{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2dae0359-8110-4755-9314-646e3785152c",
          "code": "C01BA04",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|ANTIARRHYTHMICS, CLASS I AND III|Antiarrhythmics, class Ia|sparteine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01BA04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "6159ca2b-67c8-4106-9331-1780b98b5879",
          "code": "QC01BA04",
          "comments": "VATC|CARDIAC THERAPY|ANTIARRYTHMICS, CLASS I  AND III|Antiarrhythmics, class Ia|sparteine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01BA04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "1d8ca858-232f-47a4-b7ef-6d38ea62e3f5",
          "code": "90-39-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=90-39-1",
          "code_system": "CAS",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077",
            "0b2ec200-dd6e-4494-a201-787c63e22e19"
          ]
        },
        {
          "uuid": "692312ce-b9ea-4a36-983d-692027ae9563",
          "code": "D013034",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013034",
          "code_system": "MESH",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "b0ae3009-9f80-4532-b340-dd5c80d0f3c7",
          "code": "SPARTEINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sparteine",
          "code_system": "WIKIPEDIA",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "f0de6967-fe11-43da-b05e-242bb7278391",
          "code": "SUB10613MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "7aef0815-0c31-428b-8199-6d02f06f6ce7",
          "code": "1447",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1447",
          "code_system": "INN",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "dc5bdce2-436d-4af2-8576-e782f184e2f6",
          "code": "201-988-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.808",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "cad76b0a-c650-4e5a-8391-8fef70c8c05f",
          "code": "m10134",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10134?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "3e78ae33-d412-4f75-888f-009811788430",
          "code": "CHEMBL412873",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL412873",
          "code_system": "ChEMBL",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "83a6aac5-0a19-4c6a-9fe8-28c390cb3b90",
          "code": "644020",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/644020",
          "code_system": "PUBCHEM",
          "references": [
            "d8f9f796-a3d5-4018-98a5-98c76eab6077"
          ]
        },
        {
          "uuid": "3d75db42-a947-8317-9f0c-04bfc165c9dd",
          "code": "DTXSID4023591",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023591",
          "code_system": "EPA CompTox",
          "references": [
            "d84af28f-ba10-a18b-6aaf-286221106930"
          ]
        },
        {
          "uuid": "850dbdb8-1498-527a-9c6e-6e02a577cd95",
          "code": "C152414",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152414",
          "code_system": "NCI_THESAURUS",
          "references": [
            "81dd60f4-3ee0-1ccd-ed8f-edfa824c6316"
          ]
        },
        {
          "uuid": "ce65da20-4b20-d952-3ba6-219a4b7896f1",
          "code": "C47793",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Antiarrhythmic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47793",
          "code_system": "NCI_THESAURUS",
          "references": [
            "413473bb-ee0c-f36d-ce18-c14cb0e7935c"
          ]
        },
        {
          "uuid": "24fea4ca-a094-47c8-a387-f5ab834fa2c0",
          "code": "298897D62S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2131f17c-74e8-0d00-a45b-b64c2c2beab2",
          "code": "DB06727",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB06727",
          "code_system": "DRUG BANK",
          "references": [
            "413473bb-ee0c-f36d-ce18-c14cb0e7935c"
          ]
        },
        {
          "uuid": "37242589-be2a-fc8d-a127-6181c96a846e",
          "code": "2467",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2467",
          "code_system": "DRUG CENTRAL",
          "references": [
            "413473bb-ee0c-f36d-ce18-c14cb0e7935c"
          ]
        },
        {
          "uuid": "e0fd6182-47e5-c6f9-013b-c7f0f15ee7d0",
          "code": "28827",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28827",
          "code_system": "CHEBI",
          "references": [
            "413473bb-ee0c-f36d-ce18-c14cb0e7935c"
          ]
        },
        {
          "uuid": "a648c12e-b560-f427-91c8-b059cc8d04ea",
          "code": "100000083800",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4ef9eb52-a01e-16cd-235e-ede5c6d54835"
          ]
        },
        {
          "uuid": "ca6a9adf-5b84-2ac1-da88-0b9d5fd8f9e6",
          "code": "21 CFR 216.24",
          "comments": "PART 216 -- HUMAN DRUG COMPOUNDING|Subpart B--Compounded Drug Products|Sec. 216.24 Drug products withdrawn or removed from the market for reasons of safety or effectiveness.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=216.24",
          "code_system": "CFR",
          "references": [
