{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "83700f7a-8575-4064-85b7-c622531591ef",
          "code": "D11AX08",
          "comments": "ATC|DERMATOLOGICALS|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Other dermatologicals|tiratricol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D11AX08&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "9f446a41-25b6-4017-9141-558b1d8c1d63",
          "code": "H03AA04",
          "comments": "ATC|SYSTEMIC HORMONAL PREPARATIONS, EXCL. SEX HORMONES AND INSULINS|THYROID THERAPY|THYROID PREPARATIONS|Thyroid hormones|tiratricol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=H03AA04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "a34c33d9-df68-47fc-b362-c3c0b259fd0f",
          "code": "QH03AA04",
          "comments": "VATC|THYROID THERAPY|THYROID PREPARATIONS|Thyroid hormones|tiratricol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QH03AA04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "e844630a-30c4-4288-91bc-4c0848fb58ec",
          "code": "51-24-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51-24-1",
          "code_system": "CAS",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2",
            "936b901a-1ca4-444e-a20b-c8eba4ec1b29"
          ]
        },
        {
          "uuid": "b3d14946-fc2d-4416-ad14-6c95f7ffefba",
          "code": "C66605",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66605",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "4166096a-2846-4d97-965e-a45d456b4491",
          "code": "C010642",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67010642",
          "code_system": "MESH",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "c6b8bd12-dfc2-4af9-91c0-0dbd7f41d715",
          "code": "TIRATRICOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tiratricol",
          "code_system": "WIKIPEDIA",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "047b0876-ec32-404c-a6dd-a1dd5b81cfbd",
          "code": "QD11AX08",
          "comments": "VATC|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Other dermatologicals|tiratricol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD11AX08&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "4bd9d53b-cc1c-4140-bc3f-4aefaa9bfc5b",
          "code": "SUB11116MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "fc675439-cb8b-4fb1-9c64-ab1cab721b65",
          "code": "4368",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4368",
          "code_system": "INN",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "38ee90b9-4a9a-46e8-aa01-60ab8890af9b",
          "code": "200-086-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.079",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "975a6eed-b943-4e03-9aab-52901217af0e",
          "code": "13982",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/13982/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "ca42fc3e-48c9-41cb-891c-ba158efcc42f",
          "code": "m10888",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10888?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "465df05d-290e-472f-ba47-188841fbb8fc",
          "code": "CHEMBL41632",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL41632",
          "code_system": "ChEMBL",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "413fc9b2-dd33-4e10-a38c-11134b861b17",
          "code": "5803",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5803",
          "code_system": "PUBCHEM",
          "references": [
            "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2"
          ]
        },
        {
          "uuid": "7f33e06d-7afd-4285-1987-34102c33a28f",
          "code": "862421",
          "comments": "ORPHAN DRUG|Designated|Treatment of Resistance to Thyroid Hormone Type Beta (RTH-Beta)",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=862421",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "795db824-8cd5-2902-8f52-a72afd8664cc"
          ]
        },
        {
          "uuid": "51517f33-2d77-638d-79ee-38a4ab2e9871",
          "code": "DTXSID2045232",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2045232",
          "code_system": "EPA CompTox",
          "references": [
            "53b8e440-ea8f-843d-56fb-e28ecd0bd607"
          ]
        },
        {
          "uuid": "d181f0b4-b974-b114-86ee-5f22c3669a8d",
          "code": "46890",
          "comments": "ORPHAN DRUG|Designated|For use in combination with levo-thyroxine to suppress thyroid stimulating hormone in patients with well-differentiated thyroid cancer who are intolerant to adequate doses of levo-thyroxine alone.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=46890",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "c2057fe5-4cfe-4ce1-29f5-a24799456abd",
          "code": "C1553",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Thyroid Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1553",
