{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "013c461a-48d8-43ae-8166-3a7e42b2ced2", "code": "126050-54-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=126050-54-2", "code_system": "CAS", "references": [ "1a5edc3e-1665-46a1-8384-2d7e0985ee46", "5293e719-5a59-4abf-818b-80a5fe035c74" ] }, { "uuid": "5b4e33b7-aa97-4f11-872f-75c4417e16ac", "code": "FCN NO. 58", "comments": "FCN|ANTIOXIDANT|STYRENE-BUTADIENE BLOCK POLYMERS", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=58", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "1a5edc3e-1665-46a1-8384-2d7e0985ee46" ] }, { "uuid": "7b62c08d-a700-493e-b243-30188517aae0", "code": "FCN NO, 21", "comments": "FCN|ANTIOXIDANT|POLYETHYLENE ARTICLES", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=21", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "1a5edc3e-1665-46a1-8384-2d7e0985ee46" ] }, { "uuid": "b722c5fa-eb20-41d7-b529-11007503167d", "code": "FCN NO. 20", "comments": "FCN|ANTIOXIDANT|LLDPE ARTICLES", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=20", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "1a5edc3e-1665-46a1-8384-2d7e0985ee46" ] }, { "uuid": "793d0c6a-add0-4386-9b26-e5b6a2dd8d5a", "code": "FCN NO. 192", "comments": "FCN|ANTIOXIDANT|POLYSTYRENE", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=192", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "1a5edc3e-1665-46a1-8384-2d7e0985ee46" ] }, { "uuid": "8e4dea48-293c-4851-8c8f-715288782289", "code": "FCN NO. 896", "comments": "FCN|ANTIOXIDANT OR STABILIZER|POLYMER", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=896", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "1a5edc3e-1665-46a1-8384-2d7e0985ee46" ] }, { "uuid": "b8986f29-7dea-494d-9747-5098c52cd131", "code": "19996246", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19996246", "code_system": "PUBCHEM", "references": [ "1a5edc3e-1665-46a1-8384-2d7e0985ee46" ] }, { "uuid": "b860bb24-d150-b29f-4824-268ce85f2466", "code": "DTXSID2051637", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2051637", "code_system": "EPA CompTox", "references": [ "0da0daab-a16b-b1cc-f1d4-02b39a12c5ae" ] }, { "uuid": "00d04a76-4b35-4db0-a8d0-a5da46fdbbc5", "code": "29A308ZN7P", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "3b079291-3256-4ebf-83f6-799907116616", "name": "12H-DIBENZO(D,G)(1,3,2)DIOXAPHOSPHOCIN, 2,4,8,10- TETRAKIS(1,1-DIMETHYLETHYL)-6-((2-ETHYLHEXYL)OXY)-", "stdName": "12H-DIBENZO(D,G)(1,3,2)DIOXAPHOSPHOCIN, 2,4,8,10- TETRAKIS(1,1-DIMETHYLETHYL)-6-((2-ETHYLHEXYL)OXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3b6e86ed-ee1a-447d-bbbc-f30be61984c6" ], "display_name": false }, { "uuid": "79918d1a-ec2b-4a5d-9b48-568ef216b5bf", "name": "2,2'-METHYLENEBIS(4,6-DI-TERT- BUTYLPHENYL) 2-ETHYLHEXYL PHOSPHITE", "stdName": "2,2'-METHYLENEBIS(4,6-DI-TERT- BUTYLPHENYL) 2-ETHYLHEXYL PHOSPHITE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "02808510-2f94-496b-a1d8-d8fe1175fa1a" ], "display_name": true }, { "uuid": "14f49c75-7674-4a87-87c2-5fe86cc65a3c", "name": "2,2'-METHYLENEBIS(4,6-DI-TERT-BUTYLPHENYL) 2-ETHYLHEXYL PHOSPHITE", "stdName": "2,2'-METHYLENEBIS(4,6-DI-TERT-BUTYLPHENYL) 2-ETHYLHEXYL PHOSPHITE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e618b948-cb3c-4bb6-a518-3dcec24f5d86" ], "display_name": false }, { "uuid": "5a81f3e5-1d79-44a5-929a-439ee277fe85", "name": "2,2'METHYLENEBIS(4,6-DI-TERT-BUTYLPHENYL) 2-ETHYLHEXYL PHOSPHITE", "stdName": "2,2'METHYLENEBIS(4,6-DI-TERT-BUTYLPHENYL) 2-ETHYLHEXYL PHOSPHITE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e618b948-cb3c-4bb6-a518-3dcec24f5d86" ], "display_name": false }, { "uuid": "1938873f-4967-464e-9472-04ee1090464b", "name": "2,4,8,10-TETRAKIS(1,1-DIMETHYLETHYL)-6-((2-ETHYLHEXYL)OXY)-12H-DIBENZO(D,G)(1,3,2)DIOXAPHOSPHOCIN", "stdName": "2,4,8,10-TETRAKIS(1,1-DIMETHYLETHYL)-6-((2-ETHYLHEXYL)OXY)-12H-DIBENZO(D,G)(1,3,2)DIOXAPHOSPHOCIN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "def2ad43-7539-418e-b9f4-d2999ba74f3f" ], "display_name": false } ], "references": [ { "uuid": "02808510-2f94-496b-a1d8-d8fe1175fa1a", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3b6e86ed-ee1a-447d-bbbc-f30be61984c6", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e618b948-cb3c-4bb6-a518-3dcec24f5d86", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "def2ad43-7539-418e-b9f4-d2999ba74f3f", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a5edc3e-1665-46a1-8384-2d7e0985ee46", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391756000, "tags": [ "NOMEN" ] }, { "uuid": "c6c8f8d8-21d0-4a11-93d1-5ab8809a95f2", "citation": "SRS import [29A308ZN7P]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=29A308ZN7P", "doc_type": "SRS", "public_domain": true, "document_date": 1493391756000, "tags": [ "NOMEN" ] }, { "uuid": "0da0daab-a16b-b1cc-f1d4-02b39a12c5ae", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126050-54-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5293e719-5a59-4abf-818b-80a5fe035c74", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "626982da-9a8b-454c-a09e-bc772cc4f11b", "id": "626982da-9a8b-454c-a09e-bc772cc4f11b", "molfile": "\n Marvin 01132105062D \n\n 41 43 0 0 0 0 999 V2000\n 3.9915 -3.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6757 -3.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8578 -3.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5421 -2.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7242 -2.2441 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.2219 -2.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4040 -2.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4084 -1.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5905 -1.3742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2748 -0.6120 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5502 -0.6120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1336 -0.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1336 0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5502 1.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2748 1.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4883 2.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2852 2.