            "a04295cc-161a-7911-b2c6-fd15056cf81d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8db51cf1-e4bd-4184-9c24-97db89e7e827",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "10a513ad-a441-4478-9fbf-af6725214fcc",
            "refuuid": "d38ddb82-ec5d-40a0-9a19-175384e550b0",
            "name": "SPARTEINE",
            "unii": "298897D62S",
            "linking_id": "298897D62S",
            "ref_pname": "SPARTEINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d7db1d04-40d6-4043-b9f2-3def97dba0cc",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "0a031947-2427-42f8-955d-ac777e63b6bc",
            "refuuid": "b75739d2-649d-4c92-bb47-e728645f3524",
            "name": "SPARTEINE SULFATE",
            "unii": "GQ3J2TLZ7E",
            "linking_id": "GQ3J2TLZ7E",
            "ref_pname": "SPARTEINE SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "22165500-2f7a-432f-b460-1b6cd18bce3a",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "243e8e24-be11-4f39-b250-f1ed3b1d3134",
            "refuuid": "2ff672a8-bcbc-4589-a55c-eff701f0eed4",
            "name": "SPARTEINE SULFATE ANHYDROUS",
            "unii": "3D76XVF9R0",
            "linking_id": "3D76XVF9R0",
            "ref_pname": "SPARTEINE SULFATE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6fa17251-1012-4cff-9ebb-12299fe17a57",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "975c9738-31f4-427f-9866-3c2218d93a1c"
          ],
          "related_substance": {
            "uuid": "d0927d7c-5699-4057-85a6-b4d0f8e6d8fd",
            "refuuid": "5f7bc98c-4527-4bf1-aa98-0d29b0538516",
            "name": "CYTISUS SCOPARIUS FLOWERING TOP",
            "unii": "XZC6H8R666",
            "linking_id": "XZC6H8R666",
            "ref_pname": "CYTISUS SCOPARIUS FLOWERING TOP",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1af3234b-7d13-4bdf-b819-1b7a07e825bb",
          "name": "6-BETA,7-ALPHA,9-ALPHA,11-ALPHA-PACHYCARPINE",
          "stdName": "6-BETA,7-ALPHA,9-ALPHA,11-ALPHA-PACHYCARPINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cb59d79-2dc5-425b-bb94-ed16e8bf60a9"
          ],
          "display_name": false
        },
        {
          "uuid": "11278c64-2846-4c34-b3c1-7360b971b16e",
          "name": "7,14-METHANO-2H,6H-DIPYRIDO(1,2-A:1',2'-E)(1,5)DIAZOCINE, DODECAHYDRO-, (7S,7AR,14S,14AS)",
          "stdName": "7,14-METHANO-2H,6H-DIPYRIDO(1,2-A:1',2'-E)(1,5)DIAZOCINE, DODECAHYDRO-, (7S,7AR,14S,14AS)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38f89db5-eac0-4406-a4cf-3fc9defeffda"
          ],
          "display_name": false
        },
        {
          "uuid": "1b0f3800-15f2-4f6c-b3fb-473562c85200",
          "name": "SPARTEINE",
          "stdName": "SPARTEINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "513d0f3e-5c85-46e2-9ff0-ca1517c47838",
            "7844a66d-8cb7-4b67-a0c9-559d16934838",
            "1f14fe4b-df0d-4475-a031-b60b009d8d61",
            "1fc3ab49-740e-41cf-90c8-75a85171dca0",
            "401cce16-13d9-4f44-9fd8-01fceef6492d",
            "2ef40cbd-c589-4e3f-be15-c86658c11cc2",
            "6221fbc0-afc1-4a12-a252-cc922bdced00"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "094f2ddf-b9c8-41e4-b5cb-587b6d3bde7d",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ad3fa858-d735-42f3-b64c-f1878a914cf6",
          "name": "SPARTEINE [MI]",
          "stdName": "SPARTEINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6221fbc0-afc1-4a12-a252-cc922bdced00"
          ],
          "display_name": false
        },
        {
          "uuid": "9ab42ad2-1afd-26c1-879e-e0d3d7028d00",
          "name": "Sparteine [WHO-DD]",
          "stdName": "SPARTEINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99334964-9496-e35b-579e-0fa8c6e48283"
          ],
          "display_name": false
        },
        {
          "uuid": "b26f151b-e334-4468-8f6a-a3cc87f7f9d5",
          "name": "sparteine [INN]",
          "stdName": "SPARTEINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc3ab49-740e-41cf-90c8-75a85171dca0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1f14fe4b-df0d-4475-a031-b60b009d8d61",
          "citation": "USAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6cb59d79-2dc5-425b-bb94-ed16e8bf60a9",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38f89db5-eac0-4406-a4cf-3fc9defeffda",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fc3ab49-740e-41cf-90c8-75a85171dca0",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6221fbc0-afc1-4a12-a252-cc922bdced00",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "401cce16-13d9-4f44-9fd8-01fceef6492d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8f9f796-a3d5-4018-98a5-98c76eab6077",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "975c9738-31f4-427f-9866-3c2218d93a1c",
          "citation": "HERBAL MEDICINES 4TH ED 2013",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb0f4440-9c41-4fb5-a79b-d06d9335a2c2",
          "citation": "SRS import [298897D62S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=298897D62S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "513d0f3e-5c85-46e2-9ff0-ca1517c47838",
          "citation": "SPARTEINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7844a66d-8cb7-4b67-a0c9-559d16934838",
