34c-d0ba-47bc-b67d-d2b72ec7b9ba",
        "molfile": "\n  Marvin  01132109592D          \n\n 14 14  0  0  0  0            999 V2000\n    1.4313   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4313   -1.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470   -1.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -1.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -1.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -2.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -1.6515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -1.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0046   -1.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -0.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  8  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4 11  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
        "smiles": "CC(C)c1ccc(C)c(c1)OC(=O)C",
        "formula": "C12H16O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "192.2547",
        "optical_activity": "NONE",
        "references": [
          "12a48123-adaf-4ab5-abc0-0c838ddf908c",
          "628ba60f-2fee-45ff-9fc5-087083a98558"
        ],
        "stereo_centers": 0
      },
      "unii": "2A2BR75B36"
    }
  ]
}