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8686 1.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6550 1.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8581 0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8581 -0.0287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2384 0.4265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8218 -0.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0249 -0.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0353 0.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4987 3.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9154 3.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7122 3.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2956 3.4005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8481 1.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5625 0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5625 -0.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8481 -0.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8481 -1.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1336 -1.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8481 -2.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5625 -1.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2770 1.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9915 1.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2770 2.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9915 0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 21 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 33 2 0 0 0 0\n 14 13 1 0 0 0 0\n 13 30 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 20 15 2 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 26 1 0 0 0 0\n 18 19 2 0 0 0 0\n 20 19 1 0 0 0 0\n 19 22 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 22 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 26 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 2 0 0 0 0\n 31 38 1 0 0 0 0\n 33 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 34 37 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 40 1 0 0 0 0\n 38 41 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COP1Oc2c(Cc3cc(cc(c3O1)C(C)(C)C)C(C)(C)C)cc(cc2C(C)(C)C)C(C)(C)C", "formula": "C37H59O3P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d48ea615-61d9-4f10-8ab3-235fc01225af" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "582.8377", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "a907c765-0cb3-4f9f-b0ce-803b6c27c5ac", "version": "4", "structure": { "id": "e2ef72e9-db57-486c-817e-0bbc1a95b1a0", "molfile": "\n Marvin 01132111452D \n\n 41 43 0 0 0 0 999 V2000\n -0.5502 -0.6120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2748 -0.6120 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8581 -0.0287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8581 0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2748 1.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5502 1.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1336 0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1336 -0.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4883 2.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2852 2.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8686 1.8067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6550 1.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8481 -0.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5625 -0.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5625 0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8481 1.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5905 -1.3742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4084 -1.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7242 -2.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5421 -2.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8578 -3.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6757 -3.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9915 -3.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2219 -2.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4040 -2.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2770 1.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9915 1.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2770 2.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9915 0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8481 -1.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1336 -1.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8481 -2.0912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5625 -1.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2384 0.4265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8218 -0.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0249 -0.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0353 0.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4987 3.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9154 3.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7122 3.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2956 3.4005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 1 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 4 12 2 0 0 0 0\n 5 9 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 7 16 2 0 0 0 0\n 8 13 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 19 24 1 0 0 0 0\n 17 18 1 0 0 0 0\n 2 17 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 1 0 0 0 0\n 26 29 1 0 0 0 0\n 15 26 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 32 1 0 0 0 0\n 30 33 1 0 0 0 0\n 13 30 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 34 37 1 0 0 0 0\n 12 34 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 40 1 0 0 0 0\n 38 41 1 0 0 0 0\n 10 38 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COP1Oc2c(Cc3cc(cc(c3O1)C(C)(C)C)C(C)(C)C)cc(cc2C(C)(C)C)C(C)(C)C", "formula": "C37H59O3P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "582.8377", "optical_activity": "( + / - )", "references": [ "c6c8f8d8-21d0-4a11-93d1-5ab8809a95f2", "3b6e86ed-ee1a-447d-bbbc-f30be61984c6" ], "stereo_centers": 1 }, "unii": "29A308ZN7P" } ] }