          "code_system": "NCI_THESAURUS",
          "references": [
            "795db824-8cd5-2902-8f52-a72afd8664cc"
          ]
        },
        {
          "uuid": "04b09543-524f-4584-265d-0cb20a3e0605",
          "code": "137200",
          "comments": "ORPHAN DRUG|Designated|Treatment of well-differentiated papillary, follicular or combined papillary/follicular carcinomas of the thyroid gland.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=137200",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "2ae57b64-a3d1-4a74-2a93-0036a69209cb",
          "code": "666618",
          "comments": "ORPHAN DRUG|Designated|Treatment of Monocarboxylate 8 Transporter (MCT8) Deficiency (Allan-Herndon-Dudley-Syndrome)",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=666618",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "795db824-8cd5-2902-8f52-a72afd8664cc"
          ]
        },
        {
          "uuid": "c268f6af-450d-ab16-aebd-687afc5d3861",
          "code": "EU/3/17/1945",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of Allan-Herndon-Dudley syndrome",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3171945",
          "code_system": "EU-Orphan Drug",
          "references": [
            "795db824-8cd5-2902-8f52-a72afd8664cc"
          ]
        },
        {
          "uuid": "019de04c-5358-40a6-b80d-8c23ae591c35",
          "code": "29OQ9EU4R1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1fbc8cf4-e086-492e-a613-1076e58a0b42",
          "code": "DB03604",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03604",
          "code_system": "DRUG BANK",
          "references": [
            "795db824-8cd5-2902-8f52-a72afd8664cc"
          ]
        },
        {
          "uuid": "78e0f420-0855-294b-6720-710cbe5d76f2",
          "code": "3611",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3611",
          "code_system": "DRUG CENTRAL",
          "references": [
            "795db824-8cd5-2902-8f52-a72afd8664cc"
          ]
        },
        {
          "uuid": "7469f21b-f20d-435d-d713-c6f828cee11a",
          "code": "100000077266",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "79380f9f-cb98-43f6-388c-680482228eff"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2565cfa7-6830-417d-8f87-ca25375c3727",
          "amount": {
            "uuid": "3f571985-f032-49cc-88fd-ad448771ee27"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "30db9cba-4cce-4a28-ad59-896918020503",
            "refuuid": "b98c5197-201c-4099-81b5-6637269d82f4",
            "name": "TIRATRICOL",
            "unii": "29OQ9EU4R1",
            "linking_id": "29OQ9EU4R1",
            "ref_pname": "TIRATRICOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a1d68d49-255f-4b2f-9828-74d8a3972083",
          "amount": {
            "uuid": "ce630dd9-3a78-4aa7-81e1-f929ca5455bb",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "d4afb91a-2ffd-492a-a189-c7b56def0f01",
            "0fede007-859f-436b-b969-3641dec63211"
          ],
          "related_substance": {
            "uuid": "11a0a5f7-034d-4673-af6e-5bc6ef5fc1e9",
            "refuuid": "0f69e182-a6e6-41a1-a4ae-cc1678fd96fe",
            "name": "LEVOTHYROXINE SODIUM",
            "unii": "9J765S329G",
            "linking_id": "9J765S329G",
            "ref_pname": "LEVOTHYROXINE SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "528dea2b-4800-4e1e-b9e7-9e34bf90995d",
          "amount": {
            "uuid": "b1e8ad9b-ec6d-42a1-ba96-12bbca080a48"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2241b715-eeae-4200-a20f-5f4536507c1d",
            "refuuid": "2472cfb2-8d7a-4b6b-ac72-cdd770f542ec",
            "name": "TIRATRICOL SODIUM",
            "unii": "3HK9045D54",
            "linking_id": "3HK9045D54",
            "ref_pname": "TIRATRICOL SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "17d4c8dd-4675-4bbf-8276-f9f23c1dc863",
          "amount": {
            "uuid": "dc5a0dab-785b-4323-ac52-dc0ad520c736",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.3
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "c7112661-ce7b-659e-9fc8-0eacf3eedcea"
          ],
          "related_substance": {
            "uuid": "c24fee35-dddb-44ef-b3d6-eadd29e9ed41",
            "refuuid": "380e19e9-df4c-4858-b7a5-9d0e55db6d9d",
            "name": "LIOTHYRONINE SODIUM",
            "unii": "GCA9VV7D2N",
            "linking_id": "GCA9VV7D2N",
            "ref_pname": "LIOTHYRONINE SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bbe583e8-fcc0-44b2-9143-20aead954f1b",
          "amount": {
            "uuid": "c099f943-0221-4f5c-9e58-2980ef7eac8a",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "d4259755-4b79-9a25-0c77-5879d165f4aa"
          ],
          "related_substance": {
            "uuid": "10a69d79-dd18-4c91-8134-cfc7202659c1",
            "refuuid": "0f69e182-a6e6-41a1-a4ae-cc1678fd96fe",