          "citation": "SPARTEINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2ef40cbd-c589-4e3f-be15-c86658c11cc2",
          "citation": "SPARTEINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d84af28f-ba10-a18b-6aaf-286221106930",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=90-39-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4ef9eb52-a01e-16cd-235e-ede5c6d54835",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "81dd60f4-3ee0-1ccd-ed8f-edfa824c6316",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "413473bb-ee0c-f36d-ce18-c14cb0e7935c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0b2ec200-dd6e-4494-a201-787c63e22e19",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "99334964-9496-e35b-579e-0fa8c6e48283",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a04295cc-161a-7911-b2c6-fd15056cf81d",
          "citation": "21 CFR 216.24",
          "doc_type": "CFR",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d4f042a3-9eca-447d-8020-5ab8a86bf316",
          "id": "d4f042a3-9eca-447d-8020-5ab8a86bf316",
          "molfile": "\n  Marvin  01132111022D          \n\n 17 20  0  0  1  0            999 V2000\n    6.6968   -4.0888    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.4088   -3.6809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4088   -2.8467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1216   -2.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1216   -1.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4098   -1.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6979   -1.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6979   -2.4389    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.9849   -2.8561    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.2731   -3.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2731   -4.0982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5606   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5606   -5.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2724   -5.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9849   -5.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9849   -4.5058    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.6968   -3.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n 16  1  1  0  0  0  0\n  1 17  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  6  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 17  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  1  0  0  0\nM  END",
          "smiles": "C1CCN2C[C@@H]3C[C@@H](CN4CCCC[C@H]34)[C@@H]2C1",
          "formula": "C15H26N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8a3ab9ce-4937-42c3-89d1-4da258c17826"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "234.3809",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d38ddb82-ec5d-40a0-9a19-175384e550b0",
      "version": "15",
      "structure": {
        "id": "d8df852a-c29d-4250-95cb-b4734d9e553a",
        "molfile": "\n  Marvin  01132111142D          \n\n 21 24  0  0  1  0            999 V2000\n    5.9849   -2.8561    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.2731   -3.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2731   -4.0982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9849   -4.5058    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9849   -5.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2724   -5.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5606   -5.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5606   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6968   -4.0888    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6968   -3.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4088   -3.6809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4088   -2.8467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1216   -2.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1216   -1.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4098   -1.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6979   -1.6141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6979   -2.4389    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9861   -2.0309    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4033   -4.4965    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7090   -4.9210    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3627   -2.0312    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  3  1  0  0  0  0\n  4  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  1  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 12  1  0  0  0  0\n  1 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n  9 19  1  6  0  0  0\n  4 20  1  6  0  0  0\n  1 21  1  6  0  0  0\nM  END",
        "smiles": "C1CCN2C[C@]3([H])C[C@@]([H])(CN4CCCC[C@]34[H])[C@]2([H])C1",
        "formula": "C15H26N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "234.3809",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "38f89db5-eac0-4406-a4cf-3fc9defeffda",
          "fb0f4440-9c41-4fb5-a79b-d06d9335a2c2",
          "1fc3ab49-740e-41cf-90c8-75a85171dca0"
        ],
        "stereo_centers": 4
      },
      "unii": "298897D62S"
    }
  ]
}