{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e34803da-189e-455b-a1ac-c3643232ba5b",
          "code": "12264-18-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=12264-18-5",
          "code_system": "CAS",
          "references": [
            "89e7e810-f8ca-4f25-98fa-b6e3e0294fe1",
            "e395c203-0c49-4bf1-bc90-d92f70865db7"
          ]
        },
        {
          "uuid": "674985bd-86ee-40c7-9d5c-701c8aba2427",
          "code": "235-534-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.032.291",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "89e7e810-f8ca-4f25-98fa-b6e3e0294fe1"
          ]
        },
        {
          "uuid": "62be7abc-dcbb-e4e5-cace-0fb1d39cb97b",
          "code": "25544",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25544",
          "code_system": "PUBCHEM",
          "references": [
            "5bf2ec34-1e4a-fcc5-435e-da355baeaff9"
          ]
        },
        {
          "uuid": "88d1f8e9-a407-4ba4-8f4e-b8099f2c1ffe",
          "code": "29C51EJ640",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9f5e446d-c2f6-94ad-b601-bc2f87283b7d",
          "code": "132317",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:132317",
          "code_system": "CHEBI",
          "references": [
            "a501c714-64e2-f1d8-a75d-417e86d659de"
          ]
        },
        {
          "uuid": "06e96369-2adf-04ba-0e72-c5eef66fe970",
          "code": "DTXSID901035102",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901035102",
          "code_system": "EPA CompTox",
          "references": [
            "a501c714-64e2-f1d8-a75d-417e86d659de"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d373ebdc-ae3a-49a7-ad9c-ed6e967893fe",
          "amount": {
            "uuid": "4791be1b-cfe4-449e-95ee-ce4ddc464139"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "5db72232-e3bb-4f29-be1e-480cb6fa9f6d",
            "refuuid": "4daf125d-b81a-4a47-ae79-9ff0fbeca136",
            "name": "Edetic Acid",
            "unii": "9G34HU7RV0",
            "linking_id": "9G34HU7RV0",
            "ref_pname": "Edetic Acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "53d508f3-b163-46fa-aef1-a511eb2d2237",
          "name": "Calciate(2-), [[N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, hydrogen (1:2), (OC-6-21)-",
          "stdName": "CALCIATE(2-), ((N,N'-1,2-ETHANEDIYLBIS(N-((CARBOXY-.KAPPA.O)METHYL)GLYCINATO-.KAPPA.N,.KAPPA.O))(4-))-, HYDROGEN (1:2), (OC-6-21)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e031d700-02b4-4d69-a139-31e4b7dcffb5"
          ],
          "display_name": false
        },
        {
          "uuid": "ec791468-0a1e-47e5-81b9-660ea74f73d6",
          "name": "Calcium ethylenediaminetetraacetate",
          "stdName": "CALCIUM ETHYLENEDIAMINETETRAACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff1508ce-54a3-4cf7-9ad2-1753d4f727de"
          ],
          "display_name": false
        },
        {
          "uuid": "70864a70-f721-4ab0-a577-3ade39cc312d",
          "name": "Edetate monocalcium",
          "stdName": "EDETATE MONOCALCIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2eff747-581b-42f1-b92b-8e57aa7d5baa"
          ],
          "display_name": true
        },
        {
          "uuid": "95a31830-a18a-493f-b838-b79dc381bb1e",
          "name": "Ethylenediaminetetraacetic acid monocalcium salt",
          "stdName": "ETHYLENEDIAMINETETRAACETIC ACID MONOCALCIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e031d700-02b4-4d69-a139-31e4b7dcffb5"
          ],
          "display_name": false
        },
        {
          "uuid": "aadfdae5-39e5-4980-a1c0-f575f45faf7c",
          "name": "Glycine, N,N′-1,2-ethanediylbis[N-(carboxymethyl)-, calcium salt (1:1)",
          "stdName": "GLYCINE, N,N'-1,2-ETHANEDIYLBIS(N-(CARBOXYMETHYL)-, CALCIUM SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e031d700-02b4-4d69-a139-31e4b7dcffb5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ff1508ce-54a3-4cf7-9ad2-1753d4f727de",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c2eff747-581b-42f1-b92b-8e57aa7d5baa",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e031d700-02b4-4d69-a139-31e4b7dcffb5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89e7e810-f8ca-4f25-98fa-b6e3e0294fe1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392031000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "242b325c-be8f-4f42-971f-dd7628ab89b0",
          "citation": "SRS import [29C51EJ640]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=29C51EJ640",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392031000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bf2ec34-1e4a-fcc5-435e-da355baeaff9",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "e395c203-0c49-4bf1-bc90-d92f70865db7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a501c714-64e2-f1d8-a75d-417e86d659de",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "34fc0bd6-05c2-4977-921c-3f8eae9789a6",
          "id": "34fc0bd6-05c2-4977-921c-3f8eae9789a6",
          "molfile": "\n  CDK     12292308582D\n\n 20 19  0  0  0  0  0  0  0  0999 V2000\n   24.8226   -7.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1737   -8.0859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4715   -8.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1207   -7.3059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1207   -5.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7696   -4.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7696   -3.4061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4186   -5.7459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7696   -8.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4186   -7.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0677   -8.0859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0677   -9.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7167  -10.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7167  -11.9859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3656   -9.6459    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.7167   -7.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7167   -5.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0677   -4.9661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3656   -4.9661    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   24.8226   -5.7459    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20  1  1  0  0  0  0\nM  CHG  1  15  -1\nM  CHG  1  19  -1\nM  CHG  1  20  -1\nM  END",
          "smiles": "C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)[O-]",
          "formula": "C10H13N2O8",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "77d693df-10ab-4835-94c3-876ce8f1ee3c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "289.2192",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e72c9405-6332-4a62-a208-0736313060c7",
          "id": "e72c9405-6332-4a62-a208-0736313060c7",
          "molfile": "\n  CDK     12292308582D\n\n  1  0  0  0  0  0  0  0  0  0999 V2000\n   30.2253   -6.5675    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8ffe585c-6501-4453-a682-0975996120ae"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e74f34d4-c6f3-46d4-9ac2-16451b2a28d3",
      "version": "8",
      "structure": {
        "id": "b9121ed6-cc3b-4d21-ac9f-6afa97ba83ac",
        "molfile": "\n   JSDraw212292308582D\n\n 21 19  0  0  0  0              0 V2000\n   24.8226   -7.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1737   -8.0859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4715   -8.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1207   -7.3059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1207   -5.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7696   -4.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7696   -3.4061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4186   -5.7459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7696   -8.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4186   -7.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0677   -8.0859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0677   -9.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7167  -10.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7167  -11.9859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3656   -9.6459    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.7167   -7.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7167   -5.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0677   -4.9661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3656   -4.9661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8226   -5.7459    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   30.2253   -6.5675    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20  1  1  0  0  0  0\nM  CHG  3  15  -1  20  -1  21   2\nM  END",
        "smiles": "C(CN(CC(=O)O)CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].[Ca+2]",
        "formula": "C10H14N2O8.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "330.3052",
        "optical_activity": "NONE",
        "references": [
          "ff1508ce-54a3-4cf7-9ad2-1753d4f727de",
          "242b325c-be8f-4f42-971f-dd7628ab89b0"
        ],
        "stereo_centers": 0
      },
      "unii": "29C51EJ640"
    }
  ]
}