            "name": "LEVOTHYROXINE SODIUM",
            "unii": "9J765S329G",
            "linking_id": "9J765S329G",
            "ref_pname": "LEVOTHYROXINE SODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e6a5dc0f-13c1-4812-9b5e-be459eb7fed5",
          "name": "(4-(4-HYDROXY-3-IODOPHENOXY)-3,5-DIIODOPHENYL)ACETIC ACID",
          "stdName": "(4-(4-HYDROXY-3-IODOPHENOXY)-3,5-DIIODOPHENYL)ACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a91973f2-c293-485f-fc43-c4e8d2b9e744",
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970"
          ],
          "display_name": false
        },
        {
          "uuid": "50652816-e86e-4120-be91-f93599405d35",
          "name": "3,3',5-TRIIODOTHYROACETIC ACID",
          "stdName": "3,3',5-TRIIODOTHYROACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970",
            "4725b759-36bb-4b9f-9b1a-bb6da96e6046"
          ],
          "display_name": false
        },
        {
          "uuid": "82c757f2-b409-49e1-9ecf-dab92cf6dcc5",
          "name": "3,5,3'-TRIIODOTHYROACETATE",
          "stdName": "3,5,3'-TRIIODOTHYROACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56909895-5c70-46b0-a169-039b97108eb9",
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970"
          ],
          "display_name": false
        },
        {
          "uuid": "bb157ab8-10a0-4de3-b346-e2ac9d48e97b",
          "name": "BENZENEACETIC ACID, 4-(4-HYDROXY-3-IODOPHENOXY)-3,5-DIIODO-",
          "stdName": "BENZENEACETIC ACID, 4-(4-HYDROXY-3-IODOPHENOXY)-3,5-DIIODO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970",
            "4725b759-36bb-4b9f-9b1a-bb6da96e6046"
          ],
          "display_name": false
        },
        {
          "uuid": "1ba5dc39-8462-88ea-cad5-1444d57a0ba3",
          "name": "LEVOTHYROXINE SODIUM IMPURITY C [EP IMPURITY]",
          "stdName": "LEVOTHYROXINE SODIUM IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a91973f2-c293-485f-fc43-c4e8d2b9e744",
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970"
          ],
          "display_name": false
        },
        {
          "uuid": "becc260a-a243-cd32-8b37-b390a5afe8dc",
          "name": "LEVOTHYROXINE SODIUM IMPURITY [USP IMPURITY]",
          "stdName": "LEVOTHYROXINE SODIUM IMPURITY [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f74d5d63-2e59-44f6-8756-a1b3b51adc55",
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970"
          ],
          "display_name": false
        },
        {
          "uuid": "a4a3bc7d-b41c-73b8-11db-7aa596bad928",
          "name": "LIOTHYRONINE SODIUM IMPURITY C [EP IMPURITY]",
          "stdName": "LIOTHYRONINE SODIUM IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7112661-ce7b-659e-9fc8-0eacf3eedcea"
          ],
          "display_name": false
        },
        {
          "uuid": "80b92139-f669-4a0d-e16b-083acc6e3338",
          "name": "NSC-759294",
          "stdName": "NSC-759294",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e92bdee3-250e-f155-7423-99c11dd96548"
          ],
          "display_name": false
        },
        {
          "uuid": "69e3da03-4a95-4fc8-8e31-756184438ad3",
          "name": "T3-ACETIC ACID",
          "stdName": "T3-ACETIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f74d5d63-2e59-44f6-8756-a1b3b51adc55",
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970"
          ],
          "display_name": false
        },
        {
          "uuid": "becf6c93-17fc-c55e-fd14-159bb96b193a",
          "name": "T3-ACETIC ACID [USP IMPURITY]",
          "stdName": "T3-ACETIC ACID [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4259755-4b79-9a25-0c77-5879d165f4aa"
          ],
          "display_name": false
        },
        {
          "uuid": "664e0c02-1d9f-400f-847c-30b3e0eb6b95",
          "name": "TIRACANA",
          "stdName": "TIRACANA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "399b78cb-29cc-4be0-86a7-692e4f934b53",
            "550ff865-b052-43e5-92e1-2f29c3a02460"
          ],
          "display_name": false
        },
        {
          "uuid": "8a1a7d55-c2a3-4e9d-9e75-f59a47c27e40",
          "name": "TIRATRICOL",
          "stdName": "TIRATRICOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffa94cd2-17ba-44b8-b46d-c002d454bafd",
            "174bb185-8edf-4904-aab5-6f38e75d0c52",
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970",
            "b7e6d792-41e3-4d5b-bc95-db2f8b84740d",
            "19669894-319a-4ac5-92d9-286a2f3da710",
            "6b6b8a86-8c8b-481e-a317-6f98864d1dc5",
            "737db8dd-00fd-4b52-a8f0-4047848f7e0a",
            "5e033e59-fad0-4ffd-a829-c2625b39d117",
            "a760ce0f-dd4b-4c79-a7ca-3e120ae0158b",
            "9a25dc9f-a69c-4a27-ad7d-e73f9d3039cf"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "6e6ace9b-518b-4cfb-9729-4127f8b268c3",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d3e329f6-6494-46d5-b30e-ec61f892ba1d",
          "name": "TIRATRICOL [MART.]",
          "stdName": "TIRATRICOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "737db8dd-00fd-4b52-a8f0-4047848f7e0a"
          ],
          "display_name": false
        },
        {
          "uuid": "5832de24-bcbf-4b69-b450-f9abdd06aa42",
          "name": "TIRATRICOL [MI]",
          "stdName": "TIRATRICOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a760ce0f-dd4b-4c79-a7ca-3e120ae0158b",
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970"
          ],
          "display_name": false
        },
        {
          "uuid": "a494f3a7-045f-4c33-a2b9-e23ef5ad1515",
          "name": "TIRATRICOL [WHO-DD]",
          "stdName": "TIRATRICOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970",
            "19669894-319a-4ac5-92d9-286a2f3da710"
          ],
          "display_name": false
        },
        {
          "uuid": "4eac409d-704d-47b9-ab4a-25cde761c1c6",
          "name": "TRIIODOTHYROACETIC ACID",
          "stdName": "TRIIODOTHYROACETIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f74d5d63-2e59-44f6-8756-a1b3b51adc55",
            "78b27a7e-eabc-4e88-ae57-a154fb4fe970"
          ],
          "display_name": false
        },
        {
          "uuid": "95865923-755a-ce30-0c93-9e04f37173fc",
          "name": "TRIIODOTHYROACETIC ACID [USP IMPURITY]",
          "stdName": "TRIIODOTHYROACETIC ACID [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4259755-4b79-9a25-0c77-5879d165f4aa"
          ],
          "display_name": false
        },
        {
          "uuid": "0307cc9f-9bd5-4c47-8529-2ae912a1d279",
          "name": "tiratricol [INN]",
          "stdName": "TIRATRICOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e033e59-fad0-4ffd-a829-c2625b39d117"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d4259755-4b79-9a25-0c77-5879d165f4aa",
          "citation": "USP42-NF37 - 2561, Levothyroxine Sodium Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c7112661-ce7b-659e-9fc8-0eacf3eedcea",
          "citation": "European Pharmacopoeia Online 9.8, Liothyronine Sodium Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d4afb91a-2ffd-492a-a189-c7b56def0f01",
          "citation": "EP 7.8 LEVOTHYROXINE SODIUM MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0fede007-859f-436b-b969-3641dec63211",
          "citation": "European Pharmacopoeia Online 9.8, Levothyroxine Sodium Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4725b759-36bb-4b9f-9b1a-bb6da96e6046",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "78b27a7e-eabc-4e88-ae57-a154fb4fe970",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b6b8a86-8c8b-481e-a317-6f98864d1dc5",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e033e59-fad0-4ffd-a829-c2625b39d117",
          "citation": "INN Proposed List 39",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL39.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "737db8dd-00fd-4b52-a8f0-4047848f7e0a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a760ce0f-dd4b-4c79-a7ca-3e120ae0158b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "550ff865-b052-43e5-92e1-2f29c3a02460",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "399b78cb-29cc-4be0-86a7-692e4f934b53",
          "citation": "D07214",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19669894-319a-4ac5-92d9-286a2f3da710",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "865feffd-6c1d-40ea-a68f-c836af40a926",
          "citation": "EP 7.8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2fd56e7-d12c-4b99-8222-e08131b08a71",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f74d5d63-2e59-44f6-8756-a1b3b51adc55",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56909895-5c70-46b0-a169-039b97108eb9",
          "citation": "ORPHAN DRUG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bba48bb4-adce-42b6-8eef-3cfe48f2e3f2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83641eb5-7dbb-4741-960a-698c7bdfd744",
          "citation": "SRS import [29OQ9EU4R1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=29OQ9EU4R1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55177656-5df3-497f-8dbf-e85ab1c06aa8",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "174bb185-8edf-4904-aab5-6f38e75d0c52",
          "citation": "TIRATRICOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ffa94cd2-17ba-44b8-b46d-c002d454bafd",
          "citation": "TIRATRICOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9a25dc9f-a69c-4a27-ad7d-e73f9d3039cf",
          "citation": "TIRATRICOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7e6d792-41e3-4d5b-bc95-db2f8b84740d",
          "citation": "TIRATRICOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53b8e440-ea8f-843d-56fb-e28ecd0bd607",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51-24-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "79380f9f-cb98-43f6-388c-680482228eff",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "795db824-8cd5-2902-8f52-a72afd8664cc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a91973f2-c293-485f-fc43-c4e8d2b9e744",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "936b901a-1ca4-444e-a20b-c8eba4ec1b29",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e92bdee3-250e-f155-7423-99c11dd96548",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9ae563a8-d1b6-4eb7-b7a5-089d4c9b7e6e",
          "id": "9ae563a8-d1b6-4eb7-b7a5-089d4c9b7e6e",
          "molfile": "\n  Marvin  01132108032D          \n\n 21 22  0  0  0  0            999 V2000\n    0.8224   -2.6377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8327   -1.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1138   -1.3887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5465   -1.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2628   -1.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2525   -2.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9610   -3.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9532   -3.9023    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6928   -2.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3859   -3.0903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1048   -2.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1177   -1.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8341   -1.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5530   -1.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2667   -1.4663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5375   -2.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2564   -3.1214    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8212   -3.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6851   -1.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4143   -1.4430    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9791   -1.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 21  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 19  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 18 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1Oc2c(cc(cc2I)CC(=O)O)I)I)O",
          "formula": "C14H9I3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b4f09a6f-aaf2-447a-b476-1af0e0c6feec"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "621.9328",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b98c5197-201c-4099-81b5-6637269d82f4",
      "version": "27",
      "structure": {
        "id": "88318f8d-e28a-4d8e-9862-5116f6c25c5f",
        "molfile": "\n  Marvin  01132107042D          \n\n 21 22  0  0  0  0            999 V2000\n    3.6928   -2.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9610   -3.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6851   -1.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3859   -3.0903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2628   -1.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5375   -2.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8212   -3.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8327   -1.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2525   -2.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9791   -1.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1048   -2.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5530   -1.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8224   -2.6377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5465   -1.4094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8341   -1.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9532   -3.9023    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4143   -1.4430    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2564   -3.1214    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1177   -1.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1138   -1.3887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2667   -1.4663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8 14  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  3  2  0  0  0  0\n 11  4  1  0  0  0  0\n 12 15  2  0  0  0  0\n 13  8  2  0  0  0  0\n 14  5  1  0  0  0  0\n 15 19  1  0  0  0  0\n 16  2  1  0  0  0  0\n 17  3  1  0  0  0  0\n 18  6  1  0  0  0  0\n 19 11  2  0  0  0  0\n 20  8  1  0  0  0  0\n 21 12  1  0  0  0  0\n  5  9  2  0  0  0  0\n  6 12  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1Oc2c(cc(cc2I)CC(=O)O)I)I)O",
        "formula": "C14H9I3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "621.9328",
        "optical_activity": "NONE",
        "references": [
          "55177656-5df3-497f-8dbf-e85ab1c06aa8",
          "83641eb5-7dbb-4741-960a-698c7bdfd744",
          "5e033e59-fad0-4ffd-a829-c2625b39d117"
        ],
        "stereo_centers": 0
      },
      "unii": "29OQ9EU4R1"
    }
  